CA1113249A - Azide gas generating composition - Google Patents
Azide gas generating compositionInfo
- Publication number
- CA1113249A CA1113249A CA240,246A CA240246A CA1113249A CA 1113249 A CA1113249 A CA 1113249A CA 240246 A CA240246 A CA 240246A CA 1113249 A CA1113249 A CA 1113249A
- Authority
- CA
- Canada
- Prior art keywords
- alkali metal
- nitrogen gas
- reactant
- oxide
- gas generating
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 52
- 150000001540 azides Chemical class 0.000 title abstract description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 49
- 239000007789 gas Substances 0.000 claims abstract description 36
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 33
- 238000002485 combustion reaction Methods 0.000 claims abstract description 31
- 239000007787 solid Substances 0.000 claims abstract description 30
- -1 alkali metal azide Chemical class 0.000 claims abstract description 28
- 229910001873 dinitrogen Inorganic materials 0.000 claims abstract description 25
- 230000001427 coherent effect Effects 0.000 claims abstract description 12
- 229910001485 alkali metal perchlorate Inorganic materials 0.000 claims abstract description 11
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 7
- 239000010941 cobalt Substances 0.000 claims abstract description 7
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000011164 primary particle Substances 0.000 claims abstract description 7
- 239000000376 reactant Substances 0.000 claims description 46
- 239000008188 pellet Substances 0.000 claims description 32
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 29
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 28
- 239000000047 product Substances 0.000 claims description 18
- 229910052759 nickel Inorganic materials 0.000 claims description 14
- 229910052742 iron Inorganic materials 0.000 claims description 13
- 230000015572 biosynthetic process Effects 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 239000000843 powder Substances 0.000 claims description 11
- 230000002939 deleterious effect Effects 0.000 claims description 7
- 229910044991 metal oxide Inorganic materials 0.000 claims description 6
- 230000007717 exclusion Effects 0.000 claims description 5
- 150000004706 metal oxides Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 238000005453 pelletization Methods 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 238000012856 packing Methods 0.000 claims description 2
- 239000002245 particle Substances 0.000 abstract description 15
- 239000007800 oxidant agent Substances 0.000 abstract description 5
- 238000001914 filtration Methods 0.000 abstract description 4
- 238000001179 sorption measurement Methods 0.000 abstract description 2
- UGKDIUIOSMUOAW-UHFFFAOYSA-N iron nickel Chemical compound [Fe].[Ni] UGKDIUIOSMUOAW-UHFFFAOYSA-N 0.000 abstract 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 13
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 11
- 239000007788 liquid Substances 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 150000001340 alkali metals Chemical class 0.000 description 7
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical class [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 description 7
- 229910000428 cobalt oxide Inorganic materials 0.000 description 6
- 229910000480 nickel oxide Inorganic materials 0.000 description 6
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 6
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000008247 solid mixture Substances 0.000 description 4
- PDEROVFZLWBVSG-UHFFFAOYSA-N strontium;diazide Chemical compound [Sr+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] PDEROVFZLWBVSG-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- UBEWDCMIDFGDOO-UHFFFAOYSA-N cobalt(II,III) oxide Inorganic materials [O-2].[O-2].[O-2].[O-2].[Co+2].[Co+3].[Co+3] UBEWDCMIDFGDOO-UHFFFAOYSA-N 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000002341 toxic gas Substances 0.000 description 3
- 229910001369 Brass Inorganic materials 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 241001507939 Cormus domestica Species 0.000 description 2
- 229910004742 Na2 O Inorganic materials 0.000 description 2
- 229910001508 alkali metal halide Inorganic materials 0.000 description 2
- 150000008045 alkali metal halides Chemical class 0.000 description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- SZVJSHCCFOBDDC-UHFFFAOYSA-N ferrosoferric oxide Chemical compound O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical compound ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- QVYYOKWPCQYKEY-UHFFFAOYSA-N [Fe].[Co] Chemical compound [Fe].[Co] QVYYOKWPCQYKEY-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 230000003749 cleanliness Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 229940056319 ferrosoferric oxide Drugs 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 150000002611 lead compounds Chemical class 0.000 description 1
- WETZJIOEDGMBMA-UHFFFAOYSA-L lead styphnate Chemical compound [Pb+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C([O-])=C1[N+]([O-])=O WETZJIOEDGMBMA-UHFFFAOYSA-L 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 150000004972 metal peroxides Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000004449 solid propellant Substances 0.000 description 1
- 230000008674 spewing Effects 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06D—MEANS FOR GENERATING SMOKE OR MIST; GAS-ATTACK COMPOSITIONS; GENERATION OF GAS FOR BLASTING OR PROPULSION (CHEMICAL PART)
- C06D5/00—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets
- C06D5/06—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets by reaction of two or more solids
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B35/00—Compositions containing a metal azide
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S149/00—Explosive and thermic compositions or charges
- Y10S149/11—Particle size of a component
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Air Bags (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52819974A | 1974-11-29 | 1974-11-29 | |
| US528,199 | 1974-11-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1113249A true CA1113249A (en) | 1981-12-01 |
Family
ID=24104653
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA240,246A Expired CA1113249A (en) | 1974-11-29 | 1975-11-24 | Azide gas generating composition |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4062708A (enExample) |
| JP (1) | JPS5183093A (enExample) |
| CA (1) | CA1113249A (enExample) |
| DE (1) | DE2551921A1 (enExample) |
| FR (1) | FR2292687A1 (enExample) |
| GB (1) | GB1532964A (enExample) |
| IT (1) | IT1050732B (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1518806A (en) * | 1974-11-29 | 1978-07-26 | Eaton Corp | Fluid supply source for inflating an expandable confinement of a vehicle occupant restraint system |
| CA1087851A (en) * | 1978-07-17 | 1980-10-21 | Lechoslaw A.M. Utracki | Gas generating composition |
| US4203787A (en) * | 1978-12-18 | 1980-05-20 | Thiokol Corporation | Pelletizable, rapid and cool burning solid nitrogen gas generant |
| DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
| US4604151A (en) * | 1985-01-30 | 1986-08-05 | Talley Defense Systems, Inc. | Method and compositions for generating nitrogen gas |
| IL76874A0 (en) * | 1985-10-29 | 1986-02-28 | Yeda Res & Dev | Source of nitrogen based on alkali metal azides |
| US4696705A (en) * | 1986-12-24 | 1987-09-29 | Trw Automotive Products, Inc. | Gas generating material |
| US4698107A (en) * | 1986-12-24 | 1987-10-06 | Trw Automotive Products, Inc. | Gas generating material |
| US4734141A (en) * | 1987-03-27 | 1988-03-29 | Hercules Incorporated | Crash bag propellant compositions for generating high quality nitrogen gas |
| US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
| US4806180A (en) * | 1987-12-10 | 1989-02-21 | Trw Vehicle Safety Systems Inc. | Gas generating material |
| GB2218698A (en) * | 1988-01-19 | 1989-11-22 | Talley Automotive Prod | Inflator device for deployment of a motor vehicle passenger passive restraint system |
| US4929290A (en) * | 1988-07-25 | 1990-05-29 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
| US4920743A (en) * | 1988-07-25 | 1990-05-01 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
| US5223184A (en) * | 1990-08-06 | 1993-06-29 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant |
| US5019220A (en) * | 1990-08-06 | 1991-05-28 | Morton International, Inc. | Process for making an enhanced thermal and ignition stability azide gas generant |
| US5387296A (en) * | 1991-08-23 | 1995-02-07 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| DE4218531C1 (enExample) * | 1991-10-11 | 1993-07-15 | Bayern-Chemie Gesellschaft Fuer Flugchemische Antriebe Mbh, 8261 Aschau, De | |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| ZA933881B (en) * | 1992-06-08 | 1994-03-28 | Ici Canada | Pyrotechnic bodies |
| CA2094888A1 (en) * | 1992-08-24 | 1994-02-25 | Bradley W. Smith | Gas generant body having pressed-on burn inhibitor layer |
| US5345873A (en) * | 1992-08-24 | 1994-09-13 | Morton International, Inc. | Gas bag inflator containing inhibited generant |
| JP2800875B2 (ja) * | 1993-01-21 | 1998-09-21 | ティーアールダブリュー・インコーポレーテッド | 車両搭乗者衝撃抑制具のためのガス発生器 |
| US5382050A (en) * | 1993-04-08 | 1995-01-17 | Trw Inc. | Gas generator for vehicle occupant restraint |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5401340A (en) * | 1993-08-10 | 1995-03-28 | Thiokol Corporation | Borohydride fuels in gas generant compositions |
| US5429691A (en) * | 1993-08-10 | 1995-07-04 | Thiokol Corporation | Thermite compositions for use as gas generants comprising basic metal carbonates and/or basic metal nitrates |
| US5439537A (en) * | 1993-08-10 | 1995-08-08 | Thiokol Corporation | Thermite compositions for use as gas generants |
| EP0740645B1 (en) * | 1994-01-19 | 2012-08-22 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US20050067074A1 (en) | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
| US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
| US5536340A (en) * | 1994-01-26 | 1996-07-16 | Breed Automotive Technology, Inc. | Gas generating composition for automobile airbags |
| RU2102366C1 (ru) * | 1995-05-30 | 1998-01-20 | Самарский государственный технический университет | Газогенерирующий состав |
| RU2102365C1 (ru) * | 1995-05-30 | 1998-01-20 | Самарский государственный технический университет | Газогенерирующий состав |
| US6949152B2 (en) | 2003-05-08 | 2005-09-27 | The Boeing Company | Hypergolic azide fuels with hydrogen peroxide |
| GB2530295A (en) * | 2014-09-18 | 2016-03-23 | Ford Global Tech Llc | Inflator propellant |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3741585A (en) * | 1971-06-29 | 1973-06-26 | Thiokol Chemical Corp | Low temperature nitrogen gas generating composition |
| US3904221A (en) * | 1972-05-19 | 1975-09-09 | Asahi Chemical Ind | Gas generating system for the inflation of a protective bag |
| US3895098A (en) * | 1972-05-31 | 1975-07-15 | Talley Industries | Method and composition for generating nitrogen gas |
| GB1443547A (en) * | 1973-12-17 | 1976-07-21 | Canadian Ind | Metal oxide/azide gas generating compositions |
| GB1518806A (en) * | 1974-11-29 | 1978-07-26 | Eaton Corp | Fluid supply source for inflating an expandable confinement of a vehicle occupant restraint system |
-
1975
- 1975-11-19 DE DE19752551921 patent/DE2551921A1/de active Granted
- 1975-11-24 CA CA240,246A patent/CA1113249A/en not_active Expired
- 1975-11-25 FR FR7535975A patent/FR2292687A1/fr active Granted
- 1975-11-25 GB GB48330/75A patent/GB1532964A/en not_active Expired
- 1975-11-28 IT IT29808/75A patent/IT1050732B/it active
- 1975-11-29 JP JP50142831A patent/JPS5183093A/ja active Pending
-
1976
- 1976-08-13 US US05/714,430 patent/US4062708A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2551921A1 (de) | 1976-08-12 |
| FR2292687A1 (fr) | 1976-06-25 |
| FR2292687B1 (enExample) | 1980-01-25 |
| IT1050732B (it) | 1981-03-20 |
| GB1532964A (en) | 1978-11-22 |
| JPS5183093A (enExample) | 1976-07-21 |
| US4062708A (en) | 1977-12-13 |
| DE2551921C2 (enExample) | 1990-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1113249A (en) | Azide gas generating composition | |
| CA1117762A (en) | Pelletizable, rapid and cool burning solid nitrogen gas generant | |
| EP0055547B1 (en) | Solid compositions for generating nitrogen, the generation of nitrogen therefrom and inflation of gas bags therewith | |
| EP0055904B1 (en) | Azide-free compositions for generating nitrogen, the generation of nitrogen therefrom and inflation of gas bags therewith | |
| US5482579A (en) | Gas generator compositions | |
| KR920008180B1 (ko) | 팽창성 장치용 아지드 가스 발생 조성물 | |
| US4604151A (en) | Method and compositions for generating nitrogen gas | |
| US4296084A (en) | Method of and apparatus for gas generation | |
| JP3912689B2 (ja) | 自己発火性火薬組成物、伝火薬、ガス発生剤及びガス発生器 | |
| CA1146756A (en) | Multi-ingredient gas generants | |
| US3904221A (en) | Gas generating system for the inflation of a protective bag | |
| KR100243443B1 (ko) | 기체 발생 조성물용 2성분 점화제 | |
| DE69829568T2 (de) | Anzündbeschleunigende zusammensetzung für eine airbagaufblasvorrichtung | |
| JPH09501392A (ja) | ガス発生剤として用いるテルミット組成物 | |
| EP0607450A1 (en) | Gas generating agent and gas generator for automotive airbag | |
| US5656793A (en) | Gas generator compositions | |
| KR100242401B1 (ko) | 에어 백 기체 발생 조성물 | |
| US4243443A (en) | Azide and doped iron oxide gas generating composition | |
| EP0012626B1 (en) | Method of and apparatus for gas generation | |
| CA1154049A (en) | Method of and apparatus for gas generation | |
| JP3952424B2 (ja) | ガス発生剤組成物 | |
| KR0137726B1 (ko) | 차량 탑승자 보호구 조립체 | |
| US4309229A (en) | Method of generating water vapor free gas | |
| WO1992021636A1 (fr) | Agent gazogene | |
| JPH0834692A (ja) | 自動車のエアバッグ用気体発生組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |