CA1095517A - 3-amino-2-hydroxy-propoxy-chroman derivatives - Google Patents
3-amino-2-hydroxy-propoxy-chroman derivativesInfo
- Publication number
- CA1095517A CA1095517A CA253,922A CA253922A CA1095517A CA 1095517 A CA1095517 A CA 1095517A CA 253922 A CA253922 A CA 253922A CA 1095517 A CA1095517 A CA 1095517A
- Authority
- CA
- Canada
- Prior art keywords
- group
- methyl
- formula
- compound
- piperazino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- SBDNPKYGKKPWOO-UHFFFAOYSA-N 1-amino-3-(3,4-dihydro-2H-chromen-2-yloxy)propan-2-ol Chemical class NCC(COC1OC2=CC=CC=C2CC1)O SBDNPKYGKKPWOO-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 100
- 238000000034 method Methods 0.000 claims abstract description 49
- 150000003839 salts Chemical class 0.000 claims abstract description 26
- 238000002360 preparation method Methods 0.000 claims abstract description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 11
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 22
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 claims abstract 4
- -1 piperidino, morpholino, pyrrolidino, piperazino Chemical group 0.000 claims description 65
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 48
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 44
- 239000000460 chlorine Substances 0.000 claims description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 25
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 18
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 15
- 229910052731 fluorine Inorganic materials 0.000 claims description 13
- 239000011737 fluorine Substances 0.000 claims description 13
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 12
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 11
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 11
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 10
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 7
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 6
- KSTIRGRHEWNYIL-UHFFFAOYSA-N 2,2-dimethyl-4-naphthalen-2-yl-7-(oxiran-2-ylmethoxy)-3,4-dihydrochromene Chemical compound C1=C2OC(C)(C)CC(C=3C=C4C=CC=CC4=CC=3)C2=CC=C1OCC1CO1 KSTIRGRHEWNYIL-UHFFFAOYSA-N 0.000 claims description 4
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000000956 methoxy group Chemical class [H]C([H])([H])O* 0.000 claims description 3
- 230000000269 nucleophilic effect Effects 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- MNSXEDWQMFWLGR-UHFFFAOYSA-N 1-[(2,2-dimethyl-4-naphthalen-2-yl-3,4-dihydrochromen-7-yl)oxy]-3-(methylamino)propan-2-ol Chemical compound C1=CC=CC2=CC(C3C4=CC=C(C=C4OC(C)(C)C3)OCC(O)CNC)=CC=C21 MNSXEDWQMFWLGR-UHFFFAOYSA-N 0.000 claims description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical class [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 11
- 230000002152 alkylating effect Effects 0.000 claims 2
- 239000012043 crude product Substances 0.000 claims 2
- LRMSWIQUEJYDJE-UHFFFAOYSA-N 1-(dimethylamino)-3-[(2,2-dimethyl-4-naphthalen-2-yl-3,4-dihydrochromen-7-yl)oxy]propan-2-ol Chemical compound C1=CC=CC2=CC(C3C4=CC=C(C=C4OC(C)(C)C3)OCC(O)CN(C)C)=CC=C21 LRMSWIQUEJYDJE-UHFFFAOYSA-N 0.000 claims 1
- KCPWYYSXPWDPPP-UHFFFAOYSA-N 1-[(2,2-dimethyl-4-naphthalen-2-yl-3,4-dihydrochromen-7-yl)oxy]-3-(methylamino)propan-2-ol hydrochloride Chemical compound Cl.OC(COC1=CC=C2C(CC(OC2=C1)(C)C)C1=CC2=CC=CC=C2C=C1)CNC KCPWYYSXPWDPPP-UHFFFAOYSA-N 0.000 claims 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims 1
- MALIONKMKPITBV-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-n-[2-(4-sulfamoylphenyl)ethyl]acetamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CCNC(=O)CC1=CC=C(O)C(Cl)=C1 MALIONKMKPITBV-UHFFFAOYSA-N 0.000 claims 1
- 230000021736 acetylation Effects 0.000 claims 1
- 238000006640 acetylation reaction Methods 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical class BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 150000002221 fluorine Chemical class 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 abstract description 6
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- 238000006243 chemical reaction Methods 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 19
- 125000000217 alkyl group Chemical group 0.000 description 18
- 239000000203 mixture Substances 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- 235000019198 oils Nutrition 0.000 description 11
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical group C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 150000002118 epoxides Chemical class 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 101150041968 CDC13 gene Proteins 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 235000019502 Orange oil Nutrition 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 3
- GNKKPEGKMNYKEZ-UHFFFAOYSA-N 2,2-dimethyl-4-naphthalen-1-yl-7-(oxiran-2-ylmethoxy)-3,4-dihydrochromene Chemical compound C1=C2OC(C)(C)CC(C=3C4=CC=CC=C4C=CC=3)C2=CC=C1OCC1CO1 GNKKPEGKMNYKEZ-UHFFFAOYSA-N 0.000 description 3
- PSGGXIULLAGENC-UHFFFAOYSA-N 2,2-dimethyl-7-(oxiran-2-ylmethoxy)-4-phenyl-3,4-dihydrochromene Chemical compound C12=CC=C(OCC3OC3)C=C2OC(C)(C)CC1C1=CC=CC=C1 PSGGXIULLAGENC-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 3
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 230000000578 anorexic effect Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 3
- 229960000956 coumarin Drugs 0.000 description 3
- 235000001671 coumarin Nutrition 0.000 description 3
- 206010061428 decreased appetite Diseases 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 description 3
- 229960003147 reserpine Drugs 0.000 description 3
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 3
- VMUXSMXIQBNMGZ-UHFFFAOYSA-N 3,4-dihydrocoumarin Chemical compound C1=CC=C2OC(=O)CCC2=C1 VMUXSMXIQBNMGZ-UHFFFAOYSA-N 0.000 description 2
- JQASTNCHPDGKAO-UHFFFAOYSA-N 7-hydroxy-4-naphthalen-1-ylchromen-2-one Chemical compound C1=CC=C2C(C=3C4=CC=C(C=C4OC(=O)C=3)O)=CC=CC2=C1 JQASTNCHPDGKAO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 208000020401 Depressive disease Diseases 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 208000022531 anorexia Diseases 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- DMSHWWDRAYHEBS-UHFFFAOYSA-N dihydrocoumarin Natural products C1CC(=O)OC2=C1C=C(OC)C(OC)=C2 DMSHWWDRAYHEBS-UHFFFAOYSA-N 0.000 description 2
- 230000037406 food intake Effects 0.000 description 2
- 235000012631 food intake Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000007892 solid unit dosage form Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- WPXMLUUYWNHQOR-CMDGGOBGSA-N (e)-3-naphthalen-1-ylprop-2-enoic acid Chemical compound C1=CC=C2C(/C=C/C(=O)O)=CC=CC2=C1 WPXMLUUYWNHQOR-CMDGGOBGSA-N 0.000 description 1
- HEDWHASZFSRCQP-UHFFFAOYSA-N 1-(diethylamino)-3-[(2,2-dimethyl-4-phenyl-3,4-dihydrochromen-7-yl)oxy]propan-2-ol Chemical compound C1C(C)(C)OC2=CC(OCC(O)CN(CC)CC)=CC=C2C1C1=CC=CC=C1 HEDWHASZFSRCQP-UHFFFAOYSA-N 0.000 description 1
- YOKBJTBTRNPNDY-UHFFFAOYSA-N 1-(dimethylamino)-3-[(2,2-dimethyl-4-phenyl-3,4-dihydrochromen-7-yl)oxy]propan-2-ol Chemical compound C1C(C)(C)OC2=CC(OCC(O)CN(C)C)=CC=C2C1C1=CC=CC=C1 YOKBJTBTRNPNDY-UHFFFAOYSA-N 0.000 description 1
- PBLWWTQESHCNKA-UHFFFAOYSA-N 1-(dimethylamino)-3-[[2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]-3,4-dihydrochromen-7-yl]oxy]propan-2-ol Chemical compound C1C(C)(C)OC2=CC(OCC(O)CN(C)C)=CC=C2C1C1=CC=CC(C(F)(F)F)=C1 PBLWWTQESHCNKA-UHFFFAOYSA-N 0.000 description 1
- XJMKCGBTZORDLR-UHFFFAOYSA-N 1-(tert-butylamino)-3-[(2,2-dimethyl-4-phenyl-3,4-dihydrochromen-7-yl)oxy]propan-2-ol Chemical compound C1C(C)(C)OC2=CC(OCC(O)CNC(C)(C)C)=CC=C2C1C1=CC=CC=C1 XJMKCGBTZORDLR-UHFFFAOYSA-N 0.000 description 1
- BGDUYVJNHQBJAK-UHFFFAOYSA-N 1-[(2,2-dimethyl-4-phenyl-3,4-dihydrochromen-7-yl)oxy]-3-(methylamino)propan-2-ol Chemical compound C1C(C)(C)OC2=CC(OCC(O)CNC)=CC=C2C1C1=CC=CC=C1 BGDUYVJNHQBJAK-UHFFFAOYSA-N 0.000 description 1
- BSFPPUSJIGAFKU-UHFFFAOYSA-N 1-[(2,2-dimethyl-4-phenyl-3,4-dihydrochromen-7-yl)oxy]-3-(methylamino)propan-2-ol;hydrochloride Chemical compound Cl.C1C(C)(C)OC2=CC(OCC(O)CNC)=CC=C2C1C1=CC=CC=C1 BSFPPUSJIGAFKU-UHFFFAOYSA-N 0.000 description 1
- ZLIPGKFMOHQSSI-UHFFFAOYSA-N 1-[(2,2-dimethyl-4-phenyl-3,4-dihydrochromen-7-yl)oxy]-3-(propan-2-ylamino)propan-2-ol Chemical compound C1C(C)(C)OC2=CC(OCC(O)CNC(C)C)=CC=C2C1C1=CC=CC=C1 ZLIPGKFMOHQSSI-UHFFFAOYSA-N 0.000 description 1
- ZTFCHKNKFJKXJG-UHFFFAOYSA-N 2,2-dimethyl-4-[3-(trifluoromethyl)phenyl]-3,4-dihydrochromen-7-ol Chemical compound C12=CC=C(O)C=C2OC(C)(C)CC1C1=CC=CC(C(F)(F)F)=C1 ZTFCHKNKFJKXJG-UHFFFAOYSA-N 0.000 description 1
- DKLZLQNMYOSMGM-UHFFFAOYSA-N 2,2-dimethyl-4-naphthalen-1-yl-7-(oxiran-2-ylmethoxy)chromene Chemical compound C=1C=C2C(C=3C4=CC=CC=C4C=CC=3)=CC(C)(C)OC2=CC=1OCC1CO1 DKLZLQNMYOSMGM-UHFFFAOYSA-N 0.000 description 1
- GNOMMMIDIIKNRS-UHFFFAOYSA-N 2,2-dimethyl-4-naphthalen-2-yl-3,4-dihydrochromen-7-ol Chemical compound C12=CC=C(O)C=C2OC(C)(C)CC1C1=CC=C(C=CC=C2)C2=C1 GNOMMMIDIIKNRS-UHFFFAOYSA-N 0.000 description 1
- STFVJAGVPMVNJE-UHFFFAOYSA-N 2,2-dimethyl-4-phenyl-3,4-dihydrochromen-7-ol Chemical compound C12=CC=C(O)C=C2OC(C)(C)CC1C1=CC=CC=C1 STFVJAGVPMVNJE-UHFFFAOYSA-N 0.000 description 1
- QQAKLWJRWRKLOD-UHFFFAOYSA-N 2,2-dimethyl-4-phenylchromen-7-ol Chemical compound C=1C(C)(C)OC2=CC(O)=CC=C2C=1C1=CC=CC=C1 QQAKLWJRWRKLOD-UHFFFAOYSA-N 0.000 description 1
- MBZZQKJZEAQREO-UHFFFAOYSA-N 2,2-dimethyl-7-(oxiran-2-ylmethoxy)-4-[3-(trifluoromethyl)phenyl]-3,4-dihydrochromene Chemical compound C12=CC=C(OCC3OC3)C=C2OC(C)(C)CC1C1=CC=CC(C(F)(F)F)=C1 MBZZQKJZEAQREO-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- TXZZTLRVXGOMAB-UHFFFAOYSA-N 2-phenyl-2h-chromene Chemical compound C1=CC2=CC=CC=C2OC1C1=CC=CC=C1 TXZZTLRVXGOMAB-UHFFFAOYSA-N 0.000 description 1
- CAJAFKCGZZJSTG-UHFFFAOYSA-N 2h-chromen-7-ol Chemical compound C1=CCOC2=CC(O)=CC=C21 CAJAFKCGZZJSTG-UHFFFAOYSA-N 0.000 description 1
- SEBPXHSZHLFWRL-UHFFFAOYSA-N 3,4-dihydro-2,2,5,7,8-pentamethyl-2h-1-benzopyran-6-ol Chemical class O1C(C)(C)CCC2=C1C(C)=C(C)C(O)=C2C SEBPXHSZHLFWRL-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- YSMODUONRAFBET-UHFFFAOYSA-N 5-hydroxylysine Chemical group NCC(O)CCC(N)C(O)=O YSMODUONRAFBET-UHFFFAOYSA-N 0.000 description 1
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000003278 haem Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000000051 modifying effect Effects 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000002348 vinylic group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/16—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted in position 7
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/20—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 hydrogenated in the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Epoxy Compounds (AREA)
- Liquid Crystal Substances (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB24005/75 | 1975-06-03 | ||
| GB24005/75A GB1493998A (en) | 1975-06-03 | 1975-06-03 | Propanolamine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1095517A true CA1095517A (en) | 1981-02-10 |
Family
ID=10204870
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA253,922A Expired CA1095517A (en) | 1975-06-03 | 1976-06-02 | 3-amino-2-hydroxy-propoxy-chroman derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (2) | US4093631A (enExample) |
| JP (1) | JPS51146449A (enExample) |
| AT (1) | AT347944B (enExample) |
| AU (1) | AU497811B2 (enExample) |
| BE (1) | BE842352A (enExample) |
| CA (1) | CA1095517A (enExample) |
| CH (1) | CH622241A5 (enExample) |
| DE (1) | DE2624570A1 (enExample) |
| DK (1) | DK243176A (enExample) |
| ES (2) | ES448484A1 (enExample) |
| FR (2) | FR2313034A1 (enExample) |
| GB (1) | GB1493998A (enExample) |
| HK (1) | HK5381A (enExample) |
| HU (1) | HU174100B (enExample) |
| IE (1) | IE43312B1 (enExample) |
| IL (1) | IL49655A (enExample) |
| KE (1) | KE3112A (enExample) |
| NL (1) | NL7605922A (enExample) |
| SE (1) | SE422795B (enExample) |
| ZA (1) | ZA763267B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2857224A (en) * | 1956-10-05 | 1958-10-21 | Re Domenic Del | Self waiting table serving apparatus |
| DE2901336A1 (de) * | 1979-01-15 | 1980-07-24 | Boehringer Mannheim Gmbh | Neue arylether, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
| EP0020018B1 (en) * | 1979-05-19 | 1983-06-01 | Beecham Group Plc | Chroman derivatives, processes for their preparation and pharmaceutical compositions containing them |
| US4255426A (en) * | 1979-07-09 | 1981-03-10 | Pfizer Inc. | 1-(2-Hydroxy-3-n-alkoxypropyl)-4-substituted-piperazines and piperidines |
| US4316899A (en) * | 1979-08-24 | 1982-02-23 | Beecham Group Limited | Chromanone derivatives, a process for their preparation and compositions containing them |
| US4394382A (en) * | 1980-06-17 | 1983-07-19 | Kowa Company, Ltd. | Dihydrobenzopyran compounds and pharmaceutical composition comprising said compounds |
| HU184359B (en) * | 1980-12-16 | 1984-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing substituted acyl-carbamides |
| JPS5832847A (ja) * | 1981-08-20 | 1983-02-25 | Mitsubishi Chem Ind Ltd | (3−アミノプロポキシ)ビベンジル類 |
| US4513135A (en) * | 1982-03-05 | 1985-04-23 | Eli Lilly And Company | Diaryl-pyrazine derivatives affecting GABA binding |
| EP0227640B1 (de) * | 1982-09-30 | 1993-05-26 | Ciba-Geigy Ag | Mit Bis-(polyalkylpiperidinyl-amino)-1,3,5-triazinen stabilisierte Polyolefine |
| AU548450B2 (en) * | 1983-08-08 | 1985-12-12 | G.D. Searle & Co. | Substituted dihydrobenzopyrans |
| JPS60202872A (ja) * | 1984-03-27 | 1985-10-14 | Kaken Pharmaceut Co Ltd | ベンゾフラン誘導体、その製法およびそれを有効成分とする降圧剤 |
| US4758678A (en) * | 1986-07-18 | 1988-07-19 | Pennwalt Corporation | Preparation of 7-(2,3-epoxypropoxy)flavone |
| US5093353A (en) * | 1988-05-20 | 1992-03-03 | G. D. Searle & Co. | 2,2-di-substituted benzopyran leukotriene-D4 antagonists |
| US5219883A (en) * | 1988-05-20 | 1993-06-15 | G. D. Searle & Co. | 2,2-di-substituted benzopyran leukotriene-D4 antagonists |
| US4950684A (en) * | 1988-05-20 | 1990-08-21 | G. D. Searle & Co. | 2,2-di-substituted benzopyran leukotriene-D4 antagonists |
| US6372776B2 (en) * | 1997-06-12 | 2002-04-16 | Novo Nordisk A/S | Crystalline(−)-3R,4R-trans-7-methoxy-2,2-dimethyl-3-phenyl-4-{4-[2-(pyrrolidin-1-yl)ethoxy]phenyl}chromane, hydrogen maleate |
| JP2007008822A (ja) * | 2005-06-28 | 2007-01-18 | Tokuyama Corp | ジヒドロベンゾピラン誘導体の製造方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1518002C3 (de) * | 1965-01-02 | 1975-01-23 | Merck Patent Gmbh, 6100 Darmstadt | Isoflavane und Isoflavene und Verfahren zu Ihrer Herstellung sowie diese enthaltende Arzneimittel |
| US3506654A (en) * | 1966-09-15 | 1970-04-14 | Syntex Corp | Benzylidene derivatives of chromene,thiochromene,quinoline,and n-alkyl quinoline and corresponding benzyl tertiary carbinol intermediates |
| DE2162721A1 (de) * | 1970-12-19 | 1972-06-22 | Dr L Zambeletti SpA, Mailand (Italien) | Substituierte Cumarine und Verfahren zu ihrer Herstellung |
| US4146539A (en) * | 1974-07-30 | 1979-03-27 | Beecham Group Limited | Anorexic chromans |
| GB1497161A (en) * | 1975-07-19 | 1978-01-05 | Beecham Group Ltd | Naphthyl derivatives |
-
1975
- 1975-06-03 GB GB24005/75A patent/GB1493998A/en not_active Expired
-
1976
- 1976-05-20 IE IE1065/76A patent/IE43312B1/en unknown
- 1976-05-21 SE SE7605825A patent/SE422795B/xx unknown
- 1976-05-25 IL IL49655A patent/IL49655A/xx unknown
- 1976-05-28 BE BE167446A patent/BE842352A/xx not_active IP Right Cessation
- 1976-05-31 FR FR7616320A patent/FR2313034A1/fr active Granted
- 1976-06-01 US US05/691,865 patent/US4093631A/en not_active Expired - Lifetime
- 1976-06-01 DE DE19762624570 patent/DE2624570A1/de not_active Withdrawn
- 1976-06-02 CH CH697176A patent/CH622241A5/de not_active IP Right Cessation
- 1976-06-02 CA CA253,922A patent/CA1095517A/en not_active Expired
- 1976-06-02 DK DK243176A patent/DK243176A/da not_active Application Discontinuation
- 1976-06-02 AT AT403076A patent/AT347944B/de not_active IP Right Cessation
- 1976-06-02 ZA ZA763267A patent/ZA763267B/xx unknown
- 1976-06-02 ES ES448484A patent/ES448484A1/es not_active Expired
- 1976-06-02 NL NL7605922A patent/NL7605922A/xx not_active Application Discontinuation
- 1976-06-03 HU HUBE001263 patent/HU174100B/hu unknown
- 1976-06-03 JP JP51065096A patent/JPS51146449A/ja active Pending
- 1976-06-03 AU AU14615/76A patent/AU497811B2/en not_active Expired
- 1976-12-15 FR FR7637719A patent/FR2361868A1/fr active Granted
-
1977
- 1977-07-12 ES ES460678A patent/ES460678A1/es not_active Expired
-
1979
- 1979-05-09 US US06/037,958 patent/US4234726A/en not_active Expired - Lifetime
-
1981
- 1981-01-27 KE KE3112A patent/KE3112A/xx unknown
- 1981-02-19 HK HK53/81A patent/HK5381A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| KE3112A (en) | 1981-02-20 |
| NL7605922A (nl) | 1976-12-07 |
| AU497811B2 (en) | 1979-01-11 |
| US4234726A (en) | 1980-11-18 |
| CH622241A5 (enExample) | 1981-03-31 |
| IL49655A (en) | 1979-10-31 |
| ATA403076A (de) | 1978-06-15 |
| HU174100B (enExample) | 1979-11-28 |
| FR2313034B1 (enExample) | 1979-03-30 |
| FR2313034A1 (fr) | 1976-12-31 |
| IL49655A0 (en) | 1976-09-30 |
| SE422795B (sv) | 1982-03-29 |
| AU1461576A (en) | 1977-12-08 |
| US4093631A (en) | 1978-06-06 |
| SE7605825L (sv) | 1976-12-04 |
| JPS51146449A (en) | 1976-12-16 |
| IE43312L (en) | 1976-12-03 |
| DE2624570A1 (de) | 1976-12-23 |
| HK5381A (en) | 1981-02-27 |
| DK243176A (da) | 1976-12-04 |
| AT347944B (de) | 1979-01-25 |
| GB1493998A (en) | 1977-12-07 |
| FR2361868B1 (enExample) | 1980-03-21 |
| BE842352A (fr) | 1976-11-29 |
| ES448484A1 (es) | 1977-12-01 |
| ZA763267B (en) | 1977-05-25 |
| ES460678A1 (es) | 1978-05-16 |
| IE43312B1 (en) | 1981-01-28 |
| FR2361868A1 (fr) | 1978-03-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1095517A (en) | 3-amino-2-hydroxy-propoxy-chroman derivatives | |
| US4113869A (en) | Tetrahydroisoquinoline basic ethers and pharmaceutical compositions and methods employing them | |
| CA1337429C (en) | Derivatives of 2,2'-iminobisethanol | |
| AU604809B2 (en) | Chroman derivatives | |
| CA1119180A (en) | Derivatives of trans-3-hydroxy-4-amino-chromans | |
| EP0264586B1 (en) | Hydantoin derivatives for treating complications of diabetes | |
| US4048317A (en) | Chroman derivatives | |
| US4338323A (en) | Piperidylbenzimidazolinone derivatives | |
| US4062870A (en) | Chroman derivatives | |
| US4478750A (en) | 1-Phenyl-azepinoindoles | |
| US4016281A (en) | Tetralone and indanone compounds | |
| US5112839A (en) | Chroman derivatives | |
| JP2874912B2 (ja) | クロマン誘導体 | |
| US4977152A (en) | Novel tricyclic derivatives which are agonists of cholinergic receptors, and drugs in which they are present | |
| US3689663A (en) | Lowering cholesterol blood levels with flavanoids | |
| EP0089781B1 (en) | Bicyclic benzo fused compounds | |
| EP0033612B1 (en) | Pyrano derivatives, a process for their preparation and antihypertensive compositions containing them | |
| GB1569251A (en) | Pyridobenzodiazepines | |
| USRE30739E (en) | Anorexic chromans | |
| US3665074A (en) | Certain benzofuran derivatives useful for relief of pain,inflammation,pyresis and tussive irritation | |
| IE42403B1 (en) | Naphthyl derivatives | |
| CA2146646C (en) | Benzopyranones, method of preparing them and their use | |
| US4133883A (en) | Polycyclic chromenes useful as antidepressants and anorexics | |
| Al Neirabeyeh et al. | Methoxy and hydroxy derivatives of 3, 4-dihydro-3-(di-n-propylamino)-2H-1-benzopyrans: new synthesis and dopaminergic activity | |
| US4146539A (en) | Anorexic chromans |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |