CA1094568A - Process for the preparation of sulfuric acid semi- ester compounds - Google Patents
Process for the preparation of sulfuric acid semi- ester compoundsInfo
- Publication number
- CA1094568A CA1094568A CA283,928A CA283928A CA1094568A CA 1094568 A CA1094568 A CA 1094568A CA 283928 A CA283928 A CA 283928A CA 1094568 A CA1094568 A CA 1094568A
- Authority
- CA
- Canada
- Prior art keywords
- beta
- formula
- compound
- group
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 title claims abstract description 64
- 238000000034 method Methods 0.000 title claims abstract description 60
- 230000008569 process Effects 0.000 title claims abstract description 44
- 238000002360 preparation method Methods 0.000 title claims abstract description 12
- 238000005886 esterification reaction Methods 0.000 claims abstract description 41
- 150000001875 compounds Chemical class 0.000 claims abstract description 40
- 230000032050 esterification Effects 0.000 claims abstract description 40
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims abstract description 25
- -1 pyrazolone com-pounds Chemical class 0.000 claims abstract description 18
- 238000004898 kneading Methods 0.000 claims abstract description 16
- 230000009471 action Effects 0.000 claims abstract description 15
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 6
- 239000012374 esterification agent Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 229910052801 chlorine Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims 3
- 229910052739 hydrogen Inorganic materials 0.000 claims 3
- 239000001257 hydrogen Substances 0.000 claims 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- HVZWVEKIQMJYIK-UHFFFAOYSA-N nitryl chloride Chemical compound [O-][N+](Cl)=O HVZWVEKIQMJYIK-UHFFFAOYSA-N 0.000 claims 1
- 239000000843 powder Substances 0.000 abstract description 42
- 239000007795 chemical reaction product Substances 0.000 abstract description 13
- 238000002955 isolation Methods 0.000 abstract description 8
- 238000006386 neutralization reaction Methods 0.000 abstract description 8
- 230000000694 effects Effects 0.000 abstract description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 abstract description 4
- 150000003839 salts Chemical class 0.000 abstract description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 abstract description 4
- 235000011152 sodium sulphate Nutrition 0.000 abstract description 4
- FDPVTENMNDHFNK-UHFFFAOYSA-N 2-amino-n-phenylbenzamide Chemical compound NC1=CC=CC=C1C(=O)NC1=CC=CC=C1 FDPVTENMNDHFNK-UHFFFAOYSA-N 0.000 abstract description 3
- 230000008901 benefit Effects 0.000 abstract description 3
- 239000004033 plastic Substances 0.000 abstract description 3
- 239000002351 wastewater Substances 0.000 abstract description 2
- 229940125904 compound 1 Drugs 0.000 abstract 1
- 239000000975 dye Substances 0.000 description 69
- 239000000243 solution Substances 0.000 description 38
- 239000000463 material Substances 0.000 description 28
- 239000000306 component Substances 0.000 description 26
- 238000004043 dyeing Methods 0.000 description 25
- 229940032330 sulfuric acid Drugs 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 230000008878 coupling Effects 0.000 description 22
- 238000010168 coupling process Methods 0.000 description 22
- 238000005859 coupling reaction Methods 0.000 description 22
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 20
- 241000219146 Gossypium Species 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 18
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 17
- 229920000742 Cotton Polymers 0.000 description 16
- 239000002253 acid Substances 0.000 description 16
- 238000007792 addition Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 15
- 239000003795 chemical substances by application Substances 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 11
- 239000010949 copper Substances 0.000 description 10
- 238000009736 wetting Methods 0.000 description 10
- 229910052802 copper Inorganic materials 0.000 description 9
- 150000001989 diazonium salts Chemical class 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 229920003043 Cellulose fiber Polymers 0.000 description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 7
- 239000002657 fibrous material Substances 0.000 description 7
- 230000007935 neutral effect Effects 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 235000017550 sodium carbonate Nutrition 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 238000001694 spray drying Methods 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 239000011651 chromium Substances 0.000 description 5
- 150000004696 coordination complex Chemical class 0.000 description 5
- 229910000365 copper sulfate Inorganic materials 0.000 description 5
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 5
- 239000012954 diazonium Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 4
- 241001366278 Leptotes marina Species 0.000 description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229910052804 chromium Inorganic materials 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000010865 sewage Substances 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 229910006069 SO3H Inorganic materials 0.000 description 3
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 3
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 3
- 150000004700 cobalt complex Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 150000004682 monohydrates Chemical class 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 229940116269 uric acid Drugs 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- OIDPCXKPHYRNKH-UHFFFAOYSA-J chrome alum Chemical compound [K]OS(=O)(=O)O[Cr]1OS(=O)(=O)O1 OIDPCXKPHYRNKH-UHFFFAOYSA-J 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 2
- 229940044175 cobalt sulfate Drugs 0.000 description 2
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 239000010440 gypsum Substances 0.000 description 2
- 229910052602 gypsum Inorganic materials 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- YAIKCRUPEVOINQ-UHFFFAOYSA-N 2-aminonaphthalene-1,5-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 YAIKCRUPEVOINQ-UHFFFAOYSA-N 0.000 description 1
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- MKMDCEXRIPLNGJ-UHFFFAOYSA-N 2-phenyl-1h-pyrazol-5-one Chemical class N1=C(O)C=CN1C1=CC=CC=C1 MKMDCEXRIPLNGJ-UHFFFAOYSA-N 0.000 description 1
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 1
- UCJKAZZVJXOLRP-UHFFFAOYSA-N 3-oxo-2-(4-sulfophenyl)-1h-pyrazole-5-carboxylic acid Chemical compound N1C(C(=O)O)=CC(=O)N1C1=CC=C(S(O)(=O)=O)C=C1 UCJKAZZVJXOLRP-UHFFFAOYSA-N 0.000 description 1
- VFMNIJOKAXPZLE-UHFFFAOYSA-N 4-(5-methyl-3-oxo-1h-pyrazol-2-yl)benzenesulfonic acid Chemical compound N1C(C)=CC(=O)N1C1=CC=C(S(O)(=O)=O)C=C1 VFMNIJOKAXPZLE-UHFFFAOYSA-N 0.000 description 1
- DOPJNPGPZIJGEZ-UHFFFAOYSA-N 5-methylpyrazol-3-one Chemical compound CC1=CC(=O)N=N1 DOPJNPGPZIJGEZ-UHFFFAOYSA-N 0.000 description 1
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 1
- CMOLPZZVECHXKN-UHFFFAOYSA-N 7-aminonaphthalene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(N)=CC=C21 CMOLPZZVECHXKN-UHFFFAOYSA-N 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- 241000660443 Encyclops Species 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- 229910004727 OSO3H Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000006149 azo coupling reaction Methods 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 229940037395 electrolytes Drugs 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/507—Azo dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
- C07D231/20—One oxygen atom attached in position 3 or 5
- C07D231/22—One oxygen atom attached in position 3 or 5 with aryl radicals attached to ring nitrogen atoms
- C07D231/24—One oxygen atom attached in position 3 or 5 with aryl radicals attached to ring nitrogen atoms having sulfone or sulfonic acid radicals in the molecule
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
- C07D231/20—One oxygen atom attached in position 3 or 5
- C07D231/22—One oxygen atom attached in position 3 or 5 with aryl radicals attached to ring nitrogen atoms
- C07D231/26—1-Phenyl-3-methyl-5- pyrazolones, unsubstituted or substituted on the phenyl ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/44—Oxygen and nitrogen or sulfur and nitrogen atoms
- C07D231/46—Oxygen atom in position 3 or 5 and nitrogen atom in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Coloring (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP2634856.1 | 1976-08-03 | ||
| DE19762634783 DE2634783C2 (de) | 1976-08-03 | 1976-08-03 | Verfahren zur Herstellung von Schwefelsäurehalbester-Verbindungen |
| DE19762634857 DE2634857C2 (de) | 1976-08-03 | 1976-08-03 | Verfahren zur Herstellung von β-Sulfatoäthylsulfonyl-amino-benzanilid-Verbindungen |
| DEP2634783.1 | 1976-08-03 | ||
| DEP2634857.2 | 1976-08-03 | ||
| DE19762634856 DE2634856A1 (de) | 1976-08-03 | 1976-08-03 | Verfahren zur herstellung von schwefelsaeurehalbester-verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1094568A true CA1094568A (en) | 1981-01-27 |
Family
ID=27186936
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA283,928A Expired CA1094568A (en) | 1976-08-03 | 1977-08-02 | Process for the preparation of sulfuric acid semi- ester compounds |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4334076A (OSRAM) |
| AU (1) | AU512427B2 (OSRAM) |
| CA (1) | CA1094568A (OSRAM) |
| CH (1) | CH613947A5 (OSRAM) |
| FR (1) | FR2360539A2 (OSRAM) |
| GB (1) | GB1540566A (OSRAM) |
| IT (1) | IT1114836B (OSRAM) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4482501A (en) * | 1979-07-19 | 1984-11-13 | Sumitomo Chemical Company, Limited | Process for producing aminoaryl-β-sulfatoethylsulfone |
| IN152895B (OSRAM) * | 1979-07-19 | 1984-04-28 | Sumitomo Chemical Co | |
| GB2125395B (en) * | 1979-07-19 | 1985-05-15 | Sumitomo Chemical Co | Process for producing aminoaryl-b-sulfatoethylsulfone |
| DE3009178A1 (de) * | 1980-03-11 | 1981-10-15 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von aminobenzanilid-schwefelsaeurehalbester-verbindung |
| DE3009174A1 (de) * | 1980-03-11 | 1981-10-15 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von sulfatoaethylsulfonyl-verbindungen |
| DE3340114A1 (de) * | 1983-11-05 | 1985-05-15 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von 2-amino-1-hydroxy-4- oder -5- (ss-sulfatoaethylsulfonyl)-benzol-verbindungen und deren verwendung zur synthese von faserreaktiven verbindungen |
| DE3343421A1 (de) * | 1983-12-01 | 1985-06-13 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von 5-oxethylsulfonyl-2-aminophenol(-ethern) |
| US4760134A (en) * | 1985-08-28 | 1988-07-26 | Hoechst Celanese Corporation | Process for the preparation of the copper complex disazo compounds from disazo compounds containing an O'-alkoxyaniline group by coppering dimethylation at a pH at about 3-6 |
| US5082963A (en) * | 1986-11-24 | 1992-01-21 | Hoechst Celanese Corporation | Process for the regiospecific sulfonation of sulfonyl substituted 2-aminonaphthalenes and fiber reactive azo dyes made from the products of said process |
| DE3703565A1 (de) * | 1987-02-06 | 1988-08-18 | Hoechst Ag | Wasserloesliche monoazo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| IN172051B (OSRAM) * | 1987-12-11 | 1993-03-27 | Hoechst Ag | |
| EP0344343B1 (en) * | 1988-06-01 | 1993-04-21 | Hoechst Celanese Corporation | Process for the regiospecific sulfonation of 2-amino-naphtalenes substituted in the 5- or 7-position by a fibre reactive vs-group, the novel 5-sulfo-substituted fiber-reactive 2-amino-naphthalene, and fibre-reactive azo dyes thereof |
| CN103709103B (zh) * | 2013-12-13 | 2016-03-02 | 山东新华制药股份有限公司 | 氨基安替比林母液的循环利用工艺 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2666788A (en) * | 1950-03-15 | 1954-01-19 | Basf Ag | Production of ethylene sulfarylamides |
| US2912428A (en) * | 1956-03-07 | 1959-11-10 | Ciba Ltd | Process for the manufacture of azo pigments |
| DE1078116B (de) * | 1956-05-15 | 1960-03-24 | Fettchemie | Verfahren und Vorrichtung zur kontinuierlichen Veresterung von Fettalkoholen |
| US3193546A (en) * | 1961-12-28 | 1965-07-06 | Gen Aniline & Film Corp | Azo dyestuffs |
| GB1124388A (en) * | 1965-11-15 | 1968-08-21 | Sumitomo Chemical Co | Reactive monoazo dyes of the benzene-azo-pyrazolone series and process for their manufacture and use |
| GB1220422A (en) * | 1968-02-28 | 1971-01-27 | Sumitomo Chemical Co | Reactive yellow monoazo dyes of the phenylazo-pyrazole series and process for the preparation thereof |
| US3956267A (en) * | 1971-03-04 | 1976-05-11 | Bayer Aktiengesellschaft | Indole-containing disazo dyestuffs having a sulfatoalkyleneoxy-substituent |
| US3859324A (en) * | 1972-08-03 | 1975-01-07 | Universal Oil Prod Co | Process for the preparation of alkaline sulfate esters of n-alkyl-substituted hydroxypolyalkoxymethylcyclohexenes |
| DE2538722C2 (de) * | 1975-08-30 | 1984-10-11 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von 1-Aminobenzol-5-β-sulfatoäthylsulfon-2-sulfonsäure und 1-Aminobenzol-5-vinylsulfon-2-sulfonsäure und deren Alkali- und Erdalkalisalzen |
-
1977
- 1977-07-29 CH CH943477A patent/CH613947A5/xx not_active IP Right Cessation
- 1977-08-01 IT IT26385/77A patent/IT1114836B/it active
- 1977-08-01 US US05/820,884 patent/US4334076A/en not_active Expired - Lifetime
- 1977-08-02 CA CA283,928A patent/CA1094568A/en not_active Expired
- 1977-08-02 AU AU27550/77A patent/AU512427B2/en not_active Expired
- 1977-08-03 FR FR7723900A patent/FR2360539A2/fr active Granted
- 1977-08-03 GB GB32533/77A patent/GB1540566A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2360539A2 (fr) | 1978-03-03 |
| US4334076A (en) | 1982-06-08 |
| FR2360539B2 (OSRAM) | 1983-01-14 |
| GB1540566A (en) | 1979-02-14 |
| IT1114836B (it) | 1986-01-27 |
| CH613947A5 (OSRAM) | 1979-10-31 |
| AU2755077A (en) | 1979-02-08 |
| AU512427B2 (en) | 1980-10-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1094568A (en) | Process for the preparation of sulfuric acid semi- ester compounds | |
| GB2034343A (en) | Reactive dyestuffs | |
| FR2567531A1 (fr) | Nouveaux composes monoazoiques anioniques, leur preparation et leur utilisation comme colorants | |
| JPS6257665B2 (OSRAM) | ||
| US3426008A (en) | Water-soluble monoazo dyestuffs and their metal complex compounds | |
| US4898933A (en) | Water-soluble fiber-reactive aminotriazine and vinylsulfone containing azo dyestuffs having carboxy- or carbamoyl pyridinium groups | |
| JPH05209135A (ja) | 二官能反応性染料 | |
| JPS61115961A (ja) | 繊維反応性モノアゾ化合物、その製法及び該化合物を染料として使用する | |
| US3274171A (en) | Monoazo dyestuffs containing a benzothiazole nucleus | |
| US3221003A (en) | Chrgmium cqmplex mixed azo dyestuffs | |
| CA1098901A (en) | Process for the manufacture of sulfuric acid semi- ester compounds | |
| JPH0217586B2 (OSRAM) | ||
| CH336139A (de) | Verfahren zur Herstellung von komplexen Schwermetallverbindungen von Azofarbstoffen | |
| US4191703A (en) | Process for the manufacture of sulfuric acid semi-ester compounds | |
| JPH09217017A (ja) | ジスアゾレーキ顔料 | |
| US3461111A (en) | Copper-containing pyrazolone monoazo dyestuffs | |
| JPH0593145A (ja) | 2官能性反応性染料 | |
| US4760134A (en) | Process for the preparation of the copper complex disazo compounds from disazo compounds containing an O'-alkoxyaniline group by coppering dimethylation at a pH at about 3-6 | |
| US4185012A (en) | Water-soluble, fibre-reactive copper complex disazo dyestuffs | |
| JP2004525208A (ja) | アセトキシエチルスルホンまたはビニルスルホン基を有する分散反応性染料及びその製造方法 | |
| US658506A (en) | Brown dye and process of making same. | |
| BE859477A (fr) | Nouveaux complexes de metaux lourds | |
| JPS6115067B2 (OSRAM) | ||
| JPS5828300B2 (ja) | シンキナジスアゾガンリヨウノセイホウ | |
| US818981A (en) | On-the-main |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |