CA1094096A - Process for producing 4-acyl-amido-4,4-dicarboxy- butanal phenyl hydrazone - Google Patents
Process for producing 4-acyl-amido-4,4-dicarboxy- butanal phenyl hydrazoneInfo
- Publication number
- CA1094096A CA1094096A CA284,270A CA284270A CA1094096A CA 1094096 A CA1094096 A CA 1094096A CA 284270 A CA284270 A CA 284270A CA 1094096 A CA1094096 A CA 1094096A
- Authority
- CA
- Canada
- Prior art keywords
- acyl
- amido
- catalyst
- butanal
- acrolein
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 19
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims abstract description 30
- 239000003054 catalyst Substances 0.000 claims abstract description 22
- -1 alkali metal salt Chemical class 0.000 claims abstract description 16
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229940067157 phenylhydrazine Drugs 0.000 claims abstract description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- ISOLMABRZPQKOV-UHFFFAOYSA-N diethyl 2-acetamidopropanedioate Chemical group CCOC(=O)C(NC(C)=O)C(=O)OCC ISOLMABRZPQKOV-UHFFFAOYSA-N 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 235000011056 potassium acetate Nutrition 0.000 claims description 3
- 239000001632 sodium acetate Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 235000017281 sodium acetate Nutrition 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000006845 Michael addition reaction Methods 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 238000002955 isolation Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 2
- 239000006035 Tryptophane Substances 0.000 description 2
- SMNXWBKWPNTECZ-UHFFFAOYSA-N acetamide;diethyl propanedioate Chemical compound CC(N)=O.CCOC(=O)CC(=O)OCC SMNXWBKWPNTECZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229960004799 tryptophan Drugs 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 238000006957 Michael reaction Methods 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- CCZIKQHNURLYJE-UHFFFAOYSA-N diethyl 2-acetamido-2-(3-oxopropyl)propanedioate Chemical compound CCOC(=O)C(CCC=O)(NC(C)=O)C(=O)OCC CCZIKQHNURLYJE-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229940031993 lithium benzoate Drugs 0.000 description 1
- LDJNSLOKTFFLSL-UHFFFAOYSA-M lithium;benzoate Chemical compound [Li+].[O-]C(=O)C1=CC=CC=C1 LDJNSLOKTFFLSL-UHFFFAOYSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229960002446 octanoic acid Drugs 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 235000003441 saturated fatty acids Nutrition 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2647255A DE2647255C2 (de) | 1976-10-20 | 1976-10-20 | Verfahren zur Herstellung von 4-Acylamido^^-dicarbalkoxy-butanalphenylhydrazon |
| DEP2647255.9-42 | 1976-10-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1094096A true CA1094096A (en) | 1981-01-20 |
Family
ID=5990878
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA284,270A Expired CA1094096A (en) | 1976-10-20 | 1977-08-08 | Process for producing 4-acyl-amido-4,4-dicarboxy- butanal phenyl hydrazone |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4084057A (en:Method) |
| JP (1) | JPS5353625A (en:Method) |
| BE (1) | BE859871A (en:Method) |
| CA (1) | CA1094096A (en:Method) |
| CH (1) | CH630894A5 (en:Method) |
| DE (1) | DE2647255C2 (en:Method) |
| FR (1) | FR2368469A1 (en:Method) |
| GB (1) | GB1583680A (en:Method) |
| HU (1) | HU177976B (en:Method) |
| NL (1) | NL7708914A (en:Method) |
| SE (1) | SE7711790L (en:Method) |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA619472A (en) * | 1961-05-02 | Frangatos Gerassimos | Process for making 5-hydroxytryptophan | |
| US2583010A (en) * | 1948-11-22 | 1952-01-22 | Gen Mills Inc | Synthesis of tryptophane |
| US3019232A (en) * | 1958-12-18 | 1962-01-30 | Ajinomoto Kk | Process for producing synthetic tryptophane |
| JPS5418251B2 (en:Method) * | 1973-03-01 | 1979-07-06 |
-
1976
- 1976-10-20 DE DE2647255A patent/DE2647255C2/de not_active Expired
-
1977
- 1977-07-26 US US05/819,406 patent/US4084057A/en not_active Expired - Lifetime
- 1977-08-02 HU HU77DE936A patent/HU177976B/hu unknown
- 1977-08-08 CA CA284,270A patent/CA1094096A/en not_active Expired
- 1977-08-12 NL NL7708914A patent/NL7708914A/xx not_active Application Discontinuation
- 1977-09-22 FR FR7728568A patent/FR2368469A1/fr active Granted
- 1977-10-14 GB GB42820/77A patent/GB1583680A/en not_active Expired
- 1977-10-18 BE BE6046184A patent/BE859871A/xx not_active IP Right Cessation
- 1977-10-19 SE SE7711790A patent/SE7711790L/xx not_active Application Discontinuation
- 1977-10-19 CH CH1275177A patent/CH630894A5/de not_active IP Right Cessation
- 1977-10-20 JP JP12637077A patent/JPS5353625A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2368469B1 (en:Method) | 1979-07-13 |
| SE7711790L (sv) | 1978-04-21 |
| NL7708914A (nl) | 1978-04-24 |
| DE2647255C2 (de) | 1978-11-09 |
| FR2368469A1 (fr) | 1978-05-19 |
| DE2647255B1 (de) | 1978-03-02 |
| JPS5721269B2 (en:Method) | 1982-05-06 |
| GB1583680A (en) | 1981-01-28 |
| CH630894A5 (de) | 1982-07-15 |
| US4084057A (en) | 1978-04-11 |
| BE859871A (fr) | 1978-04-18 |
| HU177976B (en) | 1982-02-28 |
| JPS5353625A (en) | 1978-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5650537A (en) | Process for the preparation of N-acyl-α-amino acid derivatives | |
| KR930005256B1 (ko) | 입체-장애된 하이드록시페닐카복실산 에스테르의 제조방법 | |
| AU2002224131A1 (en) | Process for producing 5-(3-cyanophenyl)-3-formylbenzoic acid compound | |
| EP0393713B1 (en) | Process for the preparation of N-substituted maleimides | |
| US5705675A (en) | Processes for the preparation of 3-(methylthio)propanal and 2-hydroxy-4-(methylthio)butanenitrile | |
| AU5987396A (en) | Processes for the preparation of 3-(methylthio)propanal and 2-hydroxy-4-(methylthio)butanenitrile | |
| CA1310017C (en) | Process for the preparation of 2, 6-dichlorodiphenylamino-acetic acid derivatives | |
| CA1094096A (en) | Process for producing 4-acyl-amido-4,4-dicarboxy- butanal phenyl hydrazone | |
| US4785133A (en) | Process for the preparation of alkyl 3-alkoxypropionates | |
| CA1100993A (en) | Process for the production of alkoxy methylene compounds | |
| US2479972A (en) | Monoalkamine esters of pyrrole-5-carboxylic acids | |
| JP3338101B2 (ja) | アリールアクリル酸類及びそれらのエステル類の製造方法 | |
| US5264612A (en) | Process for the preparation of aryl-substituted propionic acid esters | |
| SU461492A3 (ru) | Способ получени -анилинокарбонитрилов | |
| US3158633A (en) | Process for preparation of vinyl esters | |
| US2521809A (en) | Preparation of acetamidomalonates | |
| US3259648A (en) | Cyclohexylmethyl cinnamate | |
| JPS58203934A (ja) | 1−ヒドロキシケトンの製法 | |
| JP2982259B2 (ja) | N―置換マレイミドの製造法 | |
| US3235582A (en) | Cyclohexylmethyl phenoxyacetate | |
| SU1131871A1 (ru) | Способ получени амидов адамантанкарбоновых кислот | |
| US2342613A (en) | Acylation of lactonitrile | |
| CA1107757A (en) | Process for manufacturing d,1-b-benzoylamino isobutyric acid | |
| JPS597136A (ja) | マロン酸エステルの製法 | |
| RU1824401C (ru) | Способ получени 5-метил-2-тиоурацила |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |