CA1091382A - Process for preparing thiofunctional polysiloxane polymers - Google Patents
Process for preparing thiofunctional polysiloxane polymersInfo
- Publication number
- CA1091382A CA1091382A CA264,184A CA264184A CA1091382A CA 1091382 A CA1091382 A CA 1091382A CA 264184 A CA264184 A CA 264184A CA 1091382 A CA1091382 A CA 1091382A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- group
- radical
- silicon
- hydrocarbon
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 polysiloxane Polymers 0.000 title claims abstract description 112
- 229920001296 polysiloxane Polymers 0.000 title claims abstract description 21
- 229920000642 polymer Polymers 0.000 title claims abstract description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 238000000034 method Methods 0.000 claims abstract description 44
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 25
- 150000003377 silicon compounds Chemical class 0.000 claims abstract description 21
- ZQTYRTSKQFQYPQ-UHFFFAOYSA-N trisiloxane Chemical compound [SiH3]O[SiH2]O[SiH3] ZQTYRTSKQFQYPQ-UHFFFAOYSA-N 0.000 claims abstract description 21
- 229910000077 silane Inorganic materials 0.000 claims abstract description 10
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000003396 thiol group Chemical group [H]S* 0.000 claims abstract description 6
- 125000005375 organosiloxane group Chemical group 0.000 claims abstract description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 58
- 229930195733 hydrocarbon Natural products 0.000 claims description 58
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 20
- 150000003254 radicals Chemical class 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 17
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 14
- 229910052710 silicon Inorganic materials 0.000 claims description 13
- UUEWCQRISZBELL-UHFFFAOYSA-N 3-trimethoxysilylpropane-1-thiol Chemical compound CO[Si](OC)(OC)CCCS UUEWCQRISZBELL-UHFFFAOYSA-N 0.000 claims description 12
- 125000001931 aliphatic group Chemical group 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 150000002430 hydrocarbons Chemical class 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- 150000004756 silanes Chemical class 0.000 claims description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 9
- DVNPFNZTPMWRAX-UHFFFAOYSA-N 2-triethoxysilylethanethiol Chemical compound CCO[Si](CCS)(OCC)OCC DVNPFNZTPMWRAX-UHFFFAOYSA-N 0.000 claims description 8
- HTDJPCNNEPUOOQ-UHFFFAOYSA-N hexamethylcyclotrisiloxane Chemical group C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 HTDJPCNNEPUOOQ-UHFFFAOYSA-N 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical group C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 claims description 4
- 229940073561 hexamethyldisiloxane Drugs 0.000 claims description 4
- 150000003573 thiols Chemical class 0.000 claims description 4
- 125000003944 tolyl group Chemical group 0.000 claims description 3
- 150000003568 thioethers Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 4
- YXNNPVNGGPEONZ-UHFFFAOYSA-N 3-[methyl-(3-sulfanylpropyl)-trimethylsilyloxysilyl]propane-1-thiol Chemical group SCCC[Si](C)(O[Si](C)(C)C)CCCS YXNNPVNGGPEONZ-UHFFFAOYSA-N 0.000 claims 1
- 229910007266 Si2O Inorganic materials 0.000 claims 1
- 125000004149 thio group Chemical group *S* 0.000 claims 1
- 239000000758 substrate Substances 0.000 abstract description 7
- 239000003377 acid catalyst Substances 0.000 abstract description 5
- 239000002184 metal Substances 0.000 abstract description 5
- 229910052751 metal Inorganic materials 0.000 abstract description 5
- 239000003795 chemical substances by application Substances 0.000 abstract description 4
- 239000000047 product Substances 0.000 description 45
- 238000005481 NMR spectroscopy Methods 0.000 description 32
- 238000004458 analytical method Methods 0.000 description 21
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 239000007788 liquid Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 239000004927 clay Substances 0.000 description 8
- 239000003039 volatile agent Substances 0.000 description 8
- 239000004205 dimethyl polysiloxane Substances 0.000 description 7
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 101100073357 Streptomyces halstedii sch2 gene Proteins 0.000 description 3
- 125000004965 chloroalkyl group Chemical group 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 230000005291 magnetic effect Effects 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- OAVZUKSTEKRRJR-UHFFFAOYSA-N 2-butylsulfanylethyl(triethoxy)silane Chemical compound CCCCSCC[Si](OCC)(OCC)OCC OAVZUKSTEKRRJR-UHFFFAOYSA-N 0.000 description 2
- IKYAJDOSWUATPI-UHFFFAOYSA-N 3-[dimethoxy(methyl)silyl]propane-1-thiol Chemical compound CO[Si](C)(OC)CCCS IKYAJDOSWUATPI-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- JJRDHFIVAPVZJN-UHFFFAOYSA-N cyclotrisiloxane Chemical compound O1[SiH2]O[SiH2]O[SiH2]1 JJRDHFIVAPVZJN-UHFFFAOYSA-N 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229960000443 hydrochloric acid Drugs 0.000 description 2
- 235000011167 hydrochloric acid Nutrition 0.000 description 2
- 239000012263 liquid product Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003961 organosilicon compounds Chemical class 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000005023 xylyl group Chemical group 0.000 description 2
- GRYSXUXXBDSYRT-WOUKDFQISA-N (2r,3r,4r,5r)-2-(hydroxymethyl)-4-methoxy-5-[6-(methylamino)purin-9-yl]oxolan-3-ol Chemical compound C1=NC=2C(NC)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1OC GRYSXUXXBDSYRT-WOUKDFQISA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- FLLAFJNCDLVLJS-UHFFFAOYSA-N 2-dodecylsulfanylethyl-diethoxy-methylsilane Chemical compound CCCCCCCCCCCCSCC[Si](C)(OCC)OCC FLLAFJNCDLVLJS-UHFFFAOYSA-N 0.000 description 1
- IAVCFZPUOKBIHK-UHFFFAOYSA-N 3-[[dimethyl(3-sulfanylpropyl)silyl]oxy-dimethylsilyl]propane-1-thiol Chemical compound SCCC[Si](C)(C)O[Si](C)(C)CCCS IAVCFZPUOKBIHK-UHFFFAOYSA-N 0.000 description 1
- YOSJOHNTERDRIX-UHFFFAOYSA-N 3-butylsulfanylpropyl(trimethoxy)silane Chemical compound CCCCSCCC[Si](OC)(OC)OC YOSJOHNTERDRIX-UHFFFAOYSA-N 0.000 description 1
- JVNUQDMATQWHLN-UHFFFAOYSA-N 6-ethylsulfanylhexyl(trimethoxy)silane Chemical compound CCSCCCCCC[Si](OC)(OC)OC JVNUQDMATQWHLN-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 241000042812 Divales Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000006629 Prosopis spicigera Nutrition 0.000 description 1
- 240000000037 Prosopis spicigera Species 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- LVAXPOVMRMFJSK-UHFFFAOYSA-N [Na].OS(=O)=O Chemical compound [Na].OS(=O)=O LVAXPOVMRMFJSK-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001336 alkenes Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- CMWRUTZCSFMXJQ-UHFFFAOYSA-N bis(triphenylsilyloxy)silicon Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)O[Si]O[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CMWRUTZCSFMXJQ-UHFFFAOYSA-N 0.000 description 1
- 125000005998 bromoethyl group Chemical group 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 150000001723 carbon free-radicals Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- CNRNVYLXONKYPK-UHFFFAOYSA-N diethoxy-methyl-(2-methylsulfanylethyl)silane Chemical compound CCO[Si](C)(OCC)CCSC CNRNVYLXONKYPK-UHFFFAOYSA-N 0.000 description 1
- IJFZHNQYSBAEEK-UHFFFAOYSA-N diethoxy-methyl-(2-phenylsulfanylethyl)silane Chemical compound CCO[Si](C)(OCC)CCSC1=CC=CC=C1 IJFZHNQYSBAEEK-UHFFFAOYSA-N 0.000 description 1
- OLLFKUHHDPMQFR-UHFFFAOYSA-N dihydroxy(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](O)(O)C1=CC=CC=C1 OLLFKUHHDPMQFR-UHFFFAOYSA-N 0.000 description 1
- JJQZDUKDJDQPMQ-UHFFFAOYSA-N dimethoxy(dimethyl)silane Chemical compound CO[Si](C)(C)OC JJQZDUKDJDQPMQ-UHFFFAOYSA-N 0.000 description 1
- YYLGKUPAFFKGRQ-UHFFFAOYSA-N dimethyldiethoxysilane Chemical compound CCO[Si](C)(C)OCC YYLGKUPAFFKGRQ-UHFFFAOYSA-N 0.000 description 1
- XCLIHDJZGPCUBT-UHFFFAOYSA-N dimethylsilanediol Chemical compound C[Si](C)(O)O XCLIHDJZGPCUBT-UHFFFAOYSA-N 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- ZZRGHKUNLAYDTC-UHFFFAOYSA-N ethoxy(methyl)silane Chemical compound CCO[SiH2]C ZZRGHKUNLAYDTC-UHFFFAOYSA-N 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 1
- ARYZCSRUUPFYMY-UHFFFAOYSA-N methoxysilane Chemical compound CO[SiH3] ARYZCSRUUPFYMY-UHFFFAOYSA-N 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- BFXIKLCIZHOAAZ-UHFFFAOYSA-N methyltrimethoxysilane Chemical compound CO[Si](C)(OC)OC BFXIKLCIZHOAAZ-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- VZUGBLTVBZJZOE-KRWDZBQOSA-N n-[3-[(4s)-2-amino-1,4-dimethyl-6-oxo-5h-pyrimidin-4-yl]phenyl]-5-chloropyrimidine-2-carboxamide Chemical compound N1=C(N)N(C)C(=O)C[C@@]1(C)C1=CC=CC(NC(=O)C=2N=CC(Cl)=CN=2)=C1 VZUGBLTVBZJZOE-KRWDZBQOSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 125000006337 tetrafluoro ethyl group Chemical group 0.000 description 1
- 125000004035 thiopropyl group Chemical group [H]SC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- UVCYGQNKZSDEFY-UHFFFAOYSA-N tributyl(tributylsilyloxysilyloxy)silane Chemical compound C(CCC)[Si](O[SiH2]O[Si](CCCC)(CCCC)CCCC)(CCCC)CCCC UVCYGQNKZSDEFY-UHFFFAOYSA-N 0.000 description 1
- KEOVSOJRTAYETG-UHFFFAOYSA-N triethoxy(4-methylsulfanylbutyl)silane Chemical compound CCO[Si](OCC)(OCC)CCCCSC KEOVSOJRTAYETG-UHFFFAOYSA-N 0.000 description 1
- CPUDPFPXCZDNGI-UHFFFAOYSA-N triethoxy(methyl)silane Chemical compound CCO[Si](C)(OCC)OCC CPUDPFPXCZDNGI-UHFFFAOYSA-N 0.000 description 1
- WILBTFWIBAOWLN-UHFFFAOYSA-N triethyl(triethylsilyloxy)silane Chemical compound CC[Si](CC)(CC)O[Si](CC)(CC)CC WILBTFWIBAOWLN-UHFFFAOYSA-N 0.000 description 1
- WMAOTPCQHADLHO-UHFFFAOYSA-N triethyl(triethylsilyloxysilyloxy)silane Chemical compound C(C)[Si](O[SiH2]O[Si](CC)(CC)CC)(CC)CC WMAOTPCQHADLHO-UHFFFAOYSA-N 0.000 description 1
- DIVYLRQLRQGVCW-UHFFFAOYSA-N trimethoxy(3-phenylsulfanylpropyl)silane Chemical compound CO[Si](OC)(OC)CCCSC1=CC=CC=C1 DIVYLRQLRQGVCW-UHFFFAOYSA-N 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- ZVXWAOBTEZUSAH-UHFFFAOYSA-N trioctyl(trioctylsilyloxysilyloxy)silane Chemical compound C(CCCCCCC)[Si](O[SiH2]O[Si](CCCCCCCC)(CCCCCCCC)CCCCCCCC)(CCCCCCCC)CCCCCCCC ZVXWAOBTEZUSAH-UHFFFAOYSA-N 0.000 description 1
- KHQZLUVCZCAMFU-UHFFFAOYSA-N tripropyl(tripropylsilyloxy)silane Chemical compound CCC[Si](CCC)(CCC)O[Si](CCC)(CCC)CCC KHQZLUVCZCAMFU-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/22—Polysiloxanes containing silicon bound to organic groups containing atoms other than carbon, hydrogen and oxygen
- C08G77/28—Polysiloxanes containing silicon bound to organic groups containing atoms other than carbon, hydrogen and oxygen sulfur-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
- Lubricants (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US630,475 | 1975-11-10 | ||
| US05/630,475 US4046795A (en) | 1975-11-10 | 1975-11-10 | Process for preparing thiofunctional polysiloxane polymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1091382A true CA1091382A (en) | 1980-12-09 |
Family
ID=24527326
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA264,184A Expired CA1091382A (en) | 1975-11-10 | 1976-10-26 | Process for preparing thiofunctional polysiloxane polymers |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4046795A (show.php) |
| JP (1) | JPS6035934B2 (show.php) |
| AT (1) | AT358818B (show.php) |
| AU (1) | AU497777B2 (show.php) |
| BE (1) | BE848135A (show.php) |
| CA (1) | CA1091382A (show.php) |
| DE (1) | DE2649854C2 (show.php) |
| FR (1) | FR2330715A1 (show.php) |
| GB (1) | GB1570779A (show.php) |
| IT (1) | IT1066778B (show.php) |
| NL (1) | NL183034C (show.php) |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4251277A (en) * | 1978-04-24 | 1981-02-17 | Sws Silicones Corporation | Compositions containing thiofunctional polysiloxanes |
| US4230816A (en) * | 1978-12-11 | 1980-10-28 | Sws Silicones Corporation | Thiofunctional polysiloxane polymers |
| US4289867A (en) * | 1978-12-11 | 1981-09-15 | Sws Silicones Corporation | Organofunctional polysiloxane polymers and a method for preparing the same |
| US4257699A (en) * | 1979-04-04 | 1981-03-24 | Xerox Corporation | Metal filled, multi-layered elastomer fuser member |
| US4272179A (en) * | 1979-04-04 | 1981-06-09 | Xerox Corporation | Metal-filled elastomer fuser member |
| US4264181A (en) * | 1979-04-04 | 1981-04-28 | Xerox Corporation | Metal-filled nucleophilic addition cured elastomer fuser member |
| US4281094A (en) * | 1979-12-03 | 1981-07-28 | Dow Corning Corporation | Novel mercaptoorganopolysiloxanes |
| EP0034191A1 (en) * | 1980-02-14 | 1981-08-26 | SWS Silicones Corporation | Process for preparing thiofunctional polysiloxane polymers and products obtained thereby |
| DE3021043A1 (de) * | 1980-06-03 | 1981-12-10 | Wacker-Chemie GmbH, 8000 München | Verfahren zur herstellung von organo(poly)siloxanen mit sic-gebundenen thiolgruppen |
| US4622412A (en) * | 1984-08-21 | 1986-11-11 | Charles Piskoti | Process for preparation of mercapto silicone fluid |
| DE3433654A1 (de) * | 1984-09-13 | 1986-03-20 | Wacker-Chemie GmbH, 8000 München | Durch ultraviolett-licht vernetzbare organopolysiloxanmassen und verfahren zum einbetten von elektronischen bauteilen |
| US4587320A (en) * | 1984-12-21 | 1986-05-06 | Dow Corning Corporation | Method for making carboxyfunctional silicone glycols |
| US5015717A (en) * | 1986-12-22 | 1991-05-14 | Wacker Silicones Corporation | Sulfur-containing organopolysiloxane waxes and a method for preparing the same |
| FR2611730B1 (fr) * | 1987-02-24 | 1989-06-16 | Rhone Poulenc Chimie | Diorganopolysiloxane a fonction alpha-mercaptoester utile comme stabilisant des polymeres a base de chlorure de polyvinyle |
| US5237020A (en) * | 1989-04-13 | 1993-08-17 | Rhone-Poulenc Chimie | Polydiorganosiloxane/thiuram disulfide block copolymers and radical polymerization of vinyl monomers therewith |
| FR2645868B1 (fr) * | 1989-04-13 | 1991-06-14 | Rhone Poulenc Chimie | Copolymere sequence polydiorganosiloxane/ disulfure de thiurame, sa preparation et son utilisation dans la polymerisation de monomeres vinyliques |
| US5034446A (en) * | 1989-05-26 | 1991-07-23 | Genesee Polymers Corporation | Stabilized polysiloxane fluids and a process for making the same |
| US5034445A (en) * | 1989-05-26 | 1991-07-23 | Genesee Polymers Corporation | Stabilized polysiloxane fluids and a process for making same |
| US5032460A (en) * | 1989-08-14 | 1991-07-16 | Minnesota Mining And Manufacturing Company | Method of making vinyl-silicone copolymers using mercapto functional silicone chain-transfer agents and release coatings made therewith |
| US5057619A (en) * | 1989-08-14 | 1991-10-15 | Minnesota Mining And Manufacturing Co. | Siloxane iniferter compounds, block copolymers made therewith and a method of making the block copolymers |
| US5200436A (en) * | 1989-08-14 | 1993-04-06 | Minnesota Mining And Manufacture Company | Siloxane iniferter compounds, block copolymers made therewith and a method of making the block copolymers |
| US5202190A (en) * | 1989-08-14 | 1993-04-13 | Minnesota Mining And Manufacturing Company | Method of making vinyl-silicone copolymers using mercapto functional silicone chain-transfer agents and release coatings made therewith |
| US5089336A (en) * | 1989-08-14 | 1992-02-18 | Minnesota Mining And Manufacturing Company | General purpose siloxane release coatings |
| US5061965A (en) * | 1990-04-30 | 1991-10-29 | Xerox Corporation | Fusing assembly with release agent donor member |
| US5468477A (en) * | 1992-05-12 | 1995-11-21 | Minnesota Mining And Manufacturing Company | Vinyl-silicone polymers in cosmetics and personal care products |
| TW268969B (show.php) * | 1992-10-02 | 1996-01-21 | Minnesota Mining & Mfg | |
| US6183929B1 (en) | 1999-08-02 | 2001-02-06 | Xerox Corporation | Functional fusing agent |
| US6485835B1 (en) | 1999-08-16 | 2002-11-26 | Xerox Corporation | Functional fusing agent |
| US6045961A (en) * | 1999-08-17 | 2000-04-04 | Xerox Corporation | Thermally stable silicone fluids |
| US6261688B1 (en) | 1999-08-20 | 2001-07-17 | Xerox Corporation | Tertiary amine functionalized fuser fluids |
| US6582871B2 (en) | 2001-06-12 | 2003-06-24 | Heidelberger Druckmaschinen Ag | Toner fusing system and process for electrostatographic reproduction, fuser member for toner fusing system and process, and composition for fuser member surface layer |
| US6617090B2 (en) | 2001-06-12 | 2003-09-09 | Heidelberger Druckmaschinen Ag | Toner fusing system and process for electrostatographic reproduction |
| US6890657B2 (en) * | 2001-06-12 | 2005-05-10 | Eastman Kodak Company | Surface contacting member for toner fusing system and process, composition for member surface layer, and process for preparing composition |
| US7084202B2 (en) * | 2002-06-05 | 2006-08-01 | Eastman Kodak Company | Molecular complexes and release agents |
| US6894137B2 (en) * | 2002-06-05 | 2005-05-17 | Easman Kodak Company | Block polyorganosiloxane block organomer polymers and release agents |
| EP1387224A3 (en) * | 2002-08-02 | 2011-11-16 | Eastman Kodak Company | Fuser member, apparatus and method for electrostatographic reproduction |
| EP1388765A3 (en) * | 2002-08-09 | 2010-04-07 | Eastman Kodak Company | Sleeved fuser member |
| US7195853B1 (en) | 2002-11-13 | 2007-03-27 | Eastman Kodak Company | Process for electrostatographic reproduction |
| US8092359B1 (en) | 2002-11-13 | 2012-01-10 | Eastman Kodak Company | Fuser member and fuser member surface layer |
| US7056578B2 (en) * | 2002-11-13 | 2006-06-06 | Eastman Kodak Company | Layer comprising nonfibrillatable and autoadhesive plastic particles, and method of preparation |
| US7291399B2 (en) * | 2003-08-30 | 2007-11-06 | Xerox Corporation | Fuser fluid compositions |
| US20050195261A1 (en) * | 2004-03-05 | 2005-09-08 | Eastman Kodak Company | Fuser for ink jet images and ink formulations |
| US9714371B2 (en) | 2005-05-02 | 2017-07-25 | Trican Well Service Ltd. | Method for making particulate slurries and particulate slurry compositions |
| CA2545563C (en) * | 2005-05-02 | 2016-10-25 | Trican Well Service Ltd. | Method for making particulate slurries and particulate slurry compositions |
| US7462661B2 (en) | 2005-07-19 | 2008-12-09 | Xerox Corporation | Release fluid additives |
| US7459203B2 (en) * | 2005-11-17 | 2008-12-02 | Eastman Kodak Company | Fuser member |
| US7452594B2 (en) * | 2005-11-17 | 2008-11-18 | Eastman Kodak Company | Fuser member system and process |
| CA2848264C (en) | 2007-04-26 | 2015-11-10 | Trican Well Service Ltd. | Control of particulate entrainment by fluids |
| CN101910228A (zh) * | 2007-12-28 | 2010-12-08 | 3M创新有限公司 | 纳米粒子、乙烯基单体和有机硅的共聚物 |
| US8492496B2 (en) * | 2007-12-28 | 2013-07-23 | 3M Innovative Properties Company | Copolymers of nanoparticles, vinyl monomers and silicone |
| WO2010077487A2 (en) | 2008-12-17 | 2010-07-08 | 3M Innovative Properties Company | Bulk polymerization of silicone-containing copolymers |
| CA2690768A1 (en) | 2010-01-21 | 2011-07-21 | Trican Well Services Ltd. | Compositions and methods for enhancing fluid recovery for hydraulic fracturing treatments |
| US20120164570A1 (en) * | 2010-12-22 | 2012-06-28 | Jerry Alan Pickering | Thermally conductive fuser coating |
| KR101460863B1 (ko) * | 2011-11-25 | 2014-12-04 | 주식회사 엘지화학 | 오가노폴리실록산의 제조 방법 |
| CN104066770B (zh) | 2011-11-25 | 2016-10-19 | Lg化学株式会社 | 有机聚硅氧烷 |
| US9932514B2 (en) | 2014-04-25 | 2018-04-03 | Trican Well Service Ltd. | Compositions and methods for making aqueous slurry |
| CA2856942A1 (en) | 2014-07-16 | 2016-01-16 | Trican Well Service Ltd. | Aqueous slurry for particulates transportation |
| CA2880646A1 (en) | 2015-01-30 | 2016-07-30 | Trican Well Service Ltd. | Composition and method of using polymerizable natural oils to treat proppants |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3392182A (en) * | 1963-02-28 | 1968-07-09 | Goldschmidt Ag Th | Novel organosilicon compounds and process for their preparation |
| US3388144A (en) * | 1965-07-15 | 1968-06-11 | Dow Corning | Polymercaptoorgano and polyhydroxyorgano silanes and siloxanes |
| DE2008426A1 (show.php) * | 1969-02-27 | 1970-09-10 | ||
| US3655713A (en) * | 1970-07-13 | 1972-04-11 | Dow Corning | Silacyclopentane thiols and thiolates |
| US3957844A (en) * | 1972-08-14 | 1976-05-18 | Union Carbide Corporation | Process for making mercapto substituted silicon compounds |
-
1975
- 1975-11-10 US US05/630,475 patent/US4046795A/en not_active Expired - Lifetime
-
1976
- 1976-10-12 AU AU18574/76A patent/AU497777B2/en not_active Expired
- 1976-10-26 CA CA264,184A patent/CA1091382A/en not_active Expired
- 1976-10-29 DE DE2649854A patent/DE2649854C2/de not_active Expired
- 1976-11-08 IT IT52072/76A patent/IT1066778B/it active
- 1976-11-09 AT AT831576A patent/AT358818B/de not_active IP Right Cessation
- 1976-11-09 BE BE172191A patent/BE848135A/xx not_active IP Right Cessation
- 1976-11-09 NL NLAANVRAGE7612444,A patent/NL183034C/xx not_active IP Right Cessation
- 1976-11-10 FR FR7633877A patent/FR2330715A1/fr active Granted
- 1976-11-10 JP JP51134239A patent/JPS6035934B2/ja not_active Expired
- 1976-11-10 GB GB46775/76A patent/GB1570779A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2649854A1 (de) | 1977-05-12 |
| JPS6035934B2 (ja) | 1985-08-17 |
| IT1066778B (it) | 1985-03-12 |
| JPS5260900A (en) | 1977-05-19 |
| BE848135A (fr) | 1977-05-09 |
| US4046795A (en) | 1977-09-06 |
| NL183034C (nl) | 1988-07-01 |
| AT358818B (de) | 1980-10-10 |
| ATA831576A (de) | 1980-02-15 |
| GB1570779A (en) | 1980-07-09 |
| NL7612444A (nl) | 1977-05-12 |
| AU497777B2 (en) | 1979-01-04 |
| FR2330715A1 (fr) | 1977-06-03 |
| DE2649854C2 (de) | 1984-07-12 |
| FR2330715B1 (show.php) | 1979-09-21 |
| AU1857476A (en) | 1978-04-20 |
| NL183034B (nl) | 1988-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1091382A (en) | Process for preparing thiofunctional polysiloxane polymers | |
| CA1289694C (en) | Preparation and processing of mixtures containing organocyclosiloxanes | |
| US4208503A (en) | Epoxy-functional polysiloxane polymers | |
| US5276123A (en) | Alkoxy endblocked polydiorganosiloxane and room temperature vulcanizable silicone elastomers made therefrom | |
| US4269963A (en) | Mercaptoorganopolysiloxanes and curable compositions including same | |
| US4251277A (en) | Compositions containing thiofunctional polysiloxanes | |
| CA1145887A (en) | Sulfur containing polysiloxane polymers and a method for preparing the same | |
| US5254645A (en) | Cluster azasilacycloalkyl functional polysiloxanes | |
| JPS5837054A (ja) | ヒドロキシシリル有機ポリシロキサンに基づく無溶剤組成物並びに有機鉄及びジルコニウム誘導体により触媒されるポリアルコキシシリル基を含有する架橋剤並びにアスベスト又はセルロ−ス誘導体又は合成誘導体に基づく材料を被覆若しくは含浸させるための組成物の使用 | |
| US4230816A (en) | Thiofunctional polysiloxane polymers | |
| US5015717A (en) | Sulfur-containing organopolysiloxane waxes and a method for preparing the same | |
| US4950779A (en) | Nonaqueous method for making silicone oligomers | |
| US5484871A (en) | Organopolysiloxanes containing hydrophilic groups | |
| US4764577A (en) | Curable polymeric composition | |
| US4612055A (en) | Stabilized blends of thiofunctional polysiloxane fluids and organopolysiloxane fluids and a process for stabilizing the same | |
| US5378789A (en) | Phenol-modified silicones | |
| KR101521643B1 (ko) | 유기실리콘 조성물들 및 그 제조 방법 | |
| AU3743685A (en) | Organosiloxane polymers | |
| CA1073323A (en) | Compositions containing thiofunctional polysiloxanes | |
| CA2134438A1 (en) | Siloxane copolymers containing vinyloxy groups, their preparation and their use | |
| CA1091383A (en) | Epoxy-functional polysiloxane polymers | |
| US5670597A (en) | Process for the preparation of organopolysiloxanes containing organyloxy groups | |
| US4588771A (en) | Stabilized thiofunctional polysiloxane fluids and a process for stabilizing the same | |
| CA1127344A (en) | Thiofunctional polysiloxane polymers | |
| KR20210130647A (ko) | 밀착성 조성물, 피복 기재 및 경화물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |