CA1089860A - Pyridinyl-2(1h)-pyridinones and preparation - Google Patents
Pyridinyl-2(1h)-pyridinones and preparationInfo
- Publication number
- CA1089860A CA1089860A CA263,013A CA263013A CA1089860A CA 1089860 A CA1089860 A CA 1089860A CA 263013 A CA263013 A CA 263013A CA 1089860 A CA1089860 A CA 1089860A
- Authority
- CA
- Canada
- Prior art keywords
- pyridinyl
- pyridinone
- amino
- alkyl
- oxo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title description 9
- TTYWSMWHPYKDEW-UHFFFAOYSA-N 1-pyridin-2-ylpyridin-2-one Chemical class O=C1C=CC=CN1C1=CC=CC=N1 TTYWSMWHPYKDEW-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 82
- -1 2-pyridinyl Chemical group 0.000 claims abstract description 59
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 31
- 239000001257 hydrogen Substances 0.000 claims abstract description 31
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims abstract description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 8
- 239000002168 alkylating agent Substances 0.000 claims abstract description 6
- 229940100198 alkylating agent Drugs 0.000 claims abstract description 6
- 125000001475 halogen functional group Chemical group 0.000 claims abstract 3
- 238000000034 method Methods 0.000 claims description 48
- 150000003839 salts Chemical class 0.000 claims description 29
- 239000003795 chemical substances by application Substances 0.000 claims description 20
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 18
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 18
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 claims description 18
- 230000008569 process Effects 0.000 claims description 12
- RNLQIBCLLYYYFJ-UHFFFAOYSA-N amrinone Chemical compound N1C(=O)C(N)=CC(C=2C=CN=CC=2)=C1 RNLQIBCLLYYYFJ-UHFFFAOYSA-N 0.000 claims description 10
- WWRSYASATWQNKV-UHFFFAOYSA-N 3-nitro-5-pyridin-4-yl-1h-pyridin-2-one Chemical compound N1C(=O)C([N+](=O)[O-])=CC(C=2C=CN=CC=2)=C1 WWRSYASATWQNKV-UHFFFAOYSA-N 0.000 claims description 9
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 9
- 235000019253 formic acid Nutrition 0.000 claims description 9
- 239000012458 free base Substances 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 6
- JQVJXOJHWJIKSQ-UHFFFAOYSA-N 2-oxo-5-pyridin-4-yl-1h-pyridine-3-carboxamide Chemical compound N1C(=O)C(C(=O)N)=CC(C=2C=CN=CC=2)=C1 JQVJXOJHWJIKSQ-UHFFFAOYSA-N 0.000 claims description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 4
- JZIXUSMDDINFMS-UHFFFAOYSA-N 3-(methylamino)-5-pyridin-4-yl-1h-pyridin-2-one Chemical compound N1C(=O)C(NC)=CC(C=2C=CN=CC=2)=C1 JZIXUSMDDINFMS-UHFFFAOYSA-N 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 230000000875 corresponding effect Effects 0.000 claims 10
- KJNIGBGATASAIU-UHFFFAOYSA-N 3-chloro-5-pyridin-4-yl-1h-pyridin-2-one Chemical compound N1C(=O)C(Cl)=CC(C=2C=CN=CC=2)=C1 KJNIGBGATASAIU-UHFFFAOYSA-N 0.000 claims 2
- XFFQYINSQLHURS-UHFFFAOYSA-N C(C)NC=1C(NC=C(C1)C1=CC=NC=C1)=O Chemical compound C(C)NC=1C(NC=C(C1)C1=CC=NC=C1)=O XFFQYINSQLHURS-UHFFFAOYSA-N 0.000 claims 2
- 239000010442 halite Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 84
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract description 31
- 238000010438 heat treatment Methods 0.000 abstract description 23
- 239000011570 nicotinamide Substances 0.000 abstract description 18
- 229960003966 nicotinamide Drugs 0.000 abstract description 18
- 239000011664 nicotinic acid Substances 0.000 abstract description 15
- 229960003512 nicotinic acid Drugs 0.000 abstract description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 14
- 239000000543 intermediate Substances 0.000 abstract description 13
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 abstract description 11
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 11
- 229910017604 nitric acid Inorganic materials 0.000 abstract description 11
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 abstract description 8
- 239000000496 cardiotonic agent Substances 0.000 abstract description 6
- 150000002431 hydrogen Chemical group 0.000 abstract description 6
- WRIRWRKPLXCTFD-UHFFFAOYSA-N malonamide Chemical compound NC(=O)CC(N)=O WRIRWRKPLXCTFD-UHFFFAOYSA-N 0.000 abstract description 4
- 239000003153 chemical reaction reagent Substances 0.000 abstract description 2
- 230000003301 hydrolyzing effect Effects 0.000 abstract description 2
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 111
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 69
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 62
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 60
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 54
- 239000007787 solid Substances 0.000 description 43
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 41
- 238000006243 chemical reaction Methods 0.000 description 39
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 26
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 23
- 239000002904 solvent Substances 0.000 description 22
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 19
- 229960000583 acetic acid Drugs 0.000 description 19
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 230000000747 cardiac effect Effects 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000000376 reactant Substances 0.000 description 11
- 230000002829 reductive effect Effects 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 10
- 230000003177 cardiotonic effect Effects 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 235000005152 nicotinamide Nutrition 0.000 description 9
- DJDDYWYYTKNZPM-UHFFFAOYSA-N 2-amino-1,3-dioxane-4,6-dione Chemical compound NC1OC(=O)CC(=O)O1 DJDDYWYYTKNZPM-UHFFFAOYSA-N 0.000 description 8
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- 229940076134 benzene Drugs 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 8
- 210000003540 papillary muscle Anatomy 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 235000011181 potassium carbonates Nutrition 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 241000282472 Canis lupus familiaris Species 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 6
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 229960004279 formaldehyde Drugs 0.000 description 5
- 235000019256 formaldehyde Nutrition 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 230000001965 increasing effect Effects 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 235000001968 nicotinic acid Nutrition 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000010998 test method Methods 0.000 description 5
- SEQOYYYZFNJQSV-UHFFFAOYSA-N 2-oxo-5-pyridin-4-yl-1h-pyridine-3-carbonitrile Chemical compound C1=C(C#N)C(=O)NC=C1C1=CC=NC=C1 SEQOYYYZFNJQSV-UHFFFAOYSA-N 0.000 description 4
- VZAKEEOHLWNYBT-UHFFFAOYSA-N 3-bromo-5-pyridin-4-yl-1h-pyridin-2-one Chemical compound N1C(=O)C(Br)=CC(C=2C=CN=CC=2)=C1 VZAKEEOHLWNYBT-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 4
- 210000002837 heart atrium Anatomy 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 235000015497 potassium bicarbonate Nutrition 0.000 description 4
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 4
- 239000011736 potassium bicarbonate Substances 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- LFHLXSHREORKED-UHFFFAOYSA-N 1-methyl-3-nitro-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C([N+]([O-])=O)C(=O)N(C)C=C1C1=CC=NC=C1 LFHLXSHREORKED-UHFFFAOYSA-N 0.000 description 3
- KFPKURCPGZGYHR-UHFFFAOYSA-N 2-oxo-5-pyridin-3-yl-1h-pyridine-3-carbonitrile Chemical compound C1=C(C#N)C(=O)NC=C1C1=CC=CN=C1 KFPKURCPGZGYHR-UHFFFAOYSA-N 0.000 description 3
- OTIZLYDEBSAMGZ-UHFFFAOYSA-N 3-amino-5-pyridin-2-yl-1h-pyridin-2-one Chemical compound N1C(=O)C(N)=CC(C=2N=CC=CC=2)=C1 OTIZLYDEBSAMGZ-UHFFFAOYSA-N 0.000 description 3
- DYKJWEAMXYBXRN-UHFFFAOYSA-N 5-(2-methylpyridin-3-yl)-3-nitro-1h-pyridin-2-one Chemical compound CC1=NC=CC=C1C1=CNC(=O)C([N+]([O-])=O)=C1 DYKJWEAMXYBXRN-UHFFFAOYSA-N 0.000 description 3
- JLEJXZDPNYUTIR-UHFFFAOYSA-N 5-pyridin-4-yl-1h-pyridin-2-one Chemical compound N1C(=O)C=CC(C=2C=CN=CC=2)=C1 JLEJXZDPNYUTIR-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003929 acidic solution Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 230000001746 atrial effect Effects 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 229960001412 pentobarbital Drugs 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- AJKVQEKCUACUMD-UHFFFAOYSA-N 2-Acetylpyridine Chemical compound CC(=O)C1=CC=CC=N1 AJKVQEKCUACUMD-UHFFFAOYSA-N 0.000 description 2
- NTHQYHTZRJMPFI-UHFFFAOYSA-N 2-oxo-5-pyridin-2-yl-1h-pyridine-3-carbonitrile Chemical compound C1=C(C#N)C(=O)NC=C1C1=CC=CC=N1 NTHQYHTZRJMPFI-UHFFFAOYSA-N 0.000 description 2
- OJCHEFONFHZRGQ-UHFFFAOYSA-N 2-oxo-5-pyridin-3-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(=O)O)=CC(C=2C=NC=CC=2)=C1 OJCHEFONFHZRGQ-UHFFFAOYSA-N 0.000 description 2
- WKDNSRJXCYJQBV-UHFFFAOYSA-N 2-oxo-5-pyridin-4-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(=O)O)=CC(C=2C=CN=CC=2)=C1 WKDNSRJXCYJQBV-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- SQAQGQHIPSOHIT-UHFFFAOYSA-N 3-amino-5-(2-methylpyridin-3-yl)-1h-pyridin-2-one Chemical compound CC1=NC=CC=C1C1=CNC(=O)C(N)=C1 SQAQGQHIPSOHIT-UHFFFAOYSA-N 0.000 description 2
- LHWAVCJDVQZDFB-UHFFFAOYSA-N 3-amino-5-pyridin-3-yl-1h-pyridin-2-one Chemical compound N1C(=O)C(N)=CC(C=2C=NC=CC=2)=C1 LHWAVCJDVQZDFB-UHFFFAOYSA-N 0.000 description 2
- PIMDLIFSHIDIGM-UHFFFAOYSA-N 3-chloro-5-pyridin-3-yl-1h-pyridin-2-one Chemical compound N1C(=O)C(Cl)=CC(C=2C=NC=CC=2)=C1 PIMDLIFSHIDIGM-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- RXBPSOSSQXCRSC-UHFFFAOYSA-N 3-nitro-1-propyl-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C([N+]([O-])=O)C(=O)N(CCC)C=C1C1=CC=NC=C1 RXBPSOSSQXCRSC-UHFFFAOYSA-N 0.000 description 2
- KWUMARXQTQHXCJ-UHFFFAOYSA-N 3-nitro-5-pyridin-2-yl-1h-pyridin-2-one Chemical compound N1C(=O)C([N+](=O)[O-])=CC(C=2N=CC=CC=2)=C1 KWUMARXQTQHXCJ-UHFFFAOYSA-N 0.000 description 2
- XTFQEZDWVPZETC-UHFFFAOYSA-N 3-nitro-5-pyridin-3-yl-1h-pyridin-2-one Chemical compound N1C(=O)C([N+](=O)[O-])=CC(C=2C=NC=CC=2)=C1 XTFQEZDWVPZETC-UHFFFAOYSA-N 0.000 description 2
- XLFHHRLCSZCQQX-UHFFFAOYSA-N 5-(3-ethylpyridin-4-yl)-1h-pyridin-2-one Chemical compound CCC1=CN=CC=C1C1=CNC(=O)C=C1 XLFHHRLCSZCQQX-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000007514 bases Chemical class 0.000 description 2
- 238000003287 bathing Methods 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 2
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- VRZVPALEJCLXPR-UHFFFAOYSA-N ethyl 4-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=C(C)C=C1 VRZVPALEJCLXPR-UHFFFAOYSA-N 0.000 description 2
- 210000003191 femoral vein Anatomy 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 230000000297 inotrophic effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- AHNJTQYTRPXLLG-UHFFFAOYSA-N lithium;diethylazanide Chemical compound [Li+].CC[N-]CC AHNJTQYTRPXLLG-UHFFFAOYSA-N 0.000 description 2
- 210000003141 lower extremity Anatomy 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 2
- SYNYSJHAHUUHLZ-UHFFFAOYSA-N n-(2-oxo-5-pyridin-4-yl-1h-pyridin-3-yl)formamide Chemical compound N1C(=O)C(NC=O)=CC(C=2C=CN=CC=2)=C1 SYNYSJHAHUUHLZ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 210000005241 right ventricle Anatomy 0.000 description 2
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-DYCDLGHISA-N trifluoroacetic acid-d1 Chemical compound [2H]OC(=O)C(F)(F)F DTQVDTLACAAQTR-DYCDLGHISA-N 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- WUZRKESREIVBJZ-UHFFFAOYSA-N 1-(2-hydroxyethyl)-3-nitro-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C([N+]([O-])=O)C(=O)N(CCO)C=C1C1=CC=NC=C1 WUZRKESREIVBJZ-UHFFFAOYSA-N 0.000 description 1
- DASXLYSUTRIHGW-UHFFFAOYSA-N 1-(3-ethylpyridin-4-yl)ethanone Chemical compound CCC1=CN=CC=C1C(C)=O DASXLYSUTRIHGW-UHFFFAOYSA-N 0.000 description 1
- YMFISHLOUXKURV-UHFFFAOYSA-N 1-ethyl-3-nitro-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C([N+]([O-])=O)C(=O)N(CC)C=C1C1=CC=NC=C1 YMFISHLOUXKURV-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- FWKLHPCDOAMCDX-UHFFFAOYSA-N 1-nitropyridin-2-one Chemical compound [O-][N+](=O)N1C=CC=CC1=O FWKLHPCDOAMCDX-UHFFFAOYSA-N 0.000 description 1
- BBKOPNWDPDYLBA-UHFFFAOYSA-N 1-propyl-5-pyridin-4-ylpyridin-2-one Chemical compound C(CC)N1C=C(C=CC1=O)C1=CC=NC=C1 BBKOPNWDPDYLBA-UHFFFAOYSA-N 0.000 description 1
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical class N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 1
- WVHXWVYBBTZKSN-UHFFFAOYSA-N 2-ethoxy-3-nitro-5-pyridin-4-ylpyridine Chemical compound C1=C([N+]([O-])=O)C(OCC)=NC=C1C1=CC=NC=C1 WVHXWVYBBTZKSN-UHFFFAOYSA-N 0.000 description 1
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- DZVSAHOHDQUFMZ-UHFFFAOYSA-N 2-hydroxyethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCO)C=C1 DZVSAHOHDQUFMZ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- GPNDARSGPQUTPG-UHFFFAOYSA-N 2-methoxy-3-nitro-5-pyridin-4-ylpyridine Chemical compound C1=C([N+]([O-])=O)C(OC)=NC=C1C1=CC=NC=C1 GPNDARSGPQUTPG-UHFFFAOYSA-N 0.000 description 1
- QIMRPGAQCKHRKB-UHFFFAOYSA-N 2-methylpropyl 4-methylbenzenesulfonate Chemical compound CC(C)COS(=O)(=O)C1=CC=C(C)C=C1 QIMRPGAQCKHRKB-UHFFFAOYSA-N 0.000 description 1
- MSNLSPMORDLFEW-UHFFFAOYSA-N 2-oxo-5-pyridin-2-yl-1h-pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(=O)O)=CC(C=2N=CC=CC=2)=C1 MSNLSPMORDLFEW-UHFFFAOYSA-N 0.000 description 1
- JTCBZTMDMJZMHO-UHFFFAOYSA-N 2-oxo-5-pyridin-3-yl-1h-pyridine-3-carboxamide Chemical compound N1C(=O)C(C(=O)N)=CC(C=2C=NC=CC=2)=C1 JTCBZTMDMJZMHO-UHFFFAOYSA-N 0.000 description 1
- TYMSFBKDEAGTDY-UHFFFAOYSA-N 3-(hexylamino)-5-pyridin-4-yl-1h-pyridin-2-one Chemical compound N1C(=O)C(NCCCCCC)=CC(C=2C=CN=CC=2)=C1 TYMSFBKDEAGTDY-UHFFFAOYSA-N 0.000 description 1
- ZFPXXHNWBYWFTB-UHFFFAOYSA-N 3-amino-1-(2-methylpropyl)-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C(N)C(=O)N(CC(C)C)C=C1C1=CC=NC=C1 ZFPXXHNWBYWFTB-UHFFFAOYSA-N 0.000 description 1
- LSHAYDDLMAVEIN-UHFFFAOYSA-N 3-amino-1-ethyl-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C(N)C(=O)N(CC)C=C1C1=CC=NC=C1 LSHAYDDLMAVEIN-UHFFFAOYSA-N 0.000 description 1
- KXFHELHAHLKBTH-UHFFFAOYSA-N 3-amino-1-methyl-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C(N)C(=O)N(C)C=C1C1=CC=NC=C1 KXFHELHAHLKBTH-UHFFFAOYSA-N 0.000 description 1
- CLCOLBFHLBFIGB-UHFFFAOYSA-N 3-amino-1-propyl-5-pyridin-4-ylpyridin-2-one Chemical compound C1=C(N)C(=O)N(CCC)C=C1C1=CC=NC=C1 CLCOLBFHLBFIGB-UHFFFAOYSA-N 0.000 description 1
- TYPVXUCYLAPJEE-UHFFFAOYSA-N 3-amino-5-(2-methylpyridin-4-yl)-1h-pyridin-2-one Chemical compound C1=NC(C)=CC(C=2C=C(N)C(=O)NC=2)=C1 TYPVXUCYLAPJEE-UHFFFAOYSA-N 0.000 description 1
- ISAWHBPAWIHQKS-UHFFFAOYSA-N 3-amino-5-pyridin-4-yl-1h-pyridin-2-one;methanesulfonic acid Chemical compound CS(O)(=O)=O.N1C(=O)C(N)=CC(C=2C=CN=CC=2)=C1 ISAWHBPAWIHQKS-UHFFFAOYSA-N 0.000 description 1
- HIMLDVAZUAHRFG-UHFFFAOYSA-N 3-bromo-5-(5-methylpyridin-3-yl)-1h-pyridin-2-one Chemical compound CC1=CN=CC(C=2C=C(Br)C(=O)NC=2)=C1 HIMLDVAZUAHRFG-UHFFFAOYSA-N 0.000 description 1
- SEPQTYODOKLVSB-UHFFFAOYSA-N 3-methylbut-2-enal Chemical compound CC(C)=CC=O SEPQTYODOKLVSB-UHFFFAOYSA-N 0.000 description 1
- BOAFCICMVMFLIT-UHFFFAOYSA-N 3-nitro-1h-pyridin-2-one Chemical compound OC1=NC=CC=C1[N+]([O-])=O BOAFCICMVMFLIT-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- XPKCTVWRMHSHFC-UHFFFAOYSA-N 5-(2-methylpyridin-3-yl)-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=NC=CC=C1C1=CNC(=O)C(C#N)=C1 XPKCTVWRMHSHFC-UHFFFAOYSA-N 0.000 description 1
- KTAOMEILAYLSDK-UHFFFAOYSA-N 5-(2-methylpyridin-3-yl)-2-oxo-1h-pyridine-3-carboxamide Chemical compound CC1=NC=CC=C1C1=CNC(=O)C(C(N)=O)=C1 KTAOMEILAYLSDK-UHFFFAOYSA-N 0.000 description 1
- PNWCHLYSZPVAPM-UHFFFAOYSA-N 5-(3-ethylpyridin-4-yl)-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CCC1=CN=CC=C1C1=CNC(=O)C(C#N)=C1 PNWCHLYSZPVAPM-UHFFFAOYSA-N 0.000 description 1
- HKDLCFWWBVQTQL-UHFFFAOYSA-N 5-(3-ethylpyridin-4-yl)-2-oxo-1h-pyridine-3-carboxamide Chemical compound CCC1=CN=CC=C1C1=CNC(=O)C(C(N)=O)=C1 HKDLCFWWBVQTQL-UHFFFAOYSA-N 0.000 description 1
- GGJQSTNWEARKEA-UHFFFAOYSA-N 5-(4,6-dimethylpyridin-2-yl)-1h-pyridin-2-one Chemical compound CC1=CC(C)=NC(C2=CNC(=O)C=C2)=C1 GGJQSTNWEARKEA-UHFFFAOYSA-N 0.000 description 1
- SCMAWGKXZZAPPO-UHFFFAOYSA-N 5-(4,6-dimethylpyridin-2-yl)-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(C)=NC(C=2C=C(C(=O)NC=2)C#N)=C1 SCMAWGKXZZAPPO-UHFFFAOYSA-N 0.000 description 1
- XALBGAHVDVTSLW-UHFFFAOYSA-N 5-(5-methylpyridin-3-yl)-1h-pyridin-2-one Chemical compound CC1=CN=CC(C2=CNC(=O)C=C2)=C1 XALBGAHVDVTSLW-UHFFFAOYSA-N 0.000 description 1
- QQUNCSQHMJLWAG-UHFFFAOYSA-N 5-(5-methylpyridin-3-yl)-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CN=CC(C=2C=C(C(=O)NC=2)C#N)=C1 QQUNCSQHMJLWAG-UHFFFAOYSA-N 0.000 description 1
- WULNROBQKZSIMG-UHFFFAOYSA-N 5-(5-methylpyridin-3-yl)-3-nitro-1h-pyridin-2-one Chemical compound CC1=CN=CC(C=2C=C(C(=O)NC=2)[N+]([O-])=O)=C1 WULNROBQKZSIMG-UHFFFAOYSA-N 0.000 description 1
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical group N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 1
- NHWKTZWOSIVHOL-UHFFFAOYSA-N 5-pyridin-2-yl-1h-pyridin-2-one Chemical compound N1C(=O)C=CC(C=2N=CC=CC=2)=C1 NHWKTZWOSIVHOL-UHFFFAOYSA-N 0.000 description 1
- CAWMGORMWCBPDF-UHFFFAOYSA-N 5-pyridin-2-ylpyridine-3-carbonitrile Chemical compound N#CC1=CN=CC(C=2N=CC=CC=2)=C1 CAWMGORMWCBPDF-UHFFFAOYSA-N 0.000 description 1
- MHPQKDWIECPKES-UHFFFAOYSA-N 5-pyridin-3-yl-1h-pyridin-2-one Chemical compound N1C(=O)C=CC(C=2C=NC=CC=2)=C1 MHPQKDWIECPKES-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical compound O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DFPAKSUCGFBDDF-ZQBYOMGUSA-N [14c]-nicotinamide Chemical compound N[14C](=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-ZQBYOMGUSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- MIJRUQYZDSEMBD-UHFFFAOYSA-N acetic acid;morpholine Chemical compound CC(O)=O.C1COCCN1 MIJRUQYZDSEMBD-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- DQSGVVGOPRWTKI-QVFAWCHISA-N atazanavir sulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.C([C@H](NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)[C@@H](O)CN(CC=1C=CC(=CC=1)C=1N=CC=CC=1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C1=CC=CC=C1 DQSGVVGOPRWTKI-QVFAWCHISA-N 0.000 description 1
- 238000010009 beating Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- HJCMMOODWZOXML-UHFFFAOYSA-N bromo hypobromite Chemical compound BrOBr HJCMMOODWZOXML-UHFFFAOYSA-N 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- GQWAOCYNCBKORA-UHFFFAOYSA-N dibutyl 2-(butoxymethylidene)propanedioate Chemical compound CCCCOC=C(C(=O)OCCCC)C(=O)OCCCC GQWAOCYNCBKORA-UHFFFAOYSA-N 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- DJYPHJGOEUDUKG-UHFFFAOYSA-N diethyl 2-[[(2-oxo-5-pyridin-3-yl-1h-pyridin-3-yl)amino]methylidene]propanedioate Chemical compound N1C(=O)C(NC=C(C(=O)OCC)C(=O)OCC)=CC(C=2C=NC=CC=2)=C1 DJYPHJGOEUDUKG-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- UCGNNOZVUNHBEY-UHFFFAOYSA-N dihexyl 2-(hexoxymethylidene)propanedioate Chemical compound CCCCCCOC=C(C(=O)OCCCCCC)C(=O)OCCCCCC UCGNNOZVUNHBEY-UHFFFAOYSA-N 0.000 description 1
- CLCKXYMTXIQMEJ-UHFFFAOYSA-N dihexyl 2-[[[5-(2,6-dimethylpyridin-4-yl)-2-oxo-1h-pyridin-3-yl]amino]methylidene]propanedioate Chemical compound N1C(=O)C(NC=C(C(=O)OCCCCCC)C(=O)OCCCCCC)=CC(C=2C=C(C)N=C(C)C=2)=C1 CLCKXYMTXIQMEJ-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- RHFZTBSULNJWEI-UHFFFAOYSA-N dimethyl 2-(methoxymethylidene)propanedioate Chemical compound COC=C(C(=O)OC)C(=O)OC RHFZTBSULNJWEI-UHFFFAOYSA-N 0.000 description 1
- JNOFNGKWYZVHJW-UHFFFAOYSA-N dipropan-2-yl 2-(propan-2-yloxymethylidene)propanedioate Chemical compound CC(C)OC=C(C(=O)OC(C)C)C(=O)OC(C)C JNOFNGKWYZVHJW-UHFFFAOYSA-N 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 210000003194 forelimb Anatomy 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- PKHMTIRCAFTBDS-UHFFFAOYSA-N hexanoyl hexanoate Chemical compound CCCCCC(=O)OC(=O)CCCCC PKHMTIRCAFTBDS-UHFFFAOYSA-N 0.000 description 1
- IVQOVYWBHRSGJI-UHFFFAOYSA-N hexyl 4-methylbenzenesulfonate Chemical compound CCCCCCOS(=O)(=O)C1=CC=C(C)C=C1 IVQOVYWBHRSGJI-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- CLIDMUTWHLMPMN-UHFFFAOYSA-N imidazole-1-carboxamide Chemical compound NC(=O)N1C=CN=C1 CLIDMUTWHLMPMN-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003601 intercostal effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229940035429 isobutyl alcohol Drugs 0.000 description 1
- 229940047889 isobutyramide Drugs 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 210000005246 left atrium Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- ZGHFDIIVVIFNPS-UHFFFAOYSA-N methyl alpha-methylvinyl ketone Natural products CC(=C)C(C)=O ZGHFDIIVVIFNPS-UHFFFAOYSA-N 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 230000037230 mobility Effects 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- BGPDZNNXERBWDD-UHFFFAOYSA-N n-(2-oxo-5-pyridin-4-yl-1h-pyridin-3-yl)hexanamide Chemical compound N1C(=O)C(NC(=O)CCCCC)=CC(C=2C=CN=CC=2)=C1 BGPDZNNXERBWDD-UHFFFAOYSA-N 0.000 description 1
- AMLJWLYRONUCKO-UHFFFAOYSA-N n-(6-amino-5-iodopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(I)C(N)=N1 AMLJWLYRONUCKO-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 150000002814 niacins Chemical class 0.000 description 1
- 150000005480 nicotinamides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- XFZRQAZGUOTJCS-UHFFFAOYSA-N phosphoric acid;1,3,5-triazine-2,4,6-triamine Chemical compound OP(O)(O)=O.NC1=NC(N)=NC(N)=N1 XFZRQAZGUOTJCS-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- RAIYODFGMLZUDF-UHFFFAOYSA-N piperidin-1-ium;acetate Chemical compound CC([O-])=O.C1CC[NH2+]CC1 RAIYODFGMLZUDF-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-OUBTZVSYSA-N potassium-40 Chemical compound [40K] ZLMJMSJWJFRBEC-OUBTZVSYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000005299 pyridinones Chemical class 0.000 description 1
- ZHNFLHYOFXQIOW-LPYZJUEESA-N quinine sulfate dihydrate Chemical compound [H+].[H+].O.O.[O-]S([O-])(=O)=O.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21.C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 ZHNFLHYOFXQIOW-LPYZJUEESA-N 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 102220004588 rs104893797 Human genes 0.000 description 1
- 102220024375 rs201069984 Human genes 0.000 description 1
- 210000001013 sinoatrial node Anatomy 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 230000003019 stabilising effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/48—Aldehydo radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/621,763 US4004012A (en) | 1975-10-14 | 1975-10-14 | 3-Cyano-5-(pyridinyl)-2(1H)-pyridinones |
| US621,763 | 1975-10-14 | ||
| US707,235 | 1976-07-21 | ||
| US05/707,235 US4072746A (en) | 1975-10-14 | 1976-07-21 | 3-Amino-5-(pyridinyl)-2(1H)-pyridinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1089860A true CA1089860A (en) | 1980-11-18 |
Family
ID=27089047
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA263,013A Expired CA1089860A (en) | 1975-10-14 | 1976-10-08 | Pyridinyl-2(1h)-pyridinones and preparation |
| CA357,650A Expired CA1103253A (en) | 1975-10-14 | 1980-08-05 | Pyridinyl -2(1h)-pyridinones and preparation |
| CA357,651A Expired CA1103254A (en) | 1975-10-14 | 1980-08-05 | Pyridinyl-2(1h)-pyridinones and preparation |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA357,650A Expired CA1103253A (en) | 1975-10-14 | 1980-08-05 | Pyridinyl -2(1h)-pyridinones and preparation |
| CA357,651A Expired CA1103254A (en) | 1975-10-14 | 1980-08-05 | Pyridinyl-2(1h)-pyridinones and preparation |
Country Status (22)
| Country | Link |
|---|---|
| US (5) | US4072746A (Direct) |
| AR (3) | AR220512A1 (Direct) |
| AT (3) | AT359494B (Direct) |
| BE (1) | BE847196A (Direct) |
| CA (3) | CA1089860A (Direct) |
| CH (3) | CH618969A5 (Direct) |
| DE (1) | DE2646469A1 (Direct) |
| DK (1) | DK151331C (Direct) |
| ES (1) | ES452405A1 (Direct) |
| FI (1) | FI66849C (Direct) |
| FR (1) | FR2327779A1 (Direct) |
| GB (1) | GB1512129A (Direct) |
| GR (1) | GR64513B (Direct) |
| IE (1) | IE43956B1 (Direct) |
| IL (1) | IL50632A (Direct) |
| LU (1) | LU76011A1 (Direct) |
| NL (1) | NL186694C (Direct) |
| NO (2) | NO147025C (Direct) |
| NZ (1) | NZ182270A (Direct) |
| PH (2) | PH12507A (Direct) |
| PT (1) | PT65708B (Direct) |
| SE (2) | SE430335B (Direct) |
Families Citing this family (84)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4072746A (en) * | 1975-10-14 | 1978-02-07 | Sterling Drug Inc. | 3-Amino-5-(pyridinyl)-2(1H)-pyridinones |
| US4223149A (en) * | 1979-07-26 | 1980-09-16 | Sterling Drug Inc. | Process for producing 3-cyano-5-(pyridinyl)-2(1H)-pyridinones |
| US4304777A (en) * | 1979-08-30 | 1981-12-08 | Sterling Drug Inc. | 6-(Pyridinyl)-3(2H)-pyridazinones and their use as cardiotonics |
| US4225601A (en) * | 1979-09-10 | 1980-09-30 | Sterling Drug Inc. | 3-Hydroxy or hydroxymethyl-5-(4-pyridinyl)2(1H)-pyridinones, useful as cardiotonic agents and their preparation |
| US4365065A (en) * | 1979-11-26 | 1982-12-21 | Sterling Drug Inc. | 1-(Pyridinyl)-2-(dimethylamino)ethenyl lower-alkyl ketones |
| NZ195564A (en) * | 1979-11-26 | 1983-09-30 | Sterling Drug Inc | 5-pyridinyl-2(1h)-pyridinones pharmaceutical compositions intermediate pyridine compounds |
| US4297360A (en) * | 1980-03-28 | 1981-10-27 | Sterling Drug Inc. | 5-(Pyridinyl)pyridine-2,3-diamines, preparation thereof and their cardiotonic use |
| AT379386B (de) * | 1979-11-26 | 1985-12-27 | Sterling Drug Inc | Verfahren zur herstellung von neuen 1-pyridinyl-2-(dialkylamino)-aethenyl-nied.-alky ketonen |
| US4313951A (en) * | 1979-11-26 | 1982-02-02 | Sterling Drug Inc. | 3-Substituted-6-(lower-alkyl)-5-(pyridinyl)-2(1H)-pyridinones, their cardiotonic use and intermediates therefor |
| US4304775A (en) * | 1979-12-13 | 1981-12-08 | Sterling Drug Inc. | 3-Hydrazino-6-(pyridinyl) pyridazines and cardiotonic use thereof |
| US4271168A (en) * | 1979-12-26 | 1981-06-02 | Sterling Drug Inc. | Selected 3-acylamino-5-[4(or 3)-pyridinyl]-2(1H)-pyridinones |
| US4264609A (en) * | 1980-02-26 | 1981-04-28 | Sterling Drug Inc. | N-[3-Dimethylamino-2-(4-pyridinyl)-2-propenylidene]-N-methylmethaniminium chloride hydrochloride, its use in preparing 5-(cyano or carbamyl)-[3,4'-bipyridin]-6(1H)-one and its use as a cardiotonic |
| US4310670A (en) * | 1980-02-26 | 1982-01-12 | Sterling Drug Inc. | Low-temperature, aqueous conversion of 4-picoline derivative to 5-cyano-[3,4'-bipyridin]-6(1H)-one |
| DE3106460A1 (de) * | 1980-03-03 | 1982-01-28 | Sandoz-Patent-GmbH, 7850 Lörrach | 2(1h)-pyridinon-derivate, ihre herstellung und sie enthaltende pharmazeutische zubereitungen |
| US4264612A (en) * | 1980-03-17 | 1981-04-28 | Sterling Drug Inc. | Lower-alkyl 2-halo-5-(pyridinyl)nicotinates, their preparation and use as cardiotonics |
| US4264603A (en) * | 1980-03-17 | 1981-04-28 | Sterling Drug Inc. | 5-(Pyridinyl)-1H-pyrazolo[3,4-b]pyridine-3-amines, their use as cardiotonics and their preparation |
| US4265895A (en) * | 1980-03-17 | 1981-05-05 | Sterling Drug Inc. | 1,2-Dihydro-5-pyridinyl-3H-pyrazolo[3,4-b]pyridin-3-ones and their use as cardiotonics |
| IL62306A0 (en) * | 1980-03-17 | 1981-05-20 | Sterling Drug Inc | Pyrazolopyridinones and pyridinylnicotinates,their preparation and pharmaceutical compositions containing them |
| US4294836A (en) * | 1980-03-24 | 1981-10-13 | Sterling Drug Inc. | 1,3-Dihydro-6-(pyridinyl)-2H-imidazo[4,5-b]pyridin-2-ones and -imidazo[4,5-b]-pyridine-2-thiones and their cardiotonic use |
| US4317909A (en) * | 1980-03-24 | 1982-03-02 | Sterling Drug Inc. | Preparation of 1,3-dihydro-5-(pyridinyl)-2H-imidazo[4,5-b]pyridin-2-ones |
| US4337253A (en) * | 1980-04-28 | 1982-06-29 | Sterling Drug Inc. | 4,5-Dihydro-2-methyl-6-(4-pyridinyl)-3(2H)-pyridazinone and its use as a cardiotonic |
| US4338446A (en) * | 1980-04-28 | 1982-07-06 | Sterling Drug Inc. | Di-(lower-alkyl)hydroxy-[2-oxo-2-(pyridinyl)ethyl]-propanedioates |
| US4305943A (en) * | 1980-04-28 | 1981-12-15 | Sterling Drug Inc. | 4-Amino-6-(pyridinyl)-3(2H)-pyridazinones and their use as cardiotonics |
| US4335131A (en) * | 1980-11-24 | 1982-06-15 | Sterling Drug Inc. | Amrinone-N-glucuronide, salts and cardiotonic use thereof |
| US4305948A (en) * | 1980-12-22 | 1981-12-15 | Sterling Drug Inc. | N-Hydroxy-1,2-dihydro-2-oxo-5-(pyridinyl)-nicotinimidamide and their cardiotonic use |
| US4339584A (en) * | 1980-12-22 | 1982-07-13 | Sterling Drug Inc. | Process for preparing 3-amino-5-(pyridinyl)-2(1H)-pyridinones via N-hydroxy-1,2-dihydro-2-oxo-5-(pyridinyl)-nicotinimidamide by reaction with polyphosphoric acid |
| US4559352A (en) * | 1981-03-30 | 1985-12-17 | Sterling Drug Inc. | 1,2-Dihydro-2-oxo-5-(hydroxy-and/or amino-phenyl)-nicotinonitriles and cardiotonic use thereof |
| IL65278A0 (en) * | 1981-03-30 | 1982-05-31 | Sterling Drug Inc | 3-amino-5-(substituted)-2(1h)-pyridinones and corresponding 3-cyano compounds,their preparation and pharmaceutical compositions containing them |
| US4397854A (en) * | 1981-05-14 | 1983-08-09 | Warner-Lambert Company | Substituted 6-phenyl-3(2H)-pyridazinones useful as cardiotonic agents |
| US4404203A (en) * | 1981-05-14 | 1983-09-13 | Warner-Lambert Company | Substituted 6-phenyl-3(2H)-pyridazinones useful as cardiotonic agents |
| US4374141A (en) * | 1981-08-17 | 1983-02-15 | Sterling Drug Inc. | 2-Substituted amino-5-(pyridinyl)-nicotinamides and their cardiotonic use |
| US4362734A (en) * | 1981-08-26 | 1982-12-07 | Sterling Drug Inc. | 2-(Substituted-amino)-5-(pyridinyl-nicotinonitriles, and their cardiotonic use |
| US4362735A (en) * | 1981-08-31 | 1982-12-07 | Sterling Drug Inc. | 3-[(3-Oxo-1-butenyl)amino]-5-(pyridinyl)-2(1H)-pyridinones and their cardiotonic use |
| US4515797A (en) * | 1981-09-08 | 1985-05-07 | Sterling Drug Inc. | 3-Amino-5-(hydroxy- and/or aminophenyl)-6-(lower-alkyl)-2(1H)-pyridinones and cardiotonic use thereof |
| US4465686A (en) * | 1981-09-08 | 1984-08-14 | Sterling Drug Inc. | 5-(Hydroxy- and/or amino-phenyl)-6-(lower-alkyl)-2-(1H)-pyridinones, their cardiotonic use and preparation |
| US4590194A (en) * | 1981-10-05 | 1986-05-20 | Sterling Drug Inc. | 3-[methyl or dimethyl)amino]-6-(pyridinyl)pyridazines and their cardiotonic use |
| US4593028A (en) * | 1981-10-26 | 1986-06-03 | William H. Rorer, Inc. | 5-hetero aryl-substituted-2-pyridones useful as cardiotonic agents for treatment of congestive heart failure |
| US4539321A (en) * | 1981-10-26 | 1985-09-03 | William H. Rorer, Inc. | 5-Diaza-aryl-3-substituted pyridone compounds |
| US4514400A (en) * | 1981-10-26 | 1985-04-30 | William H. Rorer, Inc. | Cardiotonic 5-heteroaryl-pyridone |
| US4432979A (en) * | 1981-10-26 | 1984-02-21 | William H. Rorer, Inc. | Pyridone compounds |
| US4599423A (en) * | 1982-04-26 | 1986-07-08 | Sterling Drug Inc. | Preparation of 5-(hydroxy- and/or aminophenyl-6-lower-alkyl)-2(1H)-pyridinones |
| DE3217583A1 (de) * | 1982-05-11 | 1983-11-17 | Merck Patent Gmbh, 6100 Darmstadt | 2-aryl-tetraazaindene |
| AT384021B (de) * | 1982-05-18 | 1987-09-25 | Sandoz Ag | Verfahren zur herstellung neuer 2(1h)-pyridinon- derivate und ihrer salze |
| NO163008C (no) * | 1982-05-24 | 1990-03-21 | Sterling Drug Inc | 2-(laverealkoksy)-1-(pyridinyl)etenyl-lavere-alkylketon og fremgangsmaate for fremstilling av pyridinylnikotinderivater. |
| FR2529891A1 (fr) * | 1982-07-12 | 1984-01-13 | Nativelle Sa Ets | Derives du pyridyl-3 alcoxy-5 pyrazole, procede de preparation et application en therapeutique |
| US4415580A (en) * | 1982-08-02 | 1983-11-15 | Sterling Drug Inc. | Certain 2-(1H)-pyridinones cardiotonic compositions containing same and method of using same |
| IT8367883A0 (it) * | 1982-08-23 | 1983-08-22 | Rorer Int Overseas | Composti cardiotonici del 2 piridone 5 biciclico eteroaril sostituito e relative composizioni farmaceutiche |
| US4595762A (en) * | 1982-08-25 | 1986-06-17 | Sterling Drug Inc. | 5-α-bromoalkanoyl-2-oxo-3-pyridinecarbonitriles |
| US4539327A (en) * | 1982-08-25 | 1985-09-03 | Sterling Drug Inc. | 5-(2-Substituted-4-thiazolyl)-6-alkyl-2(1H)-pyridinones and cardiotonic use thereof |
| US4469699A (en) * | 1982-08-25 | 1984-09-04 | Sterling Drug Inc. | 5-(4-Thiazolyl)-6-alkyl-2(1H)-pyridinones and their cardiotonic use |
| US4463008A (en) * | 1982-11-10 | 1984-07-31 | Sterling Drug Inc. | 2-Alkoxy-5-(pyridinyl)pyridines and cardiotonic use thereof |
| US4431651A (en) * | 1982-11-18 | 1984-02-14 | Sterling Drug Inc. | 2-Pyridinones and their use as cardiotonic agents |
| US4451469A (en) * | 1982-12-16 | 1984-05-29 | Sterling Drug Inc. | Selected 6-alkyl-and 4,6-dialkyl-2(1H)-pyridinones as cardiotonics |
| ES8600746A1 (es) * | 1983-04-20 | 1985-10-16 | Quimicos Y Farmaceuticos Abel | Un nuevo procedimiento para la preparacion de 5-azinil-1,2-dihidroazin-2-onas. |
| US4568751A (en) * | 1983-04-29 | 1986-02-04 | Merrell Dow Pharmaceuticals Inc. | 5-Acyl-2-(1H)-pyridinones |
| US4507304A (en) * | 1983-06-30 | 1985-03-26 | American Home Products Corporation | Use of 6-amino-5-pyrimidinecarbonitrile derivatives as cardiotonic agents |
| US4505910A (en) * | 1983-06-30 | 1985-03-19 | American Home Products Corporation | Amino-pyrimidine derivatives, compositions and use |
| DE3406329A1 (de) * | 1984-02-22 | 1985-08-22 | Merck Patent Gmbh, 6100 Darmstadt | Pyridone |
| US4563528A (en) * | 1984-04-19 | 1986-01-07 | Fabrica De Productos Quimicos Y Farmaceuticos Abello, S.A. | Process for preparing 5 pyridyl pyridine-2 (1H)-ones |
| EP0200024B1 (de) | 1985-04-30 | 1992-07-01 | ARZNEIMITTELWERK DRESDEN GmbH | 3-Cyan-pyridine, Verfahren zu ihrer Herstellung und ihre pharmazeutische Verwendung |
| US4617393A (en) * | 1985-07-19 | 1986-10-14 | American Home Products Corporation | 5-substituted-6-aminopyrimidines, composition and uses as cardiotonic agents for increasing cardiac contractility |
| US4666913A (en) * | 1985-11-22 | 1987-05-19 | William H. Rorer, Inc. | Hydroxy and aminothiazolyl-benzodiazinone compounds, cardiotonic compositions including the same, and their uses |
| US4743608A (en) * | 1986-07-15 | 1988-05-10 | Rorer Pharmaceutical Corporation | Pyridone-pyridyl-imidazolyl and triazolyl compounds and their use as cardiotonic agents |
| CN1038249C (zh) * | 1991-08-28 | 1998-05-06 | 罗姆和哈斯公司 | 含有二氢哒嗪酮及其相关化合物的杀菌组合物 |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| JP4650419B2 (ja) * | 2003-10-27 | 2011-03-16 | アステラス製薬株式会社 | ピラジン誘導体およびその医薬的使用 |
| KR20070095952A (ko) * | 2004-12-16 | 2007-10-01 | 버텍스 파마슈티칼스 인코포레이티드 | 염증성 질환, 증식성 질환 및 면역학적으로 매개된 질환치료용 Tec 계열 단백질 키나제의 억제제로서 유용한피리드-2-온 |
| EP2170930B3 (en) | 2007-06-04 | 2013-10-02 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| JP2011522828A (ja) | 2008-06-04 | 2011-08-04 | シナジー ファーマシューティカルズ インコーポレイテッド | 胃腸障害、炎症、癌、およびその他の障害の治療のために有用なグアニル酸シクラーゼのアゴニスト |
| EP2321341B1 (en) | 2008-07-16 | 2017-02-22 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| CN103764672A (zh) | 2011-03-01 | 2014-04-30 | 辛纳吉制药公司 | 制备鸟苷酸环化酶c激动剂的方法 |
| CN102442946B (zh) * | 2011-11-07 | 2013-12-11 | 武汉工程大学 | 3-氰基-5-(4-吡啶基)-n-正丙基-吡啶酮及其制备方法和应用 |
| WO2013097052A1 (en) | 2011-12-30 | 2013-07-04 | Abbott Laboratories | Bromodomain inhibitors |
| US9545446B2 (en) | 2013-02-25 | 2017-01-17 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase and their uses |
| CA2905435A1 (en) | 2013-03-15 | 2014-09-25 | Synergy Pharmaceuticals Inc. | Compositions useful for the treatment of gastrointestinal disorders |
| US9708367B2 (en) | 2013-03-15 | 2017-07-18 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase and their uses |
| RS65632B1 (sr) | 2013-06-05 | 2024-07-31 | Bausch Health Ireland Ltd | Ultra-prečišćeni agonisti guanilat-ciklaze c, postupak njihove pripreme i upotrebe |
| US9695147B2 (en) | 2013-07-25 | 2017-07-04 | Teva Pharmaceuticals International Gmbh | Process for the preparation of perampanel |
| CN114404588A (zh) | 2013-08-09 | 2022-04-29 | 阿德利克斯公司 | 用于抑制磷酸盐转运的化合物和方法 |
| MX379459B (es) | 2016-04-15 | 2025-03-10 | Abbvie Inc | Inhibidores de bromodominios. |
| WO2020237096A1 (en) | 2019-05-21 | 2020-11-26 | Ardelyx, Inc. | Combination for lowering serum phosphate in a patient |
| WO2021116487A1 (en) | 2019-12-13 | 2021-06-17 | Som Innovation Biotech, S.A. | Compounds for use in the treatment of niemann-pick c disease |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3814771A (en) * | 1970-11-19 | 1974-06-04 | T Shen | 5-phenyl-2-piperidones and 5-phenyl-2-thiopiperidones |
| GB1322318A (en) | 1971-05-19 | 1973-07-04 | Sterling Drug Inc | 1-alkyl-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acids and esters |
| DE2125310A1 (en) | 1971-05-21 | 1972-11-30 | Sterling Drug Inc , New York, NY (V St A) | 1-alkyl-1,4-dihydro-4-oxo-1,8-naphtyridine 3-carboxylic acids antibac |
| US3853896A (en) * | 1971-06-25 | 1974-12-10 | Merck & Co Inc | Certain dilioweralkylamino-methylene(or ethylene)-2(ih)pyridones |
| US3838155A (en) * | 1972-08-17 | 1974-09-24 | Rohm & Haas | N-aryl 5-(or 6-)methylpyrid-2-ones |
| US3838156A (en) * | 1973-03-29 | 1974-09-24 | Sterling Drug Inc | Certain 2-substituted-6-(3 or 4-pyridyl)-nicotinic acid derivatives |
| US4072746A (en) * | 1975-10-14 | 1978-02-07 | Sterling Drug Inc. | 3-Amino-5-(pyridinyl)-2(1H)-pyridinones |
-
1976
- 1976-07-21 US US05/707,235 patent/US4072746A/en not_active Expired - Lifetime
- 1976-09-28 GB GB40246/76A patent/GB1512129A/en not_active Expired
- 1976-10-06 PH PH18982A patent/PH12507A/en unknown
- 1976-10-07 IL IL50632A patent/IL50632A/xx unknown
- 1976-10-08 GR GR51886A patent/GR64513B/el unknown
- 1976-10-08 NZ NZ182270A patent/NZ182270A/xx unknown
- 1976-10-08 CA CA263,013A patent/CA1089860A/en not_active Expired
- 1976-10-11 DK DK455876A patent/DK151331C/da not_active IP Right Cessation
- 1976-10-12 IE IE2246/76A patent/IE43956B1/en unknown
- 1976-10-13 NO NO763480A patent/NO147025C/no unknown
- 1976-10-13 SE SE7611376A patent/SE430335B/xx not_active IP Right Cessation
- 1976-10-13 AR AR265069A patent/AR220512A1/es active
- 1976-10-13 FI FI762919A patent/FI66849C/fi not_active IP Right Cessation
- 1976-10-13 BE BE1007690A patent/BE847196A/xx not_active IP Right Cessation
- 1976-10-13 PT PT65708A patent/PT65708B/pt unknown
- 1976-10-13 CH CH1297876A patent/CH618969A5/fr not_active IP Right Cessation
- 1976-10-13 FR FR7630778A patent/FR2327779A1/fr active Granted
- 1976-10-14 ES ES452405A patent/ES452405A1/es not_active Expired
- 1976-10-14 DE DE19762646469 patent/DE2646469A1/de active Granted
- 1976-10-14 NL NLAANVRAGE7611394,A patent/NL186694C/xx not_active IP Right Cessation
- 1976-10-14 LU LU76011A patent/LU76011A1/xx unknown
- 1976-10-14 AT AT767476A patent/AT359494B/de not_active IP Right Cessation
-
1977
- 1977-07-25 US US05/818,724 patent/US4107315A/en not_active Expired - Lifetime
- 1977-08-08 AR AR268719A patent/AR223137A1/es active
-
1978
- 1978-01-05 PH PH20614A patent/PH20254A/en unknown
- 1978-02-10 US US05/876,571 patent/US4137233A/en not_active Expired - Lifetime
- 1978-08-28 US US05/937,120 patent/US4199586A/en not_active Expired - Lifetime
-
1979
- 1979-01-23 AT AT48979A patent/AT357534B/de not_active IP Right Cessation
- 1979-06-20 US US06/050,507 patent/US4225715A/en not_active Expired - Lifetime
-
1980
- 1980-01-04 AT AT4380A patent/AT362375B/de not_active IP Right Cessation
- 1980-01-07 AR AR279559A patent/AR231541A1/es active
- 1980-01-16 CH CH35880A patent/CH619936A5/fr not_active IP Right Cessation
- 1980-01-16 CH CH35780A patent/CH620908A5/fr not_active IP Right Cessation
- 1980-08-05 CA CA357,650A patent/CA1103253A/en not_active Expired
- 1980-08-05 CA CA357,651A patent/CA1103254A/en not_active Expired
-
1981
- 1981-03-30 SE SE8102022A patent/SE441744B/sv not_active IP Right Cessation
- 1981-11-03 NO NO813710A patent/NO148187C/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1089860A (en) | Pyridinyl-2(1h)-pyridinones and preparation | |
| US4004012A (en) | 3-Cyano-5-(pyridinyl)-2(1H)-pyridinones | |
| CA1143736A (en) | 6-alkyl-5-(pyridinyl)-3-substituted-2(1h)-pyridinones, useful as cardiotonic agents and their preparation | |
| US4312875A (en) | 5-(Pyridinyl)-6-(lower-alkyl)-2(1H)-pyridinones, 1,2-dihydro-2-oxo-5-(pyridinyl)-6-(lower-alkyl)nicotinic acids and lower-alkyl esters thereof, and cardiotonic use thereof | |
| DE3044568C2 (Direct) | ||
| CA1159061A (en) | 6-(pyridinyl)-3h-imidazo¬4,5-b|pyridines or 6- (pyridinyl)-1h-imidazo¬4,5-b|pyridines, preparation and cardiotonic use | |
| EP0011142B1 (de) | Pyrido (2,1-b) chinazolinon-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
| JPS6032630B2 (ja) | ピリジニル−2(1h)−ピリジノン類、その製法、及びそれからなる強心剤 | |
| US4465686A (en) | 5-(Hydroxy- and/or amino-phenyl)-6-(lower-alkyl)-2-(1H)-pyridinones, their cardiotonic use and preparation | |
| JPH0345073B2 (Direct) | ||
| US4599423A (en) | Preparation of 5-(hydroxy- and/or aminophenyl-6-lower-alkyl)-2(1H)-pyridinones | |
| EP0061774A2 (en) | 3-Amino-5-(substituted)-2 (1H) pyridinones and 3-cyano compounds useful as cardiotonics and preparation thereof | |
| CA1131231A (en) | Selected 3-acylamino-5-[4(or 3)-pyridinyl] - 2(1h)-pyridinones, their preparation and use as cardiotonics | |
| US4151284A (en) | Substituted (3-loweralkylamino-2-R1 O-propoxy)pyridines, antihypertensive compositions and methods containing same | |
| CA1166253A (en) | 4-amino-6-(pyridinyl)-3(2h)-pyridazinones, preparation and cardiotonic use | |
| EP0109628A1 (en) | 2(1H)-pyridinones and preparation, useful as cardiotonics | |
| KR790001308B1 (ko) | 3-아미노-5-(피리디닐)-2(1h)-피리디논류의 제조방법 | |
| US4374141A (en) | 2-Substituted amino-5-(pyridinyl)-nicotinamides and their cardiotonic use | |
| US4346221A (en) | Preparation of 4-amino-6-(pyridinyl)-3(2H)-pyridazinones from 6-(pyridinyl)-3(2H)-pyridazinones | |
| US4304776A (en) | 4-Substituted-6-(pyridinyl)-3(2h)-pyridazinones and their use as intermediates and cardiotonics | |
| US4515797A (en) | 3-Amino-5-(hydroxy- and/or aminophenyl)-6-(lower-alkyl)-2(1H)-pyridinones and cardiotonic use thereof | |
| US4559352A (en) | 1,2-Dihydro-2-oxo-5-(hydroxy-and/or amino-phenyl)-nicotinonitriles and cardiotonic use thereof | |
| GB2089791A (en) | 1,2-dihydro-5-(pyridinyl) nicotinamide derivatives and their preparation | |
| US4338446A (en) | Di-(lower-alkyl)hydroxy-[2-oxo-2-(pyridinyl)ethyl]-propanedioates | |
| JPS6159625B2 (Direct) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |