CA1087167A - Enol esters of steroids, compositions containing such compounds, processes for their preparation and methods of treatment therewith - Google Patents
Enol esters of steroids, compositions containing such compounds, processes for their preparation and methods of treatment therewithInfo
- Publication number
- CA1087167A CA1087167A CA271,963A CA271963A CA1087167A CA 1087167 A CA1087167 A CA 1087167A CA 271963 A CA271963 A CA 271963A CA 1087167 A CA1087167 A CA 1087167A
- Authority
- CA
- Canada
- Prior art keywords
- group
- steroid
- carbon
- diene
- beta
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 72
- 150000003431 steroids Chemical class 0.000 title claims abstract description 59
- 238000000034 method Methods 0.000 title claims abstract description 56
- -1 Enol esters Chemical class 0.000 title claims abstract description 34
- 238000002360 preparation method Methods 0.000 title claims abstract description 7
- 230000008569 process Effects 0.000 title claims description 34
- 239000000203 mixture Substances 0.000 title claims description 22
- 239000002253 acid Substances 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- IUHFWCGCSVTMPG-UHFFFAOYSA-N [C].[C] Chemical group [C].[C] IUHFWCGCSVTMPG-UHFFFAOYSA-N 0.000 claims description 14
- 150000007513 acids Chemical class 0.000 claims description 14
- 150000002148 esters Chemical class 0.000 claims description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 12
- 150000008064 anhydrides Chemical class 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical group FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 238000006467 substitution reaction Methods 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Chemical class 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 150000001298 alcohols Chemical class 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 150000007519 polyprotic acids Polymers 0.000 claims description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- 150000002500 ions Chemical class 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- NUPLBTPPIOMJPG-PNKHAZJDSA-N (8r,9s,10r,13s,14s)-13-methyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene Chemical compound C1C=C2C=CCC[C@@H]2[C@@H]2[C@@H]1[C@@H]1CCC[C@@]1(C)CC2 NUPLBTPPIOMJPG-PNKHAZJDSA-N 0.000 claims description 4
- DHYMIGDMHYMJAQ-BYZMTCBYSA-N (8s,9s,10r,13r,14s,17s)-17-ethyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1h-cyclopenta[a]phenanthrene Chemical compound C1C=C2C=CCC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](CC)[C@@]1(C)CC2 DHYMIGDMHYMJAQ-BYZMTCBYSA-N 0.000 claims description 4
- HFJJFVWDQNSUGH-VMXHOPILSA-N (8s,9s,10r,13s,14s)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1h-cyclopenta[a]phenanthrene Chemical compound C1C=C2C=CCC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CCC[C@@]1(C)CC2 HFJJFVWDQNSUGH-VMXHOPILSA-N 0.000 claims description 4
- HYSDKFPHBHMBJZ-LEKSSAKUSA-N 1-[(8s,9s,10r,13s,14s,17s)-3-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1C=C2C=C(O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 HYSDKFPHBHMBJZ-LEKSSAKUSA-N 0.000 claims description 4
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 150000003804 gonanes Chemical class 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical group [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- GFLFYGQMMWGKMN-BYZMTCBYSA-N (8s,9s,10r,13r,14s,17s)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7h-cyclopenta[a]phenanthrene Chemical compound C1C=C2C=CC=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](CC)[C@@]1(C)CC2 GFLFYGQMMWGKMN-BYZMTCBYSA-N 0.000 claims description 3
- BLYDDOAEUXLBIG-ZPOLXVRWSA-N (8s,9s,10r,13s,14s,17r)-3,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-8,9,12,14,15,16-hexahydro-7h-cyclopenta[a]phenanthren-11-one Chemical compound C1=C(O)C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CC=C21 BLYDDOAEUXLBIG-ZPOLXVRWSA-N 0.000 claims description 3
- JVQRIUUIJIGHDM-YFWFAHHUSA-N 2-hydroxy-1-[(8s,9s,10r,13s,14s,17s)-3-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=C(O)CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)C(=O)CO)[C@@H]4[C@@H]3CC=C21 JVQRIUUIJIGHDM-YFWFAHHUSA-N 0.000 claims description 3
- 125000003158 alcohol group Chemical group 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000002430 hydrocarbons Chemical group 0.000 claims description 3
- GNHAWRYSMNHFTJ-BYZMTCBYSA-N (8s,9s,10r,13r,14s,17s)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-1h-cyclopenta[a]phenanthrene Chemical compound C1=CC2=CC=CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](CC)[C@@]1(C)CC2 GNHAWRYSMNHFTJ-BYZMTCBYSA-N 0.000 claims description 2
- HIQVDECUIIZANU-ZPOLXVRWSA-N (8s,9s,10r,13s,14s,17r)-3,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,7,8,9,12,14,15,16-octahydro-1h-cyclopenta[a]phenanthren-11-one Chemical compound C1=C(O)CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CC=C21 HIQVDECUIIZANU-ZPOLXVRWSA-N 0.000 claims description 2
- WGBUTJCBIKWVDA-BDXSIMOUSA-N (8s,9s,13s,14s)-13-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene Chemical compound C([C@H]1[C@@H]2CCC[C@]2(CC[C@@H]11)C)CC2=C1CCC=C2 WGBUTJCBIKWVDA-BDXSIMOUSA-N 0.000 claims description 2
- IGJGDNGVVSKWKG-DXUGQKIESA-N (9s,10r,13r,14r,17s)-17-ethyl-10,13-dimethyl-2,9,11,12,14,15,16,17-octahydro-1h-cyclopenta[a]phenanthrene Chemical compound C1=CCC[C@]2(C)[C@@H](CC[C@@]3([C@@H](CC)CC[C@H]33)C)C3=CC=C21 IGJGDNGVVSKWKG-DXUGQKIESA-N 0.000 claims description 2
- VTHUYJIXSMGYOQ-KOORYGTMSA-N 17-hydroxyprogesterone acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 VTHUYJIXSMGYOQ-KOORYGTMSA-N 0.000 claims description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 150000001767 cationic compounds Chemical class 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000000468 ketone group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229940101209 mercuric oxide Drugs 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 150000002892 organic cations Chemical class 0.000 claims description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 2
- DXUIZHKLOOKLIP-DEFZLIJTSA-N [(8r,9s,10r,13s,14s,17r)-17-acetyl-17-acetyloxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate Chemical compound C([C@H]1[C@@H]2CC[C@]([C@]2(CC[C@@H]1[C@@]1(C)CC2)C)(OC(=O)C)C(C)=O)C=C1C=C2OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 DXUIZHKLOOKLIP-DEFZLIJTSA-N 0.000 claims 2
- 125000001188 haloalkyl group Chemical group 0.000 claims 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims 2
- DKROWFJGHDLNFQ-UHFFFAOYSA-N 3-[bis(2-chloroethyl)amino]-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1N(CCCl)CCCl DKROWFJGHDLNFQ-UHFFFAOYSA-N 0.000 claims 1
- ORUYBSWKKRFMFL-UHFFFAOYSA-N 3-[bis(2-chloroethyl)amino]-4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1N(CCCl)CCCl ORUYBSWKKRFMFL-UHFFFAOYSA-N 0.000 claims 1
- SZLPXYDNRSRSQC-UHFFFAOYSA-N 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate Chemical compound C1=CC(N(CCCl)CCCl)=CC=C1CCCC(=O)OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 SZLPXYDNRSRSQC-UHFFFAOYSA-N 0.000 claims 1
- FEYKKRYEEWOVTG-CKOZHMEPSA-N [(8r,9s,10r,13s,14s,17r)-17-acetyl-10,13-dimethyl-16-methylidene-2,3,8,9,11,12,14,15-octahydro-1h-cyclopenta[a]phenanthren-17-yl] acetate Chemical compound C1=CC2=CCCC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(=C)[C@](OC(=O)C)(C(C)=O)[C@@]1(C)CC2 FEYKKRYEEWOVTG-CKOZHMEPSA-N 0.000 claims 1
- 229910001411 inorganic cation Inorganic materials 0.000 claims 1
- 229930195734 saturated hydrocarbon Natural products 0.000 claims 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical group CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 16
- 230000000259 anti-tumor effect Effects 0.000 abstract description 9
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- 206010028980 Neoplasm Diseases 0.000 description 26
- 241001465754 Metazoa Species 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 210000004940 nucleus Anatomy 0.000 description 11
- 239000003826 tablet Substances 0.000 description 10
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 8
- 201000011510 cancer Diseases 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 229910001868 water Inorganic materials 0.000 description 6
- YXRFQWKNFFQPAQ-LEKSSAKUSA-N 1-[(8s,9s,10r,13s,14s,17s)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1C=C2C=CCC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 YXRFQWKNFFQPAQ-LEKSSAKUSA-N 0.000 description 5
- 239000003470 adrenal cortex hormone Substances 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- RKHQGWMMUURILY-UHRZLXHJSA-N cortivazol Chemical compound C([C@H]1[C@@H]2C[C@H]([C@]([C@@]2(C)C[C@H](O)[C@@H]1[C@@]1(C)C2)(O)C(=O)COC(C)=O)C)=C(C)C1=CC1=C2C=NN1C1=CC=CC=C1 RKHQGWMMUURILY-UHRZLXHJSA-N 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 239000005556 hormone Substances 0.000 description 5
- 229940088597 hormone Drugs 0.000 description 5
- 238000007912 intraperitoneal administration Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 229940125721 immunosuppressive agent Drugs 0.000 description 4
- 239000003018 immunosuppressive agent Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- XNOGVXAXZQINLI-ZPOLXVRWSA-N (8s,9s,10r,13s,14s,17r)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,7,8,9,12,14,15,16-octahydro-1h-cyclopenta[a]phenanthren-11-one Chemical compound C1=CCC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CC=C21 XNOGVXAXZQINLI-ZPOLXVRWSA-N 0.000 description 3
- NAYJHDFJRHROBJ-CEGNMAFCSA-N 1-[(8r,9s,10r,13s,14s,17r)-3,17-dihydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1C=C2C=C(O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 NAYJHDFJRHROBJ-CEGNMAFCSA-N 0.000 description 3
- LFGPOYRCQQAAEF-YFWFAHHUSA-N 1-[(8s,9s,10r,13s,14s,17s)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1h-cyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone Chemical compound C1=CCC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)C(=O)CO)[C@@H]4[C@@H]3CC=C21 LFGPOYRCQQAAEF-YFWFAHHUSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 150000001266 acyl halides Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000003098 androgen Substances 0.000 description 3
- 230000001548 androgenic effect Effects 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000002512 chemotherapy Methods 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 230000003054 hormonal effect Effects 0.000 description 3
- 239000007943 implant Substances 0.000 description 3
- 238000002513 implantation Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- CPZBTYRIGVOOMI-UHFFFAOYSA-N methylsulfanyl(methylsulfanylmethoxy)methane Chemical class CSCOCSC CPZBTYRIGVOOMI-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 235000011007 phosphoric acid Nutrition 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000583 progesterone congener Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- NTDNQJMXFXTZLE-FZFXZXLVSA-N (8s,9s,10s,13s,14s)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthrene Chemical compound C1CC2CC=CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CCC[C@@]1(C)CC2 NTDNQJMXFXTZLE-FZFXZXLVSA-N 0.000 description 2
- KNYFHPYFRDKBIT-CEGNMAFCSA-N 1-[(8r,9s,10r,13s,14s,17r)-17-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1C=C2C=CCC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 KNYFHPYFRDKBIT-CEGNMAFCSA-N 0.000 description 2
- 206010003445 Ascites Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 235000019483 Peanut oil Nutrition 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 2
- 150000001728 carbonyl compounds Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 231100001274 therapeutic index Toxicity 0.000 description 2
- 230000003096 thymolvtic effect Effects 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- XOFOOPVNDALPEZ-UXMGNZLBSA-N (5S,8R,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol Chemical compound OC=1C[C@@H]2CC[C@H]3[C@@H]4CCC([C@@]4(C)CC[C@@H]3[C@]2(CC=1)C)O XOFOOPVNDALPEZ-UXMGNZLBSA-N 0.000 description 1
- JWYFBDXKKQXBKW-GCOKGBOCSA-N (5S,8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene Chemical compound CC[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC=CC[C@]4(C)[C@H]3CC[C@]12C JWYFBDXKKQXBKW-GCOKGBOCSA-N 0.000 description 1
- UPVNJOUINDANKT-UGCZWRCOSA-N (5S,8S,9S,10S,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene Chemical compound C([C@@H]1CC2)=CCC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CCC[C@@]2(C)CC1 UPVNJOUINDANKT-UGCZWRCOSA-N 0.000 description 1
- MBKYAJNPVNKMIP-IMRIKWHGSA-N (5r,8r,9r,10r,13s,14s)-3-hydroxy-13-methyl-2,5,6,7,8,9,10,11,12,14,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-one Chemical compound C1=C(O)CC[C@@H]2[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC[C@H]21 MBKYAJNPVNKMIP-IMRIKWHGSA-N 0.000 description 1
- WSGOPBSDZCOCOX-IMRIKWHGSA-N (5s,8r,9r,10s,13s,14s)-3-hydroxy-13-methyl-4,5,6,7,8,9,10,11,12,14,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-one Chemical compound C1C(O)=CC[C@@H]2[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC[C@H]21 WSGOPBSDZCOCOX-IMRIKWHGSA-N 0.000 description 1
- SHNZTMPRCBXYMT-WZNAKSSCSA-N (5s,8r,9s,10r,13s,14s)-3-hydroxy-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one Chemical compound C1=C(O)CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC[C@H]21 SHNZTMPRCBXYMT-WZNAKSSCSA-N 0.000 description 1
- ISJVDMWNISUFRJ-HKQXQEGQSA-N (5s,8r,9s,10s,13s,14s)-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one Chemical compound C1C=CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC[C@H]21 ISJVDMWNISUFRJ-HKQXQEGQSA-N 0.000 description 1
- REWRPWNDGYFELW-WZNAKSSCSA-N (5s,8r,9s,10s,13s,14s)-3-hydroxy-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one Chemical compound C1C(O)=CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC[C@H]21 REWRPWNDGYFELW-WZNAKSSCSA-N 0.000 description 1
- FOAWKLBWEPTYCP-GCOKGBOCSA-N (5s,8s,9s,10s,13r,14s,17s)-17-ethyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthrene Chemical compound C([C@@H]1CC2)=CCC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](CC)[C@@]2(C)CC1 FOAWKLBWEPTYCP-GCOKGBOCSA-N 0.000 description 1
- NINLAYUXSUKKHW-QAGGRKNESA-N (8r,9s,10r,13s,14s)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one Chemical compound C1=CCC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC=C21 NINLAYUXSUKKHW-QAGGRKNESA-N 0.000 description 1
- SHHRTQZHYMJFPS-QAGGRKNESA-N (8r,9s,10r,13s,14s)-3-hydroxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one Chemical compound C1=C(O)CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC=C21 SHHRTQZHYMJFPS-QAGGRKNESA-N 0.000 description 1
- XMZASOTWFOTBQO-QXUSFIETSA-N (8r,9s,10r,13s,14s)-3-hydroxy-13-methyl-2,7,8,9,10,11,12,14,15,16-decahydro-1h-cyclopenta[a]phenanthren-17-one Chemical compound C1=C(O)CC[C@@H]2[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC=C21 XMZASOTWFOTBQO-QXUSFIETSA-N 0.000 description 1
- NCULQPYCKPJVEO-CBZIJGRNSA-N (8r,9s,13s,14s)-3-hydroxy-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1h-cyclopenta[a]phenanthren-17-one Chemical compound C1CC(O)=CC2=C1[C@H]1CC[C@](C)(C(CC3)=O)[C@@H]3[C@@H]1CC2 NCULQPYCKPJVEO-CBZIJGRNSA-N 0.000 description 1
- MHPLORJVSXEWIZ-ZPOLXVRWSA-N (8s,9s,10r,13s,14s,17r)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-8,9,12,14,15,16-hexahydro-7h-cyclopenta[a]phenanthren-11-one Chemical compound C1=CC=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CC=C21 MHPLORJVSXEWIZ-ZPOLXVRWSA-N 0.000 description 1
- OHBNEDJJNFZTEB-KJQYFISQSA-N (8s,9s,10r,13s,14s,17s)-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,7,8,9,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-one Chemical compound C1=CCC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@H](CC4)C(=O)CO)[C@@H]4[C@@H]3CC=C21 OHBNEDJJNFZTEB-KJQYFISQSA-N 0.000 description 1
- JBFVIKZAURYSRE-KJQYFISQSA-N (8s,9s,10r,13s,14s,17s)-3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,7,8,9,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-one Chemical compound C1=C(O)CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@H](CC4)C(=O)CO)[C@@H]4[C@@H]3CC=C21 JBFVIKZAURYSRE-KJQYFISQSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- DHBXNPKRAUYBTH-UHFFFAOYSA-N 1,1-ethanedithiol Chemical compound CC(S)S DHBXNPKRAUYBTH-UHFFFAOYSA-N 0.000 description 1
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- HZTYHIJQDXHMRB-JJFNZWTKSA-N 1-[(5s,8r,9s,10r,13s,14s,17r)-3,17-dihydroxy-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C([C@@H]1CC2)=C(O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@@](C(=O)C)(O)[C@@]2(C)CC1 HZTYHIJQDXHMRB-JJFNZWTKSA-N 0.000 description 1
- ZVDSUNIZZHAUCT-BJMCWZGWSA-N 1-[(5s,8r,9s,10s,13s,14s,17s)-3-hydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C([C@@H]1CC2)C(O)=CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)C)[C@@]2(C)CC1 ZVDSUNIZZHAUCT-BJMCWZGWSA-N 0.000 description 1
- WSIWVQNVLGKILE-GUCLMQHLSA-N 1-[(8r,9s,10r,13s,14s,17r)-17-hydroxy-10,13-dimethyl-16-methylidene-8,9,11,12,14,15-hexahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=CC2=CC=CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(=C)[C@@](C(=O)C)(O)[C@@]1(C)CC2 WSIWVQNVLGKILE-GUCLMQHLSA-N 0.000 description 1
- KCNMFSIJHPHXSA-NWFSVNAMSA-N 1-[(8r,9s,10r,13s,14s,17r)-17-hydroxy-6,10,13-trimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1C(C)=C2C=CCC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 KCNMFSIJHPHXSA-NWFSVNAMSA-N 0.000 description 1
- GYOXSQSZOOPOEJ-NWFSVNAMSA-N 1-[(8r,9s,10r,13s,14s,17r)-17-hydroxy-6,10,13-trimethyl-1,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=C(C)C2=CC=CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 GYOXSQSZOOPOEJ-NWFSVNAMSA-N 0.000 description 1
- LFHJOEACXVPKCX-CEGNMAFCSA-N 1-[(8r,9s,10r,13s,14s,17r)-3,17-dihydroxy-10,13-dimethyl-1,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=CC2=CC(O)=CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 LFHJOEACXVPKCX-CEGNMAFCSA-N 0.000 description 1
- FBQJZHYDGWCIDI-TTYLFXKOSA-N 1-[(8r,9s,10r,13s,14s,17r)-6-chloro-17-hydroxy-10,13-dimethyl-1,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=C(Cl)C2=CC=CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 FBQJZHYDGWCIDI-TTYLFXKOSA-N 0.000 description 1
- HLEOOCVGNHLKDT-COOGFRGXSA-N 1-[(8r,9s,10r,13s,14s,17r)-6-chloro-17-hydroxy-10,13-dimethyl-16-methylidene-8,9,11,12,14,15-hexahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=C(Cl)C2=CC=CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(=C)[C@@](C(=O)C)(O)[C@@]1(C)CC2 HLEOOCVGNHLKDT-COOGFRGXSA-N 0.000 description 1
- MBHGCNGKGXSQOK-YFNVTMOMSA-N 1-[(9s,10r,13s,14s,17r)-17-hydroxy-10,13-dimethyl-16-methylidene-2,9,11,12,14,15-hexahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=CCC[C@]2(C)[C@@H](CC[C@@]3([C@](C(=O)C)(O)C(=C)C[C@H]33)C)C3=CC=C21 MBHGCNGKGXSQOK-YFNVTMOMSA-N 0.000 description 1
- OZMIMYFQKHRWSW-YFNVTMOMSA-N 1-[(9s,10r,13s,14s,17r)-17-hydroxy-6,10,13-trimethyl-1,2,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=CCC[C@]2(C)[C@@H](CC[C@@]3([C@](C(=O)C)(O)CC[C@H]33)C)C3=CC(C)=C21 OZMIMYFQKHRWSW-YFNVTMOMSA-N 0.000 description 1
- ZKTSKPGFWLVJPX-SXYSDOLCSA-N 1-[(9s,10r,13s,14s,17r)-3,17-dihydroxy-10,13-dimethyl-1,2,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=C(O)CC[C@]2(C)[C@@H](CC[C@@]3([C@](C(=O)C)(O)CC[C@H]33)C)C3=CC=C21 ZKTSKPGFWLVJPX-SXYSDOLCSA-N 0.000 description 1
- UISOUALCHYZTAH-BQEVRZRTSA-N 1-[(9s,10r,13s,14s,17r)-6-chloro-17-hydroxy-10,13-dimethyl-1,2,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=CCC[C@]2(C)[C@@H](CC[C@@]3([C@](C(=O)C)(O)CC[C@H]33)C)C3=CC(Cl)=C21 UISOUALCHYZTAH-BQEVRZRTSA-N 0.000 description 1
- HMEHYAYNFQMVLX-WVNMJAPOSA-N 1-[(9s,10r,13s,14s,17r)-6-chloro-17-hydroxy-10,13-dimethyl-16-methylidene-2,9,11,12,14,15-hexahydro-1h-cyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1=CCC[C@]2(C)[C@@H](CC[C@@]3([C@](C(=O)C)(O)C(=C)C[C@H]33)C)C3=CC(Cl)=C21 HMEHYAYNFQMVLX-WVNMJAPOSA-N 0.000 description 1
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- AWQSAIIDOMEEOD-UHFFFAOYSA-N 5,5-Dimethyl-4-(3-oxobutyl)dihydro-2(3H)-furanone Chemical compound CC(=O)CCC1CC(=O)OC1(C)C AWQSAIIDOMEEOD-UHFFFAOYSA-N 0.000 description 1
- JWMFYGXQPXQEEM-NUNROCCHSA-N 5β-pregnane Chemical compound C([C@H]1CC2)CCC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](CC)[C@@]2(C)CC1 JWMFYGXQPXQEEM-NUNROCCHSA-N 0.000 description 1
- 235000019890 Amylum Nutrition 0.000 description 1
- BOJKULTULYSRAS-OTESTREVSA-N Andrographolide Chemical compound C([C@H]1[C@]2(C)CC[C@@H](O)[C@]([C@H]2CCC1=C)(CO)C)\C=C1/[C@H](O)COC1=O BOJKULTULYSRAS-OTESTREVSA-N 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 241000661938 Capsus Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 201000000274 Carcinosarcoma Diseases 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 208000028018 Lymphocytic leukaemia Diseases 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 238000011785 NMRI mouse Methods 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 208000009971 Walker Carcinoma 256 Diseases 0.000 description 1
- KTBISRMQZQFYQK-FAYGLSSFSA-N [(8r,9s,10r,13s,14s,17r)-17-acetyl-17-acetyloxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] 3-[bis(2-chloroethyl)amino]-4-chlorobenzoate Chemical compound C([C@H]1[C@@H]2CC[C@]([C@]2(CC[C@@H]1[C@@]1(C)CC2)C)(OC(=O)C)C(C)=O)C=C1C=C2OC(=O)C1=CC=C(Cl)C(N(CCCl)CCCl)=C1 KTBISRMQZQFYQK-FAYGLSSFSA-N 0.000 description 1
- RZXNRBIPXYNKDV-GLVHTUAPSA-N [(8r,9s,10r,13s,14s,17r)-17-acetyl-17-acetyloxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] 3-[bis(2-chloroethyl)amino]-4-methylbenzoate Chemical compound C([C@H]1[C@@H]2CC[C@]([C@]2(CC[C@@H]1[C@@]1(C)CC2)C)(OC(=O)C)C(C)=O)C=C1C=C2OC(=O)C1=CC=C(C)C(N(CCCl)CCCl)=C1 RZXNRBIPXYNKDV-GLVHTUAPSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- 239000012445 acidic reagent Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000001195 anabolic effect Effects 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- NINLAYUXSUKKHW-UHFFFAOYSA-N androsta-3,5(6)-dien-17-one Natural products C1=CCCC2(C)C3CCC(C)(C(CC4)=O)C4C3CC=C21 NINLAYUXSUKKHW-UHFFFAOYSA-N 0.000 description 1
- QZLYKIGBANMMBK-UGCZWRCOSA-N androstane group Chemical group [C@@H]12CCC[C@@]1(C)CC[C@H]1[C@H]2CC[C@H]2CCCC[C@]12C QZLYKIGBANMMBK-UGCZWRCOSA-N 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- JWMLCCRPDOIBAV-UHFFFAOYSA-N chloro(methylsulfanyl)methane Chemical compound CSCCl JWMLCCRPDOIBAV-UHFFFAOYSA-N 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000007278 cyanoethylation reaction Methods 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- GRXPVLPQNMUNNX-MHJRRCNVSA-N estrane group Chemical group [C@@H]12CCC[C@@]1(C)CC[C@@H]1[C@H]3CCCCC3CC[C@@H]21 GRXPVLPQNMUNNX-MHJRRCNVSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000013401 experimental design Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid group Chemical group C(CCCCCC)(=O)O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- LXXKITJEFGLJNW-UHFFFAOYSA-N iodo(methylsulfanyl)methane Chemical compound CSCI LXXKITJEFGLJNW-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 231100000225 lethality Toxicity 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 208000003747 lymphoid leukemia Diseases 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 229920001206 natural gum Polymers 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000003270 steroid hormone Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- MLGCXEBRWGEOQX-UHFFFAOYSA-N tetradifon Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl MLGCXEBRWGEOQX-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J41/00—Normal steroids containing one or more nitrogen atoms not belonging to a hetero ring
- C07J41/0033—Normal steroids containing one or more nitrogen atoms not belonging to a hetero ring not covered by C07J41/0005
- C07J41/0088—Normal steroids containing one or more nitrogen atoms not belonging to a hetero ring not covered by C07J41/0005 containing unsubstituted amino radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Steroid Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB6512/76 | 1976-02-19 | ||
| GB6512/76A GB1527161A (en) | 1976-02-19 | 1976-02-19 | Enol esters of steroids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1087167A true CA1087167A (en) | 1980-10-07 |
Family
ID=9815869
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA271,963A Expired CA1087167A (en) | 1976-02-19 | 1977-02-17 | Enol esters of steroids, compositions containing such compounds, processes for their preparation and methods of treatment therewith |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4150126A (enExample) |
| JP (1) | JPS52100458A (enExample) |
| AT (1) | AT358200B (enExample) |
| AU (1) | AU511532B2 (enExample) |
| BE (1) | BE851649A (enExample) |
| CA (1) | CA1087167A (enExample) |
| DE (1) | DE2707121A1 (enExample) |
| DK (1) | DK71977A (enExample) |
| ES (1) | ES456057A1 (enExample) |
| FI (1) | FI57114C (enExample) |
| FR (1) | FR2341594A1 (enExample) |
| GB (1) | GB1527161A (enExample) |
| HU (1) | HU176558B (enExample) |
| LU (1) | LU76795A1 (enExample) |
| NL (1) | NL7701585A (enExample) |
| NO (1) | NO770560L (enExample) |
| NZ (1) | NZ183376A (enExample) |
| SE (1) | SE7700170L (enExample) |
| SU (1) | SU828970A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4260736A (en) * | 1978-08-14 | 1981-04-07 | Kureha Kagaku Kogyo Kabushiki Kaisha | Steroid hormone-antitumor derivatives |
| US4261910A (en) * | 1978-08-14 | 1981-04-14 | Kureha Kagaku Kogyo Kabushiki Kaisha | Process for the preparation of Chlorambucil derivatives |
| US4512986A (en) * | 1983-07-26 | 1985-04-23 | Research Triangle Institute | Progrestationally active steroids |
| JPS61293993A (ja) * | 1985-06-21 | 1986-12-24 | Kureha Chem Ind Co Ltd | 新規な螢光物質,その製造方法及び薬剤 |
| JPH0621072B2 (ja) * | 1986-11-12 | 1994-03-23 | 呉羽化学工業株式会社 | エストラジオ−ル誘導体よりなる免疫調節剤 |
| GB9003939D0 (en) * | 1990-02-21 | 1990-04-18 | Imperial College | Sulphatase inhibitors |
| US5429934A (en) * | 1990-08-18 | 1995-07-04 | Schering Aktiengesellschaft | Process for the production of 20-methyl-5,7-pregnadiene-3β,21-diol derivatives using mycobacterium |
| GB9118465D0 (en) * | 1991-08-29 | 1991-10-16 | Imperial College | Steroid sulphatase inhibitors |
| GB0304927D0 (en) | 2003-03-04 | 2003-04-09 | Resolution Chemicals Ltd | Process for the production of tibolone |
| RU2719457C2 (ru) * | 2015-06-29 | 2020-04-17 | Галеника С.А. | Сложные эфиры стероидного лактама и производных бис(2-хлорэтил)аминофеноксипропановой кислоты |
-
1976
- 1976-02-19 GB GB6512/76A patent/GB1527161A/en not_active Expired
-
1977
- 1977-01-10 SE SE7700170A patent/SE7700170L/ not_active Application Discontinuation
- 1977-01-17 US US05/760,151 patent/US4150126A/en not_active Expired - Lifetime
- 1977-01-28 FI FI770296A patent/FI57114C/fi not_active IP Right Cessation
- 1977-02-09 AU AU22091/77A patent/AU511532B2/en not_active Expired
- 1977-02-14 SU SU772451700A patent/SU828970A3/ru active
- 1977-02-15 NL NL7701585A patent/NL7701585A/xx not_active Application Discontinuation
- 1977-02-17 CA CA271,963A patent/CA1087167A/en not_active Expired
- 1977-02-17 HU HU77LE801A patent/HU176558B/hu unknown
- 1977-02-17 LU LU76795A patent/LU76795A1/xx unknown
- 1977-02-18 DE DE19772707121 patent/DE2707121A1/de not_active Withdrawn
- 1977-02-18 AT AT111977A patent/AT358200B/de not_active IP Right Cessation
- 1977-02-18 NZ NZ183376A patent/NZ183376A/xx unknown
- 1977-02-18 ES ES456057A patent/ES456057A1/es not_active Expired
- 1977-02-18 JP JP1633477A patent/JPS52100458A/ja active Pending
- 1977-02-18 DK DK71977A patent/DK71977A/da unknown
- 1977-02-18 NO NO770560A patent/NO770560L/no unknown
- 1977-02-21 BE BE175104A patent/BE851649A/xx unknown
- 1977-02-21 FR FR7704960A patent/FR2341594A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FI770296A7 (enExample) | 1977-08-20 |
| ATA111977A (de) | 1980-01-15 |
| SE7700170L (sv) | 1977-08-20 |
| DE2707121A1 (de) | 1977-09-01 |
| FI57114C (fi) | 1980-06-10 |
| US4150126A (en) | 1979-04-17 |
| BE851649A (fr) | 1977-08-22 |
| HU176558B (en) | 1981-03-28 |
| JPS52100458A (en) | 1977-08-23 |
| FR2341594B1 (enExample) | 1980-09-19 |
| LU76795A1 (enExample) | 1978-10-18 |
| NO770560L (no) | 1977-08-22 |
| FR2341594A1 (fr) | 1977-09-16 |
| AT358200B (de) | 1980-08-25 |
| FI57114B (fi) | 1980-02-29 |
| AU2209177A (en) | 1978-08-17 |
| NZ183376A (en) | 1980-04-28 |
| GB1527161A (en) | 1978-10-04 |
| ES456057A1 (es) | 1978-06-01 |
| NL7701585A (nl) | 1977-08-23 |
| SU828970A3 (ru) | 1981-05-07 |
| DK71977A (da) | 1977-08-20 |
| AU511532B2 (en) | 1980-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0422100B1 (en) | 11 beta-substituted progesterone analogs | |
| CA2130515C (en) | New 11-benzaldoxime-17.beta.-methoxy-17.alpha.-methoxymethylestradiene derivatives, methods for their production and pharmaceuticals containing these substances | |
| US4150126A (en) | Novel enol esters of steroids, compositions containing such compounds, processes for their preparation and methods of treatment therewith | |
| EP0227813B1 (en) | 11-beta-nitrate-substituted estranes | |
| US4177269A (en) | Novel 17-esters of 17α-hydroxy gestogens, compositions containing such compounds, processes for their preparation and methods of treatment therewith | |
| EP1599493B1 (de) | Antitumor wirksame 2-substituierte estra-1,3,5(10)-trien-3-yl sulfamate | |
| US3963707A (en) | Novel N-nitroso compounds, compositions containing such compounds, processes for their preparation and methods of treatment therewith, and novel intermediates | |
| US3084159A (en) | 3-enol ethers of 3-oxo-delta-6-aminomethyl steroids and process for preparing same | |
| US3502657A (en) | Production of 2,3-epithiosteroids | |
| US3686237A (en) | O-(nitroaryl)oximes of 3-keto steroids | |
| US3340280A (en) | Estra-4, 9-diene-3beta, 17-diols and esters thereof | |
| US3167547A (en) | 17-tetrahydropyranyl ethers of 19-nor, 3-keto androstanes | |
| US3251863A (en) | Steroidguanylhydrazones | |
| US3709878A (en) | 8 alpha-methyl-substituted-steroids | |
| US3169128A (en) | Steroidal 2beta, 3alpha-diol cyclic trithiocarbonate | |
| US3519654A (en) | 13beta-lower alkyl-delta**4,9-gonadiene-3-ones | |
| US3296075A (en) | 17alpha-acyloxy-16-methylene-pregn-4-ene-3, 20-diones, pharmaceutical preparations containing same, and intermediate thereto | |
| JP2002539135A (ja) | アンドロゲンとしての14β,17α−ヒドロキシメチルアンドロスタン誘導体 | |
| US3171844A (en) | 20-(aliphatic hydrocarbonthio) and 20-(substituted aliphatic hydrocarbonthio) pregnane derivatives | |
| US3484465A (en) | Bicyclo(2.2.2)octane - 1-carboxylate carbonate esters of estrogenic steroids | |
| US3661940A (en) | Derivatives of 21-methyl-19-norpregnanes | |
| US3691212A (en) | 17alpha-(1',3'-alkadiynyl)-17beta-acyloxy(17beta-aroyloxy) steroids | |
| US3518255A (en) | Acetalic ethers of estra-1,3,5(10)-trienes and process for their preparation | |
| US3437657A (en) | 6-fluoromethyl-3-oxo-4,6-dienic steroids and process for preparing same | |
| US3450723A (en) | 3-ureido pregnanes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |