CA1083141A - Cephalosporin displacement reaction - Google Patents
Cephalosporin displacement reactionInfo
- Publication number
- CA1083141A CA1083141A CA298,070A CA298070A CA1083141A CA 1083141 A CA1083141 A CA 1083141A CA 298070 A CA298070 A CA 298070A CA 1083141 A CA1083141 A CA 1083141A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- acetamido
- thio
- cephem
- thiol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930186147 Cephalosporin Natural products 0.000 title claims description 16
- 229940124587 cephalosporin Drugs 0.000 title claims description 16
- 238000006073 displacement reaction Methods 0.000 title abstract description 15
- 150000001780 cephalosporins Chemical class 0.000 title description 11
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 claims abstract description 163
- 238000000034 method Methods 0.000 claims abstract description 62
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 21
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 19
- 239000011593 sulfur Substances 0.000 claims abstract description 19
- 239000012038 nucleophile Substances 0.000 claims abstract description 17
- 239000003960 organic solvent Substances 0.000 claims abstract description 8
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims abstract description 6
- -1 cephalosporin compound Chemical class 0.000 claims description 263
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 79
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 63
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 57
- 239000002904 solvent Substances 0.000 claims description 48
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 claims description 47
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 35
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 33
- 239000002253 acid Substances 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 21
- FPVUWZFFEGYCGB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CC1=NN=C(S)S1 FPVUWZFFEGYCGB-UHFFFAOYSA-N 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 14
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 12
- 125000003277 amino group Chemical group 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- QNJVDZUXRBFPRA-SBXXRYSUSA-N (6r)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 QNJVDZUXRBFPRA-SBXXRYSUSA-N 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 9
- CJDXQHXLUSJTMO-UHFFFAOYSA-N 4-methyl-3-sulfanylidene-1,2,4-triazinane-5,6-dione Chemical compound CN1C(S)=NN=C(O)C1=O CJDXQHXLUSJTMO-UHFFFAOYSA-N 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 claims description 4
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical compound SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 claims description 4
- UOTQEHLQKASWQO-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-tetrazol-1-yl)acetic acid Chemical compound OC(=O)CN1N=NN=C1S UOTQEHLQKASWQO-UHFFFAOYSA-N 0.000 claims description 4
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000001072 heteroaryl group Chemical group 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- HBCQSNAFLVXVAY-UHFFFAOYSA-N pyrimidine-2-thiol Chemical compound SC1=NC=CC=N1 HBCQSNAFLVXVAY-UHFFFAOYSA-N 0.000 claims description 4
- JLAMDELLBBZOOX-UHFFFAOYSA-N 3h-1,3,4-thiadiazole-2-thione Chemical compound SC1=NN=CS1 JLAMDELLBBZOOX-UHFFFAOYSA-N 0.000 claims description 3
- CLEJZSNZYFJMKD-UHFFFAOYSA-N 3h-1,3-oxazole-2-thione Chemical compound SC1=NC=CO1 CLEJZSNZYFJMKD-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 3
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 3
- 150000008282 halocarbons Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical group 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- RRJHESVQVSRQEX-MKTAYPAQSA-N (6r)-7-[(2-formyloxy-2-phenylacetyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(OC=O)C=3C=CC=CC=3)[C@H]2SC1 RRJHESVQVSRQEX-MKTAYPAQSA-N 0.000 claims description 2
- VMZFBPKXDAYFCI-OMNKOJBGSA-N (6r)-7-acetamido-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)NC(=O)C)CC=1CSC1=NN=NN1C VMZFBPKXDAYFCI-OMNKOJBGSA-N 0.000 claims description 2
- LRDQBBIQIWWSEZ-FQNRMIAFSA-N (6r)-8-oxo-3-(pyrimidin-2-ylsulfanylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NC=CC=N1 LRDQBBIQIWWSEZ-FQNRMIAFSA-N 0.000 claims description 2
- DZMVCVMFETWNIU-QHDYGNBISA-N (6r)-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1=NN=NN1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NN=CS1 DZMVCVMFETWNIU-QHDYGNBISA-N 0.000 claims description 2
- 125000004797 2,2,2-trichloroethoxy group Chemical group ClC(CO*)(Cl)Cl 0.000 claims description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims description 2
- XCUUXCDIVKRONM-UHFFFAOYSA-N 3-methyl-2h-1,2,4-oxadiazole-5-thione Chemical compound CC1=NC(=S)ON1 XCUUXCDIVKRONM-UHFFFAOYSA-N 0.000 claims description 2
- QPHZWABVAIGWHI-UHFFFAOYSA-N 3-methyl-2h-1,2,4-thiadiazole-5-thione Chemical compound CC1=NSC(S)=N1 QPHZWABVAIGWHI-UHFFFAOYSA-N 0.000 claims description 2
- CYCKHTAVNBPQDB-UHFFFAOYSA-N 4-phenyl-3H-thiazole-2-thione Chemical compound S1C(S)=NC(C=2C=CC=CC=2)=C1 CYCKHTAVNBPQDB-UHFFFAOYSA-N 0.000 claims description 2
- HCXJFMDOHDNDCC-UHFFFAOYSA-N 5-$l^{1}-oxidanyl-3,4-dihydropyrrol-2-one Chemical group O=C1CCC(=O)[N]1 HCXJFMDOHDNDCC-UHFFFAOYSA-N 0.000 claims description 2
- ZVGKPQCCKGLQPB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-oxadiazole-2-thione Chemical compound CC1=NN=C(S)O1 ZVGKPQCCKGLQPB-UHFFFAOYSA-N 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- GMOCHVCJXLHQRY-UHFFFAOYSA-N n-methyl-n-(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)acetamide Chemical compound CC(=O)N(C)C1=NN=C(S)S1 GMOCHVCJXLHQRY-UHFFFAOYSA-N 0.000 claims description 2
- 150000002828 nitro derivatives Chemical class 0.000 claims description 2
- 125000000018 nitroso group Chemical group N(=O)* 0.000 claims description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 2
- 125000006413 ring segment Chemical group 0.000 claims description 2
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 150000003568 thioethers Chemical class 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 5
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- DKKIOOJROOHVAX-FQNRMIAFSA-N (6R)-3-[[5-[acetyl(methyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN(C(C)=O)C1=NN=C(S1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CC=1SC=CC=1)=O)=O DKKIOOJROOHVAX-FQNRMIAFSA-N 0.000 claims 1
- UYBXXXZILOVWPL-PUODRLBUSA-N (6R)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2(NC(CN1N=NN=C1)=O)OC)=O UYBXXXZILOVWPL-PUODRLBUSA-N 0.000 claims 1
- LHTJOXQHMYGJKN-QHDYGNBISA-N (6R)-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1C=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CN1N=NN=C1)=O)=O LHTJOXQHMYGJKN-QHDYGNBISA-N 0.000 claims 1
- FRPSFCPAYKPEDL-JLOHTSLTSA-N (6r)-3-(carbamimidoylsulfanylmethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)CSC(=N)N)C(O)=O)NC(=O)CC1=CC=CS1 FRPSFCPAYKPEDL-JLOHTSLTSA-N 0.000 claims 1
- NGUGGZZGPVSQNS-FQNRMIAFSA-N (6r)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)COC=3C=CC=CC=3)[C@H]2SC1 NGUGGZZGPVSQNS-FQNRMIAFSA-N 0.000 claims 1
- HLHQDMDHTLDCEI-WPZCJLIBSA-N (6r)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NOC(SCC=2CS[C@H]3N(C(C3NC(=O)CC=3SC=CC=3)=O)C=2C(O)=O)=N1 HLHQDMDHTLDCEI-WPZCJLIBSA-N 0.000 claims 1
- JKSGJOGGZPWNTE-FBMWCMRBSA-N (6r)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3C=CC=CC=3)[C@H]2SC1 JKSGJOGGZPWNTE-FBMWCMRBSA-N 0.000 claims 1
- LSUZOLXNVYRLHE-WPZCJLIBSA-N (6r)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 LSUZOLXNVYRLHE-WPZCJLIBSA-N 0.000 claims 1
- MLYYVTUWGNIJIB-FFFFSGIJSA-N (6r)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-FFFFSGIJSA-N 0.000 claims 1
- KTQWBCXLZUKCFG-AFYYWNPRSA-N (6r)-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-7-methoxy-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(CSC=3N(N=NN=3)CC(O)=O)=C(C(O)=O)N1C(=O)C2(OC)NC(=O)CN1C=NN=N1 KTQWBCXLZUKCFG-AFYYWNPRSA-N 0.000 claims 1
- IAIJXUHASIZJOZ-WPZCJLIBSA-N (6r)-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 IAIJXUHASIZJOZ-WPZCJLIBSA-N 0.000 claims 1
- OLVCFLKTBJRLHI-IJGSQOGDSA-N (6r)-7-[(2-hydroxy-2-phenylacetyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(O)C=3C=CC=CC=3)[C@H]2SC1 OLVCFLKTBJRLHI-IJGSQOGDSA-N 0.000 claims 1
- GCFBRXLSHGKWDP-WTOQYCPUSA-N (6r)-7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O=C1C(=O)N(CC)CCN1C(=O)NC(C=1C=CC(O)=CC=1)C(=O)NC1C(=O)N2C(C(O)=O)=C(CSC=3N(N=NN=3)C)CS[C@@H]21 GCFBRXLSHGKWDP-WTOQYCPUSA-N 0.000 claims 1
- DKUSJJZPNJGDFX-IOJJLOCKSA-N (6r)-7-formamido-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC=O)[C@H]2SC1 DKUSJJZPNJGDFX-IOJJLOCKSA-N 0.000 claims 1
- JPDOWZIXGKOVST-DUSLRRAJSA-N (6r)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(CSC=3N(N=NN=3)C)=C(C(O)=O)N1C(=O)C2(OC)NC(=O)CC1=CC=CC=C1 JPDOWZIXGKOVST-DUSLRRAJSA-N 0.000 claims 1
- WBCWFOAESSGKJE-BDPMCISCSA-N (6r)-8-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanylmethyl]-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC(SC=1)=NC=1C1=CC=CC=C1 WBCWFOAESSGKJE-BDPMCISCSA-N 0.000 claims 1
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 claims 1
- 229940054266 2-mercaptobenzothiazole Drugs 0.000 claims 1
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical group C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 claims 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 150000001733 carboxylic acid esters Chemical class 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 197
- 239000000047 product Substances 0.000 description 193
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 115
- 238000005481 NMR spectroscopy Methods 0.000 description 109
- 239000011541 reaction mixture Substances 0.000 description 89
- 238000002360 preparation method Methods 0.000 description 78
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 65
- 238000004809 thin layer chromatography Methods 0.000 description 63
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 47
- 238000006243 chemical reaction Methods 0.000 description 47
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- 239000010410 layer Substances 0.000 description 36
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 35
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 32
- 239000007858 starting material Substances 0.000 description 32
- 238000001914 filtration Methods 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- 150000003536 tetrazoles Chemical class 0.000 description 29
- 239000000203 mixture Substances 0.000 description 28
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 21
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 19
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 19
- 229960000583 acetic acid Drugs 0.000 description 18
- 239000013078 crystal Substances 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 239000007787 solid Substances 0.000 description 17
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 16
- 229930192474 thiophene Natural products 0.000 description 16
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 15
- 229940011051 isopropyl acetate Drugs 0.000 description 15
- 239000000706 filtrate Substances 0.000 description 14
- 150000003573 thiols Chemical class 0.000 description 14
- 125000000217 alkyl group Chemical group 0.000 description 13
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 13
- 239000006260 foam Substances 0.000 description 13
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 239000000376 reactant Substances 0.000 description 12
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 12
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000523 sample Substances 0.000 description 9
- 159000000000 sodium salts Chemical class 0.000 description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 8
- 229960003390 magnesium sulfate Drugs 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 238000001035 drying Methods 0.000 description 7
- 238000000921 elemental analysis Methods 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 125000004193 piperazinyl group Chemical group 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 6
- 229940095564 anhydrous calcium sulfate Drugs 0.000 description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 6
- 229950005499 carbon tetrachloride Drugs 0.000 description 6
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 6
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 6
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- 101150041968 CDC13 gene Proteins 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 229940022663 acetate Drugs 0.000 description 5
- 125000003368 amide group Chemical group 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- BFROMESWLJHKCS-IJGSQOGDSA-N (6R)-7-[[5-(butoxycarbonylamino)-5-carboxypentanoyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(CCC)OC(=O)NC(CCCC(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C(=O)O BFROMESWLJHKCS-IJGSQOGDSA-N 0.000 description 4
- IVSZLXZYQVIEFR-UHFFFAOYSA-N 1,3-Dimethylbenzene Natural products CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 4
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 241001061127 Thione Species 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- OGJCIAFFKGRGJC-UHFFFAOYSA-N 1,2-bis(chloranyl)ethane Chemical compound ClCCCl.ClCCCl OGJCIAFFKGRGJC-UHFFFAOYSA-N 0.000 description 3
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-dimethylbenzene Natural products CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 3
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 3
- XUDVEGGLPJVTHY-LEHRNKBSSA-N (6r)-7-[(2-formyloxy-2-phenylacetyl)amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(OC=O)C=3C=CC=CC=3)[C@H]2SC1 XUDVEGGLPJVTHY-LEHRNKBSSA-N 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- ODDAWJGQWOGBCX-UHFFFAOYSA-N 1-[2-(dimethylazaniumyl)ethyl]tetrazole-5-thiolate Chemical compound CN(C)CCN1N=NN=C1S ODDAWJGQWOGBCX-UHFFFAOYSA-N 0.000 description 2
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 2
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 2
- OSOUNOBYRMOXQQ-UHFFFAOYSA-N 1-chloro-3-methylbenzene Chemical compound CC1=CC=CC(Cl)=C1 OSOUNOBYRMOXQQ-UHFFFAOYSA-N 0.000 description 2
- YZNQITSGDRCUKE-UHFFFAOYSA-N 1-chloropropane Chemical compound [CH2]CCCl YZNQITSGDRCUKE-UHFFFAOYSA-N 0.000 description 2
- MMZYCBHLNZVROM-UHFFFAOYSA-N 1-fluoro-2-methylbenzene Chemical compound CC1=CC=CC=C1F MMZYCBHLNZVROM-UHFFFAOYSA-N 0.000 description 2
- BTQZKHUEUDPRST-UHFFFAOYSA-N 1-fluoro-3-methylbenzene Chemical compound CC1=CC=CC(F)=C1 BTQZKHUEUDPRST-UHFFFAOYSA-N 0.000 description 2
- WRWPPGUCZBJXKX-UHFFFAOYSA-N 1-fluoro-4-methylbenzene Chemical compound CC1=CC=C(F)C=C1 WRWPPGUCZBJXKX-UHFFFAOYSA-N 0.000 description 2
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 2
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 2
- NIFAOMSJMGEFTQ-UHFFFAOYSA-N 4-methoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1 NIFAOMSJMGEFTQ-UHFFFAOYSA-N 0.000 description 2
- SRYILVFXQKHDGZ-UHFFFAOYSA-N 6-sulfanylidene-1,2-dihydropyridazin-3-one Chemical compound OC1=CC=C(S)N=N1 SRYILVFXQKHDGZ-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- RFFFKMOABOFIDF-UHFFFAOYSA-N Pentanenitrile Chemical compound CCCCC#N RFFFKMOABOFIDF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- 150000001356 alkyl thiols Chemical class 0.000 description 2
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- NMJJFJNHVMGPGM-UHFFFAOYSA-N butyl formate Chemical compound CCCCOC=O NMJJFJNHVMGPGM-UHFFFAOYSA-N 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- OLVCFLKTBJRLHI-AXAPSJFSSA-N cefamandole Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)[C@H](O)C=3C=CC=CC=3)[C@H]2SC1 OLVCFLKTBJRLHI-AXAPSJFSSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229960001701 chloroform Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- MLFHJEHSLIIPHL-UHFFFAOYSA-N isoamyl acetate Chemical compound CC(C)CCOC(C)=O MLFHJEHSLIIPHL-UHFFFAOYSA-N 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 2
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical class [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 229940090181 propyl acetate Drugs 0.000 description 2
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propyl mercaptan Natural products CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- ZNLABNPTWSKGDX-UHFFFAOYSA-N (2-chloro-2-oxo-1-phenylethyl) formate Chemical compound O=COC(C(=O)Cl)C1=CC=CC=C1 ZNLABNPTWSKGDX-UHFFFAOYSA-N 0.000 description 1
- NLDLXEAUMGUSPX-UHFFFAOYSA-N (5-sulfanylidene-2h-tetrazol-1-yl)methanesulfonic acid Chemical compound OS(=O)(=O)CN1N=NN=C1S NLDLXEAUMGUSPX-UHFFFAOYSA-N 0.000 description 1
- XGCZJDZFYNKVIK-SBXXRYSUSA-N (6R)-3-(methylsulfanylmethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CSCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CC=1SC=CC=1)=O)=O XGCZJDZFYNKVIK-SBXXRYSUSA-N 0.000 description 1
- HEOFYAAFCHLUBT-FQNRMIAFSA-N (6R)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CSC1=CC=CC=C1)=O)=O HEOFYAAFCHLUBT-FQNRMIAFSA-N 0.000 description 1
- RLWSFGQABHEBSY-JHANDDDOSA-N (6R)-4-[[5-(butoxycarbonylamino)-5-carboxypentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(CCC)OC(=O)NC(CCCC(=O)NC1S[C@H]2N(C(=C1)C(=O)O)C(C2)=O)C(=O)O RLWSFGQABHEBSY-JHANDDDOSA-N 0.000 description 1
- ATRVTPIMLOGPGR-FFFFSGIJSA-N (6R)-7-(3-chloropropanoylamino)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NN=C(S1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CCCl)=O)=O ATRVTPIMLOGPGR-FFFFSGIJSA-N 0.000 description 1
- XAIVNHVZXXGSAM-TYJKZOGGSA-N (6R)-7-[(5-benzamido-5-carboxypentanoyl)amino]-3-(carbamimidoylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(N)(=N)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CCCC(C(=O)O)NC(C1=CC=CC=C1)=O)=O)=O XAIVNHVZXXGSAM-TYJKZOGGSA-N 0.000 description 1
- AGKWVNYBBKMVJW-SDDNFHFQSA-N (6R)-7-[(5-benzamido-5-carboxypentanoyl)amino]-3-[(4-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC=1C(N(C(=NN=1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CCCC(C(=O)O)NC(C1=CC=CC=C1)=O)=O)=O)C)=O AGKWVNYBBKMVJW-SDDNFHFQSA-N 0.000 description 1
- QEPIBSSOIKEEMJ-AEJJIKPWSA-N (6R)-7-[(5-benzamido-5-carboxypentanoyl)amino]-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NN=C(O1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CCCC(C(=O)O)NC(C1=CC=CC=C1)=O)=O)=O QEPIBSSOIKEEMJ-AEJJIKPWSA-N 0.000 description 1
- RDRJUKIQXXOOQO-KDDGLUCOSA-N (6R)-7-[(5-benzamido-5-carboxypentanoyl)amino]-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)(O)CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CCCC(C(=O)O)NC(C1=CC=CC=C1)=O)=O)=O RDRJUKIQXXOOQO-KDDGLUCOSA-N 0.000 description 1
- UMDDKKHWYIUXNM-SYYXXDDXSA-N (6R)-7-[(5-benzamido-5-carboxypentanoyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2(NC(CCCC(C(=O)O)NC(C1=CC=CC=C1)=O)=O)OC)=O UMDDKKHWYIUXNM-SYYXXDDXSA-N 0.000 description 1
- PMQUGDLDEBRUNW-BXINMOFBSA-N (6R)-7-[(5-benzamido-5-carboxypentanoyl)amino]-7-methoxy-3-[(4-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC=1C(N(C(=NN=1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2(NC(CCCC(C(=O)O)NC(C1=CC=CC=C1)=O)=O)OC)=O)C)=O PMQUGDLDEBRUNW-BXINMOFBSA-N 0.000 description 1
- DNSWHEPNPLYYTF-OTOKDRCRSA-N (6R)-7-[[2-methoxyimino-2-[2-[(4-nitrophenyl)methoxycarbonylamino]-1,3-thiazol-4-yl]acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(C(=NOC)C=1N=C(SC=1)NC(=O)OCC1=CC=C(C=C1)[N+](=O)[O-])=O)=O DNSWHEPNPLYYTF-OTOKDRCRSA-N 0.000 description 1
- ODYICZJSIZTUON-IJGSQOGDSA-N (6R)-7-[[5-(butoxycarbonylamino)-5-carboxypentanoyl]amino]-3-(carbamimidoylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(N)(=N)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CCCC(C(=O)O)NC(=O)OCCCC)=O)=O ODYICZJSIZTUON-IJGSQOGDSA-N 0.000 description 1
- YNUIATRDFRHAIH-CWZMJNCASA-N (6R)-7-[[5-[(2,4-dichlorobenzoyl)amino]-6-methoxy-6-oxohexanoyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NN=C(S1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CCCC(NC(C1=C(C=C(C=C1)Cl)Cl)=O)C(=O)OC)=O)=O YNUIATRDFRHAIH-CWZMJNCASA-N 0.000 description 1
- NZAAOFQSJONDJB-FBMWCMRBSA-N (6R)-8-oxo-3-(tetrazolo[1,5-b]pyridazin-6-ylsulfanylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N=1N=NN2N=C(C=CC2=1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CC=1SC=CC=1)=O)=O NZAAOFQSJONDJB-FBMWCMRBSA-N 0.000 description 1
- DGUNWOQQZWDUQQ-AVKWCDSFSA-N (6R)-8-oxo-3-[[5-(phenylmethoxycarbonylaminomethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C1=CC=CC=C1)OC(=O)NCC1=NNC(=N1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2NC(CC=1SC=CC=1)=O)=O DGUNWOQQZWDUQQ-AVKWCDSFSA-N 0.000 description 1
- PBKMWLIHDXJIBT-FBMWCMRBSA-N (6r)-3-(cyclobutanecarbonyloxymethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2COC(=O)C1CCC1 PBKMWLIHDXJIBT-FBMWCMRBSA-N 0.000 description 1
- SFZMUVSQMSGXRC-LRTDYKAYSA-N (6r)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-7-[[2-[2-[(4-nitrophenyl)methoxycarbonylamino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3N=C(NC(=O)OCC=4C=CC(=CC=4)[N+]([O-])=O)SC=3)[C@H]2SC1 SFZMUVSQMSGXRC-LRTDYKAYSA-N 0.000 description 1
- SIIYLUACVWUAFF-IJGSQOGDSA-N (6r)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenyl-2-sulfoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(C=3C=CC=CC=3)S(O)(=O)=O)[C@H]2SC1 SIIYLUACVWUAFF-IJGSQOGDSA-N 0.000 description 1
- FGYKFRAJEMTRRR-FQNRMIAFSA-N (6r)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3C=CC=CC=3)[C@H]2SC1 FGYKFRAJEMTRRR-FQNRMIAFSA-N 0.000 description 1
- HGXLJRWXCXSEJO-OMNKOJBGSA-N (6r)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[[2-(trifluoromethylsulfanyl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CSC(F)(F)F)[C@H]2SC1 HGXLJRWXCXSEJO-OMNKOJBGSA-N 0.000 description 1
- AYQDZBIFHYBANR-UUSAFJCLSA-N (6r)-3-[(2-methylphenyl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=CC=CC=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 AYQDZBIFHYBANR-UUSAFJCLSA-N 0.000 description 1
- CBVXHEBBFMNWLN-AVKWCDSFSA-N (6r)-3-[(3-benzyltriazol-4-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=CN=NN1CC1=CC=CC=C1 CBVXHEBBFMNWLN-AVKWCDSFSA-N 0.000 description 1
- UCKBOWWMPJFXJQ-WPZCJLIBSA-N (6r)-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NSC(SCC=2CS[C@H]3N(C(C3NC(=O)CC=3SC=CC=3)=O)C=2C(O)=O)=N1 UCKBOWWMPJFXJQ-WPZCJLIBSA-N 0.000 description 1
- WGVGPAFBOWXNCN-LRTDYKAYSA-N (6r)-3-[(4-chlorophenyl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=CC=C(Cl)C=C1 WGVGPAFBOWXNCN-LRTDYKAYSA-N 0.000 description 1
- DMGMWOFMSRBAJR-UUSAFJCLSA-N (6r)-3-[(4-methoxyphenyl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 DMGMWOFMSRBAJR-UUSAFJCLSA-N 0.000 description 1
- FRZYAGVCJMNUIJ-WPZCJLIBSA-N (6r)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 FRZYAGVCJMNUIJ-WPZCJLIBSA-N 0.000 description 1
- KWGCGAMWFHEDFW-FBMWCMRBSA-N (6r)-3-[[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylmethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN(C)CCN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC=3SC=CC=3)[C@H]2SC1 KWGCGAMWFHEDFW-FBMWCMRBSA-N 0.000 description 1
- KQJZLURCFPDHTD-LRHAYUFXSA-N (6r)-7-(1,3-dioxoisoindol-2-yl)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N3C(C4=CC=CC=C4C3=O)=O)[C@H]2SC1 KQJZLURCFPDHTD-LRHAYUFXSA-N 0.000 description 1
- YNKAQGBEMKCRJS-GSQSYGFSSA-N (6r)-7-[(2-acetyloxy-2-phenylacetyl)amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)NC(=O)C(OC(=O)C)C=2C=CC=CC=2)CC=1CSC1=NN=C(C)S1 YNKAQGBEMKCRJS-GSQSYGFSSA-N 0.000 description 1
- JEZLZCPPFVYXIV-QHDYGNBISA-N (6r)-7-[(2-cyanoacetyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CC#N)[C@H]2SC1 JEZLZCPPFVYXIV-QHDYGNBISA-N 0.000 description 1
- DGDXYRPJLDTHQU-LEHRNKBSSA-N (6r)-7-[(2-formyloxy-2-phenylacetyl)amino]-3-(1,3-oxazol-2-ylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CC=CC=1C(OC=O)C(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NC=CO1 DGDXYRPJLDTHQU-LEHRNKBSSA-N 0.000 description 1
- VDFFPBOAOLQAJV-MKTAYPAQSA-N (6r)-7-[(2-hydroxy-2-phenylacetyl)amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(O)C=3C=CC=CC=3)[C@H]2SC1 VDFFPBOAOLQAJV-MKTAYPAQSA-N 0.000 description 1
- INJKOVISLMUZQP-QHDYGNBISA-N (6r)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)OC(C)(C)C)[C@H]2SC1 INJKOVISLMUZQP-QHDYGNBISA-N 0.000 description 1
- XGIWMSBIHJMIFX-ZEPSKSRBSA-N (6r)-7-[[2-(carbamoylamino)-2-phenylacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)C(NC(N)=O)C=3C=CC=CC=3)[C@H]2SC1 XGIWMSBIHJMIFX-ZEPSKSRBSA-N 0.000 description 1
- HRNAAEHNTDTJBB-FFFFSGIJSA-N (6r)-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CSCC#N)[C@H]2SC1 HRNAAEHNTDTJBB-FFFFSGIJSA-N 0.000 description 1
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 1
- HATMDKMNOIJXRA-IURRXHLWSA-N (6r)-7-methoxy-3-[(4-methyl-5,6-dioxo-1h-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(CSC=3N(C(=O)C(=O)NN=3)C)=C(C(O)=O)N1C(=O)C2(OC)NC(=O)CN1C=NN=N1 HATMDKMNOIJXRA-IURRXHLWSA-N 0.000 description 1
- DGPRSHDQCQEVEV-PUODRLBUSA-N (6r)-7-methoxy-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-3-(1h-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(CSC=3NN=CN=3)=C(C(O)=O)N1C(=O)C2(OC)NC(=O)CN1C=NN=N1 DGPRSHDQCQEVEV-PUODRLBUSA-N 0.000 description 1
- LEUZOVDQTJQABX-JLOHTSLTSA-N (6r)-8-oxo-3-(2h-tetrazol-5-ylsulfanylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC=1N=NNN=1 LEUZOVDQTJQABX-JLOHTSLTSA-N 0.000 description 1
- NUKQRQIHNJTIPS-LRTDYKAYSA-N (6r)-8-oxo-3-(phenylsulfanylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=CC=CC=C1 NUKQRQIHNJTIPS-LRTDYKAYSA-N 0.000 description 1
- VPEFJRAQWPSMOP-FQNRMIAFSA-N (6r)-8-oxo-3-(propanoyloxymethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)COC(=O)CC)C(O)=O)NC(=O)CC1=CC=CS1 VPEFJRAQWPSMOP-FQNRMIAFSA-N 0.000 description 1
- DKHLBUPCOKTGNQ-FFFFSGIJSA-N (6r)-8-oxo-3-[(6-oxo-1h-pyridazin-3-yl)sulfanylmethyl]-7-(2,2,2-trichloroethoxycarbonylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClC(Cl)(Cl)COC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC=1C=CC(=O)NN=1 DKHLBUPCOKTGNQ-FFFFSGIJSA-N 0.000 description 1
- GFPQDWMGPSIOBT-FBMWCMRBSA-N (6r)-8-oxo-3-[(6-oxo-1h-pyridazin-3-yl)sulfanylmethyl]-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC=1C=CC(=O)NN=1 GFPQDWMGPSIOBT-FBMWCMRBSA-N 0.000 description 1
- DGOUJJSVYKEJKS-TVKKRMFBSA-N (6r)-8-oxo-4-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H]1S2)C(=O)N1C(C(=O)O)=CC2NC(=O)CC1=CC=CS1 DGOUJJSVYKEJKS-TVKKRMFBSA-N 0.000 description 1
- VTKCZXODCRDHIU-TVKKRMFBSA-N (6r)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@H]2SCC=C(N2C1=O)C(=O)O)NC(=O)CC1=CC=CS1 VTKCZXODCRDHIU-TVKKRMFBSA-N 0.000 description 1
- HPNPXNUAIRGSKT-HIYAZECZSA-N (6r,7s)-7-[[2-(carbamoylamino)-2-thiophen-2-ylacetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N([C@]1(OC)C(N2C(=C(CSC=3N(N=NN=3)C)CS[C@@H]21)C(O)=O)=O)C(=O)C(NC(N)=O)C1=CC=CS1 HPNPXNUAIRGSKT-HIYAZECZSA-N 0.000 description 1
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 1
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 description 1
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 1
- KREOCUNMMFZOOS-UHFFFAOYSA-N 1,3-di(propan-2-yl)thiourea Chemical compound CC(C)NC(S)=NC(C)C KREOCUNMMFZOOS-UHFFFAOYSA-N 0.000 description 1
- WSAIKWBIEKCYFN-UHFFFAOYSA-N 1,5-dimethyl-1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound CC1=NC(S)=NN1C WSAIKWBIEKCYFN-UHFFFAOYSA-N 0.000 description 1
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical compound N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 description 1
- KPUKRKAPMFWIBV-UHFFFAOYSA-N 1-benzyl-2h-tetrazole-5-thione Chemical compound SC1=NN=NN1CC1=CC=CC=C1 KPUKRKAPMFWIBV-UHFFFAOYSA-N 0.000 description 1
- VRDSRXVCRBMZOD-UHFFFAOYSA-N 1-benzyltriazole Chemical compound C1=CN=NN1CC1=CC=CC=C1 VRDSRXVCRBMZOD-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- WJIFKOVZNJTSGO-UHFFFAOYSA-N 1-bromo-3-methylbenzene Chemical compound CC1=CC=CC(Br)=C1 WJIFKOVZNJTSGO-UHFFFAOYSA-N 0.000 description 1
- BYLAWYTWAYOBDP-UHFFFAOYSA-N 1-chlorobutane Chemical compound [CH2]CCCCl BYLAWYTWAYOBDP-UHFFFAOYSA-N 0.000 description 1
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-chloropentane Chemical compound CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 1
- PZHIWRCQKBBTOW-UHFFFAOYSA-N 1-ethoxybutane Chemical group CCCCOCC PZHIWRCQKBBTOW-UHFFFAOYSA-N 0.000 description 1
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical class CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- LXYHDGHYFGKBMN-UHFFFAOYSA-N 1-methyl-5-methylsulfanyltetrazole Chemical compound CSC1=NN=NN1C LXYHDGHYFGKBMN-UHFFFAOYSA-N 0.000 description 1
- OMAFFHIGWTVZOH-UHFFFAOYSA-N 1-methyltetrazole Chemical compound CN1C=NN=N1 OMAFFHIGWTVZOH-UHFFFAOYSA-N 0.000 description 1
- JUZHDRZOQVECPH-UHFFFAOYSA-N 1-nitropropane Chemical compound [CH2]CC[N+]([O-])=O JUZHDRZOQVECPH-UHFFFAOYSA-N 0.000 description 1
- AOPDRZXCEAKHHW-UHFFFAOYSA-N 1-pentoxypentane Chemical compound CCCCCOCCCCC AOPDRZXCEAKHHW-UHFFFAOYSA-N 0.000 description 1
- JBGWMRAMUROVND-UHFFFAOYSA-N 1-sulfanylidenethiophene Chemical compound S=S1C=CC=C1 JBGWMRAMUROVND-UHFFFAOYSA-N 0.000 description 1
- UTWZHANFVKEHLE-UHFFFAOYSA-N 1h-1,2,4,5-tetrazine-6-thione Chemical compound SC1=NN=CN=N1 UTWZHANFVKEHLE-UHFFFAOYSA-N 0.000 description 1
- RBYFKCAAFQIZAQ-UHFFFAOYSA-N 1h-1,3,5-triazine-2-thione Chemical compound S=C1N=CN=CN1 RBYFKCAAFQIZAQ-UHFFFAOYSA-N 0.000 description 1
- HKAVADYDPYUPRD-UHFFFAOYSA-N 1h-pyrazine-2-thione Chemical compound SC1=CN=CC=N1 HKAVADYDPYUPRD-UHFFFAOYSA-N 0.000 description 1
- PGPALTXHBOPBSH-UHFFFAOYSA-N 1h-pyrazole;1,2-thiazole Chemical compound C=1C=NNC=1.C=1C=NSC=1 PGPALTXHBOPBSH-UHFFFAOYSA-N 0.000 description 1
- YQQSRZSUGBETRS-UHFFFAOYSA-N 1h-pyridazine-6-thione Chemical compound SC1=CC=CN=N1 YQQSRZSUGBETRS-UHFFFAOYSA-N 0.000 description 1
- CARFETJZUQORNQ-UHFFFAOYSA-N 1h-pyrrole-2-thiol Chemical compound SC1=CC=CN1 CARFETJZUQORNQ-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical class CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- QIULLHZMZMGGFH-UHFFFAOYSA-N 2,5-dichlorobenzenethiol Chemical compound SC1=CC(Cl)=CC=C1Cl QIULLHZMZMGGFH-UHFFFAOYSA-N 0.000 description 1
- LXUNZSDDXMPKLP-UHFFFAOYSA-N 2-Methylbenzenethiol Chemical compound CC1=CC=CC=C1S LXUNZSDDXMPKLP-UHFFFAOYSA-N 0.000 description 1
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- BSPCSKHALVHRSR-UHFFFAOYSA-N 2-chlorobutane Chemical compound CCC(C)Cl BSPCSKHALVHRSR-UHFFFAOYSA-N 0.000 description 1
- DDTBTEUOSOSZAJ-UHFFFAOYSA-N 2-chlorobutane;1-chloro-2-methylpropane Chemical compound CCC(C)Cl.CC(C)CCl DDTBTEUOSOSZAJ-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- LQEPMYURMYBIGE-UHFFFAOYSA-N 2-chloropentane Chemical compound [CH2]C(Cl)CCC LQEPMYURMYBIGE-UHFFFAOYSA-N 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- QTHAENTXMGYGTI-UHFFFAOYSA-N 2-hydroxy-2-nitroacetonitrile Chemical compound N#CC(O)[N+]([O-])=O QTHAENTXMGYGTI-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- RQSCFNPNNLWQBJ-UHFFFAOYSA-N 2-methyl-1,3,4-thiadiazole Chemical compound CC1=NN=CS1 RQSCFNPNNLWQBJ-UHFFFAOYSA-N 0.000 description 1
- FGLBSLMDCBOPQK-UHFFFAOYSA-N 2-nitropropane Chemical compound CC(C)[N+]([O-])=O FGLBSLMDCBOPQK-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- LYGLYFUBLZCHCT-UHFFFAOYSA-N 2h-1,2,4-oxadiazole-5-thione Chemical compound SC1=NC=NO1 LYGLYFUBLZCHCT-UHFFFAOYSA-N 0.000 description 1
- HNJZDPKMMZXSKT-UHFFFAOYSA-N 3,4-dichlorobenzenethiol Chemical compound SC1=CC=C(Cl)C(Cl)=C1 HNJZDPKMMZXSKT-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- QMVAZEHZOPDGHA-UHFFFAOYSA-N 3-methoxybenzenethiol Chemical compound COC1=CC=CC(S)=C1 QMVAZEHZOPDGHA-UHFFFAOYSA-N 0.000 description 1
- FZAXBPZVVJOFKX-UHFFFAOYSA-N 3-methyl-1,2,4-oxadiazole Chemical compound CC=1N=CON=1 FZAXBPZVVJOFKX-UHFFFAOYSA-N 0.000 description 1
- JBOYAGICRPDZIA-UHFFFAOYSA-N 3h-1,3-benzothiazole-2-thione;1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(=S)NC2=C1.C1=CC=C2SC(=S)NC2=C1 JBOYAGICRPDZIA-UHFFFAOYSA-N 0.000 description 1
- CYDQOEWLBCCFJZ-UHFFFAOYSA-N 4-(4-fluorophenyl)oxane-4-carboxylic acid Chemical compound C=1C=C(F)C=CC=1C1(C(=O)O)CCOCC1 CYDQOEWLBCCFJZ-UHFFFAOYSA-N 0.000 description 1
- OKIHXNKYYGUVTE-UHFFFAOYSA-N 4-Fluorothiophenol Chemical compound FC1=CC=C(S)C=C1 OKIHXNKYYGUVTE-UHFFFAOYSA-N 0.000 description 1
- UNDXPKDBFOOQFC-UHFFFAOYSA-N 4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC=C1N1CCOCC1 UNDXPKDBFOOQFC-UHFFFAOYSA-N 0.000 description 1
- LZJWLHDEWPQTPL-UHFFFAOYSA-N 4-bromo-3-methylbenzenethiol Chemical compound CC1=CC(S)=CC=C1Br LZJWLHDEWPQTPL-UHFFFAOYSA-N 0.000 description 1
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- UQUDZKOREXYFDJ-UHFFFAOYSA-N 4-methyl-1,2,4-triazol-3-amine Chemical compound CN1C=NN=C1N UQUDZKOREXYFDJ-UHFFFAOYSA-N 0.000 description 1
- HUZASKHMPBJXJP-UHFFFAOYSA-N 4-methyl-3-(trifluoromethyl)-1h-1,2,4-triazole-5-thione Chemical compound CN1C(C(F)(F)F)=NNC1=S HUZASKHMPBJXJP-UHFFFAOYSA-N 0.000 description 1
- FDZKDNZAWDUCCO-UHFFFAOYSA-N 4-methyl-5-sulfanylidene-1,2,4-triazolidin-3-one Chemical compound CN1C(O)=NN=C1S FDZKDNZAWDUCCO-UHFFFAOYSA-N 0.000 description 1
- LHTOVJHYUSQYEI-UHFFFAOYSA-N 4-methyl-5-sulfanylidene-1h-1,2,4-triazole-3-carboxamide Chemical compound CN1C(S)=NN=C1C(N)=O LHTOVJHYUSQYEI-UHFFFAOYSA-N 0.000 description 1
- WLHCBQAPPJAULW-UHFFFAOYSA-N 4-methylbenzenethiol Chemical compound CC1=CC=C(S)C=C1 WLHCBQAPPJAULW-UHFFFAOYSA-N 0.000 description 1
- AXBVSRMHOPMXBA-UHFFFAOYSA-N 4-nitrothiophenol Chemical compound [O-][N+](=O)C1=CC=C(S)C=C1 AXBVSRMHOPMXBA-UHFFFAOYSA-N 0.000 description 1
- CFWGYKRJMYXYND-UHFFFAOYSA-N 5-methylsulfanyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CSC1=NN=C(S)S1 CFWGYKRJMYXYND-UHFFFAOYSA-N 0.000 description 1
- QRYPLYMBHJGACD-UHFFFAOYSA-N 5h-tetrazolo[1,5-b]pyridazine-6-thione Chemical compound N1=C(S)C=CC2=NN=NN21 QRYPLYMBHJGACD-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 101100138673 Arabidopsis thaliana NPF3.1 gene Proteins 0.000 description 1
- 101100439665 Arabidopsis thaliana SWI2 gene Proteins 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DMUQEABSXZGXOT-UHFFFAOYSA-N C1(=CC=CC=C1)S.CC(CS)C.CC(CC)S Chemical class C1(=CC=CC=C1)S.CC(CS)C.CC(CC)S DMUQEABSXZGXOT-UHFFFAOYSA-N 0.000 description 1
- MMLZESSEYRXSCP-UHFFFAOYSA-N CC(O)=O.CCC(O)=O.CCCC(O)=O.CC(C)C(O)=O.CCCCC(O)=O Chemical compound CC(O)=O.CCC(O)=O.CCCC(O)=O.CC(C)C(O)=O.CCCCC(O)=O MMLZESSEYRXSCP-UHFFFAOYSA-N 0.000 description 1
- UQLLWWBDSUHNEB-CZUORRHYSA-N Cefaprin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CSC1=CC=NC=C1 UQLLWWBDSUHNEB-CZUORRHYSA-N 0.000 description 1
- QYQDKDWGWDOFFU-IUODEOHRSA-N Cefotiam Chemical compound CN(C)CCN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CC=3N=C(N)SC=3)[C@H]2SC1 QYQDKDWGWDOFFU-IUODEOHRSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JGFBQFKZKSSODQ-UHFFFAOYSA-N Isothiocyanatocyclopropane Chemical compound S=C=NC1CC1 JGFBQFKZKSSODQ-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- JXORQWJDQFPULB-UHFFFAOYSA-N N1=NC=NN=C1.N1=NN=NC=C1.N1=CN=CN=C1.N1=NC=NC=C1.N1=NN=CC=C1.N1=CC=NC=C1.N1=CN=CC=C1.N1=NC=CC=C1.N1=CC=CC=C1 Chemical compound N1=NC=NN=C1.N1=NN=NC=C1.N1=CN=CN=C1.N1=NC=NC=C1.N1=NN=CC=C1.N1=CC=NC=C1.N1=CN=CC=C1.N1=NC=CC=C1.N1=CC=CC=C1 JXORQWJDQFPULB-UHFFFAOYSA-N 0.000 description 1
- SQZGZLVEYFEXHS-UHFFFAOYSA-N O1N=CC=C1.O1C=NC=C1.N1C=CC=C1 Chemical compound O1N=CC=C1.O1C=NC=C1.N1C=CC=C1 SQZGZLVEYFEXHS-UHFFFAOYSA-N 0.000 description 1
- 229910004727 OSO3H Inorganic materials 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- 241000183024 Populus tremula Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- KZXIQMSWVSTGQX-UHFFFAOYSA-N SC1=CN=NS1 Chemical compound SC1=CN=NS1 KZXIQMSWVSTGQX-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- CUILWARXLARWLY-UHFFFAOYSA-N [N+](=O)([O-])CCC.[N+](=O)([O-])CC.[N+](=O)([O-])C.[N+](=O)([O-])C1=CC=CC=C1 Chemical compound [N+](=O)([O-])CCC.[N+](=O)([O-])CC.[N+](=O)([O-])C.[N+](=O)([O-])C1=CC=CC=C1 CUILWARXLARWLY-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- HTKFORQRBXIQHD-UHFFFAOYSA-N allylthiourea Chemical compound NC(=S)NCC=C HTKFORQRBXIQHD-UHFFFAOYSA-N 0.000 description 1
- 229960001748 allylthiourea Drugs 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- DALDUXIBIKGWTK-UHFFFAOYSA-N benzene;toluene Chemical compound C1=CC=CC=C1.CC1=CC=CC=C1 DALDUXIBIKGWTK-UHFFFAOYSA-N 0.000 description 1
- 229940007550 benzyl acetate Drugs 0.000 description 1
- IGCVDZPSYBWJGY-UHFFFAOYSA-N benzyl n-[(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)methyl]carbamate Chemical compound N1C(S)=NC(CNC(=O)OCC=2C=CC=CC=2)=N1 IGCVDZPSYBWJGY-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- FFKJPPDHFPWNMJ-UHFFFAOYSA-N butanenitrile;propanenitrile Chemical compound CCC#N.CCCC#N FFKJPPDHFPWNMJ-UHFFFAOYSA-N 0.000 description 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 1
- 229940043232 butyl acetate Drugs 0.000 description 1
- PEZDWJIWGKFHQA-UHFFFAOYSA-N butyl acetate 2-methylpropyl acetate propan-2-yl acetate Chemical compound C(C)(=O)OCC(C)C.C(C)(=O)OCCCC.C(C)(C)OC(C)=O PEZDWJIWGKFHQA-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PWLNAUNEAKQYLH-UHFFFAOYSA-N butyric acid octyl ester Natural products CCCCCCCCOC(=O)CCC PWLNAUNEAKQYLH-UHFFFAOYSA-N 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229940095672 calcium sulfate Drugs 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229960003012 cefamandole Drugs 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- SNBUBQHDYVFSQF-HIFRSBDPSA-N cefmetazole Chemical compound S([C@@H]1[C@@](C(N1C=1C(O)=O)=O)(NC(=O)CSCC#N)OC)CC=1CSC1=NN=NN1C SNBUBQHDYVFSQF-HIFRSBDPSA-N 0.000 description 1
- NAXFZVGOZUWLEP-RFXDPDBWSA-L cefonicid sodium Chemical compound [Na+].[Na+].S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)[C@H](O)C=2C=CC=CC=2)CC=1CSC1=NN=NN1CS([O-])(=O)=O NAXFZVGOZUWLEP-RFXDPDBWSA-L 0.000 description 1
- DZMVCVMFETWNIU-LDYMZIIASA-N ceftezole Chemical compound O=C([C@@H](NC(=O)CN1N=NN=C1)[C@H]1SC2)N1C(C(=O)O)=C2CSC1=NN=CS1 DZMVCVMFETWNIU-LDYMZIIASA-N 0.000 description 1
- 229960004366 ceftezole Drugs 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- ARDKDZFHQUSWLT-UHFFFAOYSA-N cumene;1,3,5-trimethylbenzene Chemical compound CC(C)C1=CC=CC=C1.CC1=CC(C)=CC(C)=C1 ARDKDZFHQUSWLT-UHFFFAOYSA-N 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 229960003887 dichlorophen Drugs 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- ZDSQMVGQPFUDSW-UHFFFAOYSA-N ethanethiol;methanethiol Chemical compound SC.CCS ZDSQMVGQPFUDSW-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- IWOXNUMLIHGOKN-UHFFFAOYSA-N ethyl 2-(4-methyl-5-sulfanylidene-1h-1,2,4-triazol-3-yl)acetate Chemical compound CCOC(=O)CC1=NNC(=S)N1C IWOXNUMLIHGOKN-UHFFFAOYSA-N 0.000 description 1
- 229940093499 ethyl acetate Drugs 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000003651 hexanedioyl group Chemical group C(CCCCC(=O)*)(=O)* 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- GJRQTCIYDGXPES-UHFFFAOYSA-N iso-butyl acetate Natural products CC(C)COC(C)=O GJRQTCIYDGXPES-UHFFFAOYSA-N 0.000 description 1
- 229940117955 isoamyl acetate Drugs 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical compound CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- FGKJLKRYENPLQH-UHFFFAOYSA-M isocaproate Chemical compound CC(C)CCC([O-])=O FGKJLKRYENPLQH-UHFFFAOYSA-M 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- OQAGVSWESNCJJT-UHFFFAOYSA-N isovaleric acid methyl ester Natural products COC(=O)CC(C)C OQAGVSWESNCJJT-UHFFFAOYSA-N 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- XIXADJRWDQXREU-UHFFFAOYSA-M lithium acetate Chemical compound [Li+].CC([O-])=O XIXADJRWDQXREU-UHFFFAOYSA-M 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- IAQLJCYTGRMXMA-UHFFFAOYSA-M lithium;acetate;dihydrate Chemical compound [Li+].O.O.CC([O-])=O IAQLJCYTGRMXMA-UHFFFAOYSA-M 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000001055 magnesium Nutrition 0.000 description 1
- 229940091250 magnesium supplement Drugs 0.000 description 1
- 238000003760 magnetic stirring Methods 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- WDWDWGRYHDPSDS-UHFFFAOYSA-N methanimine Chemical group N=C WDWDWGRYHDPSDS-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 229940073584 methylene chloride Drugs 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 238000004452 microanalysis Methods 0.000 description 1
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 1
- UUIQMZJEGPQKFD-UHFFFAOYSA-N n-butyric acid methyl ester Natural products CCCC(=O)OC UUIQMZJEGPQKFD-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- VRFVYLZTDWWKBJ-UHFFFAOYSA-N oxatriazole 2H-tetrazole Chemical compound N1N=NN=C1.O1N=NN=C1 VRFVYLZTDWWKBJ-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 229930185482 poranic acid Natural products 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000012521 purified sample Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000005030 pyridylthio group Chemical group N1=C(C=CC=C1)S* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000001540 sodium lactate Substances 0.000 description 1
- 235000011088 sodium lactate Nutrition 0.000 description 1
- 229940005581 sodium lactate Drugs 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 229960002415 trichloroethylene Drugs 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US77501877A | 1977-03-07 | 1977-03-07 | |
| US775,018 | 1977-03-07 | ||
| US862,871 | 1977-12-27 | ||
| US05/862,871 US4144391A (en) | 1977-03-07 | 1977-12-27 | Cephalosporin displacement reaction |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1083141A true CA1083141A (en) | 1980-08-05 |
Family
ID=27118982
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA298,070A Expired CA1083141A (en) | 1977-03-07 | 1978-03-02 | Cephalosporin displacement reaction |
Country Status (30)
| Country | Link |
|---|---|
| JP (1) | JPS53130689A (enEXAMPLES) |
| AT (1) | AT366696B (enEXAMPLES) |
| AU (1) | AU515428B2 (enEXAMPLES) |
| BG (1) | BG31379A3 (enEXAMPLES) |
| CA (1) | CA1083141A (enEXAMPLES) |
| CH (1) | CH637964A5 (enEXAMPLES) |
| CS (1) | CS205115B2 (enEXAMPLES) |
| CY (1) | CY1196A (enEXAMPLES) |
| DD (1) | DD137356A5 (enEXAMPLES) |
| DE (1) | DE2809058A1 (enEXAMPLES) |
| DK (1) | DK97378A (enEXAMPLES) |
| EG (1) | EG13454A (enEXAMPLES) |
| ES (1) | ES467637A1 (enEXAMPLES) |
| FI (1) | FI69309C (enEXAMPLES) |
| FR (1) | FR2383189A1 (enEXAMPLES) |
| GB (1) | GB1597036A (enEXAMPLES) |
| GR (1) | GR68893B (enEXAMPLES) |
| HK (1) | HK49083A (enEXAMPLES) |
| HU (1) | HU179967B (enEXAMPLES) |
| IE (1) | IE46437B1 (enEXAMPLES) |
| IL (1) | IL54181A (enEXAMPLES) |
| IT (1) | IT1093504B (enEXAMPLES) |
| MX (1) | MX5142E (enEXAMPLES) |
| NL (1) | NL190703C (enEXAMPLES) |
| NZ (1) | NZ186610A (enEXAMPLES) |
| PH (1) | PH14596A (enEXAMPLES) |
| PL (1) | PL122152B1 (enEXAMPLES) |
| PT (1) | PT67732A (enEXAMPLES) |
| SE (1) | SE437991B (enEXAMPLES) |
| YU (1) | YU51478A (enEXAMPLES) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011103686A1 (en) * | 2010-02-26 | 2011-09-01 | Viswanatha , Sundaramma | CEPHALOSPORIN DERIVATIVES USEFUL AS β-LACTAMASE INHIBITORS AND COMPOSITIONS AND METHODS OF USE THEREOF |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5543043A (en) * | 1978-09-22 | 1980-03-26 | Sankyo Co Ltd | Preparation of 3-substituted thiomethylcephalosporin derivative |
| US4576937A (en) * | 1984-02-29 | 1986-03-18 | Smithkline Beckman Corporation | 7-D-Mandelamido-3(1-sulfomethyltetrazol-5-yl)thiomethyl-3-cephem-4-carboxylic acid monosodium salt |
| GB8519606D0 (en) * | 1985-08-05 | 1985-09-11 | Fujisawa Pharmaceutical Co | 3 7-d substituted-3-cephem compounds |
| JP2503500B2 (ja) * | 1986-04-14 | 1996-06-05 | 萬有製薬株式会社 | 新規セフアロスポリン誘導体及びその製造法 |
| JPS62281881A (ja) * | 1986-09-08 | 1987-12-07 | Sankyo Co Ltd | 3−置換チオメチルセフアロスポリン誘導体の製法 |
| GB201818410D0 (en) * | 2018-11-12 | 2018-12-26 | Imperial Innovations Ltd | Compounds |
| WO2021041583A1 (en) * | 2019-08-29 | 2021-03-04 | The Regents Of The University Of California | Compounds to identify beta-lactamases, and methods of use thereof |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
| JPS5116436B1 (enEXAMPLES) * | 1971-05-31 | 1976-05-24 | ||
| JPS5143785A (en) * | 1974-10-11 | 1976-04-14 | Yamanouchi Pharma Co Ltd | Shinsefuarosuhorinkanrenkagobutsuno goseiho |
| JPS612674B2 (enEXAMPLES) * | 1974-06-20 | 1986-01-27 | Meiji Seika Co | |
| CA1100129A (en) * | 1974-08-02 | 1981-04-28 | William H.W. Lunn | Cephalosporin compounds |
| AU1303576A (en) * | 1975-04-21 | 1977-10-20 | Erba Carlo Spa | Cephalosporins |
-
1978
- 1978-03-02 NZ NZ186610A patent/NZ186610A/xx unknown
- 1978-03-02 AT AT0150778A patent/AT366696B/de not_active IP Right Cessation
- 1978-03-02 IL IL54181A patent/IL54181A/xx unknown
- 1978-03-02 GB GB8224/78A patent/GB1597036A/en not_active Expired
- 1978-03-02 DE DE19782809058 patent/DE2809058A1/de active Granted
- 1978-03-02 CY CY1196A patent/CY1196A/xx unknown
- 1978-03-02 PT PT67732A patent/PT67732A/pt unknown
- 1978-03-02 CA CA298,070A patent/CA1083141A/en not_active Expired
- 1978-03-03 FI FI780716A patent/FI69309C/fi not_active IP Right Cessation
- 1978-03-03 FR FR7806158A patent/FR2383189A1/fr active Granted
- 1978-03-03 CH CH236178A patent/CH637964A5/de not_active IP Right Cessation
- 1978-03-03 PH PH20847A patent/PH14596A/en unknown
- 1978-03-03 DK DK97378A patent/DK97378A/da not_active Application Discontinuation
- 1978-03-03 AU AU33828/78A patent/AU515428B2/en not_active Expired
- 1978-03-03 NL NL7802376A patent/NL190703C/xx not_active IP Right Cessation
- 1978-03-03 HU HU78EI784A patent/HU179967B/hu unknown
- 1978-03-03 GR GR55608A patent/GR68893B/el unknown
- 1978-03-06 IT IT20912/78A patent/IT1093504B/it active
- 1978-03-06 IE IE453/78A patent/IE46437B1/en not_active IP Right Cessation
- 1978-03-06 MX MX786901U patent/MX5142E/es unknown
- 1978-03-06 SE SE7802530A patent/SE437991B/sv not_active IP Right Cessation
- 1978-03-06 YU YU00514/78A patent/YU51478A/xx unknown
- 1978-03-07 PL PL1978205135A patent/PL122152B1/pl unknown
- 1978-03-07 JP JP2646878A patent/JPS53130689A/ja active Granted
- 1978-03-07 ES ES467637A patent/ES467637A1/es not_active Expired
- 1978-03-07 BG BG038941A patent/BG31379A3/xx unknown
- 1978-03-07 CS CS781436A patent/CS205115B2/cs unknown
- 1978-03-07 EG EG149/78A patent/EG13454A/xx active
- 1978-03-07 DD DD78204007A patent/DD137356A5/xx not_active IP Right Cessation
-
1983
- 1983-10-27 HK HK490/83A patent/HK49083A/en not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011103686A1 (en) * | 2010-02-26 | 2011-09-01 | Viswanatha , Sundaramma | CEPHALOSPORIN DERIVATIVES USEFUL AS β-LACTAMASE INHIBITORS AND COMPOSITIONS AND METHODS OF USE THEREOF |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1316171C (en) | Cephalosporin derivatives | |
| US4421912A (en) | Cephalosporin derivatives | |
| HU177441B (en) | Process for preparing syn isomers of 3,7-disubstituted 3-cephem-4-carboxylic acid derivatives | |
| US4144391A (en) | Cephalosporin displacement reaction | |
| CA1083141A (en) | Cephalosporin displacement reaction | |
| US4048311A (en) | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl)cephalosporins | |
| US4117125A (en) | 7-Acylamino-3-[1-[2-(carboxymethylamino]ethyl) tetrazol-5-ylthiomethyl]-3-cephem-4-carboxylic acids | |
| US4101656A (en) | 7β-Acylamino-3-(alkanesulfonamidoalkyl substituted tetrazolylthiomethyl) cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| NL7907551A (nl) | Cefalosporinen; werkwijze voor de bereiding van cafalosporinen. | |
| US4117124A (en) | 7-Acylamino-3-[[3-(carboxymethyl)thio-1H-1,2,4-triazol-5-yl]thiomethyl]-3-cephem-4-carboxylic acids | |
| US4093723A (en) | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins | |
| KR830001278B1 (ko) | 세파로스포린 화합물의 제조방법 | |
| US4079134A (en) | 7-Acylamino-3-(5-sulfomethyl-1,3,4-thiadiazol-2-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| US4117123A (en) | 7-Acylamino-3-[1-(2-sulfamidoethyl)tetrazol-5-ylthiomethyl]-3-cephem-4-carboxylic acids | |
| US4174323A (en) | 1-(2-Sulfamidoethyl)-1,4-dihydro-5H-tetrazole-5-thione | |
| US4064242A (en) | 7-Acylamino-3-[1-(2,3-dihydroxypropyl)tetrazole-5-ylthiomethyl]-3-cephem-4-carboxylic acids | |
| US4229573A (en) | 7α-Methoxycephalosporin derivatives | |
| US4159373A (en) | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins | |
| US4083975A (en) | 7-Acylamino-3-(3-sulfomethyl-1,2,4-triazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| JPS5946237B2 (ja) | セフアロスポリン誘導体およびその製造法 | |
| US4210587A (en) | 7-Acylamino-3-[1-[2-(carboxymethylamino)ethyl]tetrazol-5-ylthio methyl]-3-cephem-4-carboxylic acids | |
| US4174324A (en) | 3-(Carboxymethyl)thio-1H-1,2,4-triazol-5-thione | |
| US4111981A (en) | Intermediates for preparing substituted phenylglycylcephalosporins | |
| US4379924A (en) | Cephalosporin derivatives | |
| US4963542A (en) | Cephalosporin derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |