CA1082675A - Fused ring catalyst and ethylene polymerization process therewith - Google Patents
Fused ring catalyst and ethylene polymerization process therewithInfo
- Publication number
- CA1082675A CA1082675A CA268,539A CA268539A CA1082675A CA 1082675 A CA1082675 A CA 1082675A CA 268539 A CA268539 A CA 268539A CA 1082675 A CA1082675 A CA 1082675A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- catalyst
- chromium
- cyclopentadiene
- support
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 106
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 title claims abstract description 39
- 239000005977 Ethylene Substances 0.000 title claims abstract description 39
- 238000006116 polymerization reaction Methods 0.000 title abstract description 49
- 150000001875 compounds Chemical class 0.000 claims abstract description 33
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical class C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 claims abstract description 29
- 239000001257 hydrogen Substances 0.000 claims abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 19
- 229910052809 inorganic oxide Inorganic materials 0.000 claims abstract description 11
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims abstract description 9
- OMLPWKBOTSRZOL-UHFFFAOYSA-N C1(=CC=CC=2C3=CC=CC=C3CC12)[Cr]C1=CC=CC=2C3=CC=CC=C3CC12 Chemical compound C1(=CC=CC=2C3=CC=CC=C3CC12)[Cr]C1=CC=CC=2C3=CC=CC=C3CC12 OMLPWKBOTSRZOL-UHFFFAOYSA-N 0.000 claims abstract description 5
- -1 cyclopentadiene compound Chemical class 0.000 claims description 32
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 27
- 239000002904 solvent Substances 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000178 monomer Substances 0.000 claims description 14
- 239000002685 polymerization catalyst Substances 0.000 claims description 12
- 239000000377 silicon dioxide Substances 0.000 claims description 11
- 229930195733 hydrocarbon Natural products 0.000 claims description 10
- KMDSCAWNOOGOCR-UHFFFAOYSA-N C1=CC2=CC=CC=C2C1[Cr]C1C2=CC=CC=C2C=C1 Chemical compound C1=CC2=CC=CC=C2C1[Cr]C1C2=CC=CC=C2C=C1 KMDSCAWNOOGOCR-UHFFFAOYSA-N 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 239000011651 chromium Substances 0.000 claims description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims description 5
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 5
- 239000004711 α-olefin Substances 0.000 claims description 3
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims 11
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims 11
- 229920000642 polymer Polymers 0.000 abstract description 65
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 26
- 239000002002 slurry Substances 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000000155 melt Substances 0.000 description 12
- 239000011148 porous material Substances 0.000 description 12
- 238000000151 deposition Methods 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 239000007787 solid Substances 0.000 description 7
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 6
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 150000001845 chromium compounds Chemical class 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000002574 poison Substances 0.000 description 5
- 231100000614 poison Toxicity 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 229910052804 chromium Inorganic materials 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 239000011261 inert gas Substances 0.000 description 4
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 150000002902 organometallic compounds Chemical class 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000013019 agitation Methods 0.000 description 3
- TYYBBNOTQFVVKN-UHFFFAOYSA-N chromium(2+);cyclopenta-1,3-diene Chemical compound [Cr+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 TYYBBNOTQFVVKN-UHFFFAOYSA-N 0.000 description 3
- 239000012632 extractable Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000002723 alicyclic group Chemical group 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- QWHNJUXXYKPLQM-UHFFFAOYSA-N dimethyl cyclopentane Natural products CC1(C)CCCC1 QWHNJUXXYKPLQM-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000007669 thermal treatment Methods 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- OJOWICOBYCXEKR-KRXBUXKQSA-N (5e)-5-ethylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=C/C)/CC1C=C2 OJOWICOBYCXEKR-KRXBUXKQSA-N 0.000 description 1
- PRBHEGAFLDMLAL-UHFFFAOYSA-N 1,5-Hexadiene Natural products CC=CCC=C PRBHEGAFLDMLAL-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- LFDIOPDAZWTQOV-UHFFFAOYSA-N 5-ethyldec-1-ene Chemical compound CCCCCC(CC)CCC=C LFDIOPDAZWTQOV-UHFFFAOYSA-N 0.000 description 1
- UISVEIQALKNFTF-UHFFFAOYSA-N 5-prop-2-enylnonane Chemical compound CCCCC(CC=C)CCCC UISVEIQALKNFTF-UHFFFAOYSA-N 0.000 description 1
- BSFODEXXVBBYOC-UHFFFAOYSA-N 8-[4-(dimethylamino)butan-2-ylamino]quinolin-6-ol Chemical compound C1=CN=C2C(NC(CCN(C)C)C)=CC(O)=CC2=C1 BSFODEXXVBBYOC-UHFFFAOYSA-N 0.000 description 1
- IQJRGSUQLJZPHD-UHFFFAOYSA-N CC1c2ccccc2-c2cccc([Cr]c3cccc4-c5ccccc5C(C)c34)c12 Chemical compound CC1c2ccccc2-c2cccc([Cr]c3cccc4-c5ccccc5C(C)c34)c12 IQJRGSUQLJZPHD-UHFFFAOYSA-N 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010981 drying operation Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical compound C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000005007 materials handling Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000005673 monoalkenes Chemical class 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000037048 polymerization activity Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 238000003878 thermal aging Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F10/02—Ethene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US644,814 | 1975-12-29 | ||
| US05/644,814 US4015059A (en) | 1975-12-29 | 1975-12-29 | Fused ring catalyst and ethylene polymerization process therewith |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1082675A true CA1082675A (en) | 1980-07-29 |
Family
ID=24586446
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA268,539A Expired CA1082675A (en) | 1975-12-29 | 1976-12-22 | Fused ring catalyst and ethylene polymerization process therewith |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4015059A (enExample) |
| JP (1) | JPS5282692A (enExample) |
| AU (1) | AU502532B2 (enExample) |
| BE (1) | BE849917A (enExample) |
| CA (1) | CA1082675A (enExample) |
| DE (1) | DE2659166C2 (enExample) |
| ES (1) | ES454633A1 (enExample) |
| FR (1) | FR2337145A1 (enExample) |
| GB (1) | GB1561910A (enExample) |
| IT (1) | IT1067035B (enExample) |
| NL (1) | NL178602C (enExample) |
| SE (1) | SE431555B (enExample) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4077904A (en) * | 1976-06-29 | 1978-03-07 | Union Carbide Corporation | Olefin polymerization process and catalyst therefor |
| US4170589A (en) * | 1978-02-22 | 1979-10-09 | Union Carbide Corporation | Catalytic polymerization of ethylene with supported chromium [II] catalyst in the presence of a phenolic antioxidant |
| US4368301A (en) * | 1979-12-14 | 1983-01-11 | Phillips Petroleum Company | Solubilized chromium salt in polymerization catalyst |
| US4364841A (en) | 1980-12-31 | 1982-12-21 | Phillips Petroleum Company | Phosphate containing support with zerovalent chromium |
| US4444968A (en) * | 1980-12-31 | 1984-04-24 | Phillips Petroleum Company | Olefin polymerization with phosphate supported zerovalent chromium |
| US4526942A (en) * | 1981-09-24 | 1985-07-02 | Mobil Oil Corporation | Catalyst for olefin polymerization |
| AU555386B2 (en) * | 1981-09-24 | 1986-09-25 | Mobil Oil Corp. | Organo-metallic-zeolite catalyst |
| US4377497A (en) * | 1981-09-24 | 1983-03-22 | Mobil Oil Corporation | Catalyst for olefin polymerization |
| US4803253A (en) * | 1982-03-30 | 1989-02-07 | Phillips Petroleum Company | Ethylene polymer produced using a catalyst comprising a phosphate and with a bis-(cyclopentadienyl)chromium(II) compound |
| US5418200A (en) * | 1991-03-29 | 1995-05-23 | Chevron Chemical Company | Cyclopentadienyl group 6B metal α-olefin polymerization catalysts and process for polymerizing α-olefins |
| ATE153034T1 (de) * | 1991-03-29 | 1997-05-15 | Chevron Usa Inc | Cyclopentadienylgruppe enthaltende alpha-olefin- polymerisationskatalysatoren auf basis eines metals der 6b-gruppe und verfahren zur polymerisation von alpha-olefinen |
| US5436305A (en) * | 1991-05-09 | 1995-07-25 | Phillips Petroleum Company | Organometallic fluorenyl compounds, preparation, and use |
| CA2067525C (en) * | 1991-05-09 | 1998-09-15 | Helmut G. Alt | Organometallic fluorenyl compounds, preparation and use |
| US5399636A (en) * | 1993-06-11 | 1995-03-21 | Phillips Petroleum Company | Metallocenes and processes therefor and therewith |
| DE69210480T2 (de) * | 1991-06-27 | 1996-11-28 | Nippon Oil Co Ltd | Katalysatorbestandteil für die Olefinpolymerisation |
| US5276115A (en) * | 1992-12-14 | 1994-01-04 | Phillips Petroleum Company | Mono-1-olefin polymerization in the presence of hydrogen and a cyclopentadienyl compound |
| DE4306105A1 (de) * | 1993-02-27 | 1994-09-01 | Basf Ag | Modifizierte geträgerte Chromocen-Katalysatorsysteme |
| CA2120852C (en) * | 1993-06-03 | 1998-10-13 | Konstantinos Patsidis | 9-substituted fluorenyl compounds and the preparation and use of metallocenes thereof |
| DE4323192A1 (de) * | 1993-07-10 | 1995-01-12 | Basf Ag | Verfahren zur Herstellung von Homo- und Copolymerisaten von Alk-1-enen |
| US5593931A (en) * | 1995-03-03 | 1997-01-14 | Chevron Chemical Company | Cyclopentadienyl group 6b metal alpha-olefin polymerization catalysts and process for polymerizing alpha-olefins |
| NO300220B1 (no) | 1996-01-26 | 1997-04-28 | Borealis As | Fremgangsmåte og katalysatorsystem for polymerisering av etylen, eventuelt sammen med <alfa>-olefiner, og fremstilt polymermateriale |
| US6255418B1 (en) | 1996-07-30 | 2001-07-03 | Studiengesellschaft Kohle Mbh | Catalysts containing organochromium compounds and their use for polymerizing alkenes |
| DE19637669A1 (de) | 1996-09-16 | 1998-03-19 | Hoechst Ag | Verfahren zur Herstellung einer methylenverbrückten Biscyclopentadienylverbindung |
| DE19833858C2 (de) * | 1998-07-28 | 2000-06-08 | Elenac Gmbh | Geruchsarme Polyethylen-Blends |
| DE19935592A1 (de) | 1999-08-02 | 2001-02-08 | Elenac Gmbh | Imidochromverbindungen in Katalysatorsystemen für die Olefinpolymerisation |
| US6437161B1 (en) * | 1999-08-13 | 2002-08-20 | Basf Aktiengesellschaft | Monocyclopentadienyl complexes of chromium, molybdenum or tungsten |
| GB0021301D0 (en) * | 2000-08-30 | 2000-10-18 | Borealis Tech Oy | Supported catalyst |
| US20060089253A1 (en) * | 2002-08-13 | 2006-04-27 | Shahram Mihan | Monocyclopentadienyl complexes |
| DE60314262T2 (de) | 2002-08-22 | 2008-01-31 | Basell Polyolefine Gmbh | Monocyclopentadienylkomplexe |
| WO2004056481A1 (en) * | 2002-12-20 | 2004-07-08 | Basell Polyolefine Gmbh | Monocyclopentadienyl complexes |
| KR20060118552A (ko) * | 2003-12-16 | 2006-11-23 | 바젤 폴리올레핀 게엠베하 | 모노시클로펜타디에닐 착물 |
| WO2005058983A2 (en) * | 2003-12-19 | 2005-06-30 | Basell Polyolefine Gmbh | Monocyclopentadienyl complexes |
| US7307133B2 (en) * | 2004-04-22 | 2007-12-11 | Chevron Phillips Chemical Company Lp | Polymers having broad molecular weight distributions and methods of making the same |
| US6977235B2 (en) * | 2004-04-22 | 2005-12-20 | Chevron Phillips Chemical Company, Lp | Catalyst systems comprising a calcined chromium catalyst and a non-transition metal cyclopentadienyl cocatalyst |
| DE102004039877A1 (de) * | 2004-08-17 | 2006-02-23 | Basell Polyolefine Gmbh | Silylhalogenidsubstituierte Cyclopentadienylkomplexe der Gruppe 6 |
| DE102004061618A1 (de) * | 2004-12-17 | 2006-06-22 | Basell Polyolefine Gmbh | Monocyclopentadienylkomplexe |
| DE102005014395A1 (de) * | 2005-03-24 | 2006-09-28 | Basell Polyolefine Gmbh | Monocyclopentadienylkomplexe |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3806500A (en) * | 1972-07-21 | 1974-04-23 | Union Carbide Corp | Polymerization with thermally aged catalyst |
-
1975
- 1975-12-29 US US05/644,814 patent/US4015059A/en not_active Expired - Lifetime
-
1976
- 1976-12-22 CA CA268,539A patent/CA1082675A/en not_active Expired
- 1976-12-24 GB GB54167/76A patent/GB1561910A/en not_active Expired
- 1976-12-28 DE DE2659166A patent/DE2659166C2/de not_active Expired
- 1976-12-28 FR FR7639316A patent/FR2337145A1/fr active Granted
- 1976-12-28 JP JP15765776A patent/JPS5282692A/ja active Granted
- 1976-12-28 BE BE173689A patent/BE849917A/xx not_active IP Right Cessation
- 1976-12-28 ES ES454633A patent/ES454633A1/es not_active Expired
- 1976-12-28 SE SE7614640A patent/SE431555B/sv not_active IP Right Cessation
- 1976-12-28 IT IT30916/76A patent/IT1067035B/it active
- 1976-12-28 NL NLAANVRAGE7614484,A patent/NL178602C/xx not_active IP Right Cessation
- 1976-12-30 AU AU20970/76A patent/AU502532B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4015059A (en) | 1977-03-29 |
| FR2337145B1 (enExample) | 1981-01-09 |
| ES454633A1 (es) | 1977-12-01 |
| JPS558086B2 (enExample) | 1980-03-01 |
| AU2097076A (en) | 1978-07-06 |
| SE7614640L (sv) | 1977-06-30 |
| GB1561910A (en) | 1980-03-05 |
| DE2659166C2 (de) | 1984-04-26 |
| IT1067035B (it) | 1985-03-12 |
| DE2659166A1 (de) | 1977-06-30 |
| NL7614484A (nl) | 1977-07-01 |
| BE849917A (fr) | 1977-06-28 |
| FR2337145A1 (fr) | 1977-07-29 |
| NL178602C (nl) | 1986-04-16 |
| SE431555B (sv) | 1984-02-13 |
| JPS5282692A (en) | 1977-07-11 |
| AU502532B2 (en) | 1979-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1082675A (en) | Fused ring catalyst and ethylene polymerization process therewith | |
| US4100337A (en) | Olefin polymerization process and catalyst therefor | |
| EP0802203B1 (en) | Catalytic system for the polymerization of alpha-olefins in suspension, in gas phase at low and high temperature or in a mass at high pressure and high or low temperature | |
| US4374753A (en) | Polymerization catalyst and method | |
| EP0879250B1 (en) | Improved supported metallocene catalyst systems | |
| US3709954A (en) | Preparation of liquid polymers of olefins | |
| EP0120501B1 (en) | Ethylene polymerization using supported vanadium catalyst | |
| JPH10508631A (ja) | 反応器の汚染を防止するための方法と触媒 | |
| CA2141616A1 (en) | Gas phase polymerization of ethylene and c to c olefins | |
| CA2038745A1 (en) | Supported polyolefin catalyst for the (co-) polymerization of ethylene in gas phase | |
| EP0003836B1 (en) | Catalytic polymerization of ethylene with chromium(ii) catalyst in the presence of a phenolic antioxidant and product obtained | |
| US5260245A (en) | High activity polyethylene catalysts | |
| KR20020091084A (ko) | 삼원공중합체 | |
| CA2259905C (en) | Olefin polymerization process with alkyl-substituted metallocenes | |
| US3757002A (en) | Pported diarene chromium compounds catalytic polymerization of olefins using cyclopentadiene modified su | |
| CA2227248A1 (en) | Polymers of ethylene having a high environmental stress crack resistance | |
| US4065612A (en) | Phenol modified polymerization catalyst and polymerization process | |
| CA1087595A (en) | Silica support, catalyst and processes | |
| EP0658571A2 (en) | Olefin polymerization process, catalyst system, and polymer | |
| EP0910470A4 (en) | HIGH ACTIVITY CATALYSTS FOR PRODUCING POLYETHYLENE WITH MEDIUM MOLECULAR WEIGHT DISTRIBUTION | |
| JPH04331204A (ja) | 高活性のバナジウム基材触媒 | |
| AU666239B2 (en) | Process for preparing a catalyst composition | |
| US3813381A (en) | Ethylene polymerization with ammonia modified catalyst | |
| AU700892B2 (en) | Catalyst for the manufacture of polyethylene with a narrow molecular weight distribution |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |