CA1076321A - Process for manufacturing chlorine dioxide - Google Patents
Process for manufacturing chlorine dioxideInfo
- Publication number
- CA1076321A CA1076321A CA263,089A CA263089A CA1076321A CA 1076321 A CA1076321 A CA 1076321A CA 263089 A CA263089 A CA 263089A CA 1076321 A CA1076321 A CA 1076321A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- beta
- complex catalyst
- chlorate
- ion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 title claims abstract description 34
- 238000000034 method Methods 0.000 title claims abstract description 34
- 239000004155 Chlorine dioxide Substances 0.000 title claims abstract description 17
- 235000019398 chlorine dioxide Nutrition 0.000 title claims abstract description 17
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 5
- 239000003054 catalyst Substances 0.000 claims abstract description 30
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims abstract description 18
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 claims abstract description 16
- 239000002253 acid Substances 0.000 claims abstract description 12
- 239000012429 reaction media Substances 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 15
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 claims description 4
- -1 alkyl radical Chemical class 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 claims description 3
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical group CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- YALMXYPQBUJUME-UHFFFAOYSA-L calcium chlorate Chemical compound [Ca+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O YALMXYPQBUJUME-UHFFFAOYSA-L 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- RVPVRDXYQKGNMQ-UHFFFAOYSA-N lead(2+) Chemical compound [Pb+2] RVPVRDXYQKGNMQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910001437 manganese ion Inorganic materials 0.000 claims description 2
- 229910052716 thallium Inorganic materials 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 4
- ASYBEJAJVKOXLG-UHFFFAOYSA-N 1-chloropentane-2,4-dione Chemical group CC(=O)CC(=O)CCl ASYBEJAJVKOXLG-UHFFFAOYSA-N 0.000 claims 1
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical group CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 claims 1
- GSOHKPVFCOWKPU-UHFFFAOYSA-N 3-methylpentane-2,4-dione Chemical group CC(=O)C(C)C(C)=O GSOHKPVFCOWKPU-UHFFFAOYSA-N 0.000 claims 1
- NZZIMKJIVMHWJC-UHFFFAOYSA-N dibenzoylmethane Chemical group C=1C=CC=CC=1C(=O)CC(=O)C1=CC=CC=C1 NZZIMKJIVMHWJC-UHFFFAOYSA-N 0.000 claims 1
- QAMFBRUWYYMMGJ-UHFFFAOYSA-N hexafluoroacetylacetone Chemical group FC(F)(F)C(=O)CC(=O)C(F)(F)F QAMFBRUWYYMMGJ-UHFFFAOYSA-N 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- NNNSKJSUQWKSAM-UHFFFAOYSA-L magnesium;dichlorate Chemical compound [Mg+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O NNNSKJSUQWKSAM-UHFFFAOYSA-L 0.000 claims 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 claims 1
- NVLYBJDGUWDDGH-UHFFFAOYSA-N undecane-4,6-dione Chemical group CCCCCC(=O)CC(=O)CCC NVLYBJDGUWDDGH-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 32
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 13
- 150000002500 ions Chemical class 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 5
- 241000861718 Chloris <Aves> Species 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 4
- 241000282326 Felis catus Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 3
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 230000036647 reaction Effects 0.000 description 3
- 229940116269 uric acid Drugs 0.000 description 3
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical compound CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229910021120 PdC12 Inorganic materials 0.000 description 2
- 239000013522 chelant Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 2
- 125000005594 diketone group Chemical group 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000004880 explosion Methods 0.000 description 2
- MWVFCEVNXHTDNF-UHFFFAOYSA-N hexane-2,3-dione Chemical compound CCCC(=O)C(C)=O MWVFCEVNXHTDNF-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- CHYAELHICQUTEB-UHFFFAOYSA-N 1-chloro-1,1-difluorohexane-2,4-dione Chemical compound CCC(=O)CC(=O)C(F)(F)Cl CHYAELHICQUTEB-UHFFFAOYSA-N 0.000 description 1
- WBMJETLNTZLTFE-UHFFFAOYSA-N 1-phenylhexane-1,3-dione Chemical compound CCCC(=O)CC(=O)C1=CC=CC=C1 WBMJETLNTZLTFE-UHFFFAOYSA-N 0.000 description 1
- XCBBNTFYSLADTO-UHFFFAOYSA-N 2,3-Octanedione Chemical compound CCCCCC(=O)C(C)=O XCBBNTFYSLADTO-UHFFFAOYSA-N 0.000 description 1
- KFBXUKHERGLHLG-UHFFFAOYSA-N 2,4-Nonanedione Chemical compound CCCCCC(=O)CC(C)=O KFBXUKHERGLHLG-UHFFFAOYSA-N 0.000 description 1
- UQOOCVASVGYQCY-UHFFFAOYSA-N 3-methylheptane-2,4-dione Chemical compound CCCC(=O)C(C)C(C)=O UQOOCVASVGYQCY-UHFFFAOYSA-N 0.000 description 1
- VMPZHUZUESBODJ-UHFFFAOYSA-N 5-methylheptane-2,4-dione Chemical compound CCC(C)C(=O)CC(C)=O VMPZHUZUESBODJ-UHFFFAOYSA-N 0.000 description 1
- 101100188553 Arabidopsis thaliana OCT4 gene Proteins 0.000 description 1
- 101100188554 Arabidopsis thaliana OCT5 gene Proteins 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000905957 Channa melasoma Species 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- 244000287680 Garcinia dulcis Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000575946 Ione Species 0.000 description 1
- LTXREWYXXSTFRX-QGZVFWFLSA-N Linagliptin Chemical compound N=1C=2N(C)C(=O)N(CC=3N=C4C=CC=CC4=C(C)N=3)C(=O)C=2N(CC#CC)C=1N1CCC[C@@H](N)C1 LTXREWYXXSTFRX-QGZVFWFLSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- HAYXDMNJJFVXCI-UHFFFAOYSA-N arsenic(5+) Chemical compound [As+5] HAYXDMNJJFVXCI-UHFFFAOYSA-N 0.000 description 1
- DQSGVVGOPRWTKI-QVFAWCHISA-N atazanavir sulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.C([C@H](NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)[C@@H](O)CN(CC=1C=CC(=CC=1)C=1N=CC=CC=1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C1=CC=CC=C1 DQSGVVGOPRWTKI-QVFAWCHISA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 229940077449 dichromate ion Drugs 0.000 description 1
- ILPNRWUGFSPGAA-UHFFFAOYSA-N heptane-2,4-dione Chemical compound CCCC(=O)CC(C)=O ILPNRWUGFSPGAA-UHFFFAOYSA-N 0.000 description 1
- 239000002440 industrial waste Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 150000002697 manganese compounds Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 235000000010 nanu Nutrition 0.000 description 1
- 244000082862 nanu Species 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 235000014571 nuts Nutrition 0.000 description 1
- WXHIJDCHNDBCNY-UHFFFAOYSA-N palladium dihydride Chemical compound [PdH2] WXHIJDCHNDBCNY-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ONLKWZYYIZMJRH-UHFFFAOYSA-N tridecane-6,8-dione Chemical compound CCCCCC(=O)CC(=O)CCCCC ONLKWZYYIZMJRH-UHFFFAOYSA-N 0.000 description 1
- IRYJRGCIQBGHIV-UHFFFAOYSA-N trimethadione Chemical compound CN1C(=O)OC(C)(C)C1=O IRYJRGCIQBGHIV-UHFFFAOYSA-N 0.000 description 1
- NNIUGFWCIDVDCZ-UHFFFAOYSA-N undecane-5,7-dione Chemical compound CCCCC(=O)CC(=O)CCCC NNIUGFWCIDVDCZ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 230000003245 working effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B11/00—Oxides or oxyacids of halogens; Salts thereof
- C01B11/02—Oxides of chlorine
- C01B11/022—Chlorine dioxide (ClO2)
- C01B11/023—Preparation from chlorites or chlorates
- C01B11/025—Preparation from chlorites or chlorates from chlorates without any other reaction reducing agent than chloride ions
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B11/00—Oxides or oxyacids of halogens; Salts thereof
- C01B11/02—Oxides of chlorine
- C01B11/022—Chlorine dioxide (ClO2)
- C01B11/023—Preparation from chlorites or chlorates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8270776A JPS538398A (en) | 1976-07-12 | 1976-07-12 | Manufacturing method of chlorine dioxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1076321A true CA1076321A (en) | 1980-04-29 |
Family
ID=13781864
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA263,089A Expired CA1076321A (en) | 1976-07-12 | 1976-10-08 | Process for manufacturing chlorine dioxide |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4051229A (en, 2012) |
| JP (1) | JPS538398A (en, 2012) |
| CA (1) | CA1076321A (en, 2012) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1223715A (en) * | 1976-10-26 | 1987-07-07 | David N. Glew | Production of chlorine dioxide |
| JPS5474296A (en) * | 1977-11-26 | 1979-06-14 | Japan Carlit Co Ltd | Manufacture of chlorine dioxide |
| US4169134A (en) * | 1977-12-02 | 1979-09-25 | The Japan Carlit Co., Ltd. | Manufacturing chlorine dioxide with thallium and silver or palladium catalysts |
| SE8005942L (sv) * | 1979-08-28 | 1981-03-01 | Erco Ind Ltd | Katalytisk framstellning av klordioxid |
| JPS5953205B2 (ja) * | 1981-05-19 | 1984-12-24 | 日本カ−リツト株式会社 | 高純度の二酸化塩素を製造する方法 |
| SE464193B (sv) * | 1988-10-20 | 1991-03-18 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| US5273733A (en) * | 1992-04-14 | 1993-12-28 | Eka Nobel Inc. | Process for the production of chlorine dioxide |
| US5435984A (en) * | 1992-04-28 | 1995-07-25 | Degussa Corporation | Catalyst for the synthesis of chlorine dioxide |
| US20130136685A1 (en) | 2011-11-25 | 2013-05-30 | Juan Carlos Baselli | Portable Chlorie Dioxide Generator |
| US11279617B2 (en) | 2011-11-25 | 2022-03-22 | Juan Carlos Baselli | Portable chlorine dioxide generator |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3101253A (en) * | 1959-08-07 | 1963-08-20 | Hoechst Ag | Process for the manufacture of chlorine dioxide |
| US3563702A (en) * | 1968-03-05 | 1971-02-16 | Hooker Chemical Corp | Production of chlorine dioxide |
| GB1216447A (en) * | 1969-07-16 | 1970-12-23 | Nippon Soda Co | A process for the manufacture of chlorine dioxide |
-
1976
- 1976-07-12 JP JP8270776A patent/JPS538398A/ja active Granted
- 1976-10-06 US US05/730,196 patent/US4051229A/en not_active Expired - Lifetime
- 1976-10-08 CA CA263,089A patent/CA1076321A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5444278B2 (en, 2012) | 1979-12-25 |
| JPS538398A (en) | 1978-01-25 |
| US4051229A (en) | 1977-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1076321A (en) | Process for manufacturing chlorine dioxide | |
| CA1080434A (en) | High efficiency chlorine dioxide production using hc1 as acid | |
| CA2028550C (en) | Process for the production of chlorine dioxide | |
| US3828097A (en) | Process for the preparation of chlorous acid | |
| US4421730A (en) | Process for manufacturing highly pure chlorine dioxide | |
| EP0473559A1 (en) | Process for the production of chlorine dioxide | |
| CA1333518C (en) | Process for production of chlorine dioxide | |
| CA1223715A (en) | Production of chlorine dioxide | |
| US4154809A (en) | High efficiency chlorine dioxide production using HCl as acid and methanol addition | |
| US4154810A (en) | Manufacture of chlorine dioxide by reduction of a specified chlorate | |
| EP0465447B1 (en) | Process for the production of chlorine dioxide | |
| US4178356A (en) | Process for manufacturing chlorine dioxide | |
| IL91772A (en) | Process for the production of N-phosphono-methylglycine | |
| US5433938A (en) | Chlorine-destruct method | |
| CS216940B2 (en) | Method of continuous production of the chlorine oxide | |
| EP0535113B1 (en) | Methanol-based chlorine dioxide process | |
| CA2268173A1 (en) | Method for producing chlorine dioxide using methanol, chloride, and hydrogen peroxide as reducing agents | |
| CA2242685C (en) | Nitric acid based chlorine dioxide generation process | |
| WO1998013296A9 (en) | Method for producing chlorine dioxide using methanol, chloride, and hydrogen peroxide as reducing agents | |
| CA1089627A (en) | Process for manufacturing chlorine dioxide | |
| JP2673518B2 (ja) | 塩水中の塩素酸塩の除去方法 | |
| WO1998013295A1 (en) | Method for producing chlorine dioxide using methanol and hydrogen peroxide as reducing agents | |
| WO1998013295A9 (en) | Method for producing chlorine dioxide using methanol and hydrogen peroxide as reducing agents | |
| EP0963945A1 (en) | High purity alkali metal chlorite and method manufacture | |
| US3950440A (en) | Process for oxidizing olefins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |