CA1074330A - Antiinflammatory substituted phenylacetic acids - Google Patents
Antiinflammatory substituted phenylacetic acidsInfo
- Publication number
- CA1074330A CA1074330A CA242,207A CA242207A CA1074330A CA 1074330 A CA1074330 A CA 1074330A CA 242207 A CA242207 A CA 242207A CA 1074330 A CA1074330 A CA 1074330A
- Authority
- CA
- Canada
- Prior art keywords
- chloro
- carbon atoms
- acid
- chloride
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 title claims abstract description 34
- 230000003110 anti-inflammatory effect Effects 0.000 title claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 8
- 150000007529 inorganic bases Chemical class 0.000 claims abstract description 6
- 150000007530 organic bases Chemical class 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- 125000005843 halogen group Chemical group 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 25
- ACBFEXJHCINJDS-UHFFFAOYSA-N methyl 2-(3-chloro-4-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C(Cl)=C1 ACBFEXJHCINJDS-UHFFFAOYSA-N 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 15
- -1 alkyl 3-chloro-4-hydroxy-phenylacetate Chemical compound 0.000 claims description 15
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical class NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims description 15
- 229960003424 phenylacetic acid Drugs 0.000 claims description 15
- 239000003279 phenylacetic acid Substances 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 13
- DFHBBMJTBBLQSA-UHFFFAOYSA-N 2-(3-chloro-4-phenylmethoxyphenyl)acetic acid Chemical compound ClC1=CC(CC(=O)O)=CC=C1OCC1=CC=CC=C1 DFHBBMJTBBLQSA-UHFFFAOYSA-N 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- RPNSUIRLAUJMRP-UHFFFAOYSA-N 2-[3-chloro-4-[(3-chloro-4-methoxyphenyl)methoxy]phenyl]acetic acid Chemical compound C1=C(Cl)C(OC)=CC=C1COC1=CC=C(CC(O)=O)C=C1Cl RPNSUIRLAUJMRP-UHFFFAOYSA-N 0.000 claims description 4
- JAXSPAXDDROBLQ-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1Cl JAXSPAXDDROBLQ-UHFFFAOYSA-N 0.000 claims description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 4
- JPEXNRYOPURVQP-UHFFFAOYSA-N 2-[3-chloro-4-[[4-(2-methylpropoxy)phenyl]methoxy]phenyl]acetic acid Chemical compound C1=CC(OCC(C)C)=CC=C1COC1=CC=C(CC(O)=O)C=C1Cl JPEXNRYOPURVQP-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- IELPPEZSLSKWCP-UHFFFAOYSA-N 1-(chloromethyl)-4-(2-methylpropoxy)benzene Chemical compound CC(C)COC1=CC=C(CCl)C=C1 IELPPEZSLSKWCP-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000001414 amino alcohols Chemical class 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229960002887 deanol Drugs 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 6
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 claims 2
- 229940073608 benzyl chloride Drugs 0.000 claims 2
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 231100000053 low toxicity Toxicity 0.000 abstract description 2
- 230000001562 ulcerogenic effect Effects 0.000 abstract description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 23
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 10
- 235000019341 magnesium sulphate Nutrition 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 229930040373 Paraformaldehyde Natural products 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- IYTUKSIOQKTZEG-UHFFFAOYSA-N (3-chloro-4-hydroxyphenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(O)C(Cl)=C1 IYTUKSIOQKTZEG-UHFFFAOYSA-N 0.000 description 4
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 229920002866 paraformaldehyde Polymers 0.000 description 4
- 229940049953 phenylacetate Drugs 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- RVQOLTBRWHPYTM-UHFFFAOYSA-N 1-(chloromethyl)-4-(2-methylpropyl)benzene Chemical compound CC(C)CC1=CC=C(CCl)C=C1 RVQOLTBRWHPYTM-UHFFFAOYSA-N 0.000 description 2
- DUBCVXSYZVTCOC-UHFFFAOYSA-N 1-(chloromethyl)-4-ethylbenzene Chemical compound CCC1=CC=C(CCl)C=C1 DUBCVXSYZVTCOC-UHFFFAOYSA-N 0.000 description 2
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 2
- VFYLEHMWKPEVTA-UHFFFAOYSA-N 1-(chloromethyl)-4-prop-2-enoxybenzene Chemical compound ClCC1=CC=C(OCC=C)C=C1 VFYLEHMWKPEVTA-UHFFFAOYSA-N 0.000 description 2
- CYAKWEQUWJAHLW-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(CCl)C=C1 CYAKWEQUWJAHLW-UHFFFAOYSA-N 0.000 description 2
- QGRPVMLBTFGQDQ-UHFFFAOYSA-N 1-chloro-2-methoxybenzene Chemical compound COC1=CC=CC=C1Cl QGRPVMLBTFGQDQ-UHFFFAOYSA-N 0.000 description 2
- OBJKHHRZMIIEOK-UHFFFAOYSA-N 2-(3-bromo-4-methoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1Br OBJKHHRZMIIEOK-UHFFFAOYSA-N 0.000 description 2
- CDNWEVUZHGBTIV-UHFFFAOYSA-N 2-(3-chloro-4-methoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1Cl CDNWEVUZHGBTIV-UHFFFAOYSA-N 0.000 description 2
- BZYPVAZBDUBWHE-UHFFFAOYSA-N 2-[3-chloro-4-[(4-methoxyphenyl)methoxy]phenyl]acetic acid Chemical compound C1=CC(OC)=CC=C1COC1=CC=C(CC(O)=O)C=C1Cl BZYPVAZBDUBWHE-UHFFFAOYSA-N 0.000 description 2
- XZECPLIMOPAQFE-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=C(CCl)C=C1Cl XZECPLIMOPAQFE-UHFFFAOYSA-N 0.000 description 2
- NPSBMLMDVCSISR-UHFFFAOYSA-N 4-(chloromethyl)-2-methyl-1-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=C(CCl)C=C1C NPSBMLMDVCSISR-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-O cyclohexylammonium Chemical compound [NH3+]C1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-O 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- LSFYCRUFNRBZNC-UHFFFAOYSA-N (2-hydroxyphenyl) acetate Chemical compound CC(=O)OC1=CC=CC=C1O LSFYCRUFNRBZNC-UHFFFAOYSA-N 0.000 description 1
- NWIAETGHZKYGAD-UHFFFAOYSA-N (4-methoxyphenyl)methylhydrazine;hydrochloride Chemical compound [Cl-].COC1=CC=C(CN[NH3+])C=C1 NWIAETGHZKYGAD-UHFFFAOYSA-N 0.000 description 1
- HJTAZXHBEBIQQX-UHFFFAOYSA-N 1,5-bis(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1CCl HJTAZXHBEBIQQX-UHFFFAOYSA-N 0.000 description 1
- MNWIWTZKCATVSP-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=C(CCl)C=C1 MNWIWTZKCATVSP-UHFFFAOYSA-N 0.000 description 1
- UJVKKWVLMCDZDA-UHFFFAOYSA-N 1-chloro-2-(2-methylpropoxy)benzene Chemical compound CC(C)COC1=CC=CC=C1Cl UJVKKWVLMCDZDA-UHFFFAOYSA-N 0.000 description 1
- JJOKVZBVPCSGJM-UHFFFAOYSA-N 1-chloro-2-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=CC=C1Cl JJOKVZBVPCSGJM-UHFFFAOYSA-N 0.000 description 1
- ONNCZAPKYZWFHQ-UHFFFAOYSA-N 1-methyl-2-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=CC=C1C ONNCZAPKYZWFHQ-UHFFFAOYSA-N 0.000 description 1
- IEJPPSMHUUQABK-UHFFFAOYSA-N 2,4-diphenyl-4h-1,3-oxazol-5-one Chemical compound O=C1OC(C=2C=CC=CC=2)=NC1C1=CC=CC=C1 IEJPPSMHUUQABK-UHFFFAOYSA-N 0.000 description 1
- UYCPLSFRPVKQNF-UHFFFAOYSA-N 2-(3-chloro-4-phenylmethoxyphenyl)acetate;cyclohexylazanium Chemical compound [NH3+]C1CCCCC1.ClC1=CC(CC(=O)[O-])=CC=C1OCC1=CC=CC=C1 UYCPLSFRPVKQNF-UHFFFAOYSA-N 0.000 description 1
- CXKJRUSOCDLLNA-UHFFFAOYSA-N 2-(3-chloro-4-phenylmethoxyphenyl)acetic acid;1-methylpiperazine Chemical compound C[NH+]1CCNCC1.ClC1=CC(CC(=O)[O-])=CC=C1OCC1=CC=CC=C1 CXKJRUSOCDLLNA-UHFFFAOYSA-N 0.000 description 1
- NVXSKDSPYQWBEF-UHFFFAOYSA-N 2-(3-chloro-4-phenylmethoxyphenyl)acetyl chloride Chemical compound ClC=1C=C(C=CC=1OCC1=CC=CC=C1)CC(=O)Cl NVXSKDSPYQWBEF-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YFJWKNWYIKMVQA-UHFFFAOYSA-N 2-[3-chloro-4-[(4-ethylphenyl)methoxy]phenyl]acetic acid Chemical compound C1=CC(CC)=CC=C1COC1=CC=C(CC(O)=O)C=C1Cl YFJWKNWYIKMVQA-UHFFFAOYSA-N 0.000 description 1
- OHGZSCXLSSWMKH-UHFFFAOYSA-N 2-[3-chloro-4-[(4-propan-2-yloxyphenyl)methoxy]phenyl]acetic acid Chemical compound C1=CC(OC(C)C)=CC=C1COC1=CC=C(CC(O)=O)C=C1Cl OHGZSCXLSSWMKH-UHFFFAOYSA-N 0.000 description 1
- HYPWEHDKOKVLRO-UHFFFAOYSA-N 2-[3-chloro-4-[(4-propan-2-ylphenyl)methoxy]phenyl]acetic acid Chemical compound C1=CC(C(C)C)=CC=C1COC1=CC=C(CC(O)=O)C=C1Cl HYPWEHDKOKVLRO-UHFFFAOYSA-N 0.000 description 1
- LGROUIFCRUBNIJ-UHFFFAOYSA-N 2-bromo-4-(chloromethyl)-1-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1Br LGROUIFCRUBNIJ-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- DTFKRVXLBCAIOZ-UHFFFAOYSA-N 2-methylanisole Chemical compound COC1=CC=CC=C1C DTFKRVXLBCAIOZ-UHFFFAOYSA-N 0.000 description 1
- ZGAJGFUIIQGVFQ-UHFFFAOYSA-N 2-methylpropyl 2-(3-chloro-4-phenylmethoxyphenyl)acetate Chemical compound ClC1=CC(CC(=O)OCC(C)C)=CC=C1OCC1=CC=CC=C1 ZGAJGFUIIQGVFQ-UHFFFAOYSA-N 0.000 description 1
- BHEHNICAPZVKRH-UHFFFAOYSA-N 4-(chloromethyl)-1-methoxy-2-methylbenzene Chemical compound COC1=CC=C(CCl)C=C1C BHEHNICAPZVKRH-UHFFFAOYSA-N 0.000 description 1
- 238000006218 Arndt-Eistert homologation reaction Methods 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- YVBSAPDHRXHFHV-UHFFFAOYSA-N [chloro(methoxy)methyl]benzene Chemical compound COC(Cl)C1=CC=CC=C1 YVBSAPDHRXHFHV-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- GOLCXWYRSKYTSP-UHFFFAOYSA-N arsenic trioxide Inorganic materials O1[As]2O[As]1O2 GOLCXWYRSKYTSP-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 150000005524 benzylchlorides Chemical class 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000006324 decarbonylation Effects 0.000 description 1
- 238000006606 decarbonylation reaction Methods 0.000 description 1
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229940035429 isobutyl alcohol Drugs 0.000 description 1
- KXUHSQYYJYAXGZ-UHFFFAOYSA-N isobutylbenzene Chemical compound CC(C)CC1=CC=CC=C1 KXUHSQYYJYAXGZ-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- FYKFTMDYVSKEGK-UHFFFAOYSA-N methyl 2-(3-bromo-4-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C(Br)=C1 FYKFTMDYVSKEGK-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229940113083 morpholine Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- POSICDHOUBKJKP-UHFFFAOYSA-N prop-2-enoxybenzene Chemical compound C=CCOC1=CC=CC=C1 POSICDHOUBKJKP-UHFFFAOYSA-N 0.000 description 1
- ZYNMJJNWXVKJJV-UHFFFAOYSA-N propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=CC=C1 ZYNMJJNWXVKJJV-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 101150115956 slc25a26 gene Proteins 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
- C07D295/027—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring
- C07D295/03—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring with the ring nitrogen atoms directly attached to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/26—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton
- C07C17/32—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by introduction of halogenated alkyl groups into ring compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/08—Preparation of carboxylic acids or their salts, halides or anhydrides from nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS8681A CS175831B1 (enExample) | 1974-12-17 | 1974-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1074330A true CA1074330A (en) | 1980-03-25 |
Family
ID=5437722
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA242,207A Expired CA1074330A (en) | 1974-12-17 | 1975-12-17 | Antiinflammatory substituted phenylacetic acids |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4221919A (enExample) |
| JP (1) | JPS5186442A (enExample) |
| AT (1) | AT341506B (enExample) |
| BE (1) | BE836679A (enExample) |
| CA (1) | CA1074330A (enExample) |
| CH (1) | CH619205A5 (enExample) |
| CS (1) | CS175831B1 (enExample) |
| DE (1) | DE2556474C2 (enExample) |
| DK (1) | DK143552C (enExample) |
| FI (1) | FI60195C (enExample) |
| FR (1) | FR2294689A1 (enExample) |
| GB (1) | GB1487149A (enExample) |
| NL (1) | NL7514725A (enExample) |
| SE (1) | SE427108B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7932290B2 (en) | 2003-02-13 | 2011-04-26 | Wellstat Biologics Corporation | Method for the treatment of metabolic disorders |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8400239D0 (sv) * | 1984-01-19 | 1984-01-19 | Pharmacia Ab | Nya arylettiksyraderivat |
| AU1624801A (en) | 1999-11-19 | 2001-05-30 | Corvas International, Inc. | Plasminogen activator inhibitor antagonists related applications |
| US6638977B1 (en) | 1999-11-19 | 2003-10-28 | Corvas International, Inc. | Plasminogen activator inhibitor antagonists |
| GB0214149D0 (en) * | 2002-06-19 | 2002-07-31 | Glaxo Group Ltd | Chemical compounds |
| US7531543B2 (en) | 2003-10-14 | 2009-05-12 | Wyeth | Phenylpiperazine cycloalkanol derivatives and methods of their use |
| US7524846B2 (en) | 2003-10-14 | 2009-04-28 | Wyeth | Arylalkyl- and cycloalkylalkyl-piperazine derivatives and methods of their use |
| US7365076B2 (en) | 2003-10-14 | 2008-04-29 | Wyeth | Substituted aryl cycloalkanol derivatives and methods of their use |
| US7550485B2 (en) | 2003-10-14 | 2009-06-23 | Wyeth | Substituted N-heterocycle derivatives and methods of their use |
| US7419980B2 (en) | 2003-10-14 | 2008-09-02 | Wyeth | Fused-aryl and heteroaryl derivatives and methods of their use |
| US7402698B2 (en) | 2003-10-14 | 2008-07-22 | Wyeth | Secondary amino-and cycloamino-cycloalkanol derivatives and methods of their use |
| US20050130987A1 (en) * | 2003-10-14 | 2005-06-16 | Wyeth | Methods of treating vasomotor symptoms |
| US7491723B2 (en) | 2003-10-14 | 2009-02-17 | Wyeth | Alkanol and cycloalkanol-amine derivatives and methods of their use |
| US7517899B2 (en) * | 2004-03-30 | 2009-04-14 | Wyeth | Phenylaminopropanol derivatives and methods of their use |
| US7414052B2 (en) | 2004-03-30 | 2008-08-19 | Wyeth | Phenylaminopropanol derivatives and methods of their use |
| UA95613C2 (ru) * | 2005-11-09 | 2011-08-25 | Уеллстат Терепьютикс Корпорейшн | Соединения для лечения расстройсв метаболизма |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1459084A (en) * | 1973-05-24 | 1976-12-22 | Boots Co Ltd | Preparation of arylalkanoic acid |
-
1974
- 1974-12-17 CS CS8681A patent/CS175831B1/cs unknown
-
1975
- 1975-12-08 CH CH1592575A patent/CH619205A5/de not_active IP Right Cessation
- 1975-12-12 GB GB50958/75A patent/GB1487149A/en not_active Expired
- 1975-12-15 DE DE2556474A patent/DE2556474C2/de not_active Expired
- 1975-12-16 SE SE7514212A patent/SE427108B/xx unknown
- 1975-12-16 AT AT953075A patent/AT341506B/de not_active IP Right Cessation
- 1975-12-16 BE BE162774A patent/BE836679A/xx not_active IP Right Cessation
- 1975-12-16 FI FI753551A patent/FI60195C/fi not_active IP Right Cessation
- 1975-12-17 CA CA242,207A patent/CA1074330A/en not_active Expired
- 1975-12-17 DK DK573475A patent/DK143552C/da not_active IP Right Cessation
- 1975-12-17 JP JP50149660A patent/JPS5186442A/ja active Pending
- 1975-12-17 NL NL7514725A patent/NL7514725A/xx not_active Application Discontinuation
- 1975-12-17 FR FR7538606A patent/FR2294689A1/fr active Granted
-
1979
- 1979-04-24 US US06/033,147 patent/US4221919A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7932290B2 (en) | 2003-02-13 | 2011-04-26 | Wellstat Biologics Corporation | Method for the treatment of metabolic disorders |
Also Published As
| Publication number | Publication date |
|---|---|
| SE7514212L (sv) | 1976-06-18 |
| NL7514725A (nl) | 1976-06-21 |
| ATA953075A (de) | 1977-06-15 |
| FR2294689A1 (fr) | 1976-07-16 |
| BE836679A (fr) | 1976-04-16 |
| DK143552B (da) | 1981-09-07 |
| FI60195B (fi) | 1981-08-31 |
| DE2556474C2 (de) | 1984-08-09 |
| FI60195C (fi) | 1981-12-10 |
| DE2556474A1 (de) | 1976-07-01 |
| AT341506B (de) | 1978-02-10 |
| US4221919A (en) | 1980-09-09 |
| DK573475A (da) | 1976-06-18 |
| CH619205A5 (enExample) | 1980-09-15 |
| CS175831B1 (enExample) | 1977-05-31 |
| JPS5186442A (enExample) | 1976-07-29 |
| SE427108B (sv) | 1983-03-07 |
| GB1487149A (en) | 1977-09-28 |
| FR2294689B1 (enExample) | 1978-12-01 |
| DK143552C (da) | 1982-02-08 |
| FI753551A7 (enExample) | 1976-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1074330A (en) | Antiinflammatory substituted phenylacetic acids | |
| DE2814556C2 (de) | Substituierte Phenylessigsäurederivate, Verfahren zu deren Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| CA1153384A (en) | 6,11-dihydrodibenz[b,e]oxepin-acetic acids and derivatives | |
| CA1210770A (en) | Leukotriene antagonists | |
| US4182764A (en) | Tetrazole derivatives of [1-oxo-2-aryl or thienyl-2-substituted-5-indanyloxy(or thio)]alkanoic acids | |
| US4074057A (en) | 2-Halopropionic acid and its derivatives | |
| Chien et al. | Stereochemistry of Diphenyls. XXXV. 1 The Effect of 3'Substituents on the Rate of Racemization of 2-Nitro-6-carboxy-2'-methoxydiphenyl | |
| US3362988A (en) | Alkanoylnaphthyloxy-carboxylic acids | |
| Holdrege et al. | Synthesis of Trifluoromethylated Compounds Possessing Diuretic Activity1 | |
| US4027040A (en) | Novel benzophenone derivatives | |
| US3182061A (en) | 5-[4-(p-hydroxyphenoxy)phenyl]-5-oxo-3-methylvaleric acid | |
| US3225096A (en) | N-cyclopropylamine aralkanone and aralkanol amine derivatives | |
| JPS6045631B2 (ja) | フエニルグリオキザル酸エステの製造法 | |
| Bordwell et al. | Preparation of salts of 2-Phenylethene-1-sulfonic acid1 | |
| JACOBS et al. | SUBSTITUTED α-DIALKYLAMINOALKYL-1-NAPHTHALENEMETHANOLS. II. 1-HALONAPHTHALENES IN THE FRIEDEL AND CRAFTS REACTION1 | |
| US3244748A (en) | 5h-dibenzo [a, d] cycloheptenes | |
| JPS5949207B2 (ja) | ジエンの製造方法 | |
| US3352901A (en) | Phenylacetic acids, esters, and amides | |
| ROBINSON et al. | The synthesis of substituted 5, 6-benzocinchoninic acids by the Doebner and by the Pfitzinger reactions | |
| US3812194A (en) | Novel process for preparing 6-halo-3-methylphenols | |
| US3886207A (en) | Process for producing indan-1-carboxylic acid derivatives | |
| Schneller et al. | Unsymmetrical Analogs of DDT1 | |
| CH392483A (fr) | Procédé de préparation de nouveaux esters d'acides 4-halo-3-sulfamoyl-benzoïques | |
| EP0012512B1 (en) | A process for the production of 2-alkyl- or 2-alkenyl-4,6-diacetyl resorcinols; 2-allyl-4,6-diacetyl resorcinol | |
| US3342851A (en) | Esters of [(2-methyleneacyl)phenoxy]-carboxylic acids and a method for their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |