CA1068446A - Olefin polymerization - Google Patents
Olefin polymerizationInfo
- Publication number
- CA1068446A CA1068446A CA252,281A CA252281A CA1068446A CA 1068446 A CA1068446 A CA 1068446A CA 252281 A CA252281 A CA 252281A CA 1068446 A CA1068446 A CA 1068446A
- Authority
- CA
- Canada
- Prior art keywords
- process according
- compound
- magnesium
- aluminium
- ratio
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000006116 polymerization reaction Methods 0.000 title claims abstract description 28
- 150000001336 alkenes Chemical class 0.000 title description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 title 1
- 239000010936 titanium Substances 0.000 claims abstract description 43
- 239000004411 aluminium Substances 0.000 claims abstract description 38
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 38
- 239000011777 magnesium Substances 0.000 claims abstract description 38
- -1 aluminium halides Chemical class 0.000 claims abstract description 31
- 150000001875 compounds Chemical class 0.000 claims abstract description 24
- 238000000034 method Methods 0.000 claims abstract description 21
- 239000000047 product Substances 0.000 claims abstract description 21
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 19
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 17
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 13
- 229910052719 titanium Inorganic materials 0.000 claims abstract description 13
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims abstract description 12
- 238000006243 chemical reaction Methods 0.000 claims abstract description 11
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 10
- 150000002367 halogens Chemical class 0.000 claims abstract description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 9
- 150000002681 magnesium compounds Chemical class 0.000 claims abstract description 9
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 8
- 239000000203 mixture Substances 0.000 claims abstract description 8
- 239000003054 catalyst Substances 0.000 claims abstract description 7
- 238000006467 substitution reaction Methods 0.000 claims abstract description 7
- 150000004820 halides Chemical class 0.000 claims abstract description 5
- 239000004711 α-olefin Substances 0.000 claims abstract description 5
- 150000003609 titanium compounds Chemical class 0.000 claims abstract description 4
- 150000001350 alkyl halides Chemical class 0.000 claims abstract description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 159000000003 magnesium salts Chemical class 0.000 claims abstract description 3
- 239000002879 Lewis base Substances 0.000 claims abstract 2
- 150000005840 aryl radicals Chemical group 0.000 claims abstract 2
- 150000007527 lewis bases Chemical class 0.000 claims abstract 2
- 229920006395 saturated elastomer Polymers 0.000 claims abstract 2
- 150000002148 esters Chemical class 0.000 claims description 4
- 150000003254 radicals Chemical group 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims 3
- 229910003074 TiCl4 Inorganic materials 0.000 claims 1
- 229910001629 magnesium chloride Inorganic materials 0.000 claims 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 164
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 45
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 45
- 229920000642 polymer Polymers 0.000 description 27
- 239000012265 solid product Substances 0.000 description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 21
- 239000004743 Polypropylene Substances 0.000 description 21
- 238000009835 boiling Methods 0.000 description 21
- 239000001257 hydrogen Substances 0.000 description 21
- 229910052739 hydrogen Inorganic materials 0.000 description 21
- 229920001155 polypropylene Polymers 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 19
- 238000000605 extraction Methods 0.000 description 15
- FHUODBDRWMIBQP-UHFFFAOYSA-N Ethyl p-anisate Chemical compound CCOC(=O)C1=CC=C(OC)C=C1 FHUODBDRWMIBQP-UHFFFAOYSA-N 0.000 description 14
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 239000000178 monomer Substances 0.000 description 10
- 229910000831 Steel Inorganic materials 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000010959 steel Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 229910001220 stainless steel Inorganic materials 0.000 description 7
- 239000010935 stainless steel Substances 0.000 description 7
- 238000000921 elemental analysis Methods 0.000 description 6
- NWPWRAWAUYIELB-UHFFFAOYSA-N ethyl 4-methylbenzoate Chemical compound CCOC(=O)C1=CC=C(C)C=C1 NWPWRAWAUYIELB-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000010908 decantation Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910010066 TiC14 Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- UAIVFDJJMVMUGY-UHFFFAOYSA-N 1,2,4-trimethylpiperazine Chemical compound CC1CN(C)CCN1C UAIVFDJJMVMUGY-UHFFFAOYSA-N 0.000 description 1
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 229910019438 Mg(OC2H5)2 Inorganic materials 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- 240000004760 Pimpinella anisum Species 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001399 aluminium compounds Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 229940077746 antacid containing aluminium compound Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000002844 continuous effect Effects 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- HHEIMYAXCOIQCJ-UHFFFAOYSA-N ethyl 2,2-dimethylpropanoate Chemical compound CCOC(=O)C(C)(C)C HHEIMYAXCOIQCJ-UHFFFAOYSA-N 0.000 description 1
- RETLCWPMLJPOTP-UHFFFAOYSA-N ethyl 2-chlorobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1Cl RETLCWPMLJPOTP-UHFFFAOYSA-N 0.000 description 1
- JJOYCHKVKWDMEA-UHFFFAOYSA-N ethyl cyclohexanecarboxylate Chemical compound CCOC(=O)C1CCCCC1 JJOYCHKVKWDMEA-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical class ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical class [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- AJSTXXYNEIHPMD-UHFFFAOYSA-N triethyl borate Chemical compound CCOB(OCC)OCC AJSTXXYNEIHPMD-UHFFFAOYSA-N 0.000 description 1
- DAOVYDBYKGXFOB-UHFFFAOYSA-N tris(2-methylpropoxy)alumane Chemical compound [Al+3].CC(C)C[O-].CC(C)C[O-].CC(C)C[O-] DAOVYDBYKGXFOB-UHFFFAOYSA-N 0.000 description 1
- 150000003682 vanadium compounds Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/02—Carriers therefor
- C08F4/022—Magnesium halide as support anhydrous or hydrated or complexed by means of a Lewis base for Ziegler-type catalysts
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT23396/75A IT1038179B (it) | 1975-05-16 | 1975-05-16 | Procedimento di polimerizzazione di alfa olefine con almeno treatoni di carbonto |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1068446A true CA1068446A (en) | 1979-12-18 |
Family
ID=11206709
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA252,281A Expired CA1068446A (en) | 1975-05-16 | 1976-05-11 | Olefin polymerization |
Country Status (19)
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1107080C (zh) * | 1994-09-22 | 2003-04-30 | 索尔维聚烯烃欧州-比利时公司 | 烯烃的聚合方法 |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1078995B (it) * | 1977-05-24 | 1985-05-08 | Montedison Spa | Catalizzatori per la polimeriazzazione di olefine |
| JPS54135886A (en) * | 1978-04-14 | 1979-10-22 | Sumitomo Chem Co Ltd | Preparation of ethylenic copolymer |
| NO155245C (no) * | 1978-07-24 | 1987-03-04 | Phillips Petroleum Co | Fremgangsmaate til fremstilling av en polymerisasjonskatalysator og anvendelse av katalysatoren til alkenpolymerisering. |
| US4324690A (en) | 1979-02-15 | 1982-04-13 | Standard Oil Company (Indiana) | Alpha-olefin polymerization catalyst |
| US4277370A (en) | 1979-02-15 | 1981-07-07 | Standard Oil Company (Indiana) | Alpha-olefin polymerization catalyst |
| US4347157A (en) | 1979-04-25 | 1982-08-31 | Sumitomo Chemical Company, Limited | Catalysts for the polymerization of olefins |
| US4363746A (en) | 1979-05-29 | 1982-12-14 | Phillips Petroleum Company | Composition of matter and method of preparing same, catalyst, method of producing the catalyst and polymerization process employing the catalyst |
| US4394291A (en) * | 1981-03-04 | 1983-07-19 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| AT377625B (de) * | 1981-06-29 | 1985-04-10 | Georges A Cournoyer | Vorrichtung zum lehren von musiktonleitern und -intervallen |
| JPS58189206A (ja) * | 1982-04-30 | 1983-11-04 | Chisso Corp | α−オレフイン重合用触媒成分 |
| US4544647A (en) * | 1982-07-29 | 1985-10-01 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4529715A (en) * | 1983-10-17 | 1985-07-16 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, carbon dioxide, reducing aluminum source, transition metal compound and zinc compound |
| US4426316A (en) | 1982-09-10 | 1984-01-17 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4605715A (en) * | 1982-09-20 | 1986-08-12 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4604374A (en) * | 1982-09-20 | 1986-08-05 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4456547A (en) * | 1982-10-21 | 1984-06-26 | Fuentes Jr Ricardo | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and complex formed from admixture of a transition metal compound and an organozinc compound |
| US4661465A (en) * | 1985-10-31 | 1987-04-28 | The Dow Chemical Company | Method for preparing transition metal component of Ziegler-Natta catalysts |
| US5045612A (en) * | 1990-04-18 | 1991-09-03 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5114897A (en) * | 1990-04-18 | 1992-05-19 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US6001939A (en) * | 1994-09-22 | 1999-12-14 | Solvay Polyolefins Europe-Belgium | Process for the polymerization of olefins |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2093306A6 (fr) * | 1970-06-09 | 1972-01-28 | Solvay | Catalyseurs et procede perfectionnes pour la polymerisation et la copolymerisation des olefines |
| NL136668C (enrdf_load_stackoverflow) * | 1969-01-24 | |||
| NL164867C (nl) * | 1971-03-11 | 1981-02-16 | Stamicarbon | Werkwijze voor het polymeriseren van alfa-alkenen. |
| NL160286C (enrdf_load_stackoverflow) * | 1971-06-25 | |||
| BE791676A (fr) * | 1971-12-08 | 1973-05-21 | Solvay | Procédé pour la polymérisation des oléfines |
| LU65587A1 (enrdf_load_stackoverflow) * | 1972-06-22 | 1973-12-27 | ||
| IT969340B (it) * | 1972-09-13 | 1974-03-30 | Montedison Spa | Catalizzatori per la polimerizza zione delle olefine a polimeri in forma sferica |
-
1975
- 1975-05-16 IT IT23396/75A patent/IT1038179B/it active
-
1976
- 1976-04-11 TR TR19114A patent/TR19114A/xx unknown
- 1976-05-10 NO NO761597A patent/NO150763C/no unknown
- 1976-05-10 NL NL7604972A patent/NL7604972A/xx not_active Application Discontinuation
- 1976-05-10 RO RO86062A patent/RO85498B/ro unknown
- 1976-05-10 DK DK206276A patent/DK151892C/da active
- 1976-05-10 SE SE7605272A patent/SE7605272L/xx unknown
- 1976-05-11 FR FR7614146A patent/FR2311032A1/fr active Granted
- 1976-05-11 GB GB32907/78A patent/GB1539175A/en not_active Expired
- 1976-05-11 CA CA252,281A patent/CA1068446A/en not_active Expired
- 1976-05-11 GB GB19291/76A patent/GB1538472A/en not_active Expired
- 1976-05-12 IN IN834/CAL/76A patent/IN146040B/en unknown
- 1976-05-12 DE DE19762620886 patent/DE2620886A1/de not_active Withdrawn
- 1976-05-13 AT AT350576A patent/AT348252B/de not_active IP Right Cessation
- 1976-05-13 JP JP51053910A patent/JPS51139887A/ja active Granted
- 1976-05-14 ZA ZA762881A patent/ZA762881B/xx unknown
- 1976-05-14 BE BE167022A patent/BE841823A/xx not_active IP Right Cessation
- 1976-05-14 BR BR7603044A patent/BR7603044A/pt unknown
- 1976-05-14 HU HU76MO960A patent/HU174358B/hu not_active IP Right Cessation
- 1976-05-15 PL PL1976189597A patent/PL105364B1/pl unknown
-
1980
- 1980-03-04 SE SE8001655A patent/SE434515B/sv not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1107080C (zh) * | 1994-09-22 | 2003-04-30 | 索尔维聚烯烃欧州-比利时公司 | 烯烃的聚合方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| IN146040B (enrdf_load_stackoverflow) | 1978-02-10 |
| DE2620886A1 (de) | 1976-11-25 |
| JPS5614682B2 (enrdf_load_stackoverflow) | 1981-04-06 |
| NO761597L (enrdf_load_stackoverflow) | 1976-11-17 |
| GB1538472A (en) | 1979-01-17 |
| NL7604972A (nl) | 1976-11-18 |
| RO85498A (ro) | 1984-11-25 |
| JPS51139887A (en) | 1976-12-02 |
| FR2311032A1 (fr) | 1976-12-10 |
| HU174358B (hu) | 1979-12-28 |
| NO150763B (no) | 1984-09-03 |
| AT348252B (de) | 1979-02-12 |
| BE841823A (fr) | 1976-11-16 |
| AU1392176A (en) | 1977-11-17 |
| DK206276A (da) | 1976-11-17 |
| FR2311032B1 (enrdf_load_stackoverflow) | 1980-07-18 |
| DK151892B (da) | 1988-01-11 |
| RO85498B (ro) | 1984-11-30 |
| BR7603044A (pt) | 1977-05-31 |
| GB1539175A (en) | 1979-01-31 |
| TR19114A (tr) | 1978-05-25 |
| ZA762881B (en) | 1977-04-27 |
| DK151892C (da) | 1988-07-18 |
| NO150763C (no) | 1984-12-12 |
| SE8001655L (sv) | 1980-03-04 |
| SE7605272L (sv) | 1976-11-17 |
| SE434515B (sv) | 1984-07-30 |
| ATA350576A (de) | 1978-06-15 |
| IT1038179B (it) | 1979-11-20 |
| PL105364B1 (pl) | 1979-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1068446A (en) | Olefin polymerization | |
| US3644318A (en) | Process for the polymerization of olefins | |
| CA1086888A (en) | Impact-resistant chemically blended propylene polymer composition and process for preparation thereof | |
| CA1151142A (en) | PROCESS FOR PRODUCING .alpha.-OLEFIN POLYMERS | |
| JP2557054B2 (ja) | アルフア−オレフイン重合用触媒組成物 | |
| US3969332A (en) | Polymerization of ethylene | |
| CA1263858A (en) | Catalyst components, a catalyst and a process for the polymerization of olefins | |
| EP0284005B1 (en) | Method of production of polyolefins | |
| EP0436328A2 (en) | Method for polymerizing alpha-olefin | |
| US4175171A (en) | Catalyst for polymerizing α-olefins | |
| US4200717A (en) | Preparation of propylene polymer-containing solid titanium trichloride and propylene polymers using same | |
| US4397762A (en) | Polymerization catalyst | |
| US4282114A (en) | Catalyst for polymerizing α-olefins | |
| EP1368392A1 (en) | Process for the (co)polymerization of ethylene | |
| US4220745A (en) | Process for polymerization of α-olefins | |
| US4456695A (en) | Component of catalyst for olefin polymerization | |
| EP0115833A1 (en) | Polyolefin polymerization process and catalyst | |
| JPH0416483B2 (enrdf_load_stackoverflow) | ||
| JPH0796571B2 (ja) | エチレンの単独重合および共重合用触媒 | |
| US4357452A (en) | Process for polymerizing propylene | |
| EP0257131A2 (en) | Method for producing butene-1 polymer | |
| EP0137971A1 (en) | Polyolefin polymerization process and catalyst | |
| US4007133A (en) | Process for the manufacture of a catalyst | |
| JPS58125706A (ja) | エチレンの重合法 | |
| KR100251599B1 (ko) | 구상 촉매 성분의 제조방법 |