CA1065344A - Purification of d,d'-2,2'(ethylenediimino) di-1-butanol dihydrochloride - Google Patents
Purification of d,d'-2,2'(ethylenediimino) di-1-butanol dihydrochlorideInfo
- Publication number
- CA1065344A CA1065344A CA234,913A CA234913A CA1065344A CA 1065344 A CA1065344 A CA 1065344A CA 234913 A CA234913 A CA 234913A CA 1065344 A CA1065344 A CA 1065344A
- Authority
- CA
- Canada
- Prior art keywords
- butanol
- ethylenediimino
- dihydrochloride
- solution
- isopropanol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000746 purification Methods 0.000 title abstract 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims abstract description 44
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 39
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims abstract description 19
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims abstract description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000011541 reaction mixture Substances 0.000 claims abstract description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims abstract description 15
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 11
- JCBPETKZIGVZRE-BYPYZUCNSA-N (2s)-2-aminobutan-1-ol Chemical compound CC[C@H](N)CO JCBPETKZIGVZRE-BYPYZUCNSA-N 0.000 claims abstract description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims abstract description 10
- 239000011780 sodium chloride Substances 0.000 claims abstract description 5
- 238000001816 cooling Methods 0.000 claims abstract 2
- 239000007789 gas Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 11
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 5
- 230000006872 improvement Effects 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims description 2
- 238000005406 washing Methods 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 abstract description 2
- 238000002156 mixing Methods 0.000 abstract description 2
- 239000005977 Ethylene Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- 229960000443 hydrochloric acid Drugs 0.000 description 9
- 235000011167 hydrochloric acid Nutrition 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 8
- AEUTYOVWOVBAKS-UWVGGRQHSA-N ethambutol Chemical compound CC[C@@H](CO)NCCN[C@@H](CC)CO AEUTYOVWOVBAKS-UWVGGRQHSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 4
- 229960000285 ethambutol Drugs 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000007792 addition Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000004064 recycling Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 2
- 229960001618 ethambutol hydrochloride Drugs 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- JCBPETKZIGVZRE-UHFFFAOYSA-N 2-aminobutan-1-ol Chemical compound CCC(N)CO JCBPETKZIGVZRE-UHFFFAOYSA-N 0.000 description 1
- KKADPXVIOXHVKN-UHFFFAOYSA-N 4-hydroxyphenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=C(O)C=C1 KKADPXVIOXHVKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000187479 Mycobacterium tuberculosis Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- QYRFJLLXPINATB-UHFFFAOYSA-N hydron;2,4,5,6-tetrafluorobenzene-1,3-diamine;dichloride Chemical compound Cl.Cl.NC1=C(F)C(N)=C(F)C(F)=C1F QYRFJLLXPINATB-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical group 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 201000008827 tuberculosis Diseases 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/14—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic the nitrogen atom of the amino group being further bound to hydrocarbon groups substituted by amino groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/518,832 US3944616A (en) | 1974-10-29 | 1974-10-29 | Purification of d,d'-2,2'(ethylenediimino)di-1-butanol dihydrochloride |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1065344A true CA1065344A (en) | 1979-10-30 |
Family
ID=24065699
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA234,913A Expired CA1065344A (en) | 1974-10-29 | 1975-09-08 | Purification of d,d'-2,2'(ethylenediimino) di-1-butanol dihydrochloride |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3944616A (enExample) |
| JP (1) | JPS5926612B2 (enExample) |
| BE (1) | BE834930A (enExample) |
| CA (1) | CA1065344A (enExample) |
| DE (1) | DE2548508A1 (enExample) |
| GB (1) | GB1516169A (enExample) |
| PH (1) | PH13460A (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0134893A3 (en) * | 1983-05-19 | 1987-11-04 | TAMBURINI SpA | System for composing heavy structure houses to disassemble |
| JPS6456231U (enExample) * | 1987-10-02 | 1989-04-07 | ||
| US5162214A (en) * | 1991-04-05 | 1992-11-10 | General Atomics International Services Corporation | Cma production utilizing acetate ion exchange from fermentation broth |
| US7456222B2 (en) | 2002-05-17 | 2008-11-25 | Sequella, Inc. | Anti tubercular drug: compositions and methods |
| US20040033986A1 (en) | 2002-05-17 | 2004-02-19 | Protopopova Marina Nikolaevna | Anti tubercular drug: compositions and methods |
| CN101404986B (zh) * | 2002-05-17 | 2011-09-28 | 赛奎拉公司 | 用于诊断和治疗感染性疾病的组合物和制药方法 |
| US7884097B2 (en) * | 2003-09-05 | 2011-02-08 | Sequella, Inc. | Methods and compositions comprising diamines as new anti-tubercular therapeutics |
| WO2009136965A1 (en) * | 2008-05-06 | 2009-11-12 | Sequella, Inc. | Compositions and methods comprising capuramycin analogues |
| CN103664652A (zh) * | 2013-09-25 | 2014-03-26 | 南京工业大学 | 一种n,n,n′,n′-四(2-羟基乙基)-乙二胺的合成方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2569549A (en) * | 1949-03-21 | 1951-10-02 | Du Pont | Imidohalides and process of preparing them and their hydrolysis products |
| AT243774B (de) * | 1961-02-07 | 1965-11-25 | American Cyanamid Co | Verfahren zur Herstellung von neuen Hydroxydiaminen |
| US3553257A (en) * | 1966-09-16 | 1971-01-05 | American Cyanamid Co | Preparation of d-2-amino-1-butanol salts |
| GB1198923A (en) * | 1968-04-18 | 1970-07-15 | Zoja Lab Chim Farm | Process for the Preparation of the Dextrorotatory 2, 2', (Ethylenediimino)-di-1-butanoldihydrochloride |
| DE1768612A1 (de) * | 1968-06-06 | 1971-11-18 | Zoja Lab Chim Farm | Verfahren zur Herstellung von sehr reinem,pharmazeutisch geeignetem rechtsdrehenden 2,2'-(AEthylendiimin)-di-1-butanoldihydrochlorid |
| US3769347A (en) * | 1971-02-11 | 1973-10-30 | American Cyanamid Co | Production of d,d'-2,2'-(ethylenediimino) di-1-butanol hydrochloride |
| US3855300A (en) * | 1973-09-05 | 1974-12-17 | Sankyo Chem Ind Ltd | Process for the production of 2-amino-1-butanol |
-
1974
- 1974-10-29 US US05/518,832 patent/US3944616A/en not_active Expired - Lifetime
-
1975
- 1975-09-08 CA CA234,913A patent/CA1065344A/en not_active Expired
- 1975-09-17 GB GB38283/75A patent/GB1516169A/en not_active Expired
- 1975-10-27 PH PH17709A patent/PH13460A/en unknown
- 1975-10-27 JP JP50128414A patent/JPS5926612B2/ja not_active Expired
- 1975-10-28 BE BE161300A patent/BE834930A/xx not_active IP Right Cessation
- 1975-10-29 DE DE19752548508 patent/DE2548508A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5926612B2 (ja) | 1984-06-29 |
| US3944616A (en) | 1976-03-16 |
| AU8472575A (en) | 1977-03-17 |
| GB1516169A (en) | 1978-06-28 |
| PH13460A (en) | 1980-05-15 |
| BE834930A (fr) | 1976-04-28 |
| JPS5168511A (en) | 1976-06-14 |
| DE2548508A1 (de) | 1976-05-06 |
| DE2548508C2 (enExample) | 1988-07-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1065344A (en) | Purification of d,d'-2,2'(ethylenediimino) di-1-butanol dihydrochloride | |
| US2938054A (en) | Process for purification of 4, 4'-methylenedianiline | |
| US2528267A (en) | Eobeet j | |
| US20060173215A1 (en) | Process for the preparation of 1-amino-3,5-dimethyladamantane hydrochloride | |
| US20230348412A1 (en) | Method for preparing glp-1 receptor agonist | |
| US3769347A (en) | Production of d,d'-2,2'-(ethylenediimino) di-1-butanol hydrochloride | |
| AU2002229575B2 (en) | A process for the preparation of 1-(aminomethyl) cyclohexaneacetic acid | |
| CA2219308C (en) | New process for the preparation of ropivacaine hydrochloride monohydrate | |
| US3579587A (en) | Process for the preparation of the dextrorotatory 2,2' - (ethylene-di-imino)-di-1-butanol | |
| US3579586A (en) | Process for the preparation of the dextrorotatory 2,2' - (ethylene-di-imino)-di-1-butanol | |
| US3116332A (en) | Resolution of racemic aminoisopropanol | |
| US2876218A (en) | Amination of alpha-halo-epsiloncaprolactams | |
| US2721217A (en) | Method of preparing diaminoguanidine hydrochloride | |
| JP2503056B2 (ja) | 1,6―ジ(n▲上3▼―シアノ―n▲上1▼―グアニジノ)ヘキサンの製造方法 | |
| US3574740A (en) | Method of preparing methane sulfonamide and its derivatives | |
| US2415786A (en) | Unsymmetrically substituted piperazines | |
| US3717680A (en) | PURIFICATION OF p-AMINOPHENOL | |
| US3876703A (en) | Purification of p-aminophenol | |
| US3864341A (en) | 3-Morpholino-2-cyanoacrylamide | |
| US2991284A (en) | Novel derivatives of cocarboxylase | |
| US3059029A (en) | Process for alkyl and aralkyl biguanides | |
| US3641003A (en) | Method of preparing an alpha-amino-omega-lactam | |
| US4873326A (en) | Process for the preparation of N-alkylated caprolactams | |
| US2518264A (en) | Method of preparing imidazolidones | |
| US2164587A (en) | Method of producing amines |