CA1058181A - Bispidine compounds - Google Patents
Bispidine compoundsInfo
- Publication number
- CA1058181A CA1058181A CA229,274A CA229274A CA1058181A CA 1058181 A CA1058181 A CA 1058181A CA 229274 A CA229274 A CA 229274A CA 1058181 A CA1058181 A CA 1058181A
- Authority
- CA
- Canada
- Prior art keywords
- group
- pharmaceutically acceptable
- chemical equivalent
- methyl
- obvious chemical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PTPQJKANBKHDPM-UHFFFAOYSA-N 3,7-diazabicyclo[3.3.1]nonane Chemical class C1NCC2CNCC1C2 PTPQJKANBKHDPM-UHFFFAOYSA-N 0.000 title claims description 7
- 238000000034 method Methods 0.000 claims abstract description 37
- 150000001875 compounds Chemical class 0.000 claims abstract description 22
- 238000006683 Mannich reaction Methods 0.000 claims abstract description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 8
- 238000002360 preparation method Methods 0.000 claims abstract description 7
- 150000001412 amines Chemical class 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 239000000126 substance Substances 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 13
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- -1 (2-phenyl)ethyl group Chemical group 0.000 claims description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- 229960000583 acetic acid Drugs 0.000 claims description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 235000019256 formaldehyde Nutrition 0.000 claims description 4
- 229960004279 formaldehyde Drugs 0.000 claims description 4
- 239000012362 glacial acetic acid Substances 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 claims description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 3
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 229920002866 paraformaldehyde Polymers 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- 239000008096 xylene Substances 0.000 claims description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 11
- 150000004820 halides Chemical class 0.000 claims 3
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 2
- 238000006722 reduction reaction Methods 0.000 claims 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 239000004305 biphenyl Substances 0.000 claims 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 239000012458 free base Substances 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 239000003416 antiarrhythmic agent Substances 0.000 abstract description 5
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical class OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 abstract 1
- 229940030602 cardiac therapy drug Drugs 0.000 abstract 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 206010022998 Irritability Diseases 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CSRBWSGDNSONNP-UHFFFAOYSA-N 3-methyl-3,7-diazabicyclo[3.3.1]nonane Chemical compound C1NCC2CN(C)CC1C2 CSRBWSGDNSONNP-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 208000000418 Premature Cardiac Complexes Diseases 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000036747 functional refractory period Effects 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 230000000297 inotrophic effect Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 206010047302 ventricular tachycardia Diseases 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- JLNYNSOPLYOWFA-UHFFFAOYSA-N (4-chloro-1-phenylbutyl)benzene Chemical compound C=1C=CC=CC=1C(CCCCl)C1=CC=CC=C1 JLNYNSOPLYOWFA-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 206010015856 Extrasystoles Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 208000008131 Ventricular Flutter Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- REYFJDPCWQRWAA-UHFFFAOYSA-N antazoline Chemical compound N=1CCNC=1CN(C=1C=CC=CC=1)CC1=CC=CC=C1 REYFJDPCWQRWAA-UHFFFAOYSA-N 0.000 description 1
- 230000002763 arrhythmic effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- OQROAIRCEOBYJA-UHFFFAOYSA-N bromodiphenylmethane Chemical compound C=1C=CC=CC=1C(Br)C1=CC=CC=C1 OQROAIRCEOBYJA-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- REQCZEXYDRLIBE-UHFFFAOYSA-N procainamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 REQCZEXYDRLIBE-UHFFFAOYSA-N 0.000 description 1
- 229960000244 procainamide Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000036279 refractory period Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2428792A DE2428792A1 (de) | 1974-06-14 | 1974-06-14 | Neue antiarrhythmika |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1058181A true CA1058181A (en) | 1979-07-10 |
Family
ID=5918151
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA229,274A Expired CA1058181A (en) | 1974-06-14 | 1975-06-13 | Bispidine compounds |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3962449A (OSRAM) |
| JP (1) | JPS5111791A (OSRAM) |
| AT (1) | AT343660B (OSRAM) |
| BE (1) | BE830153A (OSRAM) |
| CA (1) | CA1058181A (OSRAM) |
| CH (1) | CH618168A5 (OSRAM) |
| DE (1) | DE2428792A1 (OSRAM) |
| FI (1) | FI57759C (OSRAM) |
| FR (1) | FR2274300A1 (OSRAM) |
| GB (1) | GB1445967A (OSRAM) |
| NL (1) | NL7506886A (OSRAM) |
| SE (1) | SE420727B (OSRAM) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2726571A1 (de) * | 1977-06-13 | 1978-12-21 | Basf Ag | Neue bispidinderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten |
| DE3112055A1 (de) * | 1981-03-27 | 1982-10-07 | Basf Ag, 6700 Ludwigshafen | Bispidinderivate, ihre herstellung und diese enthaltende arzneimittel |
| HU184960B (en) * | 1981-07-20 | 1984-11-28 | Richter Gedeon Vegyeszet | Process for preparing new derivatives of 3,7-diazabicyclo/3.3.1/ nonane |
| DE3234697A1 (de) * | 1982-09-18 | 1984-03-22 | Kali-Chemie Pharma Gmbh, 3000 Hannover | Neue diazabicyclo-(3,3,1)-nonane |
| DE3722134A1 (de) * | 1987-07-04 | 1989-01-19 | Kali Chemie Pharma Gmbh | 3-sulfonyl-3,7-diazabicyclo(3,3,1)nonan- verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| PT88381B (pt) * | 1987-09-09 | 1995-07-06 | Kali Chemie Pharma Gmbh | Processo para a preparacao de novos compostos 3,7-diazabiciclo{3,3,1} nonano, e de composicoes farmaceuticas que contem estes compostos |
| DE3730224A1 (de) * | 1987-09-09 | 1989-03-23 | Kali Chemie Pharma Gmbh | 3-cinnamyl-3,7-diazabicyclo(3,3,1) nonan-verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE4019080A1 (de) * | 1990-06-15 | 1991-12-19 | Kali Chemie Pharma Gmbh | Neue 3,7-diazabicycolo (3,3,1)nonan-verbindungen enthaltende arzneimittel |
| DE4324086A1 (de) * | 1993-07-17 | 1995-01-19 | Basf Ag | Verfahren zur Herstellung von N,N`-Dibenzylbispidin |
| SE9704709D0 (sv) | 1997-12-17 | 1997-12-17 | Astra Ab | Pharmaceutically active compounds |
| US20040229900A1 (en) * | 1999-06-16 | 2004-11-18 | Astrazeneca Ab | Bispidine compounds useful in the treatment of cardiac arrythmias |
| SE9902270D0 (sv) | 1999-06-16 | 1999-06-16 | Astra Ab | Pharmaceutically active compounds |
| US20050004113A1 (en) * | 1999-06-16 | 2005-01-06 | Astrazeneca Ab | New bispidine compounds useful in the treatment of cardiac arrhythmias |
| US7038054B1 (en) * | 1999-09-03 | 2006-05-02 | Pharmacopeia Drug Discovery, Inc. | Diazabicyclononane scaffold for combinatorial synthesis |
| SE9904765D0 (sv) | 1999-12-23 | 1999-12-23 | Astra Ab | Pharmaceutically-useful compounds |
| SE0002603D0 (sv) * | 2000-07-07 | 2000-07-07 | Astrazeneca Ab | New compounds |
| US6808924B1 (en) | 2000-07-11 | 2004-10-26 | Claudia Lanari | Mouse mammary tumor lines expressing estrogen and progesterone receptors |
| AR030756A1 (es) * | 2000-10-02 | 2003-09-03 | Astrazeneca Ab | Compuesto de oxabispidina util en el tratamiento de arritmias cardiacas |
| SE0003795D0 (sv) * | 2000-10-20 | 2000-10-20 | Astrazeneca Ab | Pharmaceutically useful compounds |
| SE0100326D0 (sv) * | 2001-02-02 | 2001-02-02 | Astrazeneca Ab | New compounds |
| SE0302775D0 (sv) * | 2003-10-20 | 2003-10-20 | Astrazeneca Ab | Chemical compound and assay |
| SE0401539D0 (sv) | 2004-06-15 | 2004-06-15 | Astrazeneca Ab | New compounds |
| SE0401540D0 (sv) * | 2004-06-15 | 2004-06-15 | Astrazeneca Ab | New compounds |
| WO2006135316A1 (en) * | 2005-06-13 | 2006-12-21 | Astrazeneca Ab | New oxabispidine compounds for the treatment of cardiac arrhythmias |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL124628C (OSRAM) * | 1963-02-05 |
-
1974
- 1974-06-14 DE DE2428792A patent/DE2428792A1/de not_active Withdrawn
-
1975
- 1975-05-20 GB GB2137975A patent/GB1445967A/en not_active Expired
- 1975-05-29 FR FR7516828A patent/FR2274300A1/fr active Granted
- 1975-06-10 FI FI751726A patent/FI57759C/fi not_active IP Right Cessation
- 1975-06-10 US US05/585,606 patent/US3962449A/en not_active Expired - Lifetime
- 1975-06-10 NL NL7506886A patent/NL7506886A/xx not_active Application Discontinuation
- 1975-06-12 AT AT451475A patent/AT343660B/de not_active IP Right Cessation
- 1975-06-12 BE BE157260A patent/BE830153A/xx unknown
- 1975-06-12 SE SE7506743A patent/SE420727B/xx unknown
- 1975-06-13 CA CA229,274A patent/CA1058181A/en not_active Expired
- 1975-06-13 CH CH771275A patent/CH618168A5/de not_active IP Right Cessation
- 1975-06-13 JP JP50071827A patent/JPS5111791A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1445967A (en) | 1976-08-11 |
| ATA451475A (de) | 1977-10-15 |
| FI751726A7 (OSRAM) | 1975-12-15 |
| FI57759C (fi) | 1980-10-10 |
| JPS5111791A (OSRAM) | 1976-01-30 |
| FR2274300A1 (fr) | 1976-01-09 |
| BE830153A (fr) | 1975-12-12 |
| FI57759B (fi) | 1980-06-30 |
| AT343660B (de) | 1978-06-12 |
| CH618168A5 (OSRAM) | 1980-07-15 |
| NL7506886A (nl) | 1975-12-16 |
| FR2274300B1 (OSRAM) | 1978-11-10 |
| SE420727B (sv) | 1981-10-26 |
| US3962449A (en) | 1976-06-08 |
| SE7506743L (sv) | 1975-12-15 |
| DE2428792A1 (de) | 1976-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1058181A (en) | Bispidine compounds | |
| EP1904439B1 (en) | Sphingosine kinase inhibitors | |
| US5637583A (en) | Aminocyclohexylesters and uses thereof | |
| US4103012A (en) | Indolizine derivatives, pharmaceutical compositions and methods containing same | |
| IE912492A1 (en) | 1,4-disubstituted piperazines | |
| US3927011A (en) | 2-Aminoalkyl-1-(pyridylcarbonylphenyl)imidazole compounds | |
| US4018830A (en) | Phenylthioaralkylamines | |
| US3825558A (en) | Substituted aminopropoxy-2-indolinones | |
| GB1568398A (en) | Triazolo pyridazine derivatives | |
| US3141019A (en) | Chaohj | |
| JPH05271208A (ja) | 1,4‐ベンゾチアゼピン誘導体 | |
| US3931222A (en) | Tetrahydro-carbazole derivates | |
| US5747508A (en) | Amidinohydrazones of ketones derived from benzo B!furan, methods for their production, and pharmaceuticals containing these compounds | |
| US4089966A (en) | 5-N-(3-Amino-2-hydroxy-propyl)-amino-1,2,4-oxadiazole derivatives, processes for their preparation and applications thereof | |
| SE438857B (sv) | Sett att framstella kromonderivat | |
| US4173636A (en) | Decahydroquinolines, pharmaceutical compositions and methods of use | |
| EP0352639B1 (de) | p-Hydroxiphenon-Derivate und deren Anwendung | |
| Zelesko et al. | Cardiac-slowing amidines containing the 3-thioindole group. Potential antianginal agents | |
| US4530923A (en) | N-acetamilide, N-(phenoxy-2-propanol)- and N-(phenylamino-2-propanol)-cyclicamines | |
| NO123720B (OSRAM) | ||
| US2933495A (en) | 10-aminoalkanol-phenothiazines | |
| JPH04217945A (ja) | 置換アルキルベンゼン誘導体およびそれを含有する抗潰瘍剤 | |
| US3522239A (en) | Aminoether derivatives of 9,10-ethano-9,10-dihydro-anthracene | |
| HU180492B (en) | Process for preparing indolizine derivatives and pharmaceutical composition containing such compounds as active materials | |
| JP3786984B2 (ja) | ピペラジン誘導体 |