CA1052797A - Spiro-cyclopropanes - Google Patents
Spiro-cyclopropanesInfo
- Publication number
- CA1052797A CA1052797A CA208,231A CA208231A CA1052797A CA 1052797 A CA1052797 A CA 1052797A CA 208231 A CA208231 A CA 208231A CA 1052797 A CA1052797 A CA 1052797A
- Authority
- CA
- Canada
- Prior art keywords
- group
- cyclopropane carboxylate
- dimethyl
- cyclopropane
- phenoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 11
- -1 phenoxy-substituted phenyl group Chemical group 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 241000238631 Hexapoda Species 0.000 claims description 2
- 241000607479 Yersinia pestis Species 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 239000012433 hydrogen halide Substances 0.000 claims description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 2
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 claims 6
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 150000001942 cyclopropanes Chemical class 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- 231100000167 toxic agent Toxicity 0.000 description 5
- 239000003440 toxic substance Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 230000000895 acaricidal effect Effects 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 230000000749 insecticidal effect Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 241000255925 Diptera Species 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 230000000361 pesticidal effect Effects 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 241000238876 Acari Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 241000171293 Megoura viciae Species 0.000 description 2
- 241001608567 Phaedon cochleariae Species 0.000 description 2
- 240000006677 Vicia faba Species 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000004546 suspension concentrate Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- GBFUISVVTYNAKO-UHFFFAOYSA-N 1-(3-phenoxyphenyl)prop-2-yn-1-ol Chemical compound C#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GBFUISVVTYNAKO-UHFFFAOYSA-N 0.000 description 1
- UJUNUASMYSTBSK-UHFFFAOYSA-N 1-(bromomethyl)-3-phenoxybenzene Chemical compound BrCC1=CC=CC(OC=2C=CC=CC=2)=C1 UJUNUASMYSTBSK-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- DSQFSFBBPSALMS-UHFFFAOYSA-N 2-bromo-2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CC(Br)C1=CC=CC(OC=2C=CC=CC=2)=C1 DSQFSFBBPSALMS-UHFFFAOYSA-N 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 240000008100 Brassica rapa Species 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DCOMABVGRFTMBF-UHFFFAOYSA-N C1(CC1)C(=O)O.C1CCC1 Chemical compound C1(CC1)C(=O)O.C1CCC1 DCOMABVGRFTMBF-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000255969 Pieris brassicae Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241001261167 Tegenaria domestica Species 0.000 description 1
- 241001454294 Tetranychus Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 235000002098 Vicia faba var. major Nutrition 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 229950011148 cyclopropane Drugs 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000021552 granulated sugar Nutrition 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000008268 mayonnaise Substances 0.000 description 1
- 235000010746 mayonnaise Nutrition 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4692673A GB1437987A (enExample) | 1973-10-08 | 1973-10-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1052797A true CA1052797A (en) | 1979-04-17 |
Family
ID=10443099
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA208,231A Expired CA1052797A (en) | 1973-10-08 | 1974-08-30 | Spiro-cyclopropanes |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3950535A (enExample) |
| JP (1) | JPS5821885B2 (enExample) |
| AR (1) | AR215115A1 (enExample) |
| BE (1) | BE820418A (enExample) |
| BR (1) | BR7408318A (enExample) |
| CA (1) | CA1052797A (enExample) |
| CH (1) | CH608170A5 (enExample) |
| DD (1) | DD115841A5 (enExample) |
| DE (1) | DE2447735A1 (enExample) |
| EG (1) | EG11527A (enExample) |
| ES (1) | ES430753A1 (enExample) |
| FR (1) | FR2246533B1 (enExample) |
| GB (1) | GB1437987A (enExample) |
| HU (1) | HU172534B (enExample) |
| IL (1) | IL45795A (enExample) |
| IT (1) | IT1046668B (enExample) |
| NL (1) | NL7413166A (enExample) |
| OA (1) | OA04790A (enExample) |
| TR (1) | TR18223A (enExample) |
| ZA (1) | ZA746362B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4060632A (en) | 1975-02-13 | 1977-11-29 | American Cyanamid Company | Method for controlling acarina |
| US3966959A (en) | 1975-02-13 | 1976-06-29 | American Cyanamid Company | Insecticidal and acaricidal, pyrethroid compounds |
| FR2300559A1 (fr) * | 1975-02-13 | 1976-09-10 | American Cyanamid Co | Composes pyrethroides utiles comme insecticides et procede de leur preparation |
| US4118510A (en) * | 1976-03-22 | 1978-10-03 | Shell Oil Company | Dispirocyclopropane carboxylate pesticides |
| GB1577136A (en) * | 1976-03-22 | 1980-10-22 | Shell Int Research | Cyclopropane carboxylate ester derivatives and their use as pesticides |
| GB1580193A (en) * | 1976-04-22 | 1980-11-26 | Nat Res Dev | Phenyl acetic acid derivatives |
| US4221812A (en) * | 1978-02-09 | 1980-09-09 | Ciba-Geigy Corporation | Pesticidal spiropentanecarboxylates |
| DE2825314A1 (de) * | 1978-06-09 | 1979-12-20 | Bayer Ag | Substituierte spiropentancarbonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS515450B1 (enExample) * | 1971-06-29 | 1976-02-20 |
-
1973
- 1973-10-08 GB GB4692673A patent/GB1437987A/en not_active Expired
-
1974
- 1974-08-30 CA CA208,231A patent/CA1052797A/en not_active Expired
- 1974-09-27 BE BE1006199A patent/BE820418A/xx not_active IP Right Cessation
- 1974-09-30 US US05/510,197 patent/US3950535A/en not_active Expired - Lifetime
- 1974-10-04 DD DD181521A patent/DD115841A5/xx unknown
- 1974-10-04 IT IT28088/74A patent/IT1046668B/it active
- 1974-10-07 JP JP49114789A patent/JPS5821885B2/ja not_active Expired
- 1974-10-07 FR FR7433630A patent/FR2246533B1/fr not_active Expired
- 1974-10-07 HU HU74SE00001747A patent/HU172534B/hu unknown
- 1974-10-07 CH CH1344174A patent/CH608170A5/xx not_active IP Right Cessation
- 1974-10-07 TR TR18223A patent/TR18223A/xx unknown
- 1974-10-07 ZA ZA00746362A patent/ZA746362B/xx unknown
- 1974-10-07 NL NL7413166A patent/NL7413166A/xx not_active Application Discontinuation
- 1974-10-07 ES ES430753A patent/ES430753A1/es not_active Expired
- 1974-10-07 DE DE19742447735 patent/DE2447735A1/de not_active Withdrawn
- 1974-10-07 OA OA55316A patent/OA04790A/xx unknown
- 1974-10-07 IL IL45795A patent/IL45795A/xx unknown
- 1974-10-07 AR AR155954A patent/AR215115A1/es active
- 1974-10-07 BR BR8318/74A patent/BR7408318A/pt unknown
- 1974-10-08 EG EG456/74A patent/EG11527A/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| BR7408318A (pt) | 1976-04-27 |
| GB1437987A (enExample) | 1976-06-03 |
| NL7413166A (nl) | 1975-04-10 |
| US3950535A (en) | 1976-04-13 |
| IL45795A (en) | 1978-01-31 |
| TR18223A (tr) | 1976-11-25 |
| ZA746362B (en) | 1975-11-26 |
| EG11527A (en) | 1977-08-15 |
| DE2447735A1 (de) | 1975-08-21 |
| FR2246533B1 (enExample) | 1978-03-24 |
| IL45795A0 (en) | 1974-12-31 |
| JPS5821885B2 (ja) | 1983-05-04 |
| HU172534B (hu) | 1978-09-28 |
| BE820418A (nl) | 1975-03-27 |
| ES430753A1 (es) | 1977-05-16 |
| AR215115A1 (es) | 1979-09-14 |
| JPS5062957A (enExample) | 1975-05-29 |
| AU7400474A (en) | 1976-04-08 |
| IT1046668B (it) | 1980-07-31 |
| DD115841A5 (enExample) | 1975-10-20 |
| FR2246533A1 (enExample) | 1975-05-02 |
| CH608170A5 (enExample) | 1978-12-29 |
| OA04790A (fr) | 1980-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3927068A (en) | Pesticidal cyclopropane derivatives | |
| US4073812A (en) | Benzyl ethers | |
| US4042710A (en) | Alpha-cyano-phenoxybenzyl-isovalerates | |
| CA1052797A (en) | Spiro-cyclopropanes | |
| JPS59196836A (ja) | 3−フエノキシベンジル−(2−フエニル−2,2−アルキレン−エチル)エ−テル及び−チオエ−テル,並びに該化合物を含有する有害生物防除剤 | |
| US4103017A (en) | Pesticidal 2-iminothiazoline derivatives | |
| US3828043A (en) | 5-acyl barbituric acid derivatives | |
| CA1127657A (en) | Pesticidal spiroalkanecyclopropylcarboxylic acid derivatives | |
| CA1046067A (en) | 1,2,4-oxidiazole and thiadiazole esters and composition containing same | |
| US3993774A (en) | Pesticidal cyclopropane derivatives | |
| CA1078404A (en) | Pesticidal alpha-thioamidophenoxybenzyl esters | |
| US3973035A (en) | Cyanobenzyl cyclopropane carboxylate pesticides | |
| US3987193A (en) | Pesticidal dihalovinyl-spiroalkanecyclopropane derivatives | |
| US4021466A (en) | Cyclopropane carboxylates | |
| US3306726A (en) | Method for the control of weeds | |
| US4012522A (en) | Pesticidal cyclopropane derivatives | |
| US4100298A (en) | Dispirocyclopropane carboxylate pesticides | |
| US4237163A (en) | Hydrazono-substituted cyclopropanecarboxylate pesticides | |
| US3784554A (en) | Pesticidal phosphorylated thiazole derivatives | |
| US4100363A (en) | 2-Substituted isovaleric acid ester pesticides | |
| US3637800A (en) | Polychloro- or bromomucononitrile | |
| US4118510A (en) | Dispirocyclopropane carboxylate pesticides | |
| US4150160A (en) | Pesticidal carbimidocarbonylphenylformamidines | |
| US3574748A (en) | Beta-alkoxy-acrylic acid amides | |
| US3455912A (en) | Benzodioxan-n-methylcarbamates |