EG11527A - A novel cyclopropane derivatives used as insecticide - Google Patents
A novel cyclopropane derivatives used as insecticideInfo
- Publication number
- EG11527A EG11527A EG456/74A EG45674A EG11527A EG 11527 A EG11527 A EG 11527A EG 456/74 A EG456/74 A EG 456/74A EG 45674 A EG45674 A EG 45674A EG 11527 A EG11527 A EG 11527A
- Authority
- EG
- Egypt
- Prior art keywords
- insecticide
- derivatives used
- cyclopropane derivatives
- novel cyclopropane
- novel
- Prior art date
Links
- 125000001559 cyclopropyl group Chemical class [H]C1([H])C([H])([H])C1([H])* 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4692673A GB1437987A (enExample) | 1973-10-08 | 1973-10-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| EG11527A true EG11527A (en) | 1977-08-15 |
Family
ID=10443099
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EG456/74A EG11527A (en) | 1973-10-08 | 1974-10-08 | A novel cyclopropane derivatives used as insecticide |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3950535A (enExample) |
| JP (1) | JPS5821885B2 (enExample) |
| AR (1) | AR215115A1 (enExample) |
| BE (1) | BE820418A (enExample) |
| BR (1) | BR7408318A (enExample) |
| CA (1) | CA1052797A (enExample) |
| CH (1) | CH608170A5 (enExample) |
| DD (1) | DD115841A5 (enExample) |
| DE (1) | DE2447735A1 (enExample) |
| EG (1) | EG11527A (enExample) |
| ES (1) | ES430753A1 (enExample) |
| FR (1) | FR2246533B1 (enExample) |
| GB (1) | GB1437987A (enExample) |
| HU (1) | HU172534B (enExample) |
| IL (1) | IL45795A (enExample) |
| IT (1) | IT1046668B (enExample) |
| NL (1) | NL7413166A (enExample) |
| OA (1) | OA04790A (enExample) |
| TR (1) | TR18223A (enExample) |
| ZA (1) | ZA746362B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4060632A (en) | 1975-02-13 | 1977-11-29 | American Cyanamid Company | Method for controlling acarina |
| US3966959A (en) | 1975-02-13 | 1976-06-29 | American Cyanamid Company | Insecticidal and acaricidal, pyrethroid compounds |
| FR2300559A1 (fr) * | 1975-02-13 | 1976-09-10 | American Cyanamid Co | Composes pyrethroides utiles comme insecticides et procede de leur preparation |
| US4118510A (en) * | 1976-03-22 | 1978-10-03 | Shell Oil Company | Dispirocyclopropane carboxylate pesticides |
| GB1577136A (en) * | 1976-03-22 | 1980-10-22 | Shell Int Research | Cyclopropane carboxylate ester derivatives and their use as pesticides |
| GB1580193A (en) * | 1976-04-22 | 1980-11-26 | Nat Res Dev | Phenyl acetic acid derivatives |
| US4221812A (en) * | 1978-02-09 | 1980-09-09 | Ciba-Geigy Corporation | Pesticidal spiropentanecarboxylates |
| DE2825314A1 (de) * | 1978-06-09 | 1979-12-20 | Bayer Ag | Substituierte spiropentancarbonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS515450B1 (enExample) * | 1971-06-29 | 1976-02-20 |
-
1973
- 1973-10-08 GB GB4692673A patent/GB1437987A/en not_active Expired
-
1974
- 1974-08-30 CA CA208,231A patent/CA1052797A/en not_active Expired
- 1974-09-27 BE BE1006199A patent/BE820418A/xx not_active IP Right Cessation
- 1974-09-30 US US05/510,197 patent/US3950535A/en not_active Expired - Lifetime
- 1974-10-04 DD DD181521A patent/DD115841A5/xx unknown
- 1974-10-04 IT IT28088/74A patent/IT1046668B/it active
- 1974-10-07 JP JP49114789A patent/JPS5821885B2/ja not_active Expired
- 1974-10-07 FR FR7433630A patent/FR2246533B1/fr not_active Expired
- 1974-10-07 HU HU74SE00001747A patent/HU172534B/hu unknown
- 1974-10-07 CH CH1344174A patent/CH608170A5/xx not_active IP Right Cessation
- 1974-10-07 TR TR18223A patent/TR18223A/xx unknown
- 1974-10-07 ZA ZA00746362A patent/ZA746362B/xx unknown
- 1974-10-07 NL NL7413166A patent/NL7413166A/xx not_active Application Discontinuation
- 1974-10-07 ES ES430753A patent/ES430753A1/es not_active Expired
- 1974-10-07 DE DE19742447735 patent/DE2447735A1/de not_active Withdrawn
- 1974-10-07 OA OA55316A patent/OA04790A/xx unknown
- 1974-10-07 IL IL45795A patent/IL45795A/xx unknown
- 1974-10-07 AR AR155954A patent/AR215115A1/es active
- 1974-10-07 BR BR8318/74A patent/BR7408318A/pt unknown
- 1974-10-08 EG EG456/74A patent/EG11527A/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| BR7408318A (pt) | 1976-04-27 |
| GB1437987A (enExample) | 1976-06-03 |
| NL7413166A (nl) | 1975-04-10 |
| US3950535A (en) | 1976-04-13 |
| IL45795A (en) | 1978-01-31 |
| TR18223A (tr) | 1976-11-25 |
| ZA746362B (en) | 1975-11-26 |
| CA1052797A (en) | 1979-04-17 |
| DE2447735A1 (de) | 1975-08-21 |
| FR2246533B1 (enExample) | 1978-03-24 |
| IL45795A0 (en) | 1974-12-31 |
| JPS5821885B2 (ja) | 1983-05-04 |
| HU172534B (hu) | 1978-09-28 |
| BE820418A (nl) | 1975-03-27 |
| ES430753A1 (es) | 1977-05-16 |
| AR215115A1 (es) | 1979-09-14 |
| JPS5062957A (enExample) | 1975-05-29 |
| AU7400474A (en) | 1976-04-08 |
| IT1046668B (it) | 1980-07-31 |
| DD115841A5 (enExample) | 1975-10-20 |
| FR2246533A1 (enExample) | 1975-05-02 |
| CH608170A5 (enExample) | 1978-12-29 |
| OA04790A (fr) | 1980-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG11495A (en) | Cyclohexane derivatives used as herbicides | |
| EG11276A (en) | Novel cyclopropane derivatives use as pesticidal | |
| PH10979A (en) | Pyrethroidal pesticides | |
| EG11527A (en) | A novel cyclopropane derivatives used as insecticide | |
| EG11557A (en) | N,n dialkylamino-carbanrate substituted oxy-pyridine derivatives used as insecticides | |
| AU6544274A (en) | Insecticidal lacquers | |
| EG11374A (en) | New meta-diurethanes compounds used as herbicides | |
| ZA743030B (en) | Novel pesticides | |
| CS222210B2 (en) | Sprayer | |
| BG25187A3 (en) | A herbicide | |
| AU7248474A (en) | Herbicide | |
| BG24530A3 (en) | Insecticide | |
| AU7406874A (en) | Herbicide | |
| EG11643A (en) | Diphenyl-3-formazancarbonitrile insecticides | |
| ZA744217B (en) | Herbicides | |
| AU7234574A (en) | Herbicide | |
| AU6921274A (en) | Herbicide | |
| CA1018178A (en) | Insecticidal substituted alkenes | |
| AU490076B1 (en) | Accompanied by a provisional specification | |
| AU488919B1 (en) | Accompanied by a provisional specification | |
| EG11774A (en) | Herbicides | |
| ZA747182B (en) | Insecticides | |
| AU6747174A (en) | Herbicide | |
| AU6593774A (en) | Herbicide | |
| AU6979674A (en) | Herbicide |