CA1050540A - Process of producing a pyrazine derivative - Google Patents
Process of producing a pyrazine derivativeInfo
- Publication number
- CA1050540A CA1050540A CA217,443A CA217443A CA1050540A CA 1050540 A CA1050540 A CA 1050540A CA 217443 A CA217443 A CA 217443A CA 1050540 A CA1050540 A CA 1050540A
- Authority
- CA
- Canada
- Prior art keywords
- group
- chloro
- methoxypyrazine
- carboxamide
- ethylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 29
- 150000003216 pyrazines Chemical class 0.000 title claims abstract description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 22
- 125000003277 amino group Chemical group 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 10
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 8
- 125000005843 halogen group Chemical group 0.000 claims abstract description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 7
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims abstract description 5
- 150000003839 salts Chemical class 0.000 claims abstract description 5
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 4
- 231100000252 nontoxic Toxicity 0.000 claims abstract description 4
- 230000003000 nontoxic effect Effects 0.000 claims abstract description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 4
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims abstract description 4
- -1 benzoylamino, pyrrolidino, piperidino, morpholino, piperazino Chemical group 0.000 claims description 44
- NIPZZXUFJPQHNH-UHFFFAOYSA-N pyrazine-2-carboxylic acid Chemical compound OC(=O)C1=CN=CC=N1 NIPZZXUFJPQHNH-UHFFFAOYSA-N 0.000 claims description 19
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 150000001412 amines Chemical class 0.000 claims description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 3
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims 2
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 claims 1
- 125000005236 alkanoylamino group Chemical group 0.000 claims 1
- 125000006323 alkenyl amino group Chemical group 0.000 claims 1
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 41
- 230000000694 effects Effects 0.000 abstract description 21
- 230000003474 anti-emetic effect Effects 0.000 abstract description 20
- 125000000217 alkyl group Chemical group 0.000 abstract description 15
- 230000004936 stimulating effect Effects 0.000 abstract description 11
- 125000003545 alkoxy group Chemical group 0.000 abstract description 10
- 230000030135 gastric motility Effects 0.000 abstract description 7
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 5
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract description 5
- 125000005842 heteroatom Chemical group 0.000 abstract description 4
- 239000013078 crystal Substances 0.000 description 90
- 239000000203 mixture Substances 0.000 description 79
- 239000000243 solution Substances 0.000 description 79
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 65
- 238000002844 melting Methods 0.000 description 64
- 230000008018 melting Effects 0.000 description 64
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 62
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 60
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 57
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- 238000000921 elemental analysis Methods 0.000 description 54
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- 239000000284 extract Substances 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 37
- 239000002904 solvent Substances 0.000 description 37
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- 229960001701 chloroform Drugs 0.000 description 31
- 238000006243 chemical reaction Methods 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- 239000000047 product Substances 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000002253 acid Substances 0.000 description 24
- 238000001914 filtration Methods 0.000 description 22
- 229960004592 isopropanol Drugs 0.000 description 19
- 238000004519 manufacturing process Methods 0.000 description 19
- 238000001816 cooling Methods 0.000 description 18
- ZBVYLXKCFPUFLC-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-3-methoxypyrazine-2-carboxylic acid Chemical compound CCNC1=NC(OC)=C(C(O)=O)N=C1Cl ZBVYLXKCFPUFLC-UHFFFAOYSA-N 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 229960000443 hydrochloric acid Drugs 0.000 description 15
- 235000011167 hydrochloric acid Nutrition 0.000 description 15
- 239000000463 material Substances 0.000 description 15
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 14
- 229960004503 metoclopramide Drugs 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- IPEHBUMCGVEMRF-UHFFFAOYSA-N pyrazinecarboxamide Chemical compound NC(=O)C1=CN=CC=N1 IPEHBUMCGVEMRF-UHFFFAOYSA-N 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- NEKPXDIPQCARFO-UHFFFAOYSA-N methyl 5,6-dichloro-3-methoxypyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(Cl)N=C1OC NEKPXDIPQCARFO-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000012442 inert solvent Substances 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- 239000002111 antiemetic agent Substances 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- UNRBEYYLYRXYCG-UHFFFAOYSA-N (1-ethylpyrrolidin-2-yl)methanamine Chemical compound CCN1CCCC1CN UNRBEYYLYRXYCG-UHFFFAOYSA-N 0.000 description 6
- 208000009132 Catalepsy Diseases 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 206010047853 Waxy flexibility Diseases 0.000 description 6
- 150000003857 carboxamides Chemical class 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 206010047700 Vomiting Diseases 0.000 description 5
- 150000008065 acid anhydrides Chemical class 0.000 description 5
- 230000002903 catalepsic effect Effects 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 230000004899 motility Effects 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- LZYQFKPLSBGGTK-UHFFFAOYSA-N 3-methoxypyrazine-2-carboxamide Chemical compound COC1=NC=CN=C1C(N)=O LZYQFKPLSBGGTK-UHFFFAOYSA-N 0.000 description 4
- ZZLDIUMQXPQQTD-UHFFFAOYSA-N 5-(ethylamino)-3-methoxypyrazine-2-carboxamide Chemical compound CCNC1=CN=C(C(N)=O)C(OC)=N1 ZZLDIUMQXPQQTD-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- FHXLEYWLSMPTFI-UHFFFAOYSA-N 5-amino-6-bromo-3-methoxypyrazine-2-carboxylic acid Chemical compound COC1=NC(N)=C(Br)N=C1C(O)=O FHXLEYWLSMPTFI-UHFFFAOYSA-N 0.000 description 3
- HJOGYDAGMFMCQL-UHFFFAOYSA-N 5-amino-6-chloro-n-[2-(diethylamino)ethyl]-3-ethoxypyrazine-2-carboxamide Chemical compound CCOC1=NC(N)=C(Cl)N=C1C(=O)NCCN(CC)CC HJOGYDAGMFMCQL-UHFFFAOYSA-N 0.000 description 3
- LKKUPGOLHLUYNV-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxypyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)NCC1N(CC)CCC1 LKKUPGOLHLUYNV-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 229940125683 antiemetic agent Drugs 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- KWBNVXZVADOYHD-UHFFFAOYSA-N methyl 5-amino-6-chloro-3-methoxypyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(N)N=C1OC KWBNVXZVADOYHD-UHFFFAOYSA-N 0.000 description 3
- FWDCRELRQOLPET-UHFFFAOYSA-N methyl 5-anilino-6-chloro-3-methoxypyrazine-2-carboxylate Chemical compound N1=C(OC)C(C(=O)OC)=NC(Cl)=C1NC1=CC=CC=C1 FWDCRELRQOLPET-UHFFFAOYSA-N 0.000 description 3
- HVNZWWOPTRCWSC-UHFFFAOYSA-N methyl 6-chloro-5-(ethylamino)-3-methoxypyrazine-2-carboxylate Chemical compound CCNC1=NC(OC)=C(C(=O)OC)N=C1Cl HVNZWWOPTRCWSC-UHFFFAOYSA-N 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 210000002784 stomach Anatomy 0.000 description 3
- 238000010254 subcutaneous injection Methods 0.000 description 3
- 239000007929 subcutaneous injection Substances 0.000 description 3
- OVHHNKPYYVQCLN-LJQANCHMSA-N (2r)-4-(6-chloronaphthalen-2-yl)sulfonyl-1-(5-methyl-6,7-dihydro-4h-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide Chemical compound C1=C(Cl)C=CC2=CC(S(=O)(=O)N3CCN([C@H](C3)C(N)=O)C(=O)C3=NC=4CCN(CC=4S3)C)=CC=C21 OVHHNKPYYVQCLN-LJQANCHMSA-N 0.000 description 2
- BHDIRZRYVVVUSF-UHFFFAOYSA-N 6-benzylsulfanyl-5-(ethylamino)-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxypyrazine-2-carboxamide Chemical compound CCNC1=NC(OC)=C(C(=O)NCC2N(CCC2)CC)N=C1SCC1=CC=CC=C1 BHDIRZRYVVVUSF-UHFFFAOYSA-N 0.000 description 2
- GNKLTMBVOKUPFL-UHFFFAOYSA-N 6-chloro-3,5-dimethoxypyrazine-2-carboxylic acid Chemical compound COC1=NC(OC)=C(C(O)=O)N=C1Cl GNKLTMBVOKUPFL-UHFFFAOYSA-N 0.000 description 2
- JBNCIBKLULDBRV-UHFFFAOYSA-N 6-chloro-3-methoxy-5-(2-methoxyphenoxy)pyrazine-2-carboxylic acid Chemical compound COC1=CC=CC=C1OC1=NC(OC)=C(C(O)=O)N=C1Cl JBNCIBKLULDBRV-UHFFFAOYSA-N 0.000 description 2
- RZLWVMRBKBKZGG-UHFFFAOYSA-N 6-chloro-3-methoxy-5-methylpyrazine-2-carbothioic s-acid Chemical compound COC1=NC(C)=C(Cl)N=C1C(S)=O RZLWVMRBKBKZGG-UHFFFAOYSA-N 0.000 description 2
- DJDZZTKUTBESFO-UHFFFAOYSA-N 6-chloro-3-methoxypyrazine-2-carboxylic acid Chemical compound COC1=NC=C(Cl)N=C1C(O)=O DJDZZTKUTBESFO-UHFFFAOYSA-N 0.000 description 2
- FHRUKEBRMQTGOQ-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-3-methoxy-n-[(1-methylpyrrolidin-2-yl)methyl]pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)NCC1N(C)CCC1 FHRUKEBRMQTGOQ-UHFFFAOYSA-N 0.000 description 2
- HTLBJIDINWHXEI-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-3-methoxy-n-[2-(n-methylanilino)ethyl]pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)NCCN(C)C1=CC=CC=C1 HTLBJIDINWHXEI-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 206010015137 Eructation Diseases 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 208000007882 Gastritis Diseases 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 206010028813 Nausea Diseases 0.000 description 2
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 2
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 2
- 238000000862 absorption spectrum Methods 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 208000022531 anorexia Diseases 0.000 description 2
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 2
- 229960004046 apomorphine Drugs 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 208000027687 belching Diseases 0.000 description 2
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 2
- 229940005991 chloric acid Drugs 0.000 description 2
- 229960001076 chlorpromazine Drugs 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 206010061428 decreased appetite Diseases 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- KOUQJOYMQDYWDH-UHFFFAOYSA-N ethyl 3-ethoxypyrazine-2-carboxylate Chemical compound CCOC(=O)C1=NC=CN=C1OCC KOUQJOYMQDYWDH-UHFFFAOYSA-N 0.000 description 2
- PNNCONWICIEQDK-UHFFFAOYSA-N ethyl 5-amino-6-chloro-3-ethoxypyrazine-2-carboxylate Chemical compound CCOC(=O)C1=NC(Cl)=C(N)N=C1OCC PNNCONWICIEQDK-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- QQEQVEDTLSIVPS-UHFFFAOYSA-N methyl 3-methoxy-5,6-dimethylpyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(C)=C(C)N=C1OC QQEQVEDTLSIVPS-UHFFFAOYSA-N 0.000 description 2
- HAXUMIZPUZBBHJ-UHFFFAOYSA-N methyl 3-methoxypyrazine-2-carboxylate Chemical compound COC(=O)C1=NC=CN=C1OC HAXUMIZPUZBBHJ-UHFFFAOYSA-N 0.000 description 2
- QVMPFCMWFHLIAE-UHFFFAOYSA-N methyl 5-(benzylamino)-6-chloro-3-methoxypyrazine-2-carboxylate Chemical compound N1=C(OC)C(C(=O)OC)=NC(Cl)=C1NCC1=CC=CC=C1 QVMPFCMWFHLIAE-UHFFFAOYSA-N 0.000 description 2
- MLYCTEBHOXJUQB-UHFFFAOYSA-N methyl 6-chloro-3-methoxy-5-(methylamino)pyrazine-2-carboxylate Chemical compound CNC1=NC(OC)=C(C(=O)OC)N=C1Cl MLYCTEBHOXJUQB-UHFFFAOYSA-N 0.000 description 2
- 230000008693 nausea Effects 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- NIPZZXUFJPQHNH-UHFFFAOYSA-M pyrazine-2-carboxylate Chemical compound [O-]C(=O)C1=CN=CC=N1 NIPZZXUFJPQHNH-UHFFFAOYSA-M 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 229940116269 uric acid Drugs 0.000 description 2
- 230000008673 vomiting Effects 0.000 description 2
- JUFKJRCMBLLXNH-UHFFFAOYSA-N (1-methylpyrrolidin-2-yl)methanamine Chemical compound CN1CCCC1CN JUFKJRCMBLLXNH-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DPEPZAJVZHRORQ-UHFFFAOYSA-N 1-cyclohexylpyrrolidin-3-amine Chemical compound C1C(N)CCN1C1CCCCC1 DPEPZAJVZHRORQ-UHFFFAOYSA-N 0.000 description 1
- WAKUKXKZEXFXJP-UHFFFAOYSA-N 1-ethylpiperidin-3-amine Chemical compound CCN1CCCC(N)C1 WAKUKXKZEXFXJP-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000004813 2-ethylethylene group Chemical group [H]C([H])([H])C([H])([H])C([H])([*:2])C([H])([H])[*:1] 0.000 description 1
- MNWSGMTUGXNYHJ-UHFFFAOYSA-N 2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(N)=O MNWSGMTUGXNYHJ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- CJNRGSHEMCMUOE-UHFFFAOYSA-N 2-piperidin-1-ylethanamine Chemical compound NCCN1CCCCC1 CJNRGSHEMCMUOE-UHFFFAOYSA-N 0.000 description 1
- 125000006325 2-propenyl amino group Chemical group [H]C([H])=C([H])C([H])([H])N([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- JUQQQVKHNDXBDP-UHFFFAOYSA-N 3-chloro-5-n-[(1-ethylpyrrolidin-2-yl)methyl]-6-methoxypyrazine-2,5-dicarboxamide Chemical compound CCN1CCCC1CNC(=O)C1=NC(Cl)=C(C(N)=O)N=C1OC JUQQQVKHNDXBDP-UHFFFAOYSA-N 0.000 description 1
- OIFHDJMPFWNOOD-UHFFFAOYSA-N 3-chloro-N-ethyl-6-methoxypyrazin-2-amine Chemical compound ClC1=C(N=C(C=N1)OC)NCC OIFHDJMPFWNOOD-UHFFFAOYSA-N 0.000 description 1
- HIQNMBCMDBUWJV-UHFFFAOYSA-N 3-methoxypyrazine-2-carboxylic acid Chemical compound COC1=NC=CN=C1C(O)=O HIQNMBCMDBUWJV-UHFFFAOYSA-N 0.000 description 1
- KAUAWDMQKHADMP-UHFFFAOYSA-N 5,6-dimethyl-2-oxo-1h-pyrazine-3-carboxylic acid Chemical compound CC=1N=C(C(O)=O)C(=O)NC=1C KAUAWDMQKHADMP-UHFFFAOYSA-N 0.000 description 1
- WSHPHDZAVJTXET-UHFFFAOYSA-N 5-(benzylamino)-6-chloro-3-methoxypyrazine-2-carboxylic acid Chemical compound N1=C(C(O)=O)C(OC)=NC(NCC=2C=CC=CC=2)=C1Cl WSHPHDZAVJTXET-UHFFFAOYSA-N 0.000 description 1
- MBCHUMDHPVLEBQ-UHFFFAOYSA-N 5-(butylamino)-6-chloro-n-[2-(diethylamino)ethyl]-3-methoxypyrazine-2-carboxamide Chemical compound CCCCNC1=NC(OC)=C(C(=O)NCCN(CC)CC)N=C1Cl MBCHUMDHPVLEBQ-UHFFFAOYSA-N 0.000 description 1
- FNHZAQQHEUACAR-UHFFFAOYSA-N 5-(ethylamino)-3-methoxy-n-[2-(methylamino)ethyl]pyrazine-2-carboxamide Chemical compound CCNC1=CN=C(C(=O)NCCNC)C(OC)=N1 FNHZAQQHEUACAR-UHFFFAOYSA-N 0.000 description 1
- FQNZCSDIXBYGLA-UHFFFAOYSA-N 5-(ethylamino)-3-methoxy-n-[2-(methylamino)ethyl]pyrazine-2-carboxamide;hydrochloride Chemical compound Cl.CCNC1=CN=C(C(=O)NCCNC)C(OC)=N1 FQNZCSDIXBYGLA-UHFFFAOYSA-N 0.000 description 1
- SDYHJDSCVHWTLZ-UHFFFAOYSA-N 5-(ethylamino)-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxypyrazine-2-carboxamide Chemical compound COC1=NC(NCC)=CN=C1C(=O)NCC1N(CC)CCC1 SDYHJDSCVHWTLZ-UHFFFAOYSA-N 0.000 description 1
- MUQQNYWWYDZIPL-UHFFFAOYSA-N 5-benzylsulfanyl-6-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxypyrazine-2-carboxamide Chemical compound CCN1CCCC1CNC(=O)C(C(=N1)OC)=NC(Cl)=C1SCC1=CC=CC=C1 MUQQNYWWYDZIPL-UHFFFAOYSA-N 0.000 description 1
- HWUNQKPRZHEORJ-UHFFFAOYSA-N 5-chloro-3-methoxypyrazine-2-carboxylic acid Chemical compound COC1=NC(Cl)=CN=C1C(O)=O HWUNQKPRZHEORJ-UHFFFAOYSA-N 0.000 description 1
- ASWGLNRKSPOVLC-UHFFFAOYSA-N 6-chloro-1-[2-(diethylamino)ethyl]-3-methoxy-2H-pyrazin-5-amine Chemical compound C(C)N(CCN1CC(=NC(=C1Cl)N)OC)CC ASWGLNRKSPOVLC-UHFFFAOYSA-N 0.000 description 1
- FWYHWIPTHIVBKY-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-3-methoxy-n-(2-piperidin-1-ylethyl)pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)NCCN1CCCCC1 FWYHWIPTHIVBKY-UHFFFAOYSA-N 0.000 description 1
- FVTCGFANLKAJAZ-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-3-methoxy-n-[(1-phenylpyrrolidin-2-yl)methyl]pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)NCC1N(C=2C=CC=CC=2)CCC1 FVTCGFANLKAJAZ-UHFFFAOYSA-N 0.000 description 1
- IQPUBRWMQNLAKZ-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-3-methoxy-n-[2-(4-methylpiperazin-1-yl)ethyl]pyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)NCCN1CCN(C)CC1 IQPUBRWMQNLAKZ-UHFFFAOYSA-N 0.000 description 1
- QIVYGLVPQWWLIG-UHFFFAOYSA-N 6-chloro-5-(ethylamino)-3-methoxypyrazine-2-carboxamide Chemical compound CCNC1=NC(OC)=C(C(N)=O)N=C1Cl QIVYGLVPQWWLIG-UHFFFAOYSA-N 0.000 description 1
- XRSIOTKAPVOZBM-UHFFFAOYSA-N 6-chloro-n-(1-cyclohexylpyrrolidin-3-yl)-5-(ethylamino)-3-methoxypyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)NC1CN(C2CCCCC2)CC1 XRSIOTKAPVOZBM-UHFFFAOYSA-N 0.000 description 1
- KFVKBWKUVPPPGA-UHFFFAOYSA-N 6-chloro-n-[(1-cyclohexylpyrrolidin-2-yl)methyl]-5-(ethylamino)-3-methoxy-n-methylpyrazine-2-carboxamide Chemical compound N1=C(Cl)C(NCC)=NC(OC)=C1C(=O)N(C)CC1N(C2CCCCC2)CCC1 KFVKBWKUVPPPGA-UHFFFAOYSA-N 0.000 description 1
- HYINAJRLIACSHX-UHFFFAOYSA-N 6-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-methylpyrazine-2-carboxamide Chemical compound CCN1CCCC1CNC(=O)C1=NC(Cl)=C(C)N=C1OC HYINAJRLIACSHX-UHFFFAOYSA-N 0.000 description 1
- LLSVNMCXOOCQEK-UHFFFAOYSA-N 6-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-phenoxypyrazine-2-carboxamide Chemical compound CCN1CCCC1CNC(=O)C(C(=N1)OC)=NC(Cl)=C1OC1=CC=CC=C1 LLSVNMCXOOCQEK-UHFFFAOYSA-N 0.000 description 1
- PWHPXRWKXQRDSY-UHFFFAOYSA-N 6-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-phenylmethoxypyrazine-2-carboxamide Chemical compound CCN1CCCC1CNC(=O)C(C(=N1)OC)=NC(Cl)=C1OCC1=CC=CC=C1 PWHPXRWKXQRDSY-UHFFFAOYSA-N 0.000 description 1
- SODYCLIEPWAQAT-UHFFFAOYSA-N 6-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5-phenylpyrazine-2-carbothioamide Chemical compound CCN1CCCC1CNC(=S)C1=NC(Cl)=C(C=2C=CC=CC=2)N=C1OC SODYCLIEPWAQAT-UHFFFAOYSA-N 0.000 description 1
- WQRBAYYMNHNAIP-UHFFFAOYSA-N 6-chloro-n-[2-(diethylamino)ethyl]-5-(ethylamino)-3-methoxypyrazine-2-carboxamide Chemical compound CCNC1=NC(OC)=C(C(=O)NCCN(CC)CC)N=C1Cl WQRBAYYMNHNAIP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100365746 Caenorhabditis elegans sid-5 gene Proteins 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010013786 Dry skin Diseases 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 208000036366 Sensation of pressure Diseases 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- QIOZLISABUUKJY-UHFFFAOYSA-N Thiobenzamide Chemical compound NC(=S)C1=CC=CC=C1 QIOZLISABUUKJY-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000005910 alkyl carbonate group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000004380 ashing Methods 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- TXHWYSOQHNMOOU-UHFFFAOYSA-N chloro(diethoxy)phosphane Chemical compound CCOP(Cl)OCC TXHWYSOQHNMOOU-UHFFFAOYSA-N 0.000 description 1
- SOYKEARSMXGVTM-UHFFFAOYSA-N chlorphenamine Chemical compound C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Cl)C=C1 SOYKEARSMXGVTM-UHFFFAOYSA-N 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- PVCINRPAXRJLEP-UHFFFAOYSA-N dichloro(ethoxy)phosphane Chemical compound CCOP(Cl)Cl PVCINRPAXRJLEP-UHFFFAOYSA-N 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000002895 emetic Substances 0.000 description 1
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000000055 hyoplipidemic effect Effects 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 101150085091 lat-2 gene Proteins 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- ZUPDLXVEYMVFCV-UHFFFAOYSA-N methyl 5,6-dichloro-2-methoxy-1h-pyrazine-2-carboxylate Chemical compound COC(=O)C1(OC)NC(Cl)=C(Cl)N=C1 ZUPDLXVEYMVFCV-UHFFFAOYSA-N 0.000 description 1
- ACSSKMBMOVXUBE-UHFFFAOYSA-N methyl 5,6-dimethyl-2-oxo-1h-pyrazine-3-carboxylate Chemical compound COC(=O)C1=NC(C)=C(C)N=C1O ACSSKMBMOVXUBE-UHFFFAOYSA-N 0.000 description 1
- BVVMUVCPIXSBOG-UHFFFAOYSA-N methyl 5-(butylamino)-6-chloro-3-methoxypyrazine-2-carboxylate Chemical compound CCCCNC1=NC(OC)=C(C(=O)OC)N=C1Cl BVVMUVCPIXSBOG-UHFFFAOYSA-N 0.000 description 1
- LSOPNKXPEUDRPU-UHFFFAOYSA-N methyl 5-amino-6-bromo-3-methoxypyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(Br)=C(N)N=C1OC LSOPNKXPEUDRPU-UHFFFAOYSA-N 0.000 description 1
- QTWGYKVFSZVYFQ-UHFFFAOYSA-N methyl 6-chloro-3,5-dimethoxypyrazine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(OC)N=C1OC QTWGYKVFSZVYFQ-UHFFFAOYSA-N 0.000 description 1
- HCDXLQHABVDNKS-UHFFFAOYSA-N methyl 6-chloro-5-(cyclohexylamino)-3-methoxypyrazine-2-carboxylate Chemical compound N1=C(OC)C(C(=O)OC)=NC(Cl)=C1NC1CCCCC1 HCDXLQHABVDNKS-UHFFFAOYSA-N 0.000 description 1
- PCFBMVJVJJODPF-UHFFFAOYSA-N methyl 6-chloro-5-(diethylamino)-3-methoxypyrazine-2-carboxylate Chemical compound CCN(CC)C1=NC(OC)=C(C(=O)OC)N=C1Cl PCFBMVJVJJODPF-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- QOHMWDJIBGVPIF-UHFFFAOYSA-N n',n'-diethylpropane-1,3-diamine Chemical compound CCN(CC)CCCN QOHMWDJIBGVPIF-UHFFFAOYSA-N 0.000 description 1
- GCGMQDJOIHALPF-UHFFFAOYSA-N n'-methyl-n'-phenylethane-1,2-diamine Chemical compound NCCN(C)C1=CC=CC=C1 GCGMQDJOIHALPF-UHFFFAOYSA-N 0.000 description 1
- NMGVIZJUIPNHLI-UHFFFAOYSA-N n,n-dimethylpiperidin-3-amine Chemical compound CN(C)C1CCCNC1 NMGVIZJUIPNHLI-UHFFFAOYSA-N 0.000 description 1
- PUVDMBDRYIFVDX-UHFFFAOYSA-N n-[(1-ethylpyrrolidin-2-yl)methyl]-3-methoxy-5,6-dimethylpyrazine-2-carboxamide Chemical compound CCN1CCCC1CNC(=O)C1=NC(C)=C(C)N=C1OC PUVDMBDRYIFVDX-UHFFFAOYSA-N 0.000 description 1
- JRHHINYDSXGTDA-UHFFFAOYSA-N n-[2-(diethylamino)ethyl]-3-methoxypyrazine-2-carboxamide Chemical compound CCN(CC)CCNC(=O)C1=NC=CN=C1OC JRHHINYDSXGTDA-UHFFFAOYSA-N 0.000 description 1
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 210000004798 organs belonging to the digestive system Anatomy 0.000 description 1
- 229940061319 ovide Drugs 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- FXOLCUGMIBSJFM-UHFFFAOYSA-N propan-2-yl 6-chloro-3-methoxy-5-(2-methoxyphenoxy)pyrazine-2-carboxylate Chemical compound COC1=CC=CC=C1OC1=NC(OC)=C(C(=O)OC(C)C)N=C1Cl FXOLCUGMIBSJFM-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940001470 psychoactive drug Drugs 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 229960005206 pyrazinamide Drugs 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49007726A JPS50105675A (en) | 1974-01-16 | 1974-01-16 | Pirajinjudotai no seiho |
| JP4302774A JPS50140468A (OSRAM) | 1974-04-16 | 1974-04-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1050540A true CA1050540A (en) | 1979-03-13 |
Family
ID=26342070
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA217,443A Expired CA1050540A (en) | 1974-01-16 | 1975-01-07 | Process of producing a pyrazine derivative |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4041032A (OSRAM) |
| AT (1) | AT340437B (OSRAM) |
| CA (1) | CA1050540A (OSRAM) |
| DE (1) | DE2461802C2 (OSRAM) |
| DK (1) | DK139846B (OSRAM) |
| ES (1) | ES433462A1 (OSRAM) |
| FR (1) | FR2257293B1 (OSRAM) |
| GB (1) | GB1484049A (OSRAM) |
| NL (1) | NL7417060A (OSRAM) |
| SE (1) | SE420602B (OSRAM) |
| YU (1) | YU36934B (OSRAM) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE845612A (fr) * | 1976-03-23 | 1977-02-28 | Derives de tetrazole-5-carboxamide et leur preparation | |
| CA1261335A (en) * | 1984-08-29 | 1989-09-26 | Hoffmann-La Roche Limited/Hoffmann-La Roche Limitee | Ethylenediamine monoamide derivatives |
| GB8810934D0 (en) * | 1987-05-26 | 1988-06-15 | Ici America Inc | Amides |
| GB8810933D0 (en) * | 1987-05-26 | 1988-06-15 | Ici America Inc | Heterocyclic compounds |
| US4803206A (en) * | 1988-03-07 | 1989-02-07 | Schering Corporation | Antihypertensive acylpyrazines |
| CA2067663A1 (en) * | 1991-05-01 | 1992-11-02 | Hitoshi Tone | Pyrazine derivatives |
| FR2705344B1 (fr) * | 1993-05-17 | 1995-06-30 | Synthelabo | Dérivés de 2-aminopyrazine-5-carboxamide, leur préparation et leur application en thérapeutique. |
| DE4426346A1 (de) * | 1994-07-25 | 1996-02-01 | Basf Ag | Herbizide Pyrazinderivate |
| CA2241933C (en) | 1997-07-03 | 2008-10-07 | Lonza Ag | Process for preparing alkoxypyrazine derivatives |
| JP4619655B2 (ja) | 2001-09-14 | 2011-01-26 | ハイ・ポイント・ファーマスーティカルズ、エルエルシー | 新規アミノアゼチジン、−ピロリジンおよび−ピペリジン誘導体 |
| US6673829B2 (en) | 2001-09-14 | 2004-01-06 | Novo Nordisk A/S | Aminoazetidine,-pyrrolidine and -piperidine derivatives |
| US7286880B2 (en) * | 2003-10-02 | 2007-10-23 | Medtronic, Inc. | System and method for transcutaneous energy transfer achieving high efficiency |
| BR112021023848A2 (pt) * | 2019-05-29 | 2022-01-04 | Syngenta Crop Protection Ag | Derivados microbiocidas |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3544568A (en) * | 1969-03-18 | 1970-12-01 | Merck & Co Inc | 3-amino-5,6-substituted pyrazinamides |
-
1974
- 1974-12-19 US US05/534,636 patent/US4041032A/en not_active Expired - Lifetime
- 1974-12-20 SE SE7416137A patent/SE420602B/xx not_active IP Right Cessation
- 1974-12-20 DK DK673074AA patent/DK139846B/da not_active IP Right Cessation
- 1974-12-23 GB GB55539/74A patent/GB1484049A/en not_active Expired
- 1974-12-23 AT AT1028874A patent/AT340437B/de not_active IP Right Cessation
- 1974-12-26 YU YU3470/74A patent/YU36934B/xx unknown
- 1974-12-27 FR FR7442978A patent/FR2257293B1/fr not_active Expired
- 1974-12-30 ES ES433462A patent/ES433462A1/es not_active Expired
- 1974-12-30 DE DE2461802A patent/DE2461802C2/de not_active Expired
- 1974-12-31 NL NL7417060A patent/NL7417060A/xx not_active Application Discontinuation
-
1975
- 1975-01-07 CA CA217,443A patent/CA1050540A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK139846C (OSRAM) | 1979-10-08 |
| DK673074A (OSRAM) | 1975-09-08 |
| FR2257293B1 (OSRAM) | 1980-02-08 |
| DE2461802C2 (de) | 1985-01-03 |
| NL7417060A (nl) | 1975-07-18 |
| YU36934B (en) | 1984-08-31 |
| ATA1028874A (de) | 1977-04-15 |
| ES433462A1 (es) | 1976-12-16 |
| FR2257293A1 (OSRAM) | 1975-08-08 |
| SE7416137L (OSRAM) | 1975-07-17 |
| SE420602B (sv) | 1981-10-19 |
| DK139846B (da) | 1979-04-30 |
| YU347074A (en) | 1982-06-18 |
| AT340437B (de) | 1977-12-12 |
| DE2461802A1 (de) | 1975-07-17 |
| GB1484049A (en) | 1977-08-24 |
| US4041032A (en) | 1977-08-09 |
| AU7664974A (en) | 1976-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4401822A (en) | Derivatives of 4-amino-5-alkyl sulphonyl orthoanisamides | |
| CA1050540A (en) | Process of producing a pyrazine derivative | |
| KR880001315B1 (ko) | 4-아미노-6, 7-디메톡시퀴놀린 유도체의 제조방법 | |
| US3908010A (en) | Basically substituted heterocycles as anti-emetics | |
| JP3159526B2 (ja) | 2−アミノピリミジン−4−カルボキサミド誘導体、その製法及びその用途 | |
| EP0004320B1 (en) | 1-substituted-thiomethyltriazolobenzodiazepines, preparation thereof, their use, and a pharmaceutical composition | |
| US3862152A (en) | 3-carbamoylamino-4-phenyl quinoline compounds | |
| US4144338A (en) | N-pyrimidinyl-N-dialkylaminoalkyl ureas | |
| GB2078715A (en) | N-(diethylaminoethyl)-2-alkoxybenzamide derivatives | |
| EP0107930A2 (en) | Fused aromatic oxazepinones and sulphur analogues thereof and their preparation and use in counteracting histamine | |
| US3843656A (en) | 2-methylamino-4'-methyl-4-piperazinyl-6-chloro-5-methylthio-pyrimidine,salts thereof,and process for their preparation | |
| US3426017A (en) | Sulfonylurea compounds | |
| US4389406A (en) | Meta-pyrazolylaminotetramisole analogs and their use in pharmaceutical compositions | |
| KR790001029B1 (ko) | 피라진 유도체의 제조방법 | |
| US3062839A (en) | Dihydroxy-tertiary-butylamines | |
| US3598828A (en) | 1-oxa-3,8-diaza spiro(4,5)-2-decanethione compounds | |
| SK282600B6 (sk) | Deriváty 6-metoxy-1H-benzotriazol-5-karboxamidu, spôsob ich prípravy, farmaceutický prostriedok obsahujúci tieto deriváty a medziprodukty | |
| US3576001A (en) | 2-amino-3-aryl-3h-indol-3-ols and their method of preparation | |
| US3948915A (en) | 2-Halopyrimidine derivatives and a method for their preparation | |
| CA1180011A (en) | Imidazobenzodiazepines | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines | |
| AU590748B2 (en) | Benzo(C)-1,5-naphthyridines, a process and intermediates for their preparation and their use as medicaments | |
| US3835132A (en) | Morpholino-piperazinyl pyrimidines | |
| US4185104A (en) | Tranquillizing complexes | |
| US3910887A (en) | Azabenzo-1,5-diazepines |