CA1045500A - Umbrella - Google Patents
UmbrellaInfo
- Publication number
- CA1045500A CA1045500A CA191,507A CA191507A CA1045500A CA 1045500 A CA1045500 A CA 1045500A CA 191507 A CA191507 A CA 191507A CA 1045500 A CA1045500 A CA 1045500A
- Authority
- CA
- Canada
- Prior art keywords
- section
- rib
- main
- stick
- frame
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000001154 acute effect Effects 0.000 claims description 4
- 230000006835 compression Effects 0.000 claims description 4
- 238000007906 compression Methods 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- 230000000875 corresponding effect Effects 0.000 claims 10
- 238000009958 sewing Methods 0.000 description 5
- 238000010276 construction Methods 0.000 description 3
- 238000009434 installation Methods 0.000 description 2
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- XXPDBLUZJRXNNZ-UHFFFAOYSA-N promethazine hydrochloride Chemical compound Cl.C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 XXPDBLUZJRXNNZ-UHFFFAOYSA-N 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45B—WALKING STICKS; UMBRELLAS; LADIES' OR LIKE FANS
- A45B19/00—Special folding or telescoping of umbrellas
- A45B19/10—Special folding or telescoping of umbrellas with collapsible ribs
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45B—WALKING STICKS; UMBRELLAS; LADIES' OR LIKE FANS
- A45B19/00—Special folding or telescoping of umbrellas
- A45B2019/008—Umbrellas having upward pointing rib ends when closed, i.e. the lower dry side of the cover facing the outside when closed
Landscapes
- Walking Sticks, Umbrellas, And Fans (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732307679 DE2307679C3 (de) | 1973-02-16 | Verkürzbarer Schirm | |
| DE19732315624 DE2315624C3 (de) | 1973-03-29 | 1973-03-29 | Verkürzbarer Schirm |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1045500A true CA1045500A (en) | 1979-01-02 |
Family
ID=25764701
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA191,507A Expired CA1045500A (en) | 1973-02-16 | 1974-01-31 | Umbrella |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3902514A (enExample) |
| JP (1) | JPS5910802B2 (enExample) |
| CA (1) | CA1045500A (enExample) |
| CH (2) | CH577807A5 (enExample) |
| ES (1) | ES423326A1 (enExample) |
| FR (2) | FR2218063B1 (enExample) |
| GB (1) | GB1452201A (enExample) |
| NL (2) | NL162552C (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2422209C2 (de) * | 1974-05-08 | 1983-05-11 | Bremshey Ag, 5650 Solingen | Verkürzbarer Schirm |
| CH595795A5 (enExample) * | 1975-07-21 | 1978-02-28 | Bremshey Ag | |
| DE2535634C2 (de) * | 1975-08-09 | 1984-07-05 | Kortenbach & Rauh Kg, 5650 Solingen | Schirm mit mindestens zweifach verkürzbaren Dachstangen |
| US4007753A (en) * | 1976-01-22 | 1977-02-15 | Demarco Joseph H | Folding umbrella |
| DE2615731C3 (de) * | 1976-04-10 | 1979-05-10 | Kortenbach & Rauh Kg, 5650 Solingen | Verkürzbarer Schirm |
| DE2615732C2 (de) * | 1976-04-10 | 1986-10-02 | Kortenbach & Rauh Kg, 5650 Solingen | Verkürzbarer Schirm |
| EP0230494A1 (en) * | 1986-01-27 | 1987-08-05 | Shuo Shih Huang | Improved folding umbrella frame |
| GB2185682B (en) * | 1986-01-29 | 1989-11-22 | Totes Inc | Stabilizer system for an umbrella rib linkage |
| JPS62136203U (enExample) * | 1986-02-22 | 1987-08-27 | ||
| US4739783A (en) * | 1986-07-07 | 1988-04-26 | Yang Chi Kuo | Shortening link means of multiple-fold umbrella |
| DE9001666U1 (de) * | 1990-02-13 | 1991-03-14 | Kortenbach Verwaltungs- und Beteiligungsgesellschaft mbH & Co, 5650 Solingen | Selbstöffnender Schirm |
| US5048550A (en) * | 1990-07-11 | 1991-09-17 | Befashion Umbrella Co., Ltd. | Structure of triple-folding umbrella skeleton |
| US5406968A (en) * | 1994-03-30 | 1995-04-18 | Friedman; John S. | Collapsible umbrella |
| US6058952A (en) * | 1998-12-02 | 2000-05-09 | Fu Tai Umbrella Works, Ltd. | Simplified flat top umbrella |
| US6173723B1 (en) * | 1999-09-29 | 2001-01-16 | Mao-Sheng Wang | Structure of a skeleton for umbrellas |
| US20020129843A1 (en) * | 2001-03-15 | 2002-09-19 | Max Wang | Umbrella with buffering connection between ribs and stretchers |
| US20050126613A1 (en) * | 2003-12-16 | 2005-06-16 | Hsia-Hui Chen | Collapsed umbrella with shrunk volume |
| CN200983909Y (zh) * | 2006-12-21 | 2007-12-05 | 黄禄财 | 多折伞 |
| TWM532763U (en) * | 2016-03-04 | 2016-12-01 | ren-hao Dai | Rib structure of inverted umbrella |
| US9844250B1 (en) * | 2017-03-03 | 2017-12-19 | Tsun-Zong Wu | Anti-turning umbrella frame |
| US10258120B2 (en) | 2017-06-27 | 2019-04-16 | Charles E Crayton | Multiple-fold frame assembly |
| USD831951S1 (en) | 2017-10-09 | 2018-10-30 | E. Mishan & Sons, Inc. | Umbrella handle with light |
| USD830683S1 (en) | 2017-10-09 | 2018-10-16 | E. Mishan & Sons, Inc. | Umbrella handle with light |
| USD898341S1 (en) * | 2018-02-12 | 2020-10-13 | Ching-Chuan You | Umbrella frame |
| USD879460S1 (en) * | 2018-09-04 | 2020-03-31 | Hao-ming Liu | Umbrella rib |
| USD880842S1 (en) * | 2018-09-13 | 2020-04-14 | Ching-Chuan You | Umbrella frame |
| US11980263B2 (en) * | 2019-01-22 | 2024-05-14 | Mark Andrew Fraser | Portable shelter |
| US12256817B2 (en) * | 2021-07-20 | 2025-03-25 | Mark Andrew Fraser | Portable shelter |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2649103A (en) * | 1951-02-06 | 1953-08-18 | Finkel Umbrella Frame Company | Folding umbrella |
| NL6705714A (enExample) * | 1966-08-12 | 1968-02-13 | ||
| US3699988A (en) * | 1969-07-25 | 1972-10-24 | Telesco Brophey Ltd | Collapsible umbrella |
| DE2005149A1 (enExample) * | 1970-02-05 | 1971-02-11 | ||
| US3702618A (en) * | 1969-07-25 | 1972-11-14 | Telesco Brophey Ltd | Collapsible umbrella |
| US3678949A (en) * | 1969-11-19 | 1972-07-25 | Telesco Brophey Ltd | Handle for collapsible umbrella |
| US3780748A (en) * | 1971-05-21 | 1973-12-25 | Telesco Brophey Ltd | Collapsible umbrella |
| US3802452A (en) * | 1972-08-07 | 1974-04-09 | Telesco Brophey Ltd | Collapsible umbrella |
-
1974
- 1974-01-30 US US437825*A patent/US3902514A/en not_active Expired - Lifetime
- 1974-01-31 CA CA191,507A patent/CA1045500A/en not_active Expired
- 1974-02-13 NL NL7401970.A patent/NL162552C/xx not_active IP Right Cessation
- 1974-02-15 CH CH159076A patent/CH577807A5/xx not_active IP Right Cessation
- 1974-02-15 FR FR7405251A patent/FR2218063B1/fr not_active Expired
- 1974-02-15 CH CH214874A patent/CH575221A5/xx not_active IP Right Cessation
- 1974-02-15 JP JP49018447A patent/JPS5910802B2/ja not_active Expired
- 1974-02-16 ES ES423326A patent/ES423326A1/es not_active Expired
- 1974-02-18 GB GB724874A patent/GB1452201A/en not_active Expired
-
1976
- 1976-09-10 FR FR7627359A patent/FR2315880A1/fr active Granted
-
1978
- 1978-01-11 NL NL7800320A patent/NL7800320A/xx active Search and Examination
Also Published As
| Publication number | Publication date |
|---|---|
| NL162552C (nl) | 1980-06-16 |
| NL162552B (nl) | 1980-01-15 |
| JPS49112753A (enExample) | 1974-10-28 |
| CH577807A5 (enExample) | 1976-07-30 |
| NL7401970A (enExample) | 1974-08-20 |
| NL7800320A (nl) | 1978-04-28 |
| FR2218063B1 (enExample) | 1978-01-06 |
| FR2218063A1 (enExample) | 1974-09-13 |
| GB1452201A (en) | 1976-10-13 |
| US3902514A (en) | 1975-09-02 |
| JPS5910802B2 (ja) | 1984-03-12 |
| CH575221A5 (enExample) | 1976-05-14 |
| FR2315880B1 (enExample) | 1982-12-03 |
| FR2315880A1 (fr) | 1977-01-28 |
| ES423326A1 (es) | 1976-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1045500A (en) | Umbrella | |
| US4007752A (en) | Telescopic umbrella | |
| US4144900A (en) | Umbrella | |
| US4105039A (en) | Shortenable umbrella | |
| US4601301A (en) | Umbrella with lazy tong structure | |
| US5337770A (en) | Collapsible umbrella | |
| US4030514A (en) | Shortenable umbrella | |
| US2649103A (en) | Folding umbrella | |
| US4658844A (en) | Folding umbrella frame | |
| CA1045499A (en) | Telescopic umbrella | |
| US3901257A (en) | Umbrella | |
| US4077421A (en) | Shortenable umbrella | |
| EP0465706B1 (en) | Improved structure of triple-folding umbrella skeleton | |
| CA2033520C (en) | Self opening umbrella | |
| US3818919A (en) | Pocket umbrella | |
| US5193565A (en) | Rib linkage joint | |
| US3893467A (en) | Umbrella | |
| US2775977A (en) | Collapsible umbrella | |
| US5158102A (en) | Umbrella frame having folding ear structures | |
| US3848740A (en) | Umbrella | |
| US4077420A (en) | Shortenable umbrella | |
| US4607653A (en) | Collapsible umbrella with circular rim | |
| US4934395A (en) | Short fold rib linkage for an umbrella | |
| US4884586A (en) | Rib coupling for hat-like umbrellas | |
| US3732879A (en) | Umbrella |