CA1042899A - Process for the preparation of furan compounds - Google Patents
Process for the preparation of furan compoundsInfo
- Publication number
- CA1042899A CA1042899A CA188,308A CA188308A CA1042899A CA 1042899 A CA1042899 A CA 1042899A CA 188308 A CA188308 A CA 188308A CA 1042899 A CA1042899 A CA 1042899A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- carbon atoms
- compound
- phenyl
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 15
- 238000002360 preparation method Methods 0.000 title claims abstract description 9
- 150000002240 furans Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 42
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- -1 alkane carboxylic acid Chemical class 0.000 claims description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 7
- 125000001624 naphthyl group Chemical group 0.000 claims description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 claims description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 3
- 229940113088 dimethylacetamide Drugs 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical group CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- 150000004678 hydrides Chemical class 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical class C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 abstract description 6
- 230000003287 optical effect Effects 0.000 abstract description 4
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract description 3
- 238000000576 coating method Methods 0.000 abstract description 2
- 239000000543 intermediate Substances 0.000 abstract description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 abstract 2
- 150000003512 tertiary amines Chemical class 0.000 abstract 2
- 150000003934 aromatic aldehydes Chemical class 0.000 abstract 1
- 150000002576 ketones Chemical class 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 239000003204 tranquilizing agent Substances 0.000 abstract 1
- 230000002936 tranquilizing effect Effects 0.000 abstract 1
- 235000013350 formula milk Nutrition 0.000 description 48
- 238000006243 chemical reaction Methods 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000012043 crude product Substances 0.000 description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000005208 trialkylammonium group Chemical group 0.000 description 3
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 229940127557 pharmaceutical product Drugs 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 125000000565 sulfonamide group Chemical group 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- ZLNVRXFZTPRLIK-UHFFFAOYSA-N 1-(chloromethyl)-2,3,4,5,6-pentafluorobenzene Chemical compound FC1=C(F)C(F)=C(CCl)C(F)=C1F ZLNVRXFZTPRLIK-UHFFFAOYSA-N 0.000 description 1
- BBXDMCQDLOCXRA-UHFFFAOYSA-N 1-(chloromethyl)-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1CCl BBXDMCQDLOCXRA-UHFFFAOYSA-N 0.000 description 1
- XGASTRVQNVVYIZ-UHFFFAOYSA-N 1-(chloromethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCl)=C1 XGASTRVQNVVYIZ-UHFFFAOYSA-N 0.000 description 1
- MCHDHQVROPEJJT-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCl)C=C1 MCHDHQVROPEJJT-UHFFFAOYSA-N 0.000 description 1
- BZPVSNPTWJHCPU-UHFFFAOYSA-N 2-(2-bromoethyl)-1-benzofuran Chemical compound C1=CC=C2OC(CCBr)=CC2=C1 BZPVSNPTWJHCPU-UHFFFAOYSA-N 0.000 description 1
- ANRDUCQCZKLSGF-UHFFFAOYSA-N 2-(chloromethyl)-1,3-benzoxazole Chemical compound C1=CC=C2OC(CCl)=NC2=C1 ANRDUCQCZKLSGF-UHFFFAOYSA-N 0.000 description 1
- PJNPZIYGODMAQE-UHFFFAOYSA-N 2-(chloromethyl)-4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1CCl PJNPZIYGODMAQE-UHFFFAOYSA-N 0.000 description 1
- QYKBOTFPQQSPNT-UHFFFAOYSA-N 2-(chloromethyl)-5,6-dimethyl-1,3-benzoxazole Chemical compound C1=C(C)C(C)=CC2=C1OC(CCl)=N2 QYKBOTFPQQSPNT-UHFFFAOYSA-N 0.000 description 1
- HLMSMIKJAZQYJS-UHFFFAOYSA-N 2-(chloromethyl)-5-methyl-1,3-benzoxazole Chemical compound CC1=CC=C2OC(CCl)=NC2=C1 HLMSMIKJAZQYJS-UHFFFAOYSA-N 0.000 description 1
- FDGUEQXFQAFQAZ-UHFFFAOYSA-N 2-(chloromethyl)cyclopenta[4,5]pyrano[1,2-b]pyridine Chemical compound O1C=C2C=CC=C2C2=CC(CCl)=CN=C21 FDGUEQXFQAFQAZ-UHFFFAOYSA-N 0.000 description 1
- CKCWXDDNIZVNCW-UHFFFAOYSA-N 2-(chloromethyl)cyclopenta[f][1,2]benzoxazine Chemical compound C1=C2ON=C(CCl)C=C2C2=CC=CC2=C1 CKCWXDDNIZVNCW-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- DDEAEWMDOSXKBX-UHFFFAOYSA-N 2-(chloromethyl)quinoline Chemical compound C1=CC=CC2=NC(CCl)=CC=C21 DDEAEWMDOSXKBX-UHFFFAOYSA-N 0.000 description 1
- JECYUBVRTQDVAT-UHFFFAOYSA-N 2-acetylphenol Chemical compound CC(=O)C1=CC=CC=C1O JECYUBVRTQDVAT-UHFFFAOYSA-N 0.000 description 1
- AEWASAYNGKXLBK-UHFFFAOYSA-N 3-(bromomethyl)-1-benzofuran Chemical compound C1=CC=C2C(CBr)=COC2=C1 AEWASAYNGKXLBK-UHFFFAOYSA-N 0.000 description 1
- CNQCWYFDIQSALX-UHFFFAOYSA-N 3-(chloromethyl)pyridine Chemical compound ClCC1=CC=CN=C1 CNQCWYFDIQSALX-UHFFFAOYSA-N 0.000 description 1
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- LOQLDQJTSMKBJU-UHFFFAOYSA-N 4-(chloromethyl)benzonitrile Chemical compound ClCC1=CC=C(C#N)C=C1 LOQLDQJTSMKBJU-UHFFFAOYSA-N 0.000 description 1
- WZIYCIBURCPKAR-UHFFFAOYSA-N 4-(chloromethyl)pyridine Chemical compound ClCC1=CC=NC=C1 WZIYCIBURCPKAR-UHFFFAOYSA-N 0.000 description 1
- VBMJCIHAFOUASB-UHFFFAOYSA-N 5-(2-bromoethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole Chemical compound C1=CC(C)=CC=C1C1=NOC(CCBr)=N1 VBMJCIHAFOUASB-UHFFFAOYSA-N 0.000 description 1
- OFRQNAQOIUPYLF-UHFFFAOYSA-N 5-bromo-4-methylfuran-2-carbonitrile Chemical compound CC=1C=C(C#N)OC=1Br OFRQNAQOIUPYLF-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- IWTYTFSSTWXZFU-QPJJXVBHSA-N [(e)-3-chloroprop-1-enyl]benzene Chemical compound ClC\C=C\C1=CC=CC=C1 IWTYTFSSTWXZFU-QPJJXVBHSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000006193 alkinyl group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- PMHQVHHXPFUNSP-UHFFFAOYSA-M copper(1+);methylsulfanylmethane;bromide Chemical compound Br[Cu].CSC PMHQVHHXPFUNSP-UHFFFAOYSA-M 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- NZZLGVIQLWHWCI-UHFFFAOYSA-N methyl 4-(bromomethyl)naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)=CC=C(CBr)C2=C1 NZZLGVIQLWHWCI-UHFFFAOYSA-N 0.000 description 1
- SATDLKYRVXFXRE-UHFFFAOYSA-N methyl 4-(chloromethyl)benzoate Chemical compound COC(=O)C1=CC=C(CCl)C=C1 SATDLKYRVXFXRE-UHFFFAOYSA-N 0.000 description 1
- WHBQNMWZLZKDSD-UHFFFAOYSA-N methyl 5-(bromomethyl)furan-2-carboxylate Chemical compound COC(=O)C1=CC=C(CBr)O1 WHBQNMWZLZKDSD-UHFFFAOYSA-N 0.000 description 1
- GFOPHLFSDVVYGB-UHFFFAOYSA-N methyl 5-(bromomethyl)thiophene-2-carboxylate Chemical compound COC(=O)C1=CC=C(CBr)S1 GFOPHLFSDVVYGB-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/92—Naphthofurans; Hydrogenated naphthofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Color Printing (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1839772A CH583723A5 (enExample) | 1972-12-18 | 1972-12-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1042899A true CA1042899A (en) | 1978-11-21 |
Family
ID=4432711
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA188,308A Expired CA1042899A (en) | 1972-12-18 | 1973-12-17 | Process for the preparation of furan compounds |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3892807A (enExample) |
| JP (1) | JPS5849553B2 (enExample) |
| AR (1) | AR207750A1 (enExample) |
| AT (1) | AT338778B (enExample) |
| BE (1) | BE808779R (enExample) |
| BR (1) | BR7309875D0 (enExample) |
| CA (1) | CA1042899A (enExample) |
| CH (1) | CH583723A5 (enExample) |
| DD (1) | DD117070A6 (enExample) |
| DE (1) | DE2361338A1 (enExample) |
| DK (1) | DK133506B (enExample) |
| ES (1) | ES421404A1 (enExample) |
| FR (1) | FR2210608B2 (enExample) |
| GB (1) | GB1450120A (enExample) |
| IN (1) | IN138819B (enExample) |
| NL (1) | NL7317104A (enExample) |
| SE (1) | SE402107B (enExample) |
| SU (2) | SU663304A3 (enExample) |
| YU (1) | YU326473A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0010063B1 (de) * | 1978-10-04 | 1982-12-29 | Ciba-Geigy Ag | Verfahren zur Herstellung von Furanyl-benzazolen |
| US5326491A (en) * | 1989-04-28 | 1994-07-05 | Ciba-Geigy Corporation | Detergents containing certain sulfonated dibenzofuranylbiphenyls |
| DE10356130A1 (de) * | 2003-11-28 | 2005-06-23 | Dyomics Gmbh | Neue Polymethinfarbstoffe auf Cumarin-Basis mit einstellbarem Stokes-Shift |
| US9464067B2 (en) | 2011-06-16 | 2016-10-11 | Katholieke Universiteit Leuven K.U. Leuven R & D | Indanone derivatives, pharmaceutically acceptable salts or optical isomers thereof, preparation method for same, and pharmaceutical compositions containing same as active ingredient for preventing or treating viral diseases |
| ES2863985T3 (es) | 2012-12-14 | 2021-10-13 | Korea Res Inst Chemical Tech | Nuevo compuesto, sal farmacéuticamente aceptable o isómero óptico del mismo, método para prepararlo y composición farmacéutica para la prevención o el tratamiento de enfermedades virales que lo contienen como ingrediente activo |
| CN107089959A (zh) * | 2017-05-25 | 2017-08-25 | 浙江明生新材料有限公司 | 一种高日晒牢度棉用增白剂及其合成方法 |
| CN112457308B (zh) * | 2019-09-09 | 2024-01-02 | 上海长森药业有限公司 | 新型三环芳香杂环化合物,及其制备方法、药物组合物和应用 |
| CA3176618A1 (en) | 2020-04-20 | 2021-10-28 | Novartis Ag | Antiviral 1,3-di-oxo-indene compounds |
| KR20230024887A (ko) | 2020-04-20 | 2023-02-21 | 노파르티스 아게 | 항바이러스성 1,3-디-옥소-인덴 화합물 |
| CN111533717B (zh) * | 2020-06-01 | 2023-02-07 | 谷利军 | 一种蓝光激发下合成3-芳甲基苯并[b]呋喃化合物的方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3772370A (en) * | 1970-04-17 | 1973-11-13 | Sterling Drug Inc | N,n'-bis(4(4'-(nitro or amino)-phenoxy)benzyl)-n,n'-bridged-diamines |
| CH550777A (de) * | 1970-10-01 | 1974-06-28 | Ciba Geigy Ag | Verfahren zur herstellung von distyryldiphenylverbindungen. |
-
1972
- 1972-12-18 CH CH1839772A patent/CH583723A5/xx not_active IP Right Cessation
-
1973
- 1973-01-01 AR AR251551A patent/AR207750A1/es active
- 1973-12-08 DE DE2361338A patent/DE2361338A1/de not_active Withdrawn
- 1973-12-12 ES ES421404A patent/ES421404A1/es not_active Expired
- 1973-12-13 US US427016A patent/US3892807A/en not_active Expired - Lifetime
- 1973-12-13 NL NL7317104A patent/NL7317104A/xx not_active Application Discontinuation
- 1973-12-17 YU YU03264/73A patent/YU326473A/xx unknown
- 1973-12-17 BR BR9875/73A patent/BR7309875D0/pt unknown
- 1973-12-17 SU SU731981053A patent/SU663304A3/ru active
- 1973-12-17 DK DK684373AA patent/DK133506B/da unknown
- 1973-12-17 CA CA188,308A patent/CA1042899A/en not_active Expired
- 1973-12-17 JP JP48139730A patent/JPS5849553B2/ja not_active Expired
- 1973-12-17 AT AT1053373A patent/AT338778B/de active
- 1973-12-17 DD DD175391A patent/DD117070A6/xx unknown
- 1973-12-18 SE SE7317062A patent/SE402107B/xx unknown
- 1973-12-18 GB GB5849773A patent/GB1450120A/en not_active Expired
- 1973-12-18 BE BE138996A patent/BE808779R/xx active
- 1973-12-18 FR FR7345241A patent/FR2210608B2/fr not_active Expired
- 1973-12-19 IN IN2765/CAL/73A patent/IN138819B/en unknown
-
1976
- 1976-01-28 SU SU2317501A patent/SU725559A1/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4987653A (enExample) | 1974-08-22 |
| NL7317104A (enExample) | 1974-06-20 |
| DK133506C (enExample) | 1976-12-20 |
| ATA1053373A (de) | 1977-01-15 |
| FR2210608B2 (enExample) | 1980-01-25 |
| BR7309875D0 (pt) | 1974-08-29 |
| AT338778B (de) | 1977-09-12 |
| IN138819B (enExample) | 1976-04-03 |
| DD117070A6 (enExample) | 1975-12-20 |
| SE402107B (sv) | 1978-06-19 |
| SU725559A3 (en) | 1980-03-30 |
| AU6367173A (en) | 1975-06-19 |
| ES421404A1 (es) | 1977-06-16 |
| BE808779R (fr) | 1974-06-18 |
| DK133506B (da) | 1976-05-31 |
| YU326473A (en) | 1982-06-18 |
| JPS5849553B2 (ja) | 1983-11-05 |
| DE2361338A1 (de) | 1974-06-20 |
| CH583723A5 (enExample) | 1977-01-14 |
| US3892807A (en) | 1975-07-01 |
| GB1450120A (en) | 1976-09-22 |
| AR207750A1 (es) | 1976-10-29 |
| SU725559A1 (ru) | 1980-03-30 |
| FR2210608A2 (enExample) | 1974-07-12 |
| SU663304A3 (ru) | 1979-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3864333A (en) | Process for the preparation of furane compounds | |
| CA1042899A (en) | Process for the preparation of furan compounds | |
| SE452610B (sv) | Sett att spalta racemiska cis-1,2-cyklopropandikarboxylsyraderivat | |
| SU820661A3 (ru) | Способ получени производных1,2-бЕНзизОТиАзОлиНОНА-3 | |
| US3994879A (en) | Process for the preparation of benzofuran compounds | |
| US3201481A (en) | Method of preparing 4-nitrostilbenes | |
| US4180663A (en) | Methine dye synthesis | |
| US3932452A (en) | 1-Arylmethyl-2-imidazolidinones | |
| US4122256A (en) | Heterocyclic azomethines | |
| US4052433A (en) | Aromatic azomethines | |
| US3936444A (en) | Production of aryl lactam-hydrazones | |
| US4200759A (en) | Preparation of imidazo[2,1-a]isoindole compounds | |
| AU613589B2 (en) | Compounds useful as intermediates for the production of substituted 1-pyridyloxy-3-indolylalkylamino-2-propanols | |
| SU639450A3 (ru) | Способ получени гетероциклических соединений или их солей | |
| US4421919A (en) | 4-Oximino-1,2,3,4-tetrahydroquinoline derivatives | |
| SU528035A3 (ru) | Способ получени производных изохинолина или их солей | |
| Unangst et al. | 2‐Indolyl ketone synthesis | |
| US3341535A (en) | Benzimidazole derivatives | |
| US4002630A (en) | Novel aromatic o-hydroxyaldehydes, a process for their preparation and their utilization | |
| SU665802A3 (ru) | Способ получени арилалкиламинов или их солей | |
| US3507887A (en) | Process of preparing 2-alkyl quinizarins and 2-aryl-methylene quinizarins | |
| NO742960L (enExample) | ||
| SU999967A3 (ru) | Способ получени 6-N-замещенных 6-амино-3-пиридазинилгидразинов или их солей | |
| Katritzky et al. | A novel synthesis of quinolinium salts via benzotriazole methodology | |
| Machin et al. | o-Nitroaniline derivatives. Part 7. The synthesis of 2-alkoxybenzimidazole N-oxides (2-alkoxy-N-hydroxybenzimidazoles) from o-nitroanilines |