CA1041508A - Process for substituting chlorine atoms of cyanuric chloride (a) - Google Patents
Process for substituting chlorine atoms of cyanuric chloride (a)Info
- Publication number
- CA1041508A CA1041508A CA245,605A CA245605A CA1041508A CA 1041508 A CA1041508 A CA 1041508A CA 245605 A CA245605 A CA 245605A CA 1041508 A CA1041508 A CA 1041508A
- Authority
- CA
- Canada
- Prior art keywords
- amine
- minutes
- process according
- time
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 59
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 title claims abstract description 42
- 125000001309 chloro group Chemical group Cl* 0.000 title claims abstract description 9
- 150000001412 amines Chemical class 0.000 claims abstract description 60
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims abstract description 41
- 238000006243 chemical reaction Methods 0.000 claims abstract description 36
- 239000011541 reaction mixture Substances 0.000 claims abstract description 25
- 150000002576 ketones Chemical class 0.000 claims abstract description 24
- 239000000203 mixture Substances 0.000 claims abstract description 22
- 239000003513 alkali Substances 0.000 claims abstract description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims abstract description 17
- 239000002253 acid Substances 0.000 claims abstract description 15
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 13
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 13
- 230000035484 reaction time Effects 0.000 claims abstract description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 10
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 claims abstract description 10
- 238000006467 substitution reaction Methods 0.000 claims abstract description 6
- 239000000725 suspension Substances 0.000 claims abstract description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000008096 xylene Substances 0.000 claims abstract description 5
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 claims abstract description 3
- 239000003960 organic solvent Substances 0.000 claims abstract description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 25
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical group CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- -1 cyanoalkyl amine Chemical class 0.000 claims description 12
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 150000003973 alkyl amines Chemical class 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 125000006431 methyl cyclopropyl group Chemical group 0.000 claims description 4
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 2
- JQULXIOYDDCNGR-UHFFFAOYSA-N 2-amino-2-methylpropanenitrile Chemical group CC(C)(N)C#N JQULXIOYDDCNGR-UHFFFAOYSA-N 0.000 claims 4
- 229910052739 hydrogen Inorganic materials 0.000 claims 4
- 239000001257 hydrogen Substances 0.000 claims 4
- 150000002431 hydrogen Chemical class 0.000 claims 3
- VEBLEROFGPOMPB-UHFFFAOYSA-N n-methylcyclopropanamine Chemical compound CNC1CC1 VEBLEROFGPOMPB-UHFFFAOYSA-N 0.000 claims 3
- GVAMIZUZUQZECY-UHFFFAOYSA-N 2-[(3-amino-2-chloro-6-ethyl-2h-1,3,5-triazin-4-yl)amino]-2-methylpropanenitrile Chemical compound CCC1=NC(Cl)N(N)C(NC(C)(C)C#N)=N1 GVAMIZUZUQZECY-UHFFFAOYSA-N 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 2
- 230000001105 regulatory effect Effects 0.000 claims 2
- ULLANAVHNCIQLO-UHFFFAOYSA-N 2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-methylpropanenitrile Chemical compound N#CC(C)(C)NC1=NC(Cl)=NC(Cl)=N1 ULLANAVHNCIQLO-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 238000011065 in-situ storage Methods 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 125000003944 tolyl group Chemical group 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 25
- 125000001931 aliphatic group Chemical group 0.000 abstract description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 101
- 235000011121 sodium hydroxide Nutrition 0.000 description 33
- 239000000047 product Substances 0.000 description 27
- 230000015572 biosynthetic process Effects 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 230000000875 corresponding effect Effects 0.000 description 15
- 239000012071 phase Substances 0.000 description 14
- 239000000370 acceptor Substances 0.000 description 13
- 238000004519 manufacturing process Methods 0.000 description 13
- 238000003786 synthesis reaction Methods 0.000 description 13
- 239000006227 byproduct Substances 0.000 description 8
- 238000010586 diagram Methods 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 230000002349 favourable effect Effects 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 238000007086 side reaction Methods 0.000 description 5
- MCNLTUITFWBDSX-UHFFFAOYSA-N 4-chlorotriazin-5-amine Chemical compound NC1=CN=NN=C1Cl MCNLTUITFWBDSX-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000011877 solvent mixture Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 239000012062 aqueous buffer Substances 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000004966 cyanoalkyl group Chemical group 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 230000007812 deficiency Effects 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229940058172 ethylbenzene Drugs 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 238000003672 processing method Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007614 solvation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- JHYOJTQDYMGFEC-UHFFFAOYSA-N 2-[(1-amino-6-chloro-4-ethyl-2H-1,3,5-triazin-2-yl)amino]-2-methylpropanenitrile Chemical compound C(#N)C(C)(C)NC1N(C(=NC(=N1)CC)Cl)N JHYOJTQDYMGFEC-UHFFFAOYSA-N 0.000 description 1
- RHLVCLIPMVJYKS-UHFFFAOYSA-N 3-octanone Chemical compound CCCCCC(=O)CC RHLVCLIPMVJYKS-UHFFFAOYSA-N 0.000 description 1
- MCLXKFUCPVGZEN-UHFFFAOYSA-N 4,6-dichloro-1,3,5-triazin-2-amine Chemical class NC1=NC(Cl)=NC(Cl)=N1 MCLXKFUCPVGZEN-UHFFFAOYSA-N 0.000 description 1
- DILHXKUVSSSQPL-UHFFFAOYSA-N 6-chloro-2,4-diethyl-2h-1,3,5-triazin-1-amine Chemical compound CCC1N=C(CC)N=C(Cl)N1N DILHXKUVSSSQPL-UHFFFAOYSA-N 0.000 description 1
- CCCIYAQYQZQDIZ-UHFFFAOYSA-N 6-methylheptan-3-one Chemical compound CCC(=O)CCC(C)C CCCIYAQYQZQDIZ-UHFFFAOYSA-N 0.000 description 1
- DPOBMEBPSQGSMB-UHFFFAOYSA-N ClC1=NC(=NC(=N1)C(C)C)N(CC)N Chemical compound ClC1=NC(=NC(=N1)C(C)C)N(CC)N DPOBMEBPSQGSMB-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000002036 drum drying Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 229940032007 methylethyl ketone Drugs 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- ZCYXXKJEDCHMGH-UHFFFAOYSA-N nonane Chemical compound CCCC[CH]CCCC ZCYXXKJEDCHMGH-UHFFFAOYSA-N 0.000 description 1
- BKIMMITUMNQMOS-UHFFFAOYSA-N normal nonane Natural products CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000012430 organic reaction media Substances 0.000 description 1
- 238000001139 pH measurement Methods 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- WJNRPILHGGKWCK-UHFFFAOYSA-N propazine Chemical class CC(C)NC1=NC(Cl)=NC(NC(C)C)=N1 WJNRPILHGGKWCK-UHFFFAOYSA-N 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000003303 reheating Methods 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/50—Two nitrogen atoms with a halogen atom attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/44—One nitrogen atom with halogen atoms attached to the two other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2505704A DE2505704C3 (de) | 1975-02-12 | 1975-02-12 | Verfahren zur Herstellung von gegebenenfalls substituierten 2-Alkylamino-4,6-dichlor-s-triazinen und 2,4-Bis alkylamino-6-chlor-s-triazinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1041508A true CA1041508A (en) | 1978-10-31 |
Family
ID=5938607
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA245,605A Expired CA1041508A (en) | 1975-02-12 | 1976-02-12 | Process for substituting chlorine atoms of cyanuric chloride (a) |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4058662A (Sortimente) |
| JP (1) | JPS51105085A (Sortimente) |
| AT (1) | AT350578B (Sortimente) |
| AU (1) | AU1103776A (Sortimente) |
| BE (1) | BE838471A (Sortimente) |
| BR (1) | BR7600819A (Sortimente) |
| CA (1) | CA1041508A (Sortimente) |
| CH (1) | CH626355A5 (Sortimente) |
| DD (1) | DD124383A5 (Sortimente) |
| DE (1) | DE2505704C3 (Sortimente) |
| ES (1) | ES444742A1 (Sortimente) |
| FR (1) | FR2300764A1 (Sortimente) |
| GB (1) | GB1523362A (Sortimente) |
| HU (1) | HU175456B (Sortimente) |
| IL (1) | IL49013A (Sortimente) |
| IT (1) | IT1060487B (Sortimente) |
| MX (1) | MX4470E (Sortimente) |
| NL (1) | NL7600865A (Sortimente) |
| RO (1) | RO76667A (Sortimente) |
| SU (1) | SU725556A3 (Sortimente) |
| ZA (1) | ZA76831B (Sortimente) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1027241B (it) * | 1975-01-03 | 1978-11-20 | Rumianca Spa | Procedimento per la produzione di cloro amino s triazine |
| IT1081516B (it) * | 1977-07-07 | 1985-05-21 | Rumianca Spa | Procedimetno per la produzione di cloro-bis(alchilammine)-s-triazine |
| US4166909A (en) * | 1978-01-23 | 1979-09-04 | Shell Oil Company | Process for preparation of a substituted triazine |
| IT1099676B (it) * | 1978-09-29 | 1985-09-28 | Rumianca Spa | Procedimento per la preparazione di cloro-bis (alchilammino)-s-triazine |
| DE2912267A1 (de) * | 1979-03-28 | 1980-10-09 | Rumianca Spa | Verfahren zur kontinuierlichen herstellung von chlor-di-(alkylamino)- s-triazinen |
| US4275204A (en) * | 1979-09-07 | 1981-06-23 | Rumianca S.P.A. | Preparation of chloro-bis(alkylamino)-s-triazines |
| US4224444A (en) * | 1979-10-01 | 1980-09-23 | Rumianca S.P.A. | Process for the preparation of chloro-bis(alkylamino)-s-triazines |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3244712A (en) * | 1960-02-19 | 1966-04-05 | Geigy Ag J R | Acylamino symmetrical triazines |
| CH476746A (de) * | 1965-12-13 | 1969-08-15 | Agripat Sa | Verfahren zur Herstellung von Chlor-diamino-s-triazinen |
| US3505325A (en) * | 1966-07-16 | 1970-04-07 | Degussa | Cyanoalkylamino substituted triazines having plant growth regulating action |
| CH546247A (de) * | 1968-12-27 | 1974-02-28 | Agripat Sa | Adiabatisches verfahren zur herstellung von n-monosubstituierten 2,4-dichlor-6-amino-s-triazinen. |
| US3766182A (en) * | 1971-05-26 | 1973-10-16 | Ciba Geigy Corp | S-triazine derivatives |
| US3821220A (en) * | 1972-01-04 | 1974-06-28 | Ciba Geigy Corp | Reducing hydrogen cyanide levels in the formation of cyanoalkylamino substituted triazines |
| US3947374A (en) * | 1973-03-21 | 1976-03-30 | American Cyanamid Company | Substituted halotriazines as peroxygen bleach activators |
-
1975
- 1975-01-29 ES ES444742A patent/ES444742A1/es not_active Expired
- 1975-02-12 DE DE2505704A patent/DE2505704C3/de not_active Expired
-
1976
- 1976-01-28 NL NL7600865A patent/NL7600865A/xx not_active Application Discontinuation
- 1976-01-28 MX MX763638U patent/MX4470E/es unknown
- 1976-02-09 GB GB4900/76A patent/GB1523362A/en not_active Expired
- 1976-02-09 FR FR7603452A patent/FR2300764A1/fr active Granted
- 1976-02-10 DD DD191179A patent/DD124383A5/xx unknown
- 1976-02-10 BR BR7600819A patent/BR7600819A/pt unknown
- 1976-02-10 HU HU76DE905A patent/HU175456B/hu unknown
- 1976-02-10 IT IT48021/76A patent/IT1060487B/it active
- 1976-02-10 US US05/656,849 patent/US4058662A/en not_active Expired - Lifetime
- 1976-02-10 SU SU762323877A patent/SU725556A3/ru active
- 1976-02-11 RO RO7684758A patent/RO76667A/ro unknown
- 1976-02-11 BE BE6045361A patent/BE838471A/xx unknown
- 1976-02-11 AT AT96376A patent/AT350578B/de not_active IP Right Cessation
- 1976-02-11 CH CH167076A patent/CH626355A5/de not_active IP Right Cessation
- 1976-02-11 IL IL49013A patent/IL49013A/xx unknown
- 1976-02-12 JP JP51014356A patent/JPS51105085A/ja active Pending
- 1976-02-12 ZA ZA831A patent/ZA76831B/xx unknown
- 1976-02-12 CA CA245,605A patent/CA1041508A/en not_active Expired
- 1976-02-12 AU AU11037/76A patent/AU1103776A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT350578B (de) | 1979-06-11 |
| BR7600819A (pt) | 1976-09-14 |
| ES444742A1 (es) | 1977-08-16 |
| DE2505704C3 (de) | 1980-08-21 |
| ATA96376A (de) | 1978-11-15 |
| CH626355A5 (Sortimente) | 1981-11-13 |
| IL49013A0 (en) | 1976-04-30 |
| NL7600865A (nl) | 1976-08-16 |
| FR2300764A1 (fr) | 1976-09-10 |
| JPS51105085A (Sortimente) | 1976-09-17 |
| IT1060487B (it) | 1982-08-20 |
| US4058662A (en) | 1977-11-15 |
| GB1523362A (en) | 1978-08-31 |
| SU725556A1 (ru) | 1980-03-30 |
| DD124383A5 (Sortimente) | 1977-02-16 |
| BE838471A (fr) | 1976-08-11 |
| IL49013A (en) | 1980-02-29 |
| AU1103776A (en) | 1977-08-18 |
| DE2505704B2 (de) | 1979-12-13 |
| FR2300764B1 (Sortimente) | 1980-05-09 |
| DE2505704A1 (de) | 1976-08-26 |
| ZA76831B (en) | 1977-01-26 |
| RO76667A (ro) | 1981-04-30 |
| HU175456B (hu) | 1980-08-28 |
| SU725556A3 (en) | 1980-03-30 |
| MX4470E (es) | 1982-05-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Schaefer et al. | Synthesis of the s-triazine system. III. 1 Trimerization of imidates | |
| CA1041508A (en) | Process for substituting chlorine atoms of cyanuric chloride (a) | |
| US3049544A (en) | Method for the preparation of | |
| US2361823A (en) | Method of preparing hydrocarbonsubstituted amino triazines | |
| EP0711760B1 (en) | Method of alkylating triazine derivative | |
| US2394042A (en) | Triazine derivatives | |
| Nishigaki et al. | Synthetic antibacterials. I. Nitrofurylvinyl-s-triazine derivatives | |
| US4886882A (en) | Hydroxyoxaalkylmelamines | |
| US3563987A (en) | Preparation of cyanuric acid | |
| US6127538A (en) | Method for modifying 1,3,5-triazine derivatives | |
| US4587337A (en) | Process for the preparation of 2-amino-s-triazines | |
| Grundmann | Syntheses with s‐Triazine | |
| CA1041507A (en) | Process for substituting chlorine atoms of cyanuric chloride (b) | |
| US3419556A (en) | Production of cyanomelamine | |
| US3436394A (en) | Process for the production of 2,4-alkylamino-6-chloro-s-triazines | |
| US2658893A (en) | Preparation of halodiaminotriazines | |
| US3155661A (en) | Process fom producing substituted | |
| US3983115A (en) | Bis-dihalogeno-s-triazinyl ureas | |
| US3681335A (en) | SUPPRESSION OF TRIS(ALKYLAMINO)-S-TRIAZINE FORMATION IN THE PRODUCTION OF CHLORO-BIS(ALKYLAMINO)-S-TRIAZINES THROUGH ADJUSTMENT OF pH | |
| US3883515A (en) | Adiabatic process for the production of 2,4-dichloro-6-amino-S-triazines | |
| US5420274A (en) | Process for the preparation of 2,4-di(alkylamino)-6-alkylthio-s-triazines | |
| US2334162A (en) | Prepaeaxion of z-ameno-l | |
| US2864820A (en) | Isothiocyano-s-triazines | |
| US4360671A (en) | Preparation of cyanuric acid | |
| US4085282A (en) | Process for preparing substituted triazines |