BE881358A - 25-hydroxycholecalciferol-26,23-lactone - Google Patents
25-hydroxycholecalciferol-26,23-lactoneInfo
- Publication number
- BE881358A BE881358A BE0/199120A BE199120A BE881358A BE 881358 A BE881358 A BE 881358A BE 0/199120 A BE0/199120 A BE 0/199120A BE 199120 A BE199120 A BE 199120A BE 881358 A BE881358 A BE 881358A
- Authority
- BE
- Belgium
- Prior art keywords
- hydroxycholecalciferol
- lactone
- Prior art date
Links
- IJNDMZIDDKVXHR-DYEHSFNOSA-N 5-[(2r)-2-[(1r,3as,4e,7ar)-4-[(2z)-2-[(5s)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1h-inden-1-yl]propyl]-3-hydroxy-3-methyloxolan-2-one Chemical compound C([C@@H](C)[C@@H]1[C@]2(CCCC(/[C@@H]2CC1)=C\C=C\1C(CC[C@H](O)C/1)=C)C)C1CC(C)(O)C(=O)O1 IJNDMZIDDKVXHR-DYEHSFNOSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/007,473 US4223131A (en) | 1979-01-26 | 1979-01-26 | 25-Hydroxycholecalciferol-26,23-lactone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE881358A true BE881358A (fr) | 1980-05-16 |
Family
ID=21726382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE0/199120A BE881358A (fr) | 1979-01-26 | 1980-01-25 | 25-hydroxycholecalciferol-26,23-lactone |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4223131A (OSRAM) |
| JP (1) | JPS56500045A (OSRAM) |
| AU (1) | AU529072B2 (OSRAM) |
| BE (1) | BE881358A (OSRAM) |
| CH (1) | CH642071A5 (OSRAM) |
| FR (1) | FR2447377A1 (OSRAM) |
| GB (1) | GB2042549B (OSRAM) |
| IE (1) | IE49369B1 (OSRAM) |
| IL (1) | IL59162A (OSRAM) |
| NL (1) | NL8020035A (OSRAM) |
| NZ (1) | NZ192603A (OSRAM) |
| WO (1) | WO1980001565A1 (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58118515A (ja) * | 1981-12-29 | 1983-07-14 | Teijin Ltd | 25‐ヒドロキシビタミンd↓3―26,23‐ラクトンを含有する血清カルシュウム低下剤 |
| DE3247836A1 (de) * | 1981-12-29 | 1983-07-07 | Teijin Ltd., Osaka | Arzneimittel und verwendung derselben zur steuerung der serumcalciumkonzentration bei warmbluetern |
| US4456689A (en) * | 1982-05-17 | 1984-06-26 | Becton Dickinson And Company | Competitive protein binding assay using an organosilane-silica gel separation medium |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3565924A (en) * | 1968-07-01 | 1971-02-23 | Wisconsin Alumni Res Found | 25-hydroxycholfcalciferol |
| US3772150A (en) * | 1971-12-29 | 1973-11-13 | Us Health | Process for producing vitamin d{11 {11 metabolite |
| US3715374A (en) * | 1972-05-05 | 1973-02-06 | Wisconsin Alumni Res Found | 24,25-dihydroxycholecalciferol |
| US3847955A (en) * | 1973-07-16 | 1974-11-12 | Wisconsin Alumni Res Found | 1,24,25-trihydroxycholecalciferol |
| US3907843A (en) * | 1974-06-14 | 1975-09-23 | Wisconsin Alumni Res Found | 1{60 -Hydroxyergocalciferol and processes for preparing same |
| US4028349A (en) * | 1976-03-08 | 1977-06-07 | Hoffmann-La Roche Inc. | Syntheses of 24R,25- and 24S,25-dihydroxycholesterol 24,25-ketals and alkanoyl derivatives thereof |
-
1979
- 1979-01-26 US US06/007,473 patent/US4223131A/en not_active Expired - Lifetime
-
1980
- 1980-01-14 NZ NZ192603A patent/NZ192603A/en unknown
- 1980-01-17 WO PCT/US1980/000044 patent/WO1980001565A1/en not_active Ceased
- 1980-01-17 JP JP50044080A patent/JPS56500045A/ja active Pending
- 1980-01-17 CH CH716380A patent/CH642071A5/de not_active IP Right Cessation
- 1980-01-17 NL NL8020035A patent/NL8020035A/xx not_active Application Discontinuation
- 1980-01-18 IL IL59162A patent/IL59162A/xx unknown
- 1980-01-25 AU AU54948/80A patent/AU529072B2/en not_active Ceased
- 1980-01-25 IE IE142/80A patent/IE49369B1/en unknown
- 1980-01-25 BE BE0/199120A patent/BE881358A/fr not_active IP Right Cessation
- 1980-01-25 GB GB8002618A patent/GB2042549B/en not_active Expired
- 1980-01-25 FR FR8001685A patent/FR2447377A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| WO1980001565A1 (en) | 1980-08-07 |
| IL59162A (en) | 1982-12-31 |
| FR2447377A1 (fr) | 1980-08-22 |
| GB2042549A (en) | 1980-09-24 |
| NL8020035A (nl) | 1980-11-28 |
| IE49369B1 (en) | 1985-09-18 |
| AU529072B2 (en) | 1983-05-26 |
| FR2447377B1 (OSRAM) | 1982-11-19 |
| IL59162A0 (en) | 1980-05-30 |
| IE800142L (en) | 1980-07-26 |
| JPS56500045A (OSRAM) | 1981-01-16 |
| GB2042549B (en) | 1983-02-09 |
| CH642071A5 (de) | 1984-03-30 |
| AU5494880A (en) | 1980-07-31 |
| US4223131A (en) | 1980-09-16 |
| NZ192603A (en) | 1984-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI850198L (fi) | Expressionsplasmid. | |
| FI870555A7 (fi) | Nya -laktamasinhibitorfoereningar. | |
| ES256673Y (es) | Guardavistas. | |
| IT8021110A0 (it) | Mercaptoacildipeptidi. | |
| ES254327Y (es) | Portillon. | |
| FI73548B (fi) | Oeverstroemskyddskrets foer effekttransistor. | |
| FI872955A0 (fi) | 1-cyklohexenylmetyletyl-pyrrolidinderivat. | |
| DK425183D0 (da) | 3-hydroxy-24, 24-difluor-25-hydroxycholestand-5,7-dien | |
| NO802888L (no) | 2-klor-4,5-disubstituerte-thiazoler | |
| IT8023118A0 (it) | Immagazzinatore. | |
| IT1209290B (it) | Tetraidrofuran-derivato. | |
| FI854729A0 (fi) | Vedhuggningsmaskin. | |
| IT7920853A0 (it) | Piretroidi. | |
| IT8023753A0 (it) | Colecalciferol-derivati. | |
| FI73539B (fi) | Multiplexanslutningsenhet foer en digitalstation. | |
| IT7927542A0 (it) | Piretroidi. | |
| IT8021496A0 (it) | N-alchinilanilidi. | |
| BE881358A (fr) | 25-hydroxycholecalciferol-26,23-lactone | |
| IT7922553A0 (it) | Pirazolo-triazolo-trioni antibotritici. | |
| ES241610Y (es) | Muneco automecedor. | |
| ES253452Y (es) | Porta-fosforos. | |
| ES243430Y (es) | Exprime-limones. | |
| ES243197Y (es) | Interruptor-conmutador. | |
| ES243098Y (es) | Hidrociclo. | |
| ES242177Y (es) | Medallon-estuche. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RE | Patent lapsed |
Owner name: WISCONSIN ALUMNI RESEARCH FOUNDATION Effective date: 19880131 |