AU529072B2 - 25-hydroxycholecalciferol-26,23-lactone - Google Patents
25-hydroxycholecalciferol-26,23-lactoneInfo
- Publication number
- AU529072B2 AU529072B2 AU54948/80A AU5494880A AU529072B2 AU 529072 B2 AU529072 B2 AU 529072B2 AU 54948/80 A AU54948/80 A AU 54948/80A AU 5494880 A AU5494880 A AU 5494880A AU 529072 B2 AU529072 B2 AU 529072B2
- Authority
- AU
- Australia
- Prior art keywords
- hydroxycholecalciferol
- lactone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- IJNDMZIDDKVXHR-DYEHSFNOSA-N 5-[(2r)-2-[(1r,3as,4e,7ar)-4-[(2z)-2-[(5s)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1h-inden-1-yl]propyl]-3-hydroxy-3-methyloxolan-2-one Chemical compound C([C@@H](C)[C@@H]1[C@]2(CCCC(/[C@@H]2CC1)=C\C=C\1C(CC[C@H](O)C/1)=C)C)C1CC(C)(O)C(=O)O1 IJNDMZIDDKVXHR-DYEHSFNOSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/007,473 US4223131A (en) | 1979-01-26 | 1979-01-26 | 25-Hydroxycholecalciferol-26,23-lactone |
| US007473 | 1995-11-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU5494880A AU5494880A (en) | 1980-07-31 |
| AU529072B2 true AU529072B2 (en) | 1983-05-26 |
Family
ID=21726382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU54948/80A Ceased AU529072B2 (en) | 1979-01-26 | 1980-01-25 | 25-hydroxycholecalciferol-26,23-lactone |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4223131A (OSRAM) |
| JP (1) | JPS56500045A (OSRAM) |
| AU (1) | AU529072B2 (OSRAM) |
| BE (1) | BE881358A (OSRAM) |
| CH (1) | CH642071A5 (OSRAM) |
| FR (1) | FR2447377A1 (OSRAM) |
| GB (1) | GB2042549B (OSRAM) |
| IE (1) | IE49369B1 (OSRAM) |
| IL (1) | IL59162A (OSRAM) |
| NL (1) | NL8020035A (OSRAM) |
| NZ (1) | NZ192603A (OSRAM) |
| WO (1) | WO1980001565A1 (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3247836A1 (de) * | 1981-12-29 | 1983-07-07 | Teijin Ltd., Osaka | Arzneimittel und verwendung derselben zur steuerung der serumcalciumkonzentration bei warmbluetern |
| JPS58118515A (ja) * | 1981-12-29 | 1983-07-14 | Teijin Ltd | 25‐ヒドロキシビタミンd↓3―26,23‐ラクトンを含有する血清カルシュウム低下剤 |
| US4456689A (en) * | 1982-05-17 | 1984-06-26 | Becton Dickinson And Company | Competitive protein binding assay using an organosilane-silica gel separation medium |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3565924A (en) * | 1968-07-01 | 1971-02-23 | Wisconsin Alumni Res Found | 25-hydroxycholfcalciferol |
| US3772150A (en) * | 1971-12-29 | 1973-11-13 | Us Health | Process for producing vitamin d{11 {11 metabolite |
| US3715374A (en) * | 1972-05-05 | 1973-02-06 | Wisconsin Alumni Res Found | 24,25-dihydroxycholecalciferol |
| US3847955A (en) * | 1973-07-16 | 1974-11-12 | Wisconsin Alumni Res Found | 1,24,25-trihydroxycholecalciferol |
| US3907843A (en) * | 1974-06-14 | 1975-09-23 | Wisconsin Alumni Res Found | 1{60 -Hydroxyergocalciferol and processes for preparing same |
| US4028349A (en) * | 1976-03-08 | 1977-06-07 | Hoffmann-La Roche Inc. | Syntheses of 24R,25- and 24S,25-dihydroxycholesterol 24,25-ketals and alkanoyl derivatives thereof |
-
1979
- 1979-01-26 US US06/007,473 patent/US4223131A/en not_active Expired - Lifetime
-
1980
- 1980-01-14 NZ NZ192603A patent/NZ192603A/en unknown
- 1980-01-17 NL NL8020035A patent/NL8020035A/xx not_active Application Discontinuation
- 1980-01-17 WO PCT/US1980/000044 patent/WO1980001565A1/en not_active Ceased
- 1980-01-17 JP JP50044080A patent/JPS56500045A/ja active Pending
- 1980-01-17 CH CH716380A patent/CH642071A5/de not_active IP Right Cessation
- 1980-01-18 IL IL59162A patent/IL59162A/xx unknown
- 1980-01-25 GB GB8002618A patent/GB2042549B/en not_active Expired
- 1980-01-25 FR FR8001685A patent/FR2447377A1/fr active Granted
- 1980-01-25 IE IE142/80A patent/IE49369B1/en unknown
- 1980-01-25 BE BE0/199120A patent/BE881358A/fr not_active IP Right Cessation
- 1980-01-25 AU AU54948/80A patent/AU529072B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| JPS56500045A (OSRAM) | 1981-01-16 |
| US4223131A (en) | 1980-09-16 |
| BE881358A (fr) | 1980-05-16 |
| IE800142L (en) | 1980-07-26 |
| WO1980001565A1 (en) | 1980-08-07 |
| GB2042549A (en) | 1980-09-24 |
| IL59162A (en) | 1982-12-31 |
| AU5494880A (en) | 1980-07-31 |
| NL8020035A (nl) | 1980-11-28 |
| IL59162A0 (en) | 1980-05-30 |
| GB2042549B (en) | 1983-02-09 |
| IE49369B1 (en) | 1985-09-18 |
| FR2447377B1 (OSRAM) | 1982-11-19 |
| NZ192603A (en) | 1984-05-31 |
| CH642071A5 (de) | 1984-03-30 |
| FR2447377A1 (fr) | 1980-08-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU545756B2 (en) | Alpha-alkyl-alpha-phenyl-1h-1,2,4-triazole-1-ethanols | |
| AU532879B2 (en) | 1-aryl-2-acylamido-3-fluoro-1-propanols | |
| AU532626B2 (en) | Monacolink | |
| AU535632B2 (en) | Cyclo-octapeptides | |
| AU541679B2 (en) | Ergolinyl -n:,n:-diethylurea derivatives | |
| AU533526B2 (en) | Polyether-polyamines | |
| AU529508B2 (en) | 6-n-propyl-8alpha-methoxymethyl or -methylmercaptomethyl -ergolines | |
| AU525431B2 (en) | Emulsans | |
| AU532884B2 (en) | Vinyl-cephalosporins | |
| AU528665B2 (en) | Breathalyser | |
| AU527992B2 (en) | 9-aminoalkylfluorenes | |
| AU532763B2 (en) | 8-aminoalkyl-4-alkylpsoralens | |
| AU531808B2 (en) | Tetrahydrobenzothiazolylimidazolidinones | |
| AU531811B2 (en) | Thiazolylidene-oxo-propionitriles | |
| AU507873B2 (en) | 8b-ethyl-and 8b-methyl-4,5x-epoxymorphinan-6-compounds | |
| AU532700B2 (en) | Diphenylalkanoether | |
| AU528075B2 (en) | Z-aza-ergolines | |
| AU535376B2 (en) | N-oximinoalkyl-anilides | |
| AU531825B2 (en) | 4-beta-substituted-2-azetidinones | |
| AU529072B2 (en) | 25-hydroxycholecalciferol-26,23-lactone | |
| AU4872179A (en) | 2-amino-6-n,n-dimethylcarbamoyloxy-pyrimidines | |
| AU522061B2 (en) | 1-oxa-4-aza-2,6-disilacyclohexanes | |
| AU550928B2 (en) | 5-bromo-2,3-diarylthiophenes | |
| AU534329B2 (en) | Guanioinothiazoles | |
| AU519842B2 (en) | Mononitro-n-alkyl-3, 4-xylidines |