BE841496A - Cephalosporines substituees par des groupements amine - Google Patents
Cephalosporines substituees par des groupements amineInfo
- Publication number
- BE841496A BE841496A BE1007359A BE1007359A BE841496A BE 841496 A BE841496 A BE 841496A BE 1007359 A BE1007359 A BE 1007359A BE 1007359 A BE1007359 A BE 1007359A BE 841496 A BE841496 A BE 841496A
- Authority
- BE
- Belgium
- Prior art keywords
- amine groups
- cephalosporins
- substituted
- cephalosporins substituted
- amine
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 150000001412 amines Chemical group 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical group S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/02—Preparation
- C07D501/04—Preparation from compounds already containing the ring or condensed ring systems, e.g. by dehydrogenation of the ring, by introduction, elimination or modification of substituents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/59—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3 with hetero atoms directly attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/576,818 US4013651A (en) | 1975-05-12 | 1975-05-12 | 3-substituted amino-cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE841496A true BE841496A (fr) | 1976-11-08 |
Family
ID=24306128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE1007359A BE841496A (fr) | 1975-05-12 | 1976-05-06 | Cephalosporines substituees par des groupements amine |
Country Status (11)
| Country | Link |
|---|---|
| US (3) | US4013651A (enExample) |
| JP (1) | JPS51138697A (enExample) |
| BE (1) | BE841496A (enExample) |
| CA (1) | CA1074782A (enExample) |
| CH (3) | CH619958A5 (enExample) |
| DE (1) | DE2620308A1 (enExample) |
| ES (3) | ES447805A1 (enExample) |
| GB (1) | GB1544984A (enExample) |
| IE (1) | IE42540B1 (enExample) |
| IL (1) | IL49318A (enExample) |
| NL (3) | NL7605077A (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3947413A (en) * | 1972-11-13 | 1976-03-30 | Merck & Co., Inc. | 3-α-Substituted cephalosporins |
| AT342197B (de) * | 1975-02-20 | 1978-03-28 | Ciba Geigy Ag | Neues verfahren zur herstellung von 3-cephemverbindungen |
| US4550162A (en) * | 1975-02-20 | 1985-10-29 | Ciba-Geigy Corporation | Process for the manufacture of enol derivatives |
| US4434287A (en) | 1975-02-20 | 1984-02-28 | Ciba-Geigy Corporation | Cephalosporin derivatives |
| JPS543087A (en) * | 1977-06-03 | 1979-01-11 | Fujisawa Pharmaceut Co Ltd | Preparation of cephalosporin compound |
| US4244885A (en) * | 1977-12-08 | 1981-01-13 | Yeda Research And Development Co. Ltd. | α-Substituted-3-(halomethyl)-4-hydroxybenzeneacetic acids |
| US4436903A (en) | 1980-12-22 | 1984-03-13 | Ciba-Geigy Corporation | Process for the production of 7 β-substituted-3-unsubstituted-3-cephem-4-carboxylic acid compounds |
| US4533497A (en) * | 1982-12-27 | 1985-08-06 | Eli Lilly And Company | N-ethylidene azetidinones |
| US5019571A (en) * | 1988-01-25 | 1991-05-28 | Eli Lilly And Company | 1-carbacephalosporin antibiotics |
| ES2055030T3 (es) * | 1988-01-25 | 1994-08-16 | Lilly Co Eli | Antibioticos de 1-carbacefalosporina. |
| WO2017190043A1 (en) * | 2016-04-29 | 2017-11-02 | University Of Kansas | Cephalosporin-type compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE412238B (sv) * | 1971-05-24 | 1980-02-25 | Ciba Geigy | Forfarande for framstellning av 7 beta-amino-cefem-4-karboxylsyraforeningar genom dekarbonylering av en 3-formyl-cefem-4-karboxylsyraforening |
| US4001226A (en) * | 1974-12-04 | 1977-01-04 | Eli Lilly And Company | 3-(substituted)carbonylamino cephem derivatives |
| JPS609516B2 (ja) * | 1975-03-07 | 1985-03-11 | 塩野義製薬株式会社 | セフエム骨格の環化製法 |
| AT342197B (de) * | 1975-02-20 | 1978-03-28 | Ciba Geigy Ag | Neues verfahren zur herstellung von 3-cephemverbindungen |
-
1975
- 1975-05-12 US US05/576,818 patent/US4013651A/en not_active Expired - Lifetime
-
1976
- 1976-03-30 IE IE664/76A patent/IE42540B1/en unknown
- 1976-03-31 IL IL49318A patent/IL49318A/xx unknown
- 1976-04-01 CA CA249,339A patent/CA1074782A/en not_active Expired
- 1976-05-05 GB GB18312/76A patent/GB1544984A/en not_active Expired
- 1976-05-06 BE BE1007359A patent/BE841496A/xx not_active IP Right Cessation
- 1976-05-07 DE DE19762620308 patent/DE2620308A1/de not_active Withdrawn
- 1976-05-11 ES ES447805A patent/ES447805A1/es not_active Expired
- 1976-05-11 ES ES447807A patent/ES447807A1/es not_active Expired
- 1976-05-11 ES ES447806A patent/ES447806A1/es not_active Expired
- 1976-05-11 JP JP51054245A patent/JPS51138697A/ja active Pending
- 1976-05-12 NL NL7605077A patent/NL7605077A/xx not_active Application Discontinuation
- 1976-05-12 CH CH595576A patent/CH619958A5/de not_active IP Right Cessation
- 1976-05-12 CH CH595476A patent/CH621123A5/de not_active IP Right Cessation
- 1976-05-12 CH CH595376A patent/CH623054A5/de not_active IP Right Cessation
- 1976-05-12 NL NL7605078A patent/NL7605078A/xx not_active Application Discontinuation
- 1976-05-12 NL NL7605075A patent/NL7605075A/xx not_active Application Discontinuation
- 1976-09-03 US US05/720,179 patent/US4065618A/en not_active Expired - Lifetime
- 1976-09-03 US US05/720,180 patent/US4065621A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES447807A1 (es) | 1977-10-01 |
| IL49318A (en) | 1980-03-31 |
| US4065618A (en) | 1977-12-27 |
| US4013651A (en) | 1977-03-22 |
| US4065621A (en) | 1977-12-27 |
| DE2620308A1 (de) | 1976-11-25 |
| CA1074782A (en) | 1980-04-01 |
| GB1544984A (en) | 1979-04-25 |
| ES447805A1 (es) | 1978-04-01 |
| JPS51138697A (en) | 1976-11-30 |
| IE42540L (en) | 1976-11-12 |
| CH623054A5 (enExample) | 1981-05-15 |
| NL7605078A (nl) | 1976-11-16 |
| NL7605075A (nl) | 1976-11-16 |
| ES447806A1 (es) | 1977-10-01 |
| NL7605077A (nl) | 1976-11-16 |
| IE42540B1 (en) | 1980-08-27 |
| IL49318A0 (en) | 1976-05-31 |
| CH621123A5 (enExample) | 1981-01-15 |
| CH619958A5 (enExample) | 1980-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE842221A (fr) | Aluminosilicates cristallins | |
| TR19633A (tr) | Alfa-olifinleri polimerize etmeye mahsus katalizatoerler | |
| FR2299170A1 (fr) | Pneumatique | |
| BE841363A (fr) | Separateur-amortisseur | |
| FR2327109A1 (fr) | Pneumatique | |
| SE406046B (sv) | Applikatorhuvud for festorgan | |
| BG26504A3 (bg) | Средство за обезлистване на растения | |
| FR2306844A1 (fr) | Pneumatique | |
| SE7505163L (sv) | Torneschoke for hagelvapen | |
| FR2300429A1 (fr) | Groupement | |
| BE841496A (fr) | Cephalosporines substituees par des groupements amine | |
| SE408126B (sv) | Berband for blixtlas | |
| SE7609476L (sv) | Berkonstruktion for bergtunnlar | |
| SE411166B (sv) | Berband for blixtlas | |
| AT339067B (de) | Afokaler vorsatz | |
| FR2302384A1 (fr) | Train d | |
| FR2321891A1 (fr) | Nouvelles cephalosporines | |
| SE7611965L (sv) | Bensenderivat | |
| BR7600558A (pt) | Involtorio de pneumatico | |
| IT1053853B (it) | Composti polimerici ammina epicloroidrina | |
| SE7610077L (sv) | Eggviterikt fordermedel for idisslare | |
| IT1078786B (it) | Composizione elastomerica | |
| TR19001A (tr) | Insektisid olarak kullanilan piretroidler | |
| FI53155C (fi) | Foerspaent byggnadselement med en traekonstruktion | |
| DK215176A (da) | Antibiotikum |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RE | Patent lapsed |
Owner name: ELI LILLY AND CY Effective date: 19940531 |