BE513156A - - Google Patents
Info
- Publication number
- BE513156A BE513156A BE513156DA BE513156A BE 513156 A BE513156 A BE 513156A BE 513156D A BE513156D A BE 513156DA BE 513156 A BE513156 A BE 513156A
- Authority
- BE
- Belgium
- Prior art keywords
- sep
- insecticidal
- composition
- fumes
- potassium
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 44
- 230000000749 insecticidal Effects 0.000 claims description 43
- 150000001875 compounds Chemical class 0.000 claims description 24
- 239000003517 fume Substances 0.000 claims description 12
- CNUNWZZSUJPAHX-UHFFFAOYSA-N Guanidine nitrate Chemical compound NC(N)=N.O[N+]([O-])=O CNUNWZZSUJPAHX-UHFFFAOYSA-N 0.000 claims description 11
- XAQCJVGGJJFLPP-UHFFFAOYSA-L azane;hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium Chemical compound N.N.O[Cr](=O)(=O)O[Cr](O)(=O)=O XAQCJVGGJJFLPP-UHFFFAOYSA-L 0.000 claims description 7
- 239000000779 smoke Substances 0.000 claims description 7
- DVARTQFDIMZBAA-UHFFFAOYSA-O Ammonium nitrate Chemical compound [NH4+].[O-][N+]([O-])=O DVARTQFDIMZBAA-UHFFFAOYSA-O 0.000 claims description 6
- LCCNCVORNKJIRZ-UHFFFAOYSA-N Parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 claims description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 6
- 229910052700 potassium Inorganic materials 0.000 claims description 6
- 239000011591 potassium Substances 0.000 claims description 6
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 claims description 4
- FGRVOLIFQGXPCT-UHFFFAOYSA-L dipotassium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[K+].[O-]S([O-])(=O)=S FGRVOLIFQGXPCT-UHFFFAOYSA-L 0.000 claims description 3
- KMUONIBRACKNSN-UHFFFAOYSA-N Potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 claims 2
- 229940069002 Potassium Dichromate Drugs 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 229920001098 polystyrene-block-poly(ethylene/propylene) Polymers 0.000 description 302
- 239000007789 gas Substances 0.000 description 15
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N Lindane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 10
- 229960002809 lindane Drugs 0.000 description 10
- 230000000694 effects Effects 0.000 description 8
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 241000238631 Hexapoda Species 0.000 description 4
- 239000002917 insecticide Substances 0.000 description 4
- 230000000885 phytotoxic Effects 0.000 description 4
- 231100000208 phytotoxic Toxicity 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 241000256111 Aedes <genus> Species 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- PZZYQPZGQPZBDN-UHFFFAOYSA-N Aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N Chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- KRVSOGSZCMJSLX-UHFFFAOYSA-L Chromic acid Chemical class O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 2
- 241000227653 Lycopersicon Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating Effects 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 238000003958 fumigation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000001264 neutralization Effects 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- JMWJGYSYWIJZRH-UHFFFAOYSA-N (4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl) 2-cyano-2-sulfanylideneacetate Chemical compound C1CC2(C)C(OC(=O)C(=S)C#N)CC1C2(C)C JMWJGYSYWIJZRH-UHFFFAOYSA-N 0.000 description 1
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-Tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 1
- 241000256118 Aedes aegypti Species 0.000 description 1
- JOSWYUNQBRPBDN-UHFFFAOYSA-P Ammonium dichromate Chemical compound [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O JOSWYUNQBRPBDN-UHFFFAOYSA-P 0.000 description 1
- VBIXEXWLHSRNKB-UHFFFAOYSA-N Ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 description 1
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 1
- CKAPSXZOOQJIBF-UHFFFAOYSA-N Hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- IDCBOTIENDVCBQ-UHFFFAOYSA-N Tetraethyl pyrophosphate Chemical compound CCOP(=O)(OCC)OP(=O)(OCC)OCC IDCBOTIENDVCBQ-UHFFFAOYSA-N 0.000 description 1
- IXEVGHXRXDBAOB-GBIKHYSHSA-N [(1R,3S,4S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] 2-thiocyanatoacetate Chemical compound C1C[C@]2(C)[C@@H](OC(=O)CSC#N)C[C@@H]1C2(C)C IXEVGHXRXDBAOB-GBIKHYSHSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 230000000249 desinfective Effects 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 239000002316 fumigant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 230000001235 sensitizing Effects 0.000 description 1
- 231100000202 sensitizing Toxicity 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE513156A true BE513156A (xx) |
Family
ID=151361
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE513156D BE513156A (xx) |
Country Status (1)
| Country | Link |
|---|---|
| BE (1) | BE513156A (xx) |
-
0
- BE BE513156D patent/BE513156A/fr unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Chaudhry | Review a review of the mechanisms involved in the action of phosphine as an insecticide and phosphine resistance in stored‐product insects | |
| US2440082A (en) | Thermally vaporisable fumigant comprising sensitized ammonium nitrate and a presticide | |
| US2700011A (en) | Fumigating compositions | |
| BE513156A (xx) | ||
| US2423284A (en) | Insecticides | |
| US2695258A (en) | Pest control smoke generators | |
| FR2845378A1 (fr) | Base fumigene et utilisations | |
| US2532349A (en) | Pesticidal or insect-repellent fumigating compositions | |
| US3042580A (en) | Aerosol generating preparations | |
| US2606858A (en) | Thermally vaporizable pesticide | |
| BE482721A (xx) | ||
| US2578858A (en) | Fumigating compositions | |
| US3272694A (en) | Sevin-lindane insecticidal fumigating composition and method | |
| US2579300A (en) | Chlorinated pinane insecticidal composition | |
| JPS6339803A (ja) | 害虫駆除方法 | |
| US1819145A (en) | Method for the destruction of animal pests | |
| RU2258056C1 (ru) | Пиротехнический состав для генерации аэрозоля серы | |
| JPS60130501A (ja) | 燻蒸用薬剤組成物 | |
| JPS60130502A (ja) | 燻蒸用薬剤組成物 | |
| JP3552131B2 (ja) | 害虫防除用燻蒸剤組成物 | |
| DE850678C (de) | Raeuchermasse zur Schaedlingsbekaempfung | |
| US578862A (en) | Insecticide | |
| US2579298A (en) | Chlorinated bornyl chloride insecticidal composition | |
| SE122435C1 (xx) | ||
| US1521537A (en) | Fumigant and process of fumigation |