AT384414B - Verfahren zur herstellung von natriumpercarbonat - Google Patents
Verfahren zur herstellung von natriumpercarbonatInfo
- Publication number
- AT384414B AT384414B AT0079478A AT79478A AT384414B AT 384414 B AT384414 B AT 384414B AT 0079478 A AT0079478 A AT 0079478A AT 79478 A AT79478 A AT 79478A AT 384414 B AT384414 B AT 384414B
- Authority
- AT
- Austria
- Prior art keywords
- sodium percarbonate
- producing sodium
- producing
- percarbonate
- sodium
- Prior art date
Links
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 229940045872 sodium percarbonate Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/10—Peroxyhydrates; Peroxyacids or salts thereof containing carbon
- C01B15/103—Peroxyhydrates; Peroxyacids or salts thereof containing carbon containing only alkali metals as metals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7703865A FR2380221A1 (fr) | 1977-02-11 | 1977-02-11 | Perfectionnement au procede de preparation du percarbonate de sodium |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA79478A ATA79478A (de) | 1987-04-15 |
| AT384414B true AT384414B (de) | 1987-11-10 |
Family
ID=9186600
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0079478A AT384414B (de) | 1977-02-11 | 1978-02-06 | Verfahren zur herstellung von natriumpercarbonat |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4190635A (enExample) |
| JP (1) | JPS6045121B2 (enExample) |
| AT (1) | AT384414B (enExample) |
| AU (1) | AU518778B2 (enExample) |
| BE (1) | BE863795A (enExample) |
| BR (1) | BR7800818A (enExample) |
| CA (1) | CA1113223A (enExample) |
| CH (1) | CH626863A5 (enExample) |
| DE (1) | DE2805338C3 (enExample) |
| DK (1) | DK148628C (enExample) |
| ES (1) | ES466895A1 (enExample) |
| FR (1) | FR2380221A1 (enExample) |
| GB (1) | GB1554135A (enExample) |
| IE (1) | IE46388B1 (enExample) |
| IT (1) | IT1107027B (enExample) |
| LU (1) | LU79046A1 (enExample) |
| NL (1) | NL186958C (enExample) |
| NO (1) | NO148590C (enExample) |
| SE (1) | SE429228B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4316879A (en) * | 1977-06-17 | 1982-02-23 | Fmc Corporation | Stabilized sodium carbonate peroxide preparation method |
| US5328721A (en) * | 1992-07-30 | 1994-07-12 | Fmc Corporation | Process for manufacturing sodium carbonate perhydrate particles and coating them with sodium borosilicate |
| US5756445A (en) * | 1993-11-11 | 1998-05-26 | The Proctor & Gamble Company | Granular detergent composition comprising a low bulk density component |
| EP0944549B1 (de) * | 1996-12-16 | 2011-03-30 | Solvay Chemicals GmbH | Verfahren zur herstellung von natriumpercarbonat |
| KR100393323B1 (ko) * | 2001-05-25 | 2003-07-31 | 신세희 | 무공해 분말세제 조성물과 그 제조방법 |
| KR100494814B1 (ko) * | 2003-02-17 | 2005-06-13 | 동양제철화학 주식회사 | 입상 과탄산나트륨의 제조방법 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2237833B1 (enExample) * | 1973-07-20 | 1976-04-30 | Ugine Kuhlmann | |
| FR2242328B1 (enExample) * | 1973-08-28 | 1976-05-07 | Ugine Kuhlmann | |
| US4012383A (en) * | 1975-01-02 | 1977-03-15 | Bristol-Myers Company | Δ2,3 -1,4-morpholine-2-carboxylic acids and derivatives thereof useful in preparation of antibacteria agents |
| JPS51135900A (en) * | 1975-05-19 | 1976-11-25 | Kao Corp | Method for prod uction of the stable sodium percarbonate |
-
1977
- 1977-02-11 FR FR7703865A patent/FR2380221A1/fr active Granted
-
1978
- 1978-01-11 US US05/868,680 patent/US4190635A/en not_active Expired - Lifetime
- 1978-01-31 GB GB3889/78A patent/GB1554135A/en not_active Expired
- 1978-02-02 IE IE219/78A patent/IE46388B1/en not_active IP Right Cessation
- 1978-02-06 AT AT0079478A patent/AT384414B/de not_active IP Right Cessation
- 1978-02-09 DE DE2805338A patent/DE2805338C3/de not_active Expired
- 1978-02-09 JP JP53013034A patent/JPS6045121B2/ja not_active Expired
- 1978-02-09 SE SE7801536A patent/SE429228B/sv not_active IP Right Cessation
- 1978-02-09 BE BE185025A patent/BE863795A/xx not_active IP Right Cessation
- 1978-02-10 LU LU79046A patent/LU79046A1/xx unknown
- 1978-02-10 NO NO780465A patent/NO148590C/no unknown
- 1978-02-10 CH CH153178A patent/CH626863A5/fr not_active IP Right Cessation
- 1978-02-10 NL NLAANVRAGE7801567,A patent/NL186958C/xx not_active IP Right Cessation
- 1978-02-10 ES ES466895A patent/ES466895A1/es not_active Expired
- 1978-02-10 AU AU33194/78A patent/AU518778B2/en not_active Expired
- 1978-02-10 IT IT67276/78A patent/IT1107027B/it active
- 1978-02-10 CA CA296,779A patent/CA1113223A/fr not_active Expired
- 1978-02-10 DK DK60778A patent/DK148628C/da not_active IP Right Cessation
- 1978-02-10 BR BR7800818A patent/BR7800818A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL186958B (nl) | 1990-11-16 |
| NO780465L (no) | 1978-08-14 |
| CH626863A5 (enExample) | 1981-12-15 |
| BE863795A (fr) | 1978-08-09 |
| IT7867276A0 (it) | 1978-02-10 |
| AU3319478A (en) | 1979-08-16 |
| JPS53100198A (en) | 1978-09-01 |
| JPS6045121B2 (ja) | 1985-10-08 |
| NO148590C (no) | 1983-11-09 |
| ES466895A1 (es) | 1978-10-01 |
| IE46388B1 (en) | 1983-05-18 |
| DE2805338A1 (de) | 1978-08-17 |
| US4190635A (en) | 1980-02-26 |
| DK148628C (da) | 1986-04-28 |
| BR7800818A (pt) | 1978-11-28 |
| GB1554135A (en) | 1979-10-17 |
| DE2805338B2 (de) | 1980-06-26 |
| ATA79478A (de) | 1987-04-15 |
| FR2380221A1 (fr) | 1978-09-08 |
| SE7801536L (sv) | 1978-08-12 |
| NL186958C (nl) | 1991-04-16 |
| DK148628B (da) | 1985-08-19 |
| LU79046A1 (fr) | 1979-09-06 |
| CA1113223A (fr) | 1981-12-01 |
| FR2380221B1 (enExample) | 1981-02-27 |
| NL7801567A (nl) | 1978-08-15 |
| DK60778A (da) | 1978-08-12 |
| DE2805338C3 (de) | 1986-10-02 |
| IE780219L (en) | 1978-08-11 |
| NO148590B (no) | 1983-08-01 |
| IT1107027B (it) | 1985-11-18 |
| SE429228B (sv) | 1983-08-22 |
| AU518778B2 (en) | 1981-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT367438B (de) | Verfahren zur herstellung von oligoimiden | |
| AT356627B (de) | Verfahren zur herstellung von natrium- percarbonat | |
| AT356096B (de) | Verfahren zur herstellung von furokumarinen | |
| AT358548B (de) | Verfahren zur herstellung von 2-aethylhexanol | |
| AT358559B (de) | Verfahren zur herstellung von o-methallyloxy- phenol | |
| DD134511A5 (de) | Verfahren zur herstellung von dampfgehaertetem gasbeton | |
| AT360504B (de) | Verfahren zur herstellung von m-chloranilinen | |
| DD135077A5 (de) | Verfahren zur herstellung von nitrosobenzol | |
| AT356643B (de) | Verfahren zur herstellung von acylcyaniden | |
| AT360154B (de) | Verfahren zur herstellung von aminoglycosid- -antibiotka | |
| AT377741B (de) | Verfahren zur herstellung von chlordioxid | |
| AT360648B (de) | Verfahren zur herstellung von p-hydroxy-alpha- -aminobenzylpenicillin | |
| AT384414B (de) | Verfahren zur herstellung von natriumpercarbonat | |
| AT356642B (de) | Verfahren zur herstellung von acylcyaniden | |
| AT347440B (de) | Verfahren zur herstellung von benzoylcyanid | |
| AT372360B (de) | Verfahren zur herstellung von natriumtripolyphosphat | |
| AT366036B (de) | Verfahren zur herstellung von 3-pyridazonen | |
| AT365590B (de) | Verfahren zur herstellung von apovincamin | |
| AT352104B (de) | Verfahren zur herstellung von n-cyanoalkyl-p- halogenphenoxy-isobutyramiden | |
| AT359483B (de) | Verfahren zur herstellung von benzoylcyanid | |
| AT361497B (de) | Verfahren zur herstellung von alkylthiosemi- carbaziden | |
| AT359510B (de) | Verfahren zur herstellung von benzylpyrimidinen | |
| AT358021B (de) | Verfahren zur herstellung von benzoylcyanid | |
| DD128687A5 (de) | Verfahren zur herstellung von zinnii-sulfat | |
| ATA87578A (de) | Verfahren zur herstellung von natriumtrimetaphosphat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RER | Ceased as to paragraph 5 lit. 3 law introducing patent treaties | ||
| ELJ | Ceased due to non-payment of the annual fee |