AT360117B - Hochdrucknatriumdampfentladungslampe - Google Patents
HochdrucknatriumdampfentladungslampeInfo
- Publication number
- AT360117B AT360117B AT256478A AT256478A AT360117B AT 360117 B AT360117 B AT 360117B AT 256478 A AT256478 A AT 256478A AT 256478 A AT256478 A AT 256478A AT 360117 B AT360117 B AT 360117B
- Authority
- AT
- Austria
- Prior art keywords
- high pressure
- discharge lamp
- steam discharge
- pressure sodium
- sodium steam
- Prior art date
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title 1
- 229910052708 sodium Inorganic materials 0.000 title 1
- 239000011734 sodium Substances 0.000 title 1
- 238000004326 stimulated echo acquisition mode for imaging Methods 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
- H01J61/22—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent vapour of an alkali metal
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7704132,A NL181157C (nl) | 1977-04-15 | 1977-04-15 | Hogedruknatriumdampontladingslamp. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA256478A ATA256478A (de) | 1980-05-15 |
| AT360117B true AT360117B (de) | 1980-12-29 |
Family
ID=19828362
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT256478A AT360117B (de) | 1977-04-15 | 1978-04-12 | Hochdrucknatriumdampfentladungslampe |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4146813A (de) |
| JP (1) | JPS53129469A (de) |
| AT (1) | AT360117B (de) |
| BE (1) | BE865961A (de) |
| CA (1) | CA1101918A (de) |
| DE (1) | DE2814882C3 (de) |
| ES (1) | ES468743A1 (de) |
| FR (1) | FR2387511A1 (de) |
| GB (1) | GB1570881A (de) |
| HU (1) | HU186725B (de) |
| IT (1) | IT1095976B (de) |
| NL (1) | NL181157C (de) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL179855C (nl) * | 1978-02-22 | 1986-11-17 | Philips Nv | Hogedruknatriumdampontladingslamp. |
| NL7902573A (nl) * | 1979-04-03 | 1980-10-07 | Philips Nv | Menglichtlamp. |
| NL7903285A (nl) * | 1979-04-26 | 1980-10-28 | Philips Nv | Ontladingslamp. |
| DE2941114C2 (de) * | 1979-10-10 | 1984-06-28 | Matsushita Electronics Corp., Kadoma, Osaka | Hochdruck-Natriumdampf-Entladungslampe |
| US4418300A (en) * | 1980-01-17 | 1983-11-29 | Mitsubishi Denki Kabushiki Kaisha | Metal vapor discharge lamp with heat insulator and starting aid |
| US4633135A (en) * | 1980-12-29 | 1986-12-30 | General Electric Company | Starting aid for high pressure sodium vapor lamp |
| US4757236A (en) * | 1984-11-29 | 1988-07-12 | General Electric Company | High pressure metal halide arc lamp with xenon buffer gas |
| US5814944A (en) | 1996-01-22 | 1998-09-29 | Matsushita Electric Works, Ltd. | High pressure sodium vapor lamp with high color rendering |
| DE19640850A1 (de) * | 1996-10-02 | 1998-04-09 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Natriumhochdrucklampe kleiner Leistung |
| US6498429B1 (en) | 1999-11-15 | 2002-12-24 | General Electric Company | Sodium-xenon lamp with improved characteristics at end-of-life |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL168993C (nl) * | 1975-01-17 | 1982-05-17 | Philips Nv | Werkwijze voor het bedrijven van een zelfstabiliserende ontladingslamp. |
-
1977
- 1977-04-15 NL NLAANVRAGE7704132,A patent/NL181157C/xx not_active IP Right Cessation
-
1978
- 1978-03-30 US US05/891,635 patent/US4146813A/en not_active Expired - Lifetime
- 1978-04-06 DE DE2814882A patent/DE2814882C3/de not_active Expired
- 1978-04-06 CA CA300,593A patent/CA1101918A/en not_active Expired
- 1978-04-12 JP JP4223578A patent/JPS53129469A/ja active Pending
- 1978-04-12 AT AT256478A patent/AT360117B/de not_active IP Right Cessation
- 1978-04-12 GB GB14330/78A patent/GB1570881A/en not_active Expired
- 1978-04-12 FR FR7810779A patent/FR2387511A1/fr active Granted
- 1978-04-12 IT IT22252/78A patent/IT1095976B/it active
- 1978-04-13 HU HU78PI618A patent/HU186725B/hu unknown
- 1978-04-13 ES ES468743A patent/ES468743A1/es not_active Expired
- 1978-04-13 BE BE186778A patent/BE865961A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL7704132A (nl) | 1978-10-17 |
| IT1095976B (it) | 1985-08-17 |
| FR2387511B1 (de) | 1982-04-23 |
| DE2814882B2 (de) | 1979-11-29 |
| DE2814882C3 (de) | 1980-09-04 |
| ES468743A1 (es) | 1978-12-16 |
| JPS53129469A (en) | 1978-11-11 |
| US4146813A (en) | 1979-03-27 |
| ATA256478A (de) | 1980-05-15 |
| BE865961A (fr) | 1978-10-13 |
| NL181157C (nl) | 1987-06-16 |
| GB1570881A (en) | 1980-07-09 |
| HU186725B (en) | 1985-09-30 |
| CA1101918A (en) | 1981-05-26 |
| FR2387511A1 (fr) | 1978-11-10 |
| IT7822252A0 (it) | 1978-04-12 |
| DE2814882A1 (de) | 1978-10-19 |
| NL181157B (nl) | 1987-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT359164B (de) | Hochdrucknatriumdampfentladungslampe | |
| AT379709B (de) | Hochdrucknatriumdampfentladungslampe | |
| NL178107C (nl) | Hogedrukontladingslamp. | |
| NL7805145A (nl) | Boogbuis voor hogedruk natrium ontladingslamp. | |
| NL184032C (nl) | Hogedruknatriumdampontladingslamp. | |
| AT360118B (de) | Niederdruckquecksilberdampfentladungslampe | |
| NL181469C (nl) | Hogedrukkwikdampontladingslamp. | |
| AT360117B (de) | Hochdrucknatriumdampfentladungslampe | |
| NL185481C (nl) | Lagedruknatriumdampontladingslamp. | |
| NL7712215A (nl) | Hogedrukgasontladingslamp. | |
| AT375790B (de) | Hochdrucknatriumdampfentladungslampe | |
| AT362839B (de) | Niederdrucknatriumdampfentladungslampe | |
| FR2344961A1 (fr) | Lampe a decharge a vapeur de sodium haute pression | |
| NL7801635A (nl) | Lagedruknatriumdampontladingslamp. | |
| NL175770C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL7713348A (nl) | Hogedruknatriumdampontladingslamp. | |
| AT376065B (de) | Niederdruckmetalldampfentladungslampe | |
| ATA723079A (de) | Hochdrucknatriumdampfentladungslampe | |
| NL7712059A (nl) | Lagedruknatriumdampontladingslamp. | |
| JPS52111284A (en) | High pressure sodium lamp | |
| NL177639C (nl) | Hogedruk natriumdampontladingslamp. | |
| ATA274082A (de) | Hochdruck-natriumdampflampe | |
| DD129255A1 (de) | Entladungsgefaess fuer natriumdampf-hochdrucklampen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |