AT375790B - Hochdrucknatriumdampfentladungslampe - Google Patents
HochdrucknatriumdampfentladungslampeInfo
- Publication number
- AT375790B AT375790B AT0283680A AT283680A AT375790B AT 375790 B AT375790 B AT 375790B AT 0283680 A AT0283680 A AT 0283680A AT 283680 A AT283680 A AT 283680A AT 375790 B AT375790 B AT 375790B
- Authority
- AT
- Austria
- Prior art keywords
- high pressure
- discharge lamp
- steam discharge
- pressure sodium
- sodium steam
- Prior art date
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title 1
- 229910052708 sodium Inorganic materials 0.000 title 1
- 239000011734 sodium Substances 0.000 title 1
- 238000004326 stimulated echo acquisition mode for imaging Methods 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/06—Main electrodes
- H01J61/073—Main electrodes for high-pressure discharge lamps
- H01J61/0735—Main electrodes for high-pressure discharge lamps characterised by the material of the electrode
- H01J61/0737—Main electrodes for high-pressure discharge lamps characterised by the material of the electrode characterised by the electron emissive material
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7904158A NL7904158A (nl) | 1979-05-28 | 1979-05-28 | Hogedruknatriumdamp-ontladingslamp. |
| NL8000326A NL8000326A (nl) | 1979-05-28 | 1980-01-18 | Hogedruknatriumdampontladingslamp. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA283680A ATA283680A (de) | 1984-01-15 |
| AT375790B true AT375790B (de) | 1984-09-10 |
Family
ID=26645528
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0283680A AT375790B (de) | 1979-05-28 | 1980-05-28 | Hochdrucknatriumdampfentladungslampe |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4374339A (de) |
| AT (1) | AT375790B (de) |
| BR (1) | BR8003261A (de) |
| CA (1) | CA1150757A (de) |
| DE (1) | DE3019772A1 (de) |
| ES (1) | ES491845A0 (de) |
| FR (1) | FR2458143A1 (de) |
| GB (1) | GB2051470B (de) |
| HU (1) | HU179865B (de) |
| IT (1) | IT1130750B (de) |
| NL (1) | NL8000326A (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3305468A1 (de) * | 1983-02-17 | 1984-08-23 | Egyesült Izzólámpa és Villamossági Részvénytársaság, Budapest | Verfahren zur herstellung von elektroden fuer hochdruck-entladungslampen |
| HU189968B (en) * | 1984-03-28 | 1986-08-28 | Nv Philips' Gloeilampenfabrieken,Nl | High pressure sodium vapour discharge lamp with improved electrode |
| US4709184A (en) * | 1984-08-20 | 1987-11-24 | Gte Products Corporation | Low wattage metal halide lamp |
| NL8802228A (nl) * | 1988-09-12 | 1990-04-02 | Philips Nv | Hogedruknatriumontladingslamp. |
| US7633216B2 (en) * | 2005-11-28 | 2009-12-15 | General Electric Company | Barium-free electrode materials for electric lamps and methods of manufacture thereof |
| USD1059207S1 (en) * | 2024-07-26 | 2025-01-28 | Junyi Tan | Plant-climbing frame |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3434812A (en) * | 1964-04-16 | 1969-03-25 | Gen Electric | Thermionic cathode |
| NL175771B (nl) * | 1975-06-20 | 1984-07-16 | Philips Nv | Hogedrukgasontladingslamp en een werkwijze voor de vervaardiging hiervan. |
| JPS5367972A (en) * | 1976-11-30 | 1978-06-16 | Mitsubishi Electric Corp | Electrode for elctric discharge lamp |
| US4152619A (en) * | 1977-10-26 | 1979-05-01 | Westinghouse Electric Corp. | HID lamp electrode comprising barium (yttrium or rare earth metal) tungstate or molybdate |
| NL177455C (nl) * | 1977-12-02 | 1985-09-16 | Philips Nv | Hogedrukmetaaldampontladingslamp. |
| NL179855C (nl) * | 1978-02-22 | 1986-11-17 | Philips Nv | Hogedruknatriumdampontladingslamp. |
| US4152620A (en) * | 1978-06-29 | 1979-05-01 | Westinghouse Electric Corp. | High intensity vapor discharge lamp with sintering aids for electrode emission materials |
| NL175770C (nl) * | 1978-10-06 | 1984-12-17 | Philips Nv | Hogedruknatriumdampontladingslamp. |
-
1980
- 1980-01-18 NL NL8000326A patent/NL8000326A/nl not_active Application Discontinuation
- 1980-05-19 US US06/151,500 patent/US4374339A/en not_active Expired - Lifetime
- 1980-05-22 CA CA000352539A patent/CA1150757A/en not_active Expired
- 1980-05-23 HU HU80801309A patent/HU179865B/hu unknown
- 1980-05-23 FR FR8011591A patent/FR2458143A1/fr active Granted
- 1980-05-23 DE DE19803019772 patent/DE3019772A1/de not_active Withdrawn
- 1980-05-23 IT IT22304/80A patent/IT1130750B/it active
- 1980-05-23 GB GB8017178A patent/GB2051470B/en not_active Expired
- 1980-05-26 ES ES491845A patent/ES491845A0/es active Granted
- 1980-05-26 BR BR8003261A patent/BR8003261A/pt unknown
- 1980-05-28 AT AT0283680A patent/AT375790B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT8022304A0 (it) | 1980-05-23 |
| IT1130750B (it) | 1986-06-18 |
| ES8103883A1 (es) | 1981-03-16 |
| GB2051470B (en) | 1983-05-18 |
| ATA283680A (de) | 1984-01-15 |
| ES491845A0 (es) | 1981-03-16 |
| GB2051470A (en) | 1981-01-14 |
| US4374339A (en) | 1983-02-15 |
| FR2458143A1 (fr) | 1980-12-26 |
| HU179865B (en) | 1982-12-28 |
| NL8000326A (nl) | 1980-12-02 |
| CA1150757A (en) | 1983-07-26 |
| BR8003261A (pt) | 1980-12-30 |
| DE3019772A1 (de) | 1980-12-04 |
| FR2458143B1 (de) | 1982-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT379709B (de) | Hochdrucknatriumdampfentladungslampe | |
| AT359164B (de) | Hochdrucknatriumdampfentladungslampe | |
| NL178107C (nl) | Hogedrukontladingslamp. | |
| NL183794C (nl) | Hogedrukkwikontladingslamp. | |
| NL184032C (nl) | Hogedruknatriumdampontladingslamp. | |
| AT360118B (de) | Niederdruckquecksilberdampfentladungslampe | |
| AT360117B (de) | Hochdrucknatriumdampfentladungslampe | |
| DE3763535D1 (de) | Hochdrucknatriumdampfentladungslampe. | |
| NL185481C (nl) | Lagedruknatriumdampontladingslamp. | |
| AT375790B (de) | Hochdrucknatriumdampfentladungslampe | |
| AT362839B (de) | Niederdrucknatriumdampfentladungslampe | |
| NL7801635A (nl) | Lagedruknatriumdampontladingslamp. | |
| FR2344961A1 (fr) | Lampe a decharge a vapeur de sodium haute pression | |
| NL185478C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL175770C (nl) | Hogedruknatriumdampontladingslamp. | |
| AT376065B (de) | Niederdruckmetalldampfentladungslampe | |
| NL7713348A (nl) | Hogedruknatriumdampontladingslamp. | |
| ATA723079A (de) | Hochdrucknatriumdampfentladungslampe | |
| NL177639C (nl) | Hogedruk natriumdampontladingslamp. | |
| NL185480C (nl) | Hogedruknatriumdampontladingslamp. | |
| NL7712059A (nl) | Lagedruknatriumdampontladingslamp. | |
| JPS52111284A (en) | High pressure sodium lamp | |
| ATA274082A (de) | Hochdruck-natriumdampflampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee | ||
| ELJ | Ceased due to non-payment of the annual fee |