AT326112B - Verfahren zur gewinnung von terephthalsäuredimethylester - Google Patents
Verfahren zur gewinnung von terephthalsäuredimethylesterInfo
- Publication number
- AT326112B AT326112B AT780973A AT780973A AT326112B AT 326112 B AT326112 B AT 326112B AT 780973 A AT780973 A AT 780973A AT 780973 A AT780973 A AT 780973A AT 326112 B AT326112 B AT 326112B
- Authority
- AT
- Austria
- Prior art keywords
- production
- terephthalic acid
- acid dimethylester
- dimethylester
- terephthalic
- Prior art date
Links
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722244662 DE2244662C3 (de) | 1972-09-12 | Verfahren zur Gewinnung von Terephthalsäuredimethylester |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA780973A ATA780973A (de) | 1975-02-15 |
| AT326112B true AT326112B (de) | 1975-11-25 |
Family
ID=5856087
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT780973A AT326112B (de) | 1972-09-12 | 1973-09-10 | Verfahren zur gewinnung von terephthalsäuredimethylester |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4126755A (enExample) |
| JP (1) | JPS4966644A (enExample) |
| AR (1) | AR198532A1 (enExample) |
| AT (1) | AT326112B (enExample) |
| BE (1) | BE804767A (enExample) |
| BR (1) | BR7306983D0 (enExample) |
| CA (1) | CA1022180A (enExample) |
| CH (1) | CH580559A5 (enExample) |
| DD (1) | DD104973A5 (enExample) |
| ES (1) | ES417790A1 (enExample) |
| FR (1) | FR2198928B1 (enExample) |
| GB (1) | GB1427783A (enExample) |
| IN (1) | IN140025B (enExample) |
| IT (1) | IT990110B (enExample) |
| NL (1) | NL173052C (enExample) |
| PL (1) | PL91566B1 (enExample) |
| RO (1) | RO63001A (enExample) |
| ZA (1) | ZA735425B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2923681C2 (de) * | 1979-06-12 | 1981-11-05 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung und Wiederverwendung von Schwermetalloxidationskatalysator aus dem Wittem-DMT-Prozeß |
| DE3045332C2 (de) * | 1980-12-02 | 1982-11-25 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung und Wiederverwendung von Schwermetalloxidationskatalysator aus Rückständen im Witten-DMT-Prozeß |
| DE3430555A1 (de) * | 1984-08-20 | 1986-02-27 | Hoechst Ag, 6230 Frankfurt | Verfahren zur abtrennung von dimethylisophthalat und dimethylorthophthalat aus ihrem gemisch mit dimethylterephthalat |
| US4760165A (en) * | 1985-11-13 | 1988-07-26 | Teijin Petrochemical Industries, Ltd. | Recovering useful components at least containing dimethyl terephthalate from high-boiling byproducts occurring in the production of dimethyl terephthalate |
| US4886901A (en) * | 1988-11-21 | 1989-12-12 | Amoco Corporation | Method for purifying a crude dimethyl naphthalene dicarboxylate |
| DE3904586A1 (de) * | 1989-02-16 | 1990-08-23 | Huels Chemische Werke Ag | Verfahren zur herstellung von dmt-zwischenprodukt bestimmter reinheit sowie dessen weiterverarbeitung zu reinst-dmt und/oder mittel- oder hochreiner terephthalsaeure |
| DK0431477T3 (da) * | 1989-12-02 | 1994-05-02 | Hoechst Ag | Fremgangsmåde til rensning af dimethylterephthalat |
| US5578173A (en) * | 1995-04-03 | 1996-11-26 | Eastman Kodak Company | Removal of dimethylterephthalate from a methanolysis vapor stream |
| DE19530970A1 (de) * | 1995-08-23 | 1997-02-27 | Huels Chemische Werke Ag | Verfahren zur Aufarbeitung von Rückständen aus der Rohester-Destillation bei der Herstellung von Dimethylterephthalat (DMT) |
| WO2010148049A2 (en) * | 2009-06-16 | 2010-12-23 | Draths Corporation | Preparation of trans, trans muconic acid and trans, trans muconates |
| WO2010148081A2 (en) | 2009-06-16 | 2010-12-23 | Draths Corporation | Novel terephthalic and trimellitic based acids and carboxylate derivatives thereof |
| US8415496B2 (en) | 2009-06-16 | 2013-04-09 | Amyris, Inc. | Biobased polyesters |
| DK2521770T3 (en) | 2010-01-08 | 2016-02-29 | Amyris Inc | METHODS FOR PREPARING ISOMERS OF MUCONIC ACID AND MUCONATE SALTS |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2773090A (en) * | 1953-03-10 | 1956-12-04 | Du Pont | Process for preparing pure dimethylterephthalate from the carbonylation of aromatic halides |
| DE1139827B (de) * | 1961-04-15 | 1962-11-22 | Chemische Werke Witten Gesell schaft mit beschrankter Haftung, Witten | Verfahren zur verbesserten Aufarbeitung von Terephthalsäuredimethylester und Isophthalsäuredimethylester enthaltenden Mutterlaugen. |
| DE1142858B (de) * | 1961-07-19 | 1963-01-31 | Witten Gmbh Chem Werke | Verfahren zur Gewinnung von Diphenylpolycarbonsaeuremethylestern |
-
1973
- 1973-07-10 DD DD172189A patent/DD104973A5/xx unknown
- 1973-08-01 IT IT51779/73A patent/IT990110B/it active
- 1973-08-03 IN IN1798/CAL/73A patent/IN140025B/en unknown
- 1973-08-09 ZA ZA735425A patent/ZA735425B/xx unknown
- 1973-08-11 ES ES417790A patent/ES417790A1/es not_active Expired
- 1973-09-06 AR AR249952A patent/AR198532A1/es active
- 1973-09-07 CH CH1289873A patent/CH580559A5/xx not_active IP Right Cessation
- 1973-09-07 RO RO7300076017A patent/RO63001A/ro unknown
- 1973-09-10 PL PL1973165130A patent/PL91566B1/pl unknown
- 1973-09-10 BR BR6983/73A patent/BR7306983D0/pt unknown
- 1973-09-10 AT AT780973A patent/AT326112B/de not_active IP Right Cessation
- 1973-09-11 GB GB4276673A patent/GB1427783A/en not_active Expired
- 1973-09-11 FR FR7332677A patent/FR2198928B1/fr not_active Expired
- 1973-09-11 CA CA180,722A patent/CA1022180A/en not_active Expired
- 1973-09-12 BE BE135579A patent/BE804767A/xx unknown
- 1973-09-12 US US05/396,468 patent/US4126755A/en not_active Expired - Lifetime
- 1973-09-12 NL NLAANVRAGE7312572,A patent/NL173052C/xx not_active IP Right Cessation
- 1973-09-12 JP JP48102988A patent/JPS4966644A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2244662B2 (de) | 1976-06-10 |
| BR7306983D0 (pt) | 1974-07-18 |
| NL173052C (nl) | 1983-12-01 |
| IT990110B (it) | 1975-06-20 |
| CH580559A5 (enExample) | 1976-10-15 |
| BE804767A (fr) | 1974-01-02 |
| ZA735425B (en) | 1974-07-31 |
| DE2244662A1 (de) | 1974-04-04 |
| NL173052B (nl) | 1983-07-01 |
| CA1022180A (en) | 1977-12-06 |
| RO63001A (fr) | 1978-05-15 |
| IN140025B (enExample) | 1976-09-04 |
| FR2198928B1 (enExample) | 1977-02-25 |
| DD104973A5 (enExample) | 1974-04-05 |
| FR2198928A1 (enExample) | 1974-04-05 |
| ES417790A1 (es) | 1976-02-16 |
| PL91566B1 (enExample) | 1977-03-31 |
| AR198532A1 (es) | 1974-06-28 |
| GB1427783A (en) | 1976-03-10 |
| JPS4966644A (enExample) | 1974-06-27 |
| NL7312572A (enExample) | 1974-03-14 |
| US4126755A (en) | 1978-11-21 |
| ATA780973A (de) | 1975-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT330346B (de) | Verfahren zur herstellung von 7-acylamido -3- cephem-4-carbonsauren | |
| AT326112B (de) | Verfahren zur gewinnung von terephthalsäuredimethylester | |
| AT323124B (de) | Verfahren zur herstellung von alfa-chlorcarbonsäurechloriden | |
| AT327381B (de) | Verfahren zur herstellung von 7beta-amino-3-cephem-4-carbonsaureverbindungen | |
| AT325764B (de) | Verfahren zur herstellung von 3-carbamoyloxymethylcephalosporinen | |
| AT323420B (de) | Verfahren zur herstellung von poly-alpha-oxy-acrylsäure | |
| ATA532473A (de) | Verfahren zur herstellung von 7-amino-desacetoxy-cephalosporansaure | |
| AT336810B (de) | Verfahren zur herstellung von pregnansaure-derivaten | |
| AT345272B (de) | Verfahren zur herstellung von aminoanthrachinonen | |
| AT335993B (de) | Verfahren zur herstellung von atherpolycarbonsauren | |
| AT325786B (de) | Verfahren zur herstellung von eburnamoninen | |
| AT326097B (de) | Verfahren zur herstellung von 3-fluor-d-alanin | |
| CH466259A (de) | Verfahren zur Herstellung von Terephthalsäure | |
| CH537390A (de) | Verfahren zur Herstellung von Phenyl-pyrimidin-carbonsäuren | |
| CH529806A (de) | Verfahren zur Herstellung von sulfonatmodifizierten Polyestern | |
| AT324294B (de) | Verfahren zur herstellung von 3-fluor-d-alanin | |
| AT326096B (de) | Verfahren zur herstellung von 3-fluor-d-alanin | |
| AT327160B (de) | Verfahren zur herstellung von alkylen-bis-amiden | |
| AT339272B (de) | Verfahren zur herstellung von alfa-chloracrylsaure-chlorid | |
| AT331395B (de) | Verfahren zur herstellung von 3-alkyl-3-cephem-4-carbonsaurederivaten | |
| AT319197B (de) | Verfahren zur Gewinnung von Äpfelsäure | |
| CH509389A (de) | Verfahren zur Herstellung von Phthalocyaninsulfonsäuren | |
| AT326595B (de) | Verfahren zur herstellung von citronensäure | |
| AT322538B (de) | Verfahren zur herstellung von terephthalsäurediamid | |
| AT350592B (de) | Verfahren zur herstellung von chlorcyan |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |