AT277985B - Verfahren zur Herstellung von neuen Nitro-furan-, -thiophen- oder -pyrrol-derivaten - Google Patents
Verfahren zur Herstellung von neuen Nitro-furan-, -thiophen- oder -pyrrol-derivatenInfo
- Publication number
- AT277985B AT277985B AT572368A AT572368A AT277985B AT 277985 B AT277985 B AT 277985B AT 572368 A AT572368 A AT 572368A AT 572368 A AT572368 A AT 572368A AT 277985 B AT277985 B AT 277985B
- Authority
- AT
- Austria
- Prior art keywords
- furan
- thiophene
- preparation
- pyrrole derivatives
- new nitro
- Prior art date
Links
- JIZRGGUCOQKGQD-UHFFFAOYSA-N 2-nitrothiophene Chemical class [O-][N+](=O)C1=CC=CS1 JIZRGGUCOQKGQD-UHFFFAOYSA-N 0.000 title 1
- IAIWVQXQOWNYOU-FPYGCLRLSA-N nitrofural Chemical class NC(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 IAIWVQXQOWNYOU-FPYGCLRLSA-N 0.000 title 1
- 229960001907 nitrofurazone Drugs 0.000 title 1
- 150000005242 nitropyrroles Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/42—Nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/70—Nitro radicals
- C07D307/71—Nitro radicals attached in position 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/42—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms
- C07D333/44—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms attached in position 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESC041572 | 1967-11-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT277985B true AT277985B (de) | 1970-01-12 |
Family
ID=7436296
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT572368A AT277985B (de) | 1967-11-14 | 1968-06-14 | Verfahren zur Herstellung von neuen Nitro-furan-, -thiophen- oder -pyrrol-derivaten |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3716531A (enExample) |
| AT (1) | AT277985B (enExample) |
| BE (1) | BE723910A (enExample) |
| BR (1) | BR6803907D0 (enExample) |
| CA (1) | CA919669A (enExample) |
| CH (1) | CH532031A (enExample) |
| CS (2) | CS150613B2 (enExample) |
| DK (1) | DK125850B (enExample) |
| FI (1) | FI49971C (enExample) |
| FR (2) | FR1592235A (enExample) |
| GB (1) | GB1250340A (enExample) |
| NL (1) | NL6816191A (enExample) |
| NO (1) | NO124207B (enExample) |
| SE (1) | SE355806B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH535225A (de) * | 1969-03-29 | 1973-03-31 | Schering Ag | Verfahren zur Herstellung von heterocyclischen Nitroverbindungen |
| DE1935685A1 (de) * | 1969-07-10 | 1971-01-14 | Schering Ag | Neue antimikrobiell wirksame Verbindungen |
| DE1937630A1 (de) * | 1969-07-19 | 1971-02-04 | Schering Ag | 2-(5-Nitro-2-furfuryliden)-l-tetralone |
| US4053514A (en) * | 1975-07-28 | 1977-10-11 | E. R. Squibb & Sons, Inc. | 2-[Dialkylaminoalkoxyphenyl]-methylene-2,3-dihydro-1H-inden-1-ones and the salts thereof |
| IT1093805B (it) * | 1978-01-31 | 1985-07-26 | Erba Carlo Spa | Derivati del 2h-benzofuran-3-one e procedimento per la loro preparazione |
| CH636116A5 (de) * | 1978-07-28 | 1983-05-13 | Sandoz Ag | Heterocyclische dispersionsfarbstoffe. |
| SE447382B (sv) * | 1978-09-13 | 1986-11-10 | Lilly Industries Ltd | 2-bensyliden-bensofuran-3(2h)-on-derivat samt forfarande for deras framstellning |
| US6307070B1 (en) | 1996-01-26 | 2001-10-23 | Phytera, Inc. | Substituted aurone derivatives |
| JP2001510801A (ja) * | 1997-07-25 | 2001-08-07 | フィテラ インク. | 置換アウロン誘導体 |
| CN106699726B (zh) * | 2016-12-30 | 2019-02-22 | 河北大学 | 一种硫色满酮衍生物及其制备方法和应用 |
-
1968
- 1968-06-14 AT AT572368A patent/AT277985B/de active
- 1968-09-11 CH CH1282168A patent/CH532031A/de not_active IP Right Cessation
- 1968-09-19 FI FI682652A patent/FI49971C/fi active
- 1968-10-31 US US00804333*A patent/US3716531A/en not_active Expired - Lifetime
- 1968-11-07 CS CS852*[A patent/CS150613B2/cs unknown
- 1968-11-07 CS CS7591A patent/CS150612B2/cs unknown
- 1968-11-11 DK DK547068AA patent/DK125850B/da unknown
- 1968-11-12 GB GB1250340D patent/GB1250340A/en not_active Expired
- 1968-11-12 BR BR203907/68A patent/BR6803907D0/pt unknown
- 1968-11-13 NO NO4494/68A patent/NO124207B/no unknown
- 1968-11-13 SE SE15409/68A patent/SE355806B/xx unknown
- 1968-11-13 NL NL6816191A patent/NL6816191A/xx unknown
- 1968-11-13 FR FR1592235D patent/FR1592235A/fr not_active Expired
- 1968-11-14 BE BE723910D patent/BE723910A/xx unknown
- 1968-11-14 CA CA035199A patent/CA919669A/en not_active Expired
-
1969
- 1969-02-12 FR FR183252A patent/FR8255M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CS150612B2 (enExample) | 1973-09-04 |
| DE1643532A1 (de) | 1971-07-01 |
| NL6816191A (enExample) | 1969-05-19 |
| DK125850B (da) | 1973-05-14 |
| BE723910A (enExample) | 1969-05-14 |
| FI49971C (fi) | 1975-11-10 |
| BR6803907D0 (pt) | 1973-04-19 |
| CH532031A (de) | 1972-12-31 |
| DE1643532B2 (de) | 1976-03-18 |
| CA919669A (en) | 1973-01-23 |
| FR8255M (enExample) | 1970-10-12 |
| GB1250340A (enExample) | 1971-10-20 |
| SE355806B (enExample) | 1973-05-07 |
| US3716531A (en) | 1973-02-13 |
| FR1592235A (enExample) | 1970-05-11 |
| CS150613B2 (enExample) | 1973-09-04 |
| FI49971B (enExample) | 1975-07-31 |
| NO124207B (enExample) | 1972-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH532015A (de) | Verfahren zur Herstellung von neuen 1-Phenoxy-2-hydroxy-3-alkylaminopropanen | |
| AT277221B (de) | Verfahren zur Herstellung von neuen 5-Nitro-2-furyl-2-isoxazolin-derivaten | |
| AT277985B (de) | Verfahren zur Herstellung von neuen Nitro-furan-, -thiophen- oder -pyrrol-derivaten | |
| AT295530B (de) | Verfahren zur Herstellung von neuen substituierten Benzodioxolen | |
| AT275517B (de) | Verfahren zur Herstellung von neuen p-Alkoxy-piperidin-amiden | |
| AT293440B (de) | Verfahren zur Herstellung von neuen D-Glucofuranosiden | |
| AT298476B (de) | Verfahren zur Herstellung von neuen Naphthylisopropylamin-Derivaten | |
| AT291221B (de) | Verfahren zur Herstellung von neuen o-Carboxyphenylamidinen | |
| CH504451A (de) | Verfahren zur Herstellung von neuen 3-Aminoacylaminothiophenen | |
| CH493469A (de) | Verfahren zur Herstellung von neuen Diarylacetamiden | |
| AT281315B (de) | Verfahren zur Herstellung von neuen 22-Amino-dinorcholanderivaten | |
| AT283319B (de) | Verfahren zur Herstellung von neuen Azidozimtaldehyden | |
| AT281797B (de) | Verfahren zur Herstellung von neuen Dialkylaminoacylaniliden | |
| AT294124B (de) | Verfahren zur Herstellung von neuen 6-Desoxy-D-xylohexafuranosiden | |
| AT292022B (de) | Verfahren zur Herstellung von neuen Disilacyclohexadienen | |
| AT277254B (de) | Verfahren zur Herstellung von neuen Benzazepinopyridoindolderivaten | |
| AT281805B (de) | Verfahren zur Herstellung von neuen 5-Nitrofurfurylidenaminooxazolidinonen | |
| AT294044B (de) | Verfahren zur herstellung von neuen 2-alkoxy-5-chlorsulfonylnitrobenzolen | |
| AT276408B (de) | Verfahren zur Herstellung von neuen 2-Amino-3-carbonamido-chinoxalin-di-N-oxyden | |
| AT299976B (de) | Verfahren zur Herstellung von neuen Disilacyclohexadienen | |
| AT279606B (de) | Verfahren zur Herstellung von neuen 1-Phenyl-4-alkyl-2-imidazolonen | |
| AT285830B (de) | Verfahren zur Herstellung von neuen Morphin-3-acetamiden | |
| AT271472B (de) | Verfahren zur Herstellung von neuen 5-Nitrothiazol-Derivaten | |
| AT279624B (de) | Verfahren zur Herstellung von neuen Derivaten des α-Piperazino-phenylacetonitrils | |
| AT294043B (de) | Verfahren zur herstellung von neuen 2-alkoxy-5-chlorsulfonylnitrobenzolen |