AT266842B - Verfahren zur Herstellung einer gebrauchsbeständigen Kristallmodifikation eines Weißtöners der 4,4'-Bis-triazinylaminostilbenreihe - Google Patents
Verfahren zur Herstellung einer gebrauchsbeständigen Kristallmodifikation eines Weißtöners der 4,4'-Bis-triazinylaminostilbenreiheInfo
- Publication number
- AT266842B AT266842B AT448767A AT448767A AT266842B AT 266842 B AT266842 B AT 266842B AT 448767 A AT448767 A AT 448767A AT 448767 A AT448767 A AT 448767A AT 266842 B AT266842 B AT 266842B
- Authority
- AT
- Austria
- Prior art keywords
- whitener
- bis
- production
- crystal modification
- stable crystal
- Prior art date
Links
- 239000013078 crystal Substances 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 230000004048 modification Effects 0.000 title 1
- 238000012986 modification Methods 0.000 title 1
- WSZSUYCDEVZYNX-UHFFFAOYSA-N n-[4-[2-[4-(triazin-4-ylamino)phenyl]ethenyl]phenyl]triazin-4-amine Chemical class C=1C=NN=NC=1NC(C=C1)=CC=C1C=CC(C=C1)=CC=C1NC1=CC=NN=N1 WSZSUYCDEVZYNX-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH703066A CH470403A (de) | 1966-05-13 | 1966-05-13 | Verfahren zur Herstellung beständiger Kristallmodifikationen von Weisstönern der 4,4'-Bis-triazinylaminostilbenreihe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT266842B true AT266842B (de) | 1968-12-10 |
Family
ID=4318825
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT448767A AT266842B (de) | 1966-05-13 | 1967-05-12 | Verfahren zur Herstellung einer gebrauchsbeständigen Kristallmodifikation eines Weißtöners der 4,4'-Bis-triazinylaminostilbenreihe |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US3472842A (de) |
| AT (1) | AT266842B (de) |
| BE (1) | BE698472A (de) |
| CH (1) | CH470403A (de) |
| DE (1) | DE1695019C3 (de) |
| ES (1) | ES340462A1 (de) |
| FR (1) | FR1522846A (de) |
| GB (1) | GB1116619A (de) |
| NL (1) | NL6706697A (de) |
| SE (1) | SE330382B (de) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3951960A (en) * | 1966-02-10 | 1976-04-20 | Sterling Drug Inc. | Novel crystalline forms of optical brighteners |
| US3925260A (en) * | 1969-04-09 | 1975-12-09 | Ciba Geigy Corp | Crystalline forms of 4,4-bis-triazinylaminostilbene derivatives and processes for making same |
| GB1317465A (en) * | 1969-07-07 | 1973-05-16 | Sterling Drug Inc | Process for drying and grinding fluorescent whitening agents |
| DE2646273A1 (de) * | 1976-10-14 | 1978-04-20 | Ciba Geigy Ag | Verfahren zur herstellung von feinkristallinen aufhellern der bis- triazinylamino-stilbenreihe in der beta-kristallform |
| US4271036A (en) * | 1979-01-26 | 1981-06-02 | Hoechst Aktiengesellschaft | Colorless formulations of optical brighteners from the series of bis-triazinylamino-stilbene-disulfonic acid compounds |
| US4549980A (en) * | 1983-10-11 | 1985-10-29 | Mobay Chemical Corporation | White modification of a bis-triazinyl amino stilbene optical brightener and a process for making the same |
| US4474577A (en) * | 1983-10-26 | 1984-10-02 | Mobay Chemical Corporation | Modified acid dyestuff |
| US4820452A (en) * | 1985-10-16 | 1989-04-11 | Ciba-Geigy Corporation | Bechamp reduction of DNS to DAS using H2 SO4 and trace of HOAc |
| US6702986B1 (en) * | 1988-04-29 | 2004-03-09 | Igen International, Inc. | Electrochemiluminescent reaction utilizing amine-derived reductant |
| US5714450A (en) * | 1996-03-15 | 1998-02-03 | Amway Corporation | Detergent composition containing discrete whitening agent particles |
| AU2075097A (en) * | 1996-03-15 | 1997-10-01 | Amway Corporation | Discrete whitening agent particles, method of making, and powder detergent containing same |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2762801A (en) * | 1956-09-11 | Bis-triazinylamino stilbene compounds | ||
| DE1219940B (de) * | 1962-06-25 | 1966-06-30 | Geigy Ag J R | Verfahren zur Herstellung einer neuen kristallinen beta-Form einer Bis-triazinylaminotilbenverbindung |
| BE634060A (de) * | 1963-06-24 |
-
1966
- 1966-05-13 CH CH703066A patent/CH470403A/de not_active IP Right Cessation
-
1967
- 1967-05-12 US US638065A patent/US3472842A/en not_active Expired - Lifetime
- 1967-05-12 SE SE06714/67A patent/SE330382B/xx unknown
- 1967-05-12 ES ES340462A patent/ES340462A1/es not_active Expired
- 1967-05-12 AT AT448767A patent/AT266842B/de active
- 1967-05-12 BE BE698472D patent/BE698472A/xx unknown
- 1967-05-12 FR FR106266A patent/FR1522846A/fr not_active Expired
- 1967-05-12 NL NL6706697A patent/NL6706697A/xx unknown
- 1967-05-12 GB GB22189/67A patent/GB1116619A/en not_active Expired
- 1967-05-13 DE DE1695019A patent/DE1695019C3/de not_active Expired
-
1969
- 1969-02-28 US US816864*A patent/US3522185A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1695019A1 (de) | 1971-04-08 |
| FR1522846A (fr) | 1968-04-26 |
| SE330382B (de) | 1970-11-16 |
| ES340462A1 (es) | 1968-07-01 |
| US3522185A (en) | 1970-07-28 |
| US3472842A (en) | 1969-10-14 |
| NL6706697A (de) | 1967-11-14 |
| DE1695019C3 (de) | 1981-07-30 |
| CH470403A (de) | 1969-03-31 |
| GB1116619A (en) | 1968-06-06 |
| BE698472A (de) | 1967-11-13 |
| DE1695019B2 (de) | 1980-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT288152B (de) | Verfahren zur Herstellung eines Faserstoffes | |
| AT303261B (de) | Verfahren zur Herstellung eines Zahnpflegemittels | |
| CH517211A (de) | Verfahren zur Herstellung eines Textilklebers | |
| AT306617B (de) | Verfahren zur Herstellung eines feuerfesten Bauteiles | |
| AT270874B (de) | Verfahren zur Herstellung eines Zahnpflegemittels | |
| AT266842B (de) | Verfahren zur Herstellung einer gebrauchsbeständigen Kristallmodifikation eines Weißtöners der 4,4'-Bis-triazinylaminostilbenreihe | |
| CH502264A (de) | Verfahren zur Herstellung von Ammoniumpolyphosphaten | |
| AT283897B (de) | Verfahren zur Herstellung von Zeitungspapier | |
| CH488723A (de) | Verfahren zur Herstellung von Thiadiazolyl-harnstoffen | |
| CH517821A (de) | Verfahren zur Herstellung einer Pigmentzubereitung | |
| CH525026A (de) | Verfahren zur Herstellung eines Magnesium-Aluminium-Spinell-Einkristalls | |
| AT273043B (de) | Verfahren zur Herstellung von Polyphosphaten | |
| AT308666B (de) | Verfahren zur Herstellung eines Hefevorteiges | |
| CH521294A (de) | Verfahren zur kontinuierlichen Herstellung von Acetylenalkoholen | |
| CH490300A (de) | Verfahren zur Herstellung von 3,5-Dimethylphenol | |
| AT266018B (de) | Verfahren zur Herstellung eines lupulinreichen Hopfenproduktes | |
| CH480406A (de) | Verfahren zur Herstellung von Pigmenten | |
| CH478209A (de) | Verfahren zur Herstellung von Reaktivfarbstoffen | |
| AT268532B (de) | Verfahren zur Herstellung eines Faserkörpers | |
| AT257180B (de) | Verfahren zur Herstellung eines Übergangsstückes | |
| CH496777A (de) | Verfahren zur Herstellung eines dispersen Farbstoffes | |
| CH469795A (de) | Verfahren zur Herstellung wasserlöslicher Reaktivarbstoffe | |
| AT286497B (de) | Verfahren zur Herstellung einer Vaccine | |
| AT269700B (de) | Verfahren zur Herstellung einer hochdehnungsfähigen Textilware | |
| CH483657A (de) | Verfahren zur Herstellung eines Photolackes |