AT243773B - Verfahren zur Herstellung von neuen Farnesylessigsäureestern - Google Patents
Verfahren zur Herstellung von neuen FarnesylessigsäureesternInfo
- Publication number
- AT243773B AT243773B AT1003263A AT1003263A AT243773B AT 243773 B AT243773 B AT 243773B AT 1003263 A AT1003263 A AT 1003263A AT 1003263 A AT1003263 A AT 1003263A AT 243773 B AT243773 B AT 243773B
- Authority
- AT
- Austria
- Prior art keywords
- preparation
- acetic acid
- acid esters
- farnesyl acetic
- new
- Prior art date
Links
- VOKDWPMRYSKGTB-NCZFFCEISA-N (4e,8e)-5,9,13-trimethyltetradeca-4,8,12-trienoic acid Chemical class CC(C)=CCC\C(C)=C\CC\C(C)=C\CCC(O)=O VOKDWPMRYSKGTB-NCZFFCEISA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/02—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms with only carbon-to-carbon double bonds as unsaturation
- C07C57/03—Monocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/02—Esters of acyclic saturated monocarboxylic acids having the carboxyl group bound to an acyclic carbon atom or to hydrogen
- C07C69/22—Esters of acyclic saturated monocarboxylic acids having the carboxyl group bound to an acyclic carbon atom or to hydrogen having three or more carbon atoms in the acid moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/52—Esters of acyclic unsaturated carboxylic acids having the esterified carboxyl group bound to an acyclic carbon atom
- C07C69/587—Monocarboxylic acid esters having at least two carbon-to-carbon double bonds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB18812/61A GB938712A (en) | 1961-05-24 | 1961-05-24 | Farnesyl acetic esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT243773B true AT243773B (de) | 1965-11-25 |
Family
ID=10118834
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1003263A AT243773B (de) | 1961-05-24 | 1962-05-15 | Verfahren zur Herstellung von neuen Farnesylessigsäureestern |
| AT398262A AT240341B (de) | 1961-05-24 | 1962-05-15 | Verfahren zur Herstellung von neuen Farnesylessigsäureestern |
| AT1003363A AT244317B (de) | 1961-05-24 | 1962-05-15 | Verfahren zur Herstellung von neuen Farnesylesigsäureestern |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT398262A AT240341B (de) | 1961-05-24 | 1962-05-15 | Verfahren zur Herstellung von neuen Farnesylessigsäureestern |
| AT1003363A AT244317B (de) | 1961-05-24 | 1962-05-15 | Verfahren zur Herstellung von neuen Farnesylesigsäureestern |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3154570A (cg-RX-API-DMAC10.html) |
| AT (3) | AT243773B (cg-RX-API-DMAC10.html) |
| BE (1) | BE617994A (cg-RX-API-DMAC10.html) |
| CH (3) | CH416599A (cg-RX-API-DMAC10.html) |
| DE (2) | DE1793591B2 (cg-RX-API-DMAC10.html) |
| DK (3) | DK114825B (cg-RX-API-DMAC10.html) |
| FI (3) | FI40163C (cg-RX-API-DMAC10.html) |
| FR (1) | FR1981M (cg-RX-API-DMAC10.html) |
| GB (1) | GB938712A (cg-RX-API-DMAC10.html) |
| IN (1) | IN138556B (cg-RX-API-DMAC10.html) |
| SE (3) | SE305864B (cg-RX-API-DMAC10.html) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2245607B1 (cg-RX-API-DMAC10.html) * | 1973-04-18 | 1979-04-20 | Kuraray Co | |
| JPS5623415B2 (cg-RX-API-DMAC10.html) * | 1973-07-13 | 1981-05-30 | ||
| US3928403A (en) * | 1974-07-10 | 1975-12-23 | Kuraray Co | Process for preparing farnesyl acetic acid esters and 2-substituted-products thereof |
| US4028385A (en) * | 1974-09-02 | 1977-06-07 | Kuraray Co., Ltd. | Process for preparing stereospecific farnesylacetic acid and ester thereof |
| JPS5855129B2 (ja) * | 1974-11-21 | 1983-12-08 | 株式会社クラレ | 2−置換または無置換のゲラニル酢酸エステル類の製造方法 |
| JPS53145922A (en) * | 1977-05-26 | 1978-12-19 | Eisai Co Ltd | Remedy for peptic ulcer containing prenyl ketone compound |
| US4642314A (en) * | 1978-03-23 | 1987-02-10 | Nisshin Flour Milling Co., Ltd. | Antiulcer compounds |
| FR2420523A1 (fr) * | 1978-03-23 | 1979-10-19 | Nisshin Flour Milling Co | Nouveaux derives acides et esters et leur application comme agents antiulcere |
| US4483871A (en) * | 1978-03-23 | 1984-11-20 | Nisshin Flour Milling Co., Ltd. | Antiulcer compounds |
| US4738801A (en) * | 1978-03-23 | 1988-04-19 | Nisshin Flour Milling Co., Ltd. | Antiulcer compounds |
| JPS5573642A (en) * | 1978-11-28 | 1980-06-03 | Kuraray Co Ltd | Farnesyl-acetic ester derivative |
| JPS57106644A (en) * | 1980-12-20 | 1982-07-02 | Kotobuki Seiyaku Kk | Farnesence derivative, mucosa stabilizer comprising it as active ingredient, and its preparation |
| CA1280414C (en) * | 1985-03-15 | 1991-02-19 | Saichi Matsumoto | Isoprenoidamine derivatives and antiulcer agents |
| US5298655A (en) * | 1991-09-27 | 1994-03-29 | Merck & Co., Inc. | Farnesyl pyrophosphate analogs |
| US5574025A (en) * | 1994-10-26 | 1996-11-12 | Merck & Co., Inc. | Inhibitors of prenyl-protein transferases |
| WO1999067809A1 (en) * | 1998-06-24 | 1999-12-29 | Merck & Co., Inc. | Compositions and methods for inhibiting bone resorption |
| WO2014207235A1 (en) * | 2013-06-28 | 2014-12-31 | Castrol Limited | Lubricating compositions containing isoprene based components |
| CN105753696B (zh) * | 2016-03-04 | 2019-03-08 | 湖南晶天科技实业有限公司 | 一种香芹酚酯、饲料添加剂和饲料 |
-
1961
- 1961-05-24 GB GB18812/61A patent/GB938712A/en not_active Expired
-
1962
- 1962-05-04 FI FI90662A patent/FI40163C/fi active
- 1962-05-10 US US193876A patent/US3154570A/en not_active Expired - Lifetime
- 1962-05-11 DE DE19621793591 patent/DE1793591B2/de active Granted
- 1962-05-11 DE DE19621468055 patent/DE1468055A1/de active Pending
- 1962-05-15 AT AT1003263A patent/AT243773B/de active
- 1962-05-15 AT AT398262A patent/AT240341B/de active
- 1962-05-15 AT AT1003363A patent/AT244317B/de active
- 1962-05-16 CH CH300966A patent/CH416599A/de unknown
- 1962-05-16 CH CH590862A patent/CH420117A/de unknown
- 1962-05-16 CH CH301066A patent/CH416600A/de unknown
- 1962-05-16 DK DK221362AA patent/DK114825B/da unknown
- 1962-05-22 FR FR898375A patent/FR1981M/fr active Active
- 1962-05-23 BE BE617994A patent/BE617994A/fr unknown
- 1962-05-23 SE SE5796/62A patent/SE305864B/xx unknown
-
1964
- 1964-06-05 SE SE6865/64A patent/SE301313B/xx unknown
- 1964-06-05 SE SE6864/64A patent/SE301475B/xx unknown
- 1964-11-13 DK DK561764AA patent/DK115254B/da unknown
- 1964-11-13 DK DK561664AA patent/DK115469B/da unknown
-
1966
- 1966-08-25 FI FI2229/66A patent/FI40284B/fi active
- 1966-08-25 FI FI2230/66A patent/FI40285B/fi active
-
1973
- 1973-12-20 IN IN2772/CAL/1973A patent/IN138556B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR1981M (fr) | 1963-08-26 |
| DE1793591C3 (cg-RX-API-DMAC10.html) | 1974-03-28 |
| CH420117A (de) | 1966-09-15 |
| DK115254B (da) | 1969-09-22 |
| FI40163B (cg-RX-API-DMAC10.html) | 1968-07-31 |
| DE1793591A1 (de) | 1971-03-18 |
| SE301475B (sv) | 1968-06-10 |
| US3154570A (en) | 1964-10-27 |
| DE1793591B2 (de) | 1973-08-23 |
| BE617994A (fr) | 1962-09-17 |
| CH416600A (de) | 1966-07-15 |
| FI40163C (fi) | 1968-11-11 |
| SE301313B (sv) | 1968-06-04 |
| AT240341B (de) | 1965-05-25 |
| FI40284B (cg-RX-API-DMAC10.html) | 1968-09-02 |
| DK114825B (da) | 1969-08-11 |
| AT244317B (de) | 1965-12-27 |
| IN138556B (cg-RX-API-DMAC10.html) | 1976-02-21 |
| DE1468055A1 (de) | 1969-04-03 |
| FI40285B (cg-RX-API-DMAC10.html) | 1968-09-02 |
| SE305864B (cg-RX-API-DMAC10.html) | 1968-11-11 |
| GB938712A (en) | 1963-10-02 |
| CH416599A (de) | 1966-07-15 |
| DK115469B (da) | 1969-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT240341B (de) | Verfahren zur Herstellung von neuen Farnesylessigsäureestern | |
| CH429764A (de) | Verfahren zur Herstellung von neuen Estern | |
| AT269168B (de) | Verfahren zur Herstellung von neuen Cumaranyl-N-methyl-carbaminsäureestern | |
| CH412843A (de) | Verfahren zur Herstellung von Estern | |
| AT271455B (de) | Verfahren zur Herstellung von neuen substituierten Phenylaminophenylessigsäureestern | |
| AT243234B (de) | Verfahren zur Herstellung von Lösungen von Peroxydikohlensäureestern | |
| CH387611A (de) | Verfahren zur Herstellung von Tetraoxybutandicarbonsäuren | |
| CH407107A (de) | Verfahren zur Herstellung von Dihydrofusidinsäure | |
| CH446303A (de) | Verfahren zur Herstellung von neuen Iminokohlensäureesterderivaten | |
| CH413854A (de) | Verfahren zur Herstellung von Aminoalkansulfonsäuren | |
| AT240840B (de) | Verfahren zur Herstellung von neuen N - substituierten 3-Alkoxy-4-carbamidomethoxy-phenylessigsäureestern | |
| CH425234A (de) | Verfahren zur Herstellung von modifizierten Polyvinylacetessigestern | |
| AT243986B (de) | Verfahren zur Herstellung von 6-Acylaminopenicillansäuren | |
| AT226253B (de) | Verfahren zur Herstellung von neuen Thionothiolphosphonsäureestern | |
| CH401062A (de) | Verfahren zur Herstellung von 8-Hydroxy-penillinsäure | |
| CH405309A (de) | Verfahren zur Herstellung von neuen Estern der Nicotinsäure | |
| AT238887B (de) | Verfahren zur Herstellung von neuen Estern von Steroiden | |
| AT259572B (de) | Verfahren zur Herstellung von neuen Cumaranyl-N-methyl-carbaminsäureestern | |
| AT253140B (de) | Verfahren zur Herstellung von neuen Phosphorsäureestern von Steroidverbindungen | |
| AT231972B (de) | Verfahren zur Herstellung von neuen Alkylsulfonsäureestern | |
| CH422753A (de) | Verfahren zur Herstellung von Methylestern aromatischer Polyhalogencarbonsäuren | |
| CH407975A (de) | Verfahren zur Herstellung von o-Phenäthyl-benzoesäure | |
| CH481897A (de) | Verfahren zur Herstellung von substituierten Essigsäure-Derivaten | |
| CH414628A (de) | Verfahren zur Herstellung von neuen Estern von quaternären Ammoniumverbindungen | |
| CH437289A (de) | Verfahren zur Herstellung von Benz-indolcarbonsäuren |