ZA752946B - O-triazolyl-(thiono)-phosphoric (phosphonic, phosphinic) acid esters and esteramides, process for their preparation and their use as insecticides acaricides or nematocides - Google Patents
O-triazolyl-(thiono)-phosphoric (phosphonic, phosphinic) acid esters and esteramides, process for their preparation and their use as insecticides acaricides or nematocidesInfo
- Publication number
- ZA752946B ZA752946B ZA00752946A ZA752946A ZA752946B ZA 752946 B ZA752946 B ZA 752946B ZA 00752946 A ZA00752946 A ZA 00752946A ZA 752946 A ZA752946 A ZA 752946A ZA 752946 B ZA752946 B ZA 752946B
- Authority
- ZA
- South Africa
- Prior art keywords
- esteramides
- thiono
- nematocides
- phosphinic
- triazolyl
- Prior art date
Links
- 230000000895 acaricidal effect Effects 0.000 title 1
- 239000000642 acaricide Substances 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
- 230000001069 nematicidal effect Effects 0.000 title 1
- 239000005645 nematicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6515—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having three nitrogen atoms as the only ring hetero atoms
- C07F9/6518—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2422548A DE2422548C2 (de) | 1974-05-09 | 1974-05-09 | 0-Triazolyl-(thiono)-phosphor(phosphon)-säureester und -esteramide, Verfahren zu ihrer Herstellung sowieihre Verwendung als Insektizide, Akarizide und Nematizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA752946B true ZA752946B (en) | 1976-03-31 |
Family
ID=5915120
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00752946A ZA752946B (en) | 1974-05-09 | 1975-05-07 | O-triazolyl-(thiono)-phosphoric (phosphonic, phosphinic) acid esters and esteramides, process for their preparation and their use as insecticides acaricides or nematocides |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3985874A (ja) |
| JP (2) | JPS5735838B2 (ja) |
| AR (1) | AR206144A1 (ja) |
| AT (1) | AT330802B (ja) |
| BE (1) | BE828879A (ja) |
| BR (1) | BR7502836A (ja) |
| CH (1) | CH611312A5 (ja) |
| DD (1) | DD119125A5 (ja) |
| DE (1) | DE2422548C2 (ja) |
| DK (1) | DK138271C (ja) |
| EG (1) | EG12178A (ja) |
| ES (1) | ES437495A1 (ja) |
| FR (1) | FR2270265B1 (ja) |
| GB (1) | GB1452724A (ja) |
| HU (1) | HU171992B (ja) |
| IE (1) | IE41338B1 (ja) |
| IL (1) | IL47240A (ja) |
| IT (1) | IT1049424B (ja) |
| KE (1) | KE2719A (ja) |
| LU (1) | LU72425A1 (ja) |
| NL (1) | NL7505494A (ja) |
| PL (2) | PL97177B1 (ja) |
| SU (1) | SU578828A3 (ja) |
| TR (1) | TR18270A (ja) |
| ZA (1) | ZA752946B (ja) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU190795B (en) * | 1982-05-04 | 1986-11-28 | Egyt Gyogyszervegyeszeti Gyar,Hu | Process for producing carbazinic derivatives and compositions containing them for increasing weight yield |
| JPS5931443U (ja) * | 1982-08-23 | 1984-02-27 | タイワ農機株式会社 | 精米機の吸引除糠装置 |
| JP3297397B2 (ja) * | 1999-05-27 | 2002-07-02 | ヒロセ電機株式会社 | 圧入端子及びこれを有する電気コネクタ |
| US8776796B2 (en) | 2011-12-09 | 2014-07-15 | Colabs, Inc. | Apparatus and method for improved assisted ventilation |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU31414A1 (ja) * | 1951-04-20 | 1900-01-01 | ||
| BE792449A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Esters triazolyliques d'acides oxygenes du phosphore et produits pesticides qui en renferment |
-
1974
- 1974-05-09 DE DE2422548A patent/DE2422548C2/de not_active Expired
-
1975
- 1975-01-01 AR AR258664A patent/AR206144A1/es active
- 1975-04-24 GB GB1702375A patent/GB1452724A/en not_active Expired
- 1975-04-29 US US05/573,273 patent/US3985874A/en not_active Expired - Lifetime
- 1975-05-03 EG EG267/75A patent/EG12178A/xx active
- 1975-05-06 IL IL47240A patent/IL47240A/en unknown
- 1975-05-06 SU SU7502131895A patent/SU578828A3/ru active
- 1975-05-07 LU LU72425A patent/LU72425A1/xx unknown
- 1975-05-07 JP JP5394675A patent/JPS5735838B2/ja not_active Expired
- 1975-05-07 DK DK201475A patent/DK138271C/da active
- 1975-05-07 CH CH593375A patent/CH611312A5/xx not_active IP Right Cessation
- 1975-05-07 JP JP50053947A patent/JPS5829763B2/ja not_active Expired
- 1975-05-07 ZA ZA00752946A patent/ZA752946B/xx unknown
- 1975-05-07 AT AT350075A patent/AT330802B/de not_active IP Right Cessation
- 1975-05-07 IT IT23126/75A patent/IT1049424B/it active
- 1975-05-07 ES ES437495A patent/ES437495A1/es not_active Expired
- 1975-05-08 PL PL1975180251A patent/PL97177B1/pl unknown
- 1975-05-08 BR BR3614/75D patent/BR7502836A/pt unknown
- 1975-05-08 DD DD185923A patent/DD119125A5/xx unknown
- 1975-05-08 PL PL1975192026A patent/PL99854B1/pl unknown
- 1975-05-08 IE IE1032/75A patent/IE41338B1/xx unknown
- 1975-05-09 FR FR7514543A patent/FR2270265B1/fr not_active Expired
- 1975-05-09 TR TR18270A patent/TR18270A/xx unknown
- 1975-05-09 HU HU75BA00003263A patent/HU171992B/hu unknown
- 1975-05-09 NL NL7505494A patent/NL7505494A/xx not_active Application Discontinuation
- 1975-05-09 BE BE156185A patent/BE828879A/xx unknown
-
1977
- 1977-04-30 KE KE2719A patent/KE2719A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2422548A1 (de) | 1975-11-20 |
| LU72425A1 (ja) | 1976-03-17 |
| AR206144A1 (es) | 1976-06-30 |
| AU8083375A (en) | 1976-11-11 |
| ATA350075A (de) | 1975-10-15 |
| JPS50149674A (ja) | 1975-11-29 |
| US3985874A (en) | 1976-10-12 |
| FR2270265B1 (ja) | 1979-10-05 |
| DE2422548C2 (de) | 1982-08-26 |
| IE41338L (en) | 1975-11-09 |
| PL97177B1 (pl) | 1978-02-28 |
| DD119125A5 (ja) | 1976-04-12 |
| CH611312A5 (ja) | 1979-05-31 |
| BR7502836A (pt) | 1976-03-16 |
| PL99854B1 (pl) | 1978-08-31 |
| IL47240A (en) | 1977-11-30 |
| IE41338B1 (en) | 1979-12-05 |
| SU578828A3 (ru) | 1977-10-30 |
| KE2719A (en) | 1977-07-15 |
| AT330802B (de) | 1976-07-26 |
| TR18270A (tr) | 1976-11-10 |
| JPS5735838B2 (ja) | 1982-07-31 |
| DK138271C (da) | 1979-01-15 |
| GB1452724A (en) | 1976-10-13 |
| DK138271B (da) | 1978-08-07 |
| IT1049424B (it) | 1981-01-20 |
| EG12178A (en) | 1978-09-30 |
| ES437495A1 (es) | 1977-02-01 |
| FR2270265A1 (ja) | 1975-12-05 |
| HU171992B (hu) | 1978-05-28 |
| BE828879A (fr) | 1975-11-10 |
| DK201475A (da) | 1975-11-10 |
| NL7505494A (nl) | 1975-11-11 |
| JPS50148535A (ja) | 1975-11-28 |
| IL47240A0 (en) | 1975-07-28 |
| JPS5829763B2 (ja) | 1983-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA732697B (en) | O-pyrazolo(thiono)-phosphoric(phosphonic)acid esters-,process for their production and their use as insecticides and acaricides | |
| ZA756697B (en) | Novel (thiono) (thiol) phosphoric (phosphonic) acid esters and esteramides, and their use as insecticides, acaricides and nematicides | |
| ZA763157B (en) | Pyrimidine (4,6)diylbis-(thiono)(thiol)-phosphoric(phosphonic acid esters process for their preparation and their use as insecticides or acaricides | |
| ZA752946B (en) | O-triazolyl-(thiono)-phosphoric (phosphonic, phosphinic) acid esters and esteramides, process for their preparation and their use as insecticides acaricides or nematocides | |
| ZA751317B (en) | Novel quinoxalyl-(thiono)-(thiol)-phosphoric(phosphonic) acid esters and esteramides, their preparation and their use as insecticides and acaricides | |
| EG11612A (en) | Triazolothiazolyl-(thiono)-phosphoric(phosphonic)acid esters,process for their,preparation and their use as insecticides and acaricides(including tickicides) | |
| CY814A (en) | O-pyrazolopyrimidine-(thiono)-phosphoric (phosphonic) acid esters, process for their preparation, and their use as insecticides, acaricides and nematocides | |
| KE2846A (en) | O-triazolyl (thino)-phosphoric(phosphonic) acid esters and ester-amides, process for their preparation and their use as insecticides, acaricides or nematocides | |
| ZA773878B (en) | O-(1-fluoro-2-halo-ethyl)(thiono)phosphoric(phosphonic)acid esteramides,processes for their preparation and their use as insecticides,acaricides and nematocides | |
| ZA753232B (en) | S-triazolopyridinmethyl-thiolo (thione)-phosphoric (phosphonic) acid esters and esteramides, process for their preparation and their use as insecticides and acaricides | |
| EG11738A (en) | New triazolothiazole-(thiono)-phosphoric(phosphonic)acid esters,their preparation and their use as insecticides and acaricides | |
| ZA756125B (en) | Novel (thiono) (thiol)phosphoric (phosphonic) acid esters and esteramides and their use as insecticides and acaricides | |
| EG11169A (en) | O-pyrazolopyrimide-(thiono)-phosphoric(phosphonic)acid esters,process for their production and their use as insecticides and acaricides | |
| ZA762153B (en) | S-triazolobenzopyrazinemethyl (thiono) thiophosphoric (phosphonic) acid esters and their use as insecticides | |
| CA935434A (en) | Pyrazolo-(thiono)-phosphoric (phosphonic) acid esters, process for their preparation and their use as insecticides and acaricides | |
| ZA756031B (en) | Novel (thiono) (di) thiolphosphoric (phosphonic) acid esters and esteramides, and their use as insecticides and acaricides | |
| ZA754220B (en) | Novel imidazolyl-(thiono)-phosphoric (phosphonic) acid esters and esteramides and their use as insecticides and nematicides | |
| ZA731848B (en) | 1-carbalkoxy-2-cyanovinyl-(thiono)-phosphoric(phosphonic)acid esters or ester amides,process for their preparation and their use as insecticides and acaricides | |
| EG11538A (en) | Novel thionophosphoric(phosphonic)acid esters their use as insecticides and acaricides | |
| ZA766302B (en) | 1-carbalkoxyvinyl(thiono)(thiol)phosphoric(phosphonic)acid esters and esteramides process for their preparation and their use as insecticides and acaricides | |
| ZA765991B (en) | O-pyrazolopyrimidine(thiono)-phosphoric(phosphonic)acid esters and ester-amides and their use as insecticides acaricides and nematicides | |
| ZA752618B (en) | Novel(thiono)-phosphoric(phosphonic) acid esters and ester amides, their preparation and their use as insecticides acaricides and nematicides | |
| AU451124B2 (en) | O-pyrazolopyrimidine-(thiono)-phosphoric (phosphonic) acid esters, process for their preparation, and their use as insecticides and acaricides | |
| ZA761064B (en) | Lepidine (thiono) (thiol)-phosphoric (phosphonic) acid esters process for their preparation and use as insecticides | |
| AU2996671A (en) | O-pyrazolopyrimidine-(thiono)-phosphoric (phosphonic) acid esters, process for their preparation, and their use as insecticides and acaricides |