ZA745673B - S-triazol(1,5-a) pyridine derivative - Google Patents
S-triazol(1,5-a) pyridine derivativeInfo
- Publication number
- ZA745673B ZA745673B ZA00745673A ZA745673A ZA745673B ZA 745673 B ZA745673 B ZA 745673B ZA 00745673 A ZA00745673 A ZA 00745673A ZA 745673 A ZA745673 A ZA 745673A ZA 745673 B ZA745673 B ZA 745673B
- Authority
- ZA
- South Africa
- Prior art keywords
- triazol
- pyridine derivative
- pyridine
- derivative
- Prior art date
Links
- LENLQGBLVGGAMF-UHFFFAOYSA-N tributyl([1,2,4]triazolo[1,5-a]pyridin-6-yl)stannane Chemical class C1=C([Sn](CCCC)(CCCC)CCCC)C=CC2=NC=NN21 LENLQGBLVGGAMF-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48121975A JPS5070389A (mber) | 1973-10-30 | 1973-10-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA745673B true ZA745673B (en) | 1975-09-24 |
Family
ID=14824480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00745673A ZA745673B (en) | 1973-10-30 | 1974-09-06 | S-triazol(1,5-a) pyridine derivative |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3956328A (mber) |
| JP (1) | JPS5070389A (mber) |
| AR (1) | AR204175A1 (mber) |
| BE (1) | BE820656A (mber) |
| CA (1) | CA1031343A (mber) |
| DE (1) | DE2449270C3 (mber) |
| ES (1) | ES431497A1 (mber) |
| FR (1) | FR2248837B1 (mber) |
| GB (1) | GB1434517A (mber) |
| HU (1) | HU167780B (mber) |
| SE (1) | SE412234B (mber) |
| SU (1) | SU546280A3 (mber) |
| ZA (1) | ZA745673B (mber) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| YU39992B (en) * | 1976-04-02 | 1985-06-30 | Janssen Pharmaceutica Nv | Process for obtaining new piperazine and piperidine derivatives |
| US4250176A (en) * | 1976-12-21 | 1981-02-10 | Janssen Pharmaceutica N.V. | Piperazine derivatives |
| IT1094076B (it) * | 1978-04-18 | 1985-07-26 | Acraf | Cicloalchiltriazoli |
| US4202977A (en) * | 1979-02-27 | 1980-05-13 | Kyorin Pharmaceutical Co., Ltd. | S-Triazolo [1,5-a] pyridine derivatives |
| FR2450259A1 (fr) * | 1979-02-27 | 1980-09-26 | Kyorin Seiyaku Kk | Derives de la s-triazolo(1, 5-a)pyridine et medicament contenant ces substances |
| CA1129801A (en) * | 1979-06-08 | 1982-08-17 | Michael A. Kessick | Alkali recycle process for recovery of heavy oils and bitumens |
| US4465683A (en) * | 1979-09-14 | 1984-08-14 | Mead Johnson & Company | Anti-psychotic agents |
| US4411900A (en) * | 1980-01-03 | 1983-10-25 | Fujisawa Pharmaceutical Co., Ltd. | Benzhydrylpiperozinyl thiazole derivatives and pharmaceutical composition comprising the same |
| US4357243A (en) * | 1980-11-17 | 1982-11-02 | Dober Chemical Corporation | Metal-working emulsion reclaiming process |
| FR2580648B1 (fr) * | 1985-04-17 | 1987-05-15 | Adir | Nouveaux derives du triazole, leur procede de preparation et les compositions pharmaceutiques les renfermant |
| IT1190375B (it) * | 1985-06-20 | 1988-02-16 | Recordati Chem Pharm | N-benzidrildiazacicloalchil-alcanilidi ad attivita' antianafilattica ed antibroncospastica |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1066857B (it) * | 1965-12-15 | 1985-03-12 | Acraf | Derivati della s ipiazolo 4.3 a piridina e processi per la loro preparazione |
| US3472853A (en) * | 1967-05-29 | 1969-10-14 | Sterling Drug Inc | 1-((pyrido(2,1-c)-s-triazolyl)-lower-alkyl)-4-substituted- piperazines |
-
1973
- 1973-10-30 JP JP48121975A patent/JPS5070389A/ja active Pending
-
1974
- 1974-01-01 AR AR256243A patent/AR204175A1/es active
- 1974-09-04 US US05/503,089 patent/US3956328A/en not_active Expired - Lifetime
- 1974-09-05 SE SE7411243A patent/SE412234B/xx not_active IP Right Cessation
- 1974-09-06 ZA ZA00745673A patent/ZA745673B/xx unknown
- 1974-09-19 FR FR7431711A patent/FR2248837B1/fr not_active Expired
- 1974-09-20 CA CA209,836A patent/CA1031343A/en not_active Expired
- 1974-10-03 BE BE2053904A patent/BE820656A/xx not_active IP Right Cessation
- 1974-10-16 DE DE2449270A patent/DE2449270C3/de not_active Expired
- 1974-10-28 GB GB4662374A patent/GB1434517A/en not_active Expired
- 1974-10-29 SU SU2072633A patent/SU546280A3/ru active
- 1974-10-29 HU HUKI715A patent/HU167780B/hu not_active IP Right Cessation
- 1974-10-30 ES ES431497A patent/ES431497A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2449270B2 (de) | 1979-10-25 |
| ES431497A1 (es) | 1976-11-01 |
| JPS5070389A (mber) | 1975-06-11 |
| FR2248837B1 (mber) | 1978-07-21 |
| CA1031343A (en) | 1978-05-16 |
| BE820656A (fr) | 1975-02-03 |
| SU546280A3 (ru) | 1977-02-05 |
| US3956328A (en) | 1976-05-11 |
| AR204175A1 (es) | 1975-11-28 |
| SE7411243L (mber) | 1975-05-02 |
| HU167780B (mber) | 1975-12-25 |
| DE2449270A1 (de) | 1975-05-07 |
| SE412234B (sv) | 1980-02-25 |
| GB1434517A (en) | 1976-05-05 |
| DE2449270C3 (de) | 1980-07-10 |
| AU7309774A (en) | 1976-03-11 |
| FR2248837A1 (mber) | 1975-05-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA989843A (en) | 2-alkyl-3-acyl-pyrazolo(1,5-a) pyridines | |
| IL46162A (en) | 2-acyl-4-oxo-hexahydro-4h-pyrazino-(2,1- )-isoquinolines | |
| KE3086A (en) | Pyrazolo(3,4,6)quinolines | |
| IL45114A (en) | 3-substituted 5,5-diphenylhydantoins | |
| ZA745673B (en) | S-triazol(1,5-a) pyridine derivative | |
| MY8100330A (en) | 1,3-diketo-1,2,3,4-tetrahydrosoquinolines | |
| HK4080A (en) | Imidazo(4,5-b)pyridines | |
| IL45259A0 (en) | 1,3-oxygenated 8alpha-oestratrienes | |
| GB1482285A (en) | 1,3-oxygenated 8alpha-oestratrienes | |
| ZA744478B (en) | 1,3-oxygenated 8alpha-oestratrienes | |
| ZA744364B (en) | 4,3-dihydro-2h-naphthalin-1-one-5-oxypropyl-piperazine derivatives | |
| AU7278974A (en) | 2,3-dihydrobenzofuranyl-7-n-methylcarbamates | |
| IL44744A (en) | 5-benzoyl-4-amino-ih-pyrazolo 3,4-b pyridine derivatives | |
| AU6558474A (en) | 7-alkyl-delta 3,5-steroids | |
| CA1022554A (en) | 1-carbamoyl-2-alkoxycarbonylaminoimidazo (4,5-b) pyridines | |
| ZA743084B (en) | Pyrazinoisoquinoline derivative | |
| CA1029726A (en) | 1,8-naphthyridine-3-carboxamidetetrazolyl derivatives | |
| AU6776774A (en) | 2,3-dhydro-benzofurans | |
| AU7271274A (en) | 1,2-oxaphospholanes | |
| PH11677A (en) | 6,7,8,9-tetrahydro-1h-pyrazolo(3,4-b)(1,5)diazocine derivatives | |
| ZM12174A1 (en) | 7h-indolizino (5,6,7-ij) isoquinoline derivatives | |
| ZA747367B (en) | 3,3a-dihydro-2h,9h-isoxazolo(3,2-b) (1,3) benzoxazin-9-ones | |
| AU6593074A (en) | 1, 4-dihydro-2-h-isoquinoline | |
| AU6912274A (en) | Herbicidal pyridine derivatives | |
| AU467607B2 (en) | Novel 2-alkyl-3-acyl-pyrazolo [1,5-a] pyridines |