ZA742417B - Mycophenolic acid derivatives - Google Patents
Mycophenolic acid derivativesInfo
- Publication number
- ZA742417B ZA742417B ZA00742417A ZA742417A ZA742417B ZA 742417 B ZA742417 B ZA 742417B ZA 00742417 A ZA00742417 A ZA 00742417A ZA 742417 A ZA742417 A ZA 742417A ZA 742417 B ZA742417 B ZA 742417B
- Authority
- ZA
- South Africa
- Prior art keywords
- acid derivatives
- mycophenolic acid
- mycophenolic
- derivatives
- acid
- Prior art date
Links
- HPNSFSBZBAHARI-RUDMXATFSA-N mycophenolic acid Chemical class OC1=C(C\C=C(/C)CCC(O)=O)C(OC)=C(C)C2=C1C(=O)OC2 HPNSFSBZBAHARI-RUDMXATFSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H17/00—Compounds containing heterocyclic radicals directly attached to hetero atoms of saccharide radicals
- C07H17/04—Heterocyclic radicals containing only oxygen as ring hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Health & Medical Sciences (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US362700A US3903071A (en) | 1973-05-22 | 1973-05-22 | Mycophenolic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA742417B true ZA742417B (en) | 1975-11-26 |
Family
ID=23427173
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00742417A ZA742417B (en) | 1973-05-22 | 1974-04-06 | Mycophenolic acid derivatives |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3903071A (enExample) |
| JP (1) | JPS5019747A (enExample) |
| AR (1) | AR201234A1 (enExample) |
| AT (1) | AT337892B (enExample) |
| BE (1) | BE815330A (enExample) |
| BG (1) | BG25994A3 (enExample) |
| CA (1) | CA1027558A (enExample) |
| CH (1) | CH603681A5 (enExample) |
| CS (1) | CS187435B2 (enExample) |
| DD (1) | DD113544A5 (enExample) |
| DE (1) | DE2424119A1 (enExample) |
| ES (1) | ES426543A1 (enExample) |
| FR (1) | FR2230361B1 (enExample) |
| GB (1) | GB1465008A (enExample) |
| HU (1) | HU169191B (enExample) |
| IE (1) | IE39218B1 (enExample) |
| IL (1) | IL44670A (enExample) |
| NL (1) | NL7406542A (enExample) |
| PH (1) | PH10898A (enExample) |
| PL (1) | PL89967B1 (enExample) |
| RO (1) | RO68642A (enExample) |
| SE (1) | SE7908625L (enExample) |
| SU (1) | SU578006A3 (enExample) |
| ZA (1) | ZA742417B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5414176Y2 (enExample) * | 1971-05-31 | 1979-06-13 | ||
| US4103006A (en) * | 1976-05-20 | 1978-07-25 | Wisconsin Alumni Research Foundation | Glycosides of 2,6-bis(hydroxy-phenyl)-3,7-dioxabicyclo [3,3,0] octane |
| US4686234A (en) * | 1985-11-27 | 1987-08-11 | Syntex (U.S.A) Inc. | Mycophenolic acid derivatives in the treatment of inflammatory diseases, in particular rheumatoid arthritis |
| US4725622A (en) * | 1986-01-23 | 1988-02-16 | Syntex (U.S.A.) Inc. | Mycophenolic acid derivatives in the treatment of rheumatoid arthritis |
| US4753935A (en) * | 1987-01-30 | 1988-06-28 | Syntex (U.S.A.) Inc. | Morpholinoethylesters of mycophenolic acid and pharmaceutical compositions |
| US5177072A (en) * | 1987-01-30 | 1993-01-05 | Syntex (U.S.A.) Inc. | Treatment of autoimmune inflammatory, and psoriatic diseases with heterocyclic aminoalkyl esters of mycophenolic acid and derivatives |
| JPH0736475Y2 (ja) * | 1987-05-14 | 1995-08-16 | 阪神エレクトリック株式会社 | インバ−タ装置 |
| US5098899A (en) * | 1989-03-06 | 1992-03-24 | Trustees Of Boston University | Method for therapeutically treating psoriatic arthritis using vitamin D analogues and metabolites |
| US5455045A (en) * | 1993-05-13 | 1995-10-03 | Syntex (U.S.A.) Inc. | High dose formulations |
| ID18663A (id) | 1996-04-12 | 1998-04-30 | Novartis Ag | Komposisi farmasi berlapis enterik |
| US20050125054A1 (en) * | 2000-12-22 | 2005-06-09 | Avantec Vascular Corporation | Devices delivering therapeutic agents and methods regarding the same |
| US7077859B2 (en) * | 2000-12-22 | 2006-07-18 | Avantec Vascular Corporation | Apparatus and methods for variably controlled substance delivery from implanted prostheses |
| US7083642B2 (en) * | 2000-12-22 | 2006-08-01 | Avantec Vascular Corporation | Delivery of therapeutic capable agents |
| US20050203612A1 (en) * | 2000-12-22 | 2005-09-15 | Avantec Vascular Corporation | Devices delivering therapeutic agents and methods regarding the same |
| US6471980B2 (en) | 2000-12-22 | 2002-10-29 | Avantec Vascular Corporation | Intravascular delivery of mycophenolic acid |
| US20030050692A1 (en) * | 2000-12-22 | 2003-03-13 | Avantec Vascular Corporation | Delivery of therapeutic capable agents |
| AU2002322719A1 (en) * | 2001-07-26 | 2003-02-17 | Avantec Vascular Corporation | Delivery of therapeutic capable agents |
| US6641611B2 (en) | 2001-11-26 | 2003-11-04 | Swaminathan Jayaraman | Therapeutic coating for an intravascular implant |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3758455A (en) * | 1970-05-14 | 1973-09-11 | Chugai Pharmaceutical Co Ltd | Reof mycophenolic acid glucuronide and the process for the preparation the |
-
1973
- 1973-05-22 US US362700A patent/US3903071A/en not_active Expired - Lifetime
-
1974
- 1974-04-06 ZA ZA00742417A patent/ZA742417B/xx unknown
- 1974-04-17 CA CA197,708A patent/CA1027558A/en not_active Expired
- 1974-04-17 IE IE806/74A patent/IE39218B1/xx unknown
- 1974-04-19 IL IL44670A patent/IL44670A/en unknown
- 1974-04-19 PH PH15753A patent/PH10898A/en unknown
- 1974-04-29 GB GB1858374A patent/GB1465008A/en not_active Expired
- 1974-05-06 CH CH613674A patent/CH603681A5/xx not_active IP Right Cessation
- 1974-05-15 NL NL7406542A patent/NL7406542A/xx not_active Application Discontinuation
- 1974-05-17 DE DE2424119A patent/DE2424119A1/de not_active Withdrawn
- 1974-05-21 BE BE1005977A patent/BE815330A/xx unknown
- 1974-05-21 ES ES426543A patent/ES426543A1/es not_active Expired
- 1974-05-21 FR FR7417688A patent/FR2230361B1/fr not_active Expired
- 1974-05-21 PL PL1974171297A patent/PL89967B1/pl unknown
- 1974-05-21 AT AT421274A patent/AT337892B/de not_active IP Right Cessation
- 1974-05-21 SU SU7402026935A patent/SU578006A3/ru active
- 1974-05-21 HU HUEI550A patent/HU169191B/hu unknown
- 1974-05-22 DD DD178682A patent/DD113544A5/xx unknown
- 1974-05-22 BG BG026761A patent/BG25994A3/xx unknown
- 1974-05-22 RO RO7478897A patent/RO68642A/ro unknown
- 1974-05-22 CS CS743663A patent/CS187435B2/cs unknown
- 1974-05-22 JP JP49058339A patent/JPS5019747A/ja active Pending
- 1974-05-22 AR AR253880A patent/AR201234A1/es active
-
1979
- 1979-10-17 SE SE7908625A patent/SE7908625L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT337892B (de) | 1977-07-25 |
| FR2230361A1 (enExample) | 1974-12-20 |
| ATA421274A (de) | 1976-11-15 |
| IL44670A0 (en) | 1974-06-30 |
| CH603681A5 (enExample) | 1978-08-31 |
| BG25994A3 (bg) | 1979-01-12 |
| DE2424119A1 (de) | 1974-12-12 |
| BE815330A (fr) | 1974-11-21 |
| NL7406542A (enExample) | 1974-11-26 |
| CA1027558A (en) | 1978-03-07 |
| SU578006A3 (ru) | 1977-10-25 |
| SE7908625L (sv) | 1979-10-17 |
| GB1465008A (en) | 1977-02-16 |
| PL89967B1 (enExample) | 1976-12-31 |
| JPS5019747A (enExample) | 1975-03-01 |
| AR201234A1 (es) | 1975-02-21 |
| AU6802774A (en) | 1975-10-23 |
| IE39218L (en) | 1974-11-22 |
| DD113544A5 (enExample) | 1975-06-12 |
| PH10898A (en) | 1977-09-30 |
| US3903071A (en) | 1975-09-02 |
| FR2230361B1 (enExample) | 1977-01-28 |
| IL44670A (en) | 1977-08-31 |
| CS187435B2 (en) | 1979-01-31 |
| IE39218B1 (en) | 1978-08-30 |
| RO68642A (ro) | 1980-06-15 |
| HU169191B (enExample) | 1976-10-28 |
| ES426543A1 (es) | 1976-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL45299A0 (en) | Prostanoic acid derivatives | |
| KE2946A (en) | Pyrazino-isoquinoline derivatives | |
| ZA742417B (en) | Mycophenolic acid derivatives | |
| GB1483352A (en) | Phenyl-alkenol and-alkanol derivatives | |
| ZA741906B (en) | 2- anilino-nicotinic acid derivatives | |
| IL46296A (en) | Pregnan-21-oic acid derivatives | |
| AU6939974A (en) | Sulphamoylbenzoic acid | |
| IL43704A0 (en) | Lactamimide derivatives | |
| HK54080A (en) | Dihydroergopeptine derivatives | |
| PH12303A (en) | Thienotriazolodiazepine derivatives | |
| HK181A (en) | Benzylpyrimidine derivatives | |
| GB1483379A (en) | 7-halo-methyl-17-hydroxy-3-oxo-17alpha-pregn-4-ene-21-carboxylic acid ypsilon-lactones | |
| IL44831A0 (en) | Pyrazinoisoquinoline derivatives | |
| AU7333674A (en) | Arylchalcogeno-hydrocarbon derivatives | |
| GB1408550A (en) | Gitoxigenin-digitoxoside derivatives | |
| AU7333774A (en) | Arylchalcogeno-hydrocarbon derivatives | |
| IL45173A0 (en) | Cyclopentylheptanoic and-cis-5-heptanoic acid derivatives | |
| IL45084A0 (en) | Prostenoic acid derivatives | |
| ZA748127B (en) | New pregnan-21-oic acid derivatives | |
| AU479485B2 (en) | Mycophenolic acid derivatives | |
| IL44113A0 (en) | Prostanoic acid derivatives | |
| IE39295L (en) | 7-amino-3-thiomethyl-cephem-4-carboxylic acid derivatives | |
| IE39195L (en) | Quinolylaminobenzoic acid derivatives | |
| IE39561B1 (en) | Imidazolyl-alkanoic acid derivatives | |
| ZA74469B (en) | Prostanoic acid derivatives |