ZA742186B - Penicillin and their preparation - Google Patents
Penicillin and their preparationInfo
- Publication number
- ZA742186B ZA742186B ZA00742186A ZA742186A ZA742186B ZA 742186 B ZA742186 B ZA 742186B ZA 00742186 A ZA00742186 A ZA 00742186A ZA 742186 A ZA742186 A ZA 742186A ZA 742186 B ZA742186 B ZA 742186B
- Authority
- ZA
- South Africa
- Prior art keywords
- penicillin
- preparation
- Prior art date
Links
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48039358A JPS5751837B2 (enExample) | 1973-04-05 | 1973-04-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA742186B true ZA742186B (en) | 1975-05-28 |
Family
ID=12550837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00742186A ZA742186B (en) | 1973-04-05 | 1974-04-05 | Penicillin and their preparation |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3945995A (enExample) |
| JP (1) | JPS5751837B2 (enExample) |
| AR (1) | AR202297A1 (enExample) |
| BE (1) | BE813356A (enExample) |
| CA (1) | CA1026749A (enExample) |
| CH (1) | CH594681A5 (enExample) |
| DD (1) | DD110502A5 (enExample) |
| DE (1) | DE2416449C2 (enExample) |
| DK (1) | DK145157C (enExample) |
| FR (1) | FR2224132B1 (enExample) |
| GB (1) | GB1470188A (enExample) |
| HU (1) | HU168314B (enExample) |
| NL (1) | NL7404679A (enExample) |
| NO (1) | NO145576C (enExample) |
| SE (2) | SE422942B (enExample) |
| ZA (1) | ZA742186B (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1074784A (en) * | 1974-09-06 | 1980-04-01 | Sumitomo Chemical Company | N-ACYLAMINO-.alpha.-ARYLACETAMIDO CEPHALOSPORINS |
| FR2288521A1 (fr) * | 1974-10-25 | 1976-05-21 | Merck Patent Gmbh | Nouvelles penicillines et procede pour leur preparation |
| DE2525541C2 (de) * | 1975-06-07 | 1984-01-12 | Bayer Ag, 5090 Leverkusen | β-Lactam-Antibiotica, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel |
| JPS5195090A (en) * | 1975-02-14 | 1976-08-20 | 66 * dd22 * 33 hidorokishipiridajin 44 karubokishiamido * 22 * paraahidorokishifueniru * asetoamido * penishiransanno seiho | |
| US4111932A (en) * | 1975-09-08 | 1978-09-05 | Mitsubishi Chemical Industries Limited | Amino acid derivatives of 6-(2-amino-2-arylacetamido)penicillanic acids |
| US4053609A (en) * | 1975-09-12 | 1977-10-11 | Tanabe Seiyaku Co., Ltd. | Penicillins and processes for preparing the same |
| GB1568962A (en) * | 1975-10-31 | 1980-06-11 | Beecham Group Ltd | Reparation and compositions containing them (heterocyclic-carbonylamino)pencillins methods for their p |
| JPS5285143A (en) * | 1976-01-05 | 1977-07-15 | Takeda Chem Ind Ltd | Antimicrobial agents and method of preparing same |
| NZ184434A (en) * | 1976-06-30 | 1979-03-28 | Dainippon Pharmaceutical Co | Penicillins with a substituted p-hydroxy-benzyl side-chain, and injectable pharmaceutical compositions |
| JPS5346997A (en) * | 1976-10-06 | 1978-04-27 | Bristol Myers Co | Antiibacterial agent |
| US4081441A (en) * | 1976-10-06 | 1978-03-28 | Bristol-Myers Company | Antibacterial agents |
| JPS53124295A (en) * | 1977-04-04 | 1978-10-30 | Mitsubishi Chem Ind Ltd | Penicillin derivatives |
| EP0001041A3 (en) * | 1977-07-27 | 1979-06-27 | Sandoz Ag | Alpha(pyridonecarboxylamino)-alpha substituted acetamido penicillins and -cephalosporins, process for their preparation, their use in pharmaceuticals; pyridones used in the process |
| US4198504A (en) * | 1978-11-02 | 1980-04-15 | Bristol-Myers Company | [3-(Pyridinium)-7-(naphthyiridinyl carbonylamino)acetamido]cephalosporanic acid derivatives |
| JPS5573686A (en) * | 1978-11-28 | 1980-06-03 | Mitsui Toatsu Chem Inc | Novel penicillin |
| US4231928A (en) * | 1979-04-24 | 1980-11-04 | Bristol-Myers Company | Antibacterial agents |
| US4241062A (en) * | 1979-05-29 | 1980-12-23 | Merck & Co., Inc. | Antibacterial penicillins |
| JPS5651488A (en) * | 1979-10-02 | 1981-05-09 | Meiji Seika Kaisha Ltd | Penicillin derivative and its preparation |
| JPS5665874A (en) * | 1979-11-01 | 1981-06-03 | Mitsui Toatsu Chem Inc | Novel quinoline derivative |
| US4288590A (en) * | 1980-02-14 | 1981-09-08 | Bristol-Myers Company | 7-[Dα-(4-Hydroxy-1,5-naphthyridine-3-carboxamido)-α-arylacetamido]-3-(N,N-dimethyl-aminomethylpyridinium) methyl-3-cephem-4-carboxylates |
| IT1215277B (it) * | 1985-05-27 | 1990-01-31 | Pomezia Roma A | Derivato chinolin-lattaminico ad attivita' antibatterica ed inibitrice delle b-lattamasi. |
| DE4102234A1 (de) * | 1991-01-23 | 1992-07-30 | Dresden Arzneimittel | Neue (alpha)-aminochinolinoyl-(3)-penicilline, verfahren zu deren herstellung und diese enthaltende antibakterielle mittel |
| JP2674315B2 (ja) * | 1991-10-15 | 1997-11-12 | 藤沢薬品工業株式会社 | ペニシリンgエステル |
| HUP0302367A2 (hu) * | 2000-10-12 | 2003-11-28 | Merck & Co., Inc. | HIV Integráz inhibitorokként hasznos aza- és poliazanaftalenil-karboxamidok, ezeket tartalmazó gyógyszerkészítmények |
| EP1326610B1 (en) * | 2000-10-12 | 2006-11-15 | Merck & Co., Inc. | Aza-and polyaza-naphthalenyl carboxamides useful as hiv integrase inhibitors |
| CA2425395C (en) * | 2000-10-12 | 2009-06-02 | Merck & Co., Inc. | Aza- and polyaza-naphthalenyl carboxamides useful as hiv integrase inhibitors |
| DE60323743D1 (en) | 2002-03-15 | 2008-11-06 | Merck & Co Inc | N-(substituierte benzyl)-8-hydroxy-1,6-naphthyridin-7- carbonsäureamide als hiv-integrase-hemmer |
| CA2572442A1 (fr) * | 2004-07-30 | 2006-03-09 | Palumed S.A. | Molecules hybrides qa ou q est une aminoquinoleine et a est un residu antibiotique, leur synthese et leurs utilisations en tant qu'agent antibacterien |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3248387A (en) * | 1963-02-07 | 1966-04-26 | American Home Prod | Amino-acylamino-penicillanic acids |
| GB1053415A (enExample) * | 1964-07-29 | |||
| GB1130445A (en) * | 1966-04-26 | 1968-10-16 | Beecham Group Ltd | Penicillins |
| DE2104580C3 (de) * | 1971-02-01 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | Acylureidopenicilline |
| DE2165462C2 (de) * | 1971-12-29 | 1984-12-13 | Sumitomo Chemical Co., Ltd., Osaka | Penicilline, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| AR204813A1 (es) * | 1972-05-08 | 1976-03-05 | Yamanouchi Pharma Co Ltd | Proceso para la preparacion de derivados de ampilicina |
| JPS5417754B2 (enExample) * | 1972-12-15 | 1979-07-02 |
-
1973
- 1973-04-05 JP JP48039358A patent/JPS5751837B2/ja not_active Expired
-
1974
- 1974-04-03 HU HUSU855A patent/HU168314B/hu unknown
- 1974-04-03 CH CH465674A patent/CH594681A5/xx not_active IP Right Cessation
- 1974-04-04 FR FR7412029A patent/FR2224132B1/fr not_active Expired
- 1974-04-04 DE DE2416449A patent/DE2416449C2/de not_active Expired
- 1974-04-04 NO NO741227A patent/NO145576C/no unknown
- 1974-04-04 SE SE7404565A patent/SE422942B/xx unknown
- 1974-04-04 CA CA196,845A patent/CA1026749A/en not_active Expired
- 1974-04-05 US US05/458,417 patent/US3945995A/en not_active Expired - Lifetime
- 1974-04-05 GB GB1514274A patent/GB1470188A/en not_active Expired
- 1974-04-05 DD DD177736A patent/DD110502A5/xx unknown
- 1974-04-05 AR AR253166A patent/AR202297A1/es active
- 1974-04-05 BE BE142894A patent/BE813356A/xx not_active IP Right Cessation
- 1974-04-05 ZA ZA00742186A patent/ZA742186B/xx unknown
- 1974-04-05 NL NL7404679A patent/NL7404679A/xx not_active Application Discontinuation
- 1974-04-05 DK DK192274A patent/DK145157C/da not_active IP Right Cessation
-
1977
- 1977-02-18 SE SE7701836A patent/SE422943B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE813356A (fr) | 1974-10-07 |
| NO741227L (no) | 1974-10-08 |
| NL7404679A (enExample) | 1974-10-08 |
| AR202297A1 (es) | 1975-05-30 |
| AU6761374A (en) | 1975-10-09 |
| SE422943B (sv) | 1982-04-05 |
| FR2224132B1 (enExample) | 1977-05-06 |
| CA1026749A (en) | 1978-02-21 |
| JPS49125387A (enExample) | 1974-11-30 |
| DD110502A5 (enExample) | 1974-12-20 |
| JPS5751837B2 (enExample) | 1982-11-04 |
| US3945995A (en) | 1976-03-23 |
| SE422942B (sv) | 1982-04-05 |
| DE2416449C2 (de) | 1982-10-07 |
| DK145157C (da) | 1983-04-11 |
| GB1470188A (en) | 1977-04-14 |
| FR2224132A1 (enExample) | 1974-10-31 |
| DE2416449A1 (de) | 1974-10-24 |
| HU168314B (enExample) | 1976-03-28 |
| SE7701836L (sv) | 1977-02-18 |
| CH594681A5 (enExample) | 1978-01-31 |
| NO145576B (no) | 1982-01-11 |
| DK145157B (da) | 1982-09-20 |
| NO145576C (no) | 1982-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA742186B (en) | Penicillin and their preparation | |
| IL45091A0 (en) | Improved container-lid and its manufacture | |
| IL43589A0 (en) | Novel omega-pentanorprostaglandis and their preparation | |
| ZA744240B (en) | Clycoluril derivatives and preparation thereof | |
| CY969A (en) | 2-anilino-nicotinic and derivatives | |
| IL44109A0 (en) | Improved capsules and their manufacture | |
| IL44959A0 (en) | Alpha-acylureido-cephalosporins and their preparation | |
| HK8978A (en) | Triazolo-isoindole and triazolo-isoquinoline derivatives and their manufacture and uses | |
| IL44728A0 (en) | Novel penicillins and their preparation | |
| ZA744620B (en) | Aryloxyalkyl compounds and their preparation | |
| IL39071A0 (en) | New penicillins and their preparation | |
| MW4174A1 (en) | Penam derivatives and preparation thereof | |
| ZA744367B (en) | Bis-triazinobenzimidazoles and their preparation | |
| ZA744913B (en) | Groynes and their manufacture | |
| IL50239A0 (en) | Cyclopentapyrrole-4-carbonitriles and their preparation | |
| IL50239A (en) | Cyclopentapyrrole-4-carbonitriles and their preparation | |
| IL44042A0 (en) | Novel indolobenzazepines and their preparation | |
| GB1482275A (en) | Adamantyl-amino compounds and their preparation | |
| IL44035A0 (en) | Novel cephalosporins and their preparation | |
| ZA738851B (en) | Novel penicillin and production thereof | |
| AU490382B2 (en) | Penicillins and their preparation | |
| JPS5312819A (en) | Preparation of nnsubstituted chloroacetoanilide | |
| ZM15374A1 (en) | Penam derivatives and preparation thereof | |
| AU459797B2 (en) | 2-arylthiobenzoicacids and their preparation | |
| AU483128B2 (en) | Bis-triazinobenzimidazoles and their preparation |