ZA733834B - Process for producing 2-hydroxymethyl-3-phenyl-4(3h)-quinazolinone - Google Patents
Process for producing 2-hydroxymethyl-3-phenyl-4(3h)-quinazolinoneInfo
- Publication number
- ZA733834B ZA733834B ZA733834A ZA733834A ZA733834B ZA 733834 B ZA733834 B ZA 733834B ZA 733834 A ZA733834 A ZA 733834A ZA 733834 A ZA733834 A ZA 733834A ZA 733834 B ZA733834 B ZA 733834B
- Authority
- ZA
- South Africa
- Prior art keywords
- quinazolinone
- hydroxymethyl
- phenyl
- producing
- Prior art date
Links
- WORCWJOZPFHFPX-UHFFFAOYSA-N 2-(hydroxymethyl)-3-phenylquinazolin-4-one Chemical compound OCC1=NC2=CC=CC=C2C(=O)N1C1=CC=CC=C1 WORCWJOZPFHFPX-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5763172A JPS5442991B2 (cs) | 1972-06-12 | 1972-06-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA733834B true ZA733834B (en) | 1974-04-24 |
Family
ID=13061227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA733834A ZA733834B (en) | 1972-06-12 | 1973-06-06 | Process for producing 2-hydroxymethyl-3-phenyl-4(3h)-quinazolinone |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5442991B2 (cs) |
| AR (1) | AR197148A1 (cs) |
| AT (1) | AT330187B (cs) |
| AU (1) | AU474505B2 (cs) |
| BE (1) | BE800595A (cs) |
| CA (1) | CA998339A (cs) |
| CH (1) | CH582160A5 (cs) |
| CS (1) | CS184815B2 (cs) |
| ES (1) | ES415794A1 (cs) |
| FR (1) | FR2187353B1 (cs) |
| GB (1) | GB1443829A (cs) |
| HU (1) | HU165940B (cs) |
| IE (1) | IE37750B1 (cs) |
| NL (1) | NL7308045A (cs) |
| SU (1) | SU563915A3 (cs) |
| ZA (1) | ZA733834B (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU543928B2 (en) * | 1981-01-16 | 1985-05-09 | Masayuki Ishikawa | 4(311)-quinazolinone derivatives |
| JP2766791B2 (ja) * | 1995-09-04 | 1998-06-18 | 森川産業株式会社 | 集合ヘッドを有する気体圧縮機 |
| WO1997010221A1 (en) * | 1995-09-15 | 1997-03-20 | Torrey Pines Institute For Molecular Studies | Synthesis of quinazolinone libraries |
-
1972
- 1972-06-12 JP JP5763172A patent/JPS5442991B2/ja not_active Expired
-
1973
- 1973-06-05 CA CA173,223A patent/CA998339A/en not_active Expired
- 1973-06-06 ZA ZA733834A patent/ZA733834B/xx unknown
- 1973-06-06 IE IE90873A patent/IE37750B1/xx unknown
- 1973-06-07 BE BE131994A patent/BE800595A/xx not_active IP Right Cessation
- 1973-06-08 AU AU56717/73A patent/AU474505B2/en not_active Expired
- 1973-06-08 NL NL7308045A patent/NL7308045A/xx not_active Application Discontinuation
- 1973-06-11 SU SU7301930852A patent/SU563915A3/ru active
- 1973-06-11 GB GB2771873A patent/GB1443829A/en not_active Expired
- 1973-06-11 ES ES415794A patent/ES415794A1/es not_active Expired
- 1973-06-11 CS CS419873A patent/CS184815B2/cs unknown
- 1973-06-11 HU HUIO000201 patent/HU165940B/hu unknown
- 1973-06-12 AT AT514473A patent/AT330187B/de active
- 1973-06-12 AR AR24853673A patent/AR197148A1/es active
- 1973-06-12 CH CH845773A patent/CH582160A5/xx not_active IP Right Cessation
- 1973-06-12 FR FR7321301A patent/FR2187353B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AR197148A1 (es) | 1974-03-15 |
| GB1443829A (en) | 1976-07-28 |
| CS184815B2 (en) | 1978-09-15 |
| DE2329815A1 (de) | 1974-01-03 |
| BE800595A (fr) | 1973-10-01 |
| CH582160A5 (cs) | 1976-11-30 |
| ATA514473A (de) | 1975-09-15 |
| SU563915A3 (ru) | 1977-06-30 |
| AT330187B (de) | 1976-06-25 |
| IE37750L (en) | 1973-12-12 |
| CA998339A (en) | 1976-10-12 |
| HU165940B (cs) | 1974-12-28 |
| NL7308045A (cs) | 1973-12-14 |
| ES415794A1 (es) | 1976-02-01 |
| FR2187353B1 (cs) | 1976-09-03 |
| JPS5442991B2 (cs) | 1979-12-17 |
| JPS4914482A (cs) | 1974-02-07 |
| DE2329815B2 (de) | 1976-02-26 |
| IE37750B1 (en) | 1977-09-28 |
| AU5671773A (en) | 1974-12-12 |
| AU474505B2 (en) | 1976-07-22 |
| FR2187353A1 (cs) | 1974-01-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5322587A (en) | Process for producing copolymers | |
| YU90173A (en) | Process for producing ceramic dyes | |
| HU172703B (hu) | Sposob poluchenija proizvodnykh 16-fenoksi-omega-tetranor-prostaglandina | |
| YU36664B (en) | Process for producing aluminium chloro-hydroxide | |
| GB1406684A (en) | Process for producing pyrimidine derivatives | |
| CA960672A (en) | Process for producing quinazolinone derivatives | |
| YU156173A (en) | Process for producing carbamides | |
| YU36944B (en) | Process for producing ethyleneoxide | |
| YU156379A (en) | Process for producing hebricidal triazines | |
| IL40275A0 (en) | Process for producing pyrimidine derivatives | |
| YU36943B (en) | Process for producing ethyleneoxide | |
| HU172069B (hu) | Sposob poluchenija proizvodnykh 1-skobka-3-dvojjnozamehhennykh-fosfono-tioureido-skobka zakryta-2-skobka-3-zamehhennykh-ureido- ili -tioureido-skobka zakryta-benzolov | |
| HU170406B (en) | Process for producing azetidine-2-sulfenic acid silis-esters | |
| CS184329B2 (en) | Method for producing pure 1-nitroantraquionone | |
| ZA733834B (en) | Process for producing 2-hydroxymethyl-3-phenyl-4(3h)-quinazolinone | |
| HU170929B (hu) | Sposob poluchenija novykh 2-beta-gidroksi-3-al'fa-amino-steroidov i roizvodnykh | |
| YU170073A (en) | Process for producing beer | |
| HU167876B (en) | Process for producing 9-10-secoestrane derivatives | |
| YU39580B (en) | Process for producing crystalline pivaloyloxy-methyl-d(-)-alpha-aminobenzyl-penicillinate | |
| HU173381B (hu) | Sposob poluchenija proizvodnykh karboksi-ciklopropanov | |
| YU211571A (en) | Process for producing triazolobenzodiazepines | |
| JPS52112629A (en) | Process for producing dyes | |
| CA935440A (en) | Process for obtaining or producing very pure tetrachlorobisphenol a | |
| CA987326A (en) | Process for producing 2-acyl-5-nitrothiazoles | |
| CA967976A (en) | Process for producing trimethyl-p-benzoquinone |