CA998339A - Composition containing 2-hydroxymethyl-3-phenyl-4-(3h)-quinazolinone - Google Patents
Composition containing 2-hydroxymethyl-3-phenyl-4-(3h)-quinazolinoneInfo
- Publication number
- CA998339A CA998339A CA173,223A CA173223A CA998339A CA 998339 A CA998339 A CA 998339A CA 173223 A CA173223 A CA 173223A CA 998339 A CA998339 A CA 998339A
- Authority
- CA
- Canada
- Prior art keywords
- quinazolinone
- hydroxymethyl
- phenyl
- composition containing
- composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WORCWJOZPFHFPX-UHFFFAOYSA-N 2-(hydroxymethyl)-3-phenylquinazolin-4-one Chemical compound OCC1=NC2=CC=CC=C2C(=O)N1C1=CC=CC=C1 WORCWJOZPFHFPX-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5763172A JPS5442991B2 (cs) | 1972-06-12 | 1972-06-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA998339A true CA998339A (en) | 1976-10-12 |
Family
ID=13061227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA173,223A Expired CA998339A (en) | 1972-06-12 | 1973-06-05 | Composition containing 2-hydroxymethyl-3-phenyl-4-(3h)-quinazolinone |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5442991B2 (cs) |
| AR (1) | AR197148A1 (cs) |
| AT (1) | AT330187B (cs) |
| AU (1) | AU474505B2 (cs) |
| BE (1) | BE800595A (cs) |
| CA (1) | CA998339A (cs) |
| CH (1) | CH582160A5 (cs) |
| CS (1) | CS184815B2 (cs) |
| ES (1) | ES415794A1 (cs) |
| FR (1) | FR2187353B1 (cs) |
| GB (1) | GB1443829A (cs) |
| HU (1) | HU165940B (cs) |
| IE (1) | IE37750B1 (cs) |
| NL (1) | NL7308045A (cs) |
| SU (1) | SU563915A3 (cs) |
| ZA (1) | ZA733834B (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU543928B2 (en) * | 1981-01-16 | 1985-05-09 | Masayuki Ishikawa | 4(311)-quinazolinone derivatives |
| JP2766791B2 (ja) * | 1995-09-04 | 1998-06-18 | 森川産業株式会社 | 集合ヘッドを有する気体圧縮機 |
| AU4858596A (en) * | 1995-09-15 | 1997-04-01 | Torrey Pines Institute For Molecular Studies | Synthesis of quinazolinone libraries |
-
1972
- 1972-06-12 JP JP5763172A patent/JPS5442991B2/ja not_active Expired
-
1973
- 1973-06-05 CA CA173,223A patent/CA998339A/en not_active Expired
- 1973-06-06 IE IE90873A patent/IE37750B1/xx unknown
- 1973-06-06 ZA ZA733834A patent/ZA733834B/xx unknown
- 1973-06-07 BE BE131994A patent/BE800595A/xx not_active IP Right Cessation
- 1973-06-08 AU AU56717/73A patent/AU474505B2/en not_active Expired
- 1973-06-08 NL NL7308045A patent/NL7308045A/xx not_active Application Discontinuation
- 1973-06-11 CS CS419873A patent/CS184815B2/cs unknown
- 1973-06-11 ES ES415794A patent/ES415794A1/es not_active Expired
- 1973-06-11 SU SU7301930852A patent/SU563915A3/ru active
- 1973-06-11 HU HUIO000201 patent/HU165940B/hu unknown
- 1973-06-11 GB GB2771873A patent/GB1443829A/en not_active Expired
- 1973-06-12 AR AR24853673A patent/AR197148A1/es active
- 1973-06-12 CH CH845773A patent/CH582160A5/xx not_active IP Right Cessation
- 1973-06-12 AT AT514473A patent/AT330187B/de active
- 1973-06-12 FR FR7321301A patent/FR2187353B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU474505B2 (en) | 1976-07-22 |
| IE37750L (en) | 1973-12-12 |
| ZA733834B (en) | 1974-04-24 |
| AU5671773A (en) | 1974-12-12 |
| AT330187B (de) | 1976-06-25 |
| CH582160A5 (cs) | 1976-11-30 |
| AR197148A1 (es) | 1974-03-15 |
| HU165940B (cs) | 1974-12-28 |
| CS184815B2 (en) | 1978-09-15 |
| GB1443829A (en) | 1976-07-28 |
| BE800595A (fr) | 1973-10-01 |
| ATA514473A (de) | 1975-09-15 |
| ES415794A1 (es) | 1976-02-01 |
| FR2187353B1 (cs) | 1976-09-03 |
| NL7308045A (cs) | 1973-12-14 |
| DE2329815A1 (de) | 1974-01-03 |
| SU563915A3 (ru) | 1977-06-30 |
| JPS4914482A (cs) | 1974-02-07 |
| DE2329815B2 (de) | 1976-02-26 |
| FR2187353A1 (cs) | 1974-01-18 |
| IE37750B1 (en) | 1977-09-28 |
| JPS5442991B2 (cs) | 1979-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA988314A (en) | Anti-caking composition | |
| CA1011506A (en) | Softener-detergent composition | |
| AU5106773A (en) | Deodorant composition | |
| AU473998B2 (en) | Oral composition | |
| AU472176B2 (en) | Composition | |
| CA997790A (en) | Glass composition | |
| CA998339A (en) | Composition containing 2-hydroxymethyl-3-phenyl-4-(3h)-quinazolinone | |
| CA997759A (en) | 2-alkyl-4(3h)-pteridinones | |
| CA1001835A (en) | Grouting composition | |
| CA1005770A (en) | Protease-containg composition | |
| CA1005059A (en) | Quinazoline compounds | |
| CA979730A (en) | Shortening composition | |
| AU475577B2 (en) | Stabilized methychloroform | |
| CA990880A (en) | Tar-urethane composition | |
| AU480794B2 (en) | Sulphur-based composition | |
| CA892529A (en) | Combination cleaning-coloring composition | |
| CA983399A (en) | Dental-prophylaxis composition | |
| AU469232B2 (en) | Composition | |
| AU469580B2 (en) | Dental-prophylaxis composition | |
| AU477652B2 (en) | Novel quinazoline compounds | |
| AU480356B2 (en) | Quinazoline compounds | |
| AU5920873A (en) | Sulphur-based composition | |
| CA911462A (en) | Stabilized chloramphenicol composition | |
| CA901314A (en) | Fertilizer composition | |
| AU5762573A (en) | New 2-amino-4(3h) pteridinones andthe preparation thereof |