ZA72165B - Substituted m-trifluormethylphenylurea derivatives - Google Patents
Substituted m-trifluormethylphenylurea derivativesInfo
- Publication number
- ZA72165B ZA72165B ZA720165A ZA72165A ZA72165B ZA 72165 B ZA72165 B ZA 72165B ZA 720165 A ZA720165 A ZA 720165A ZA 72165 A ZA72165 A ZA 72165A ZA 72165 B ZA72165 B ZA 72165B
- Authority
- ZA
- South Africa
- Prior art keywords
- trifluormethylphenylurea
- derivatives
- substituted
- trifluormethylphenylurea derivatives
- Prior art date
Links
- FQEIBEOBXKJAMZ-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]urea Chemical class NC(=O)NC1=CC=CC(C(F)(F)F)=C1 FQEIBEOBXKJAMZ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712101698 DE2101698A1 (de) | 1971-01-15 | 1971-01-15 | Substituierte m-Trifluormethylphenylharnstoffderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA72165B true ZA72165B (en) | 1972-10-25 |
Family
ID=5795929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA720165A ZA72165B (en) | 1971-01-15 | 1972-01-11 | Substituted m-trifluormethylphenylurea derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3847971A (member.php) |
| AT (1) | AT313633B (member.php) |
| BE (1) | BE778052A (member.php) |
| BR (1) | BR7200167D0 (member.php) |
| CA (1) | CA992982A (member.php) |
| CH (1) | CH561506A5 (member.php) |
| CS (1) | CS166795B2 (member.php) |
| DE (1) | DE2101698A1 (member.php) |
| FR (1) | FR2122248A5 (member.php) |
| GB (1) | GB1367968A (member.php) |
| HU (1) | HU163829B (member.php) |
| IL (1) | IL38504A (member.php) |
| IT (1) | IT949650B (member.php) |
| NL (1) | NL7118143A (member.php) |
| PL (1) | PL77353B1 (member.php) |
| SE (1) | SE367398B (member.php) |
| SU (1) | SU516331A3 (member.php) |
| ZA (1) | ZA72165B (member.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4046808A (en) * | 1972-08-24 | 1977-09-06 | American Cyanamid Company | (Alkenyloxy)-, (alkynyloxy) and (cyanoalkoxy) alkoxyphenyl ureas and their use as herbicides |
| DE2247310A1 (de) * | 1972-09-27 | 1974-04-04 | Bayer Ag | Tetrasubstituierte harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| US3978123A (en) * | 1973-07-12 | 1976-08-31 | Chevron Research Company | Herbicidal n-alkylsulfoxymethyl-and-n-alkylsulfonyl-methyl-n-aryl |
| US3916010A (en) * | 1973-08-03 | 1975-10-28 | Chevron Res | 1-Alkanoyloxy-haloethyl urea |
| PH13853A (en) * | 1975-01-13 | 1980-10-22 | Stauffer Chemical Co | Substituted thiomethylurea herbicides |
| US4227915A (en) * | 1978-05-18 | 1980-10-14 | Monsanto Company | N-Substituted oxobenzothiazoline and oxobenzoxazoline derivatives and their use as plant growth regulants |
-
1971
- 1971-01-15 DE DE19712101698 patent/DE2101698A1/de active Pending
- 1971-12-07 CH CH1782171A patent/CH561506A5/xx not_active IP Right Cessation
- 1971-12-29 CS CS9065A patent/CS166795B2/cs unknown
- 1971-12-30 NL NL7118143A patent/NL7118143A/xx unknown
-
1972
- 1972-01-04 IL IL38504A patent/IL38504A/xx unknown
- 1972-01-05 US US00215664A patent/US3847971A/en not_active Expired - Lifetime
- 1972-01-05 SE SE00109/72A patent/SE367398B/xx unknown
- 1972-01-11 ZA ZA720165A patent/ZA72165B/xx unknown
- 1972-01-12 BR BR167/72A patent/BR7200167D0/pt unknown
- 1972-01-14 IT IT47743/72A patent/IT949650B/it active
- 1972-01-14 SU SU1737763A patent/SU516331A3/ru active
- 1972-01-14 PL PL1972152914A patent/PL77353B1/pl unknown
- 1972-01-14 BE BE778052A patent/BE778052A/xx unknown
- 1972-01-14 GB GB178572A patent/GB1367968A/en not_active Expired
- 1972-01-14 HU HUBA2693A patent/HU163829B/hu unknown
- 1972-01-14 CA CA132,496A patent/CA992982A/en not_active Expired
- 1972-01-14 FR FR7201258A patent/FR2122248A5/fr not_active Expired
- 1972-01-14 AT AT31172A patent/AT313633B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT313633B (de) | 1974-02-25 |
| PL77353B1 (member.php) | 1975-04-30 |
| BE778052A (fr) | 1972-07-14 |
| FR2122248A5 (member.php) | 1972-08-25 |
| CH561506A5 (member.php) | 1975-05-15 |
| NL7118143A (member.php) | 1972-07-18 |
| SE367398B (member.php) | 1974-05-27 |
| SU516331A3 (ru) | 1976-05-30 |
| CS166795B2 (member.php) | 1976-03-29 |
| US3847971A (en) | 1974-11-12 |
| BR7200167D0 (pt) | 1973-06-26 |
| HU163829B (member.php) | 1973-11-28 |
| IL38504A (en) | 1974-11-29 |
| GB1367968A (en) | 1974-09-25 |
| CA992982A (en) | 1976-07-13 |
| DE2101698A1 (de) | 1972-09-07 |
| IL38504A0 (en) | 1972-03-28 |
| IT949650B (it) | 1973-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL38605A0 (en) | P-methane-carboxamide derivatives | |
| IE36079B1 (en) | Benzazine derivatives | |
| CY980A (en) | 3-substituted-morphinan derivatives | |
| KE2731A (en) | Oxidazolone derivatives | |
| ZA728312B (en) | Isiondoline derivatives | |
| ZA721446B (en) | Substituted 3-benzylpyridines | |
| IL39880A0 (en) | 2-nitro-5-imidazolaldehyde derivatives | |
| ZA721334B (en) | Novel imidazo-pyridine derivatives | |
| ZA721359B (en) | Substituted thiadiazolidine-diones | |
| IL38936A0 (en) | Lumilysergol derivatives | |
| ZA72165B (en) | Substituted m-trifluormethylphenylurea derivatives | |
| IL39336A0 (en) | Substituted 2-anilinobenzoxazoles | |
| GB1408201A (en) | Adenosine-5-carboxylate derivatives | |
| HK29777A (en) | Triazolyl-ethenyl-phenylene derivatives | |
| ZA722089B (en) | Substituted chlorocarbonylureas | |
| GB1402325A (en) | Dibenzoxirenoazepine derivatives | |
| IE37196L (en) | Diphenylpyrazolium derivatives | |
| IL39834A (en) | Beta-phenyl-beta-fluoroethane derivatives | |
| MY7900211A (en) | 2-aminomethylphenol derivatives | |
| ZA721356B (en) | Benzodiazane derivatives | |
| GB1401806A (en) | Methylene-dioxyquinazoline derivatives | |
| ZA722426B (en) | Novel aminophenylketone derivatives | |
| IL38799A0 (en) | Substituted phenylthiocarbamates | |
| IL39333A0 (en) | Substituted benzimidazolecarbamates | |
| IL39613A0 (en) | New dioxo-bicycloalkane derivatives |