CA992982A - Substituted m-trifluormethylphenylurea derivatives - Google Patents
Substituted m-trifluormethylphenylurea derivativesInfo
- Publication number
- CA992982A CA992982A CA132,496A CA132496A CA992982A CA 992982 A CA992982 A CA 992982A CA 132496 A CA132496 A CA 132496A CA 992982 A CA992982 A CA 992982A
- Authority
- CA
- Canada
- Prior art keywords
- trifluormethylphenylurea
- derivatives
- substituted
- trifluormethylphenylurea derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- FQEIBEOBXKJAMZ-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]urea Chemical class NC(=O)NC1=CC=CC(C(F)(F)F)=C1 FQEIBEOBXKJAMZ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712101698 DE2101698A1 (de) | 1971-01-15 | 1971-01-15 | Substituierte m-Trifluormethylphenylharnstoffderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA992982A true CA992982A (en) | 1976-07-13 |
Family
ID=5795929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA132,496A Expired CA992982A (en) | 1971-01-15 | 1972-01-14 | Substituted m-trifluormethylphenylurea derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3847971A (member.php) |
| AT (1) | AT313633B (member.php) |
| BE (1) | BE778052A (member.php) |
| BR (1) | BR7200167D0 (member.php) |
| CA (1) | CA992982A (member.php) |
| CH (1) | CH561506A5 (member.php) |
| CS (1) | CS166795B2 (member.php) |
| DE (1) | DE2101698A1 (member.php) |
| FR (1) | FR2122248A5 (member.php) |
| GB (1) | GB1367968A (member.php) |
| HU (1) | HU163829B (member.php) |
| IL (1) | IL38504A (member.php) |
| IT (1) | IT949650B (member.php) |
| NL (1) | NL7118143A (member.php) |
| PL (1) | PL77353B1 (member.php) |
| SE (1) | SE367398B (member.php) |
| SU (1) | SU516331A3 (member.php) |
| ZA (1) | ZA72165B (member.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4046808A (en) * | 1972-08-24 | 1977-09-06 | American Cyanamid Company | (Alkenyloxy)-, (alkynyloxy) and (cyanoalkoxy) alkoxyphenyl ureas and their use as herbicides |
| DE2247310A1 (de) * | 1972-09-27 | 1974-04-04 | Bayer Ag | Tetrasubstituierte harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| US3978123A (en) * | 1973-07-12 | 1976-08-31 | Chevron Research Company | Herbicidal n-alkylsulfoxymethyl-and-n-alkylsulfonyl-methyl-n-aryl |
| US3916010A (en) * | 1973-08-03 | 1975-10-28 | Chevron Res | 1-Alkanoyloxy-haloethyl urea |
| PH13853A (en) * | 1975-01-13 | 1980-10-22 | Stauffer Chemical Co | Substituted thiomethylurea herbicides |
| US4227915A (en) * | 1978-05-18 | 1980-10-14 | Monsanto Company | N-Substituted oxobenzothiazoline and oxobenzoxazoline derivatives and their use as plant growth regulants |
-
1971
- 1971-01-15 DE DE19712101698 patent/DE2101698A1/de active Pending
- 1971-12-07 CH CH1782171A patent/CH561506A5/xx not_active IP Right Cessation
- 1971-12-29 CS CS9065A patent/CS166795B2/cs unknown
- 1971-12-30 NL NL7118143A patent/NL7118143A/xx unknown
-
1972
- 1972-01-04 IL IL38504A patent/IL38504A/xx unknown
- 1972-01-05 SE SE00109/72A patent/SE367398B/xx unknown
- 1972-01-05 US US00215664A patent/US3847971A/en not_active Expired - Lifetime
- 1972-01-11 ZA ZA720165A patent/ZA72165B/xx unknown
- 1972-01-12 BR BR167/72A patent/BR7200167D0/pt unknown
- 1972-01-14 FR FR7201258A patent/FR2122248A5/fr not_active Expired
- 1972-01-14 BE BE778052A patent/BE778052A/xx unknown
- 1972-01-14 AT AT31172A patent/AT313633B/de not_active IP Right Cessation
- 1972-01-14 HU HUBA2693A patent/HU163829B/hu unknown
- 1972-01-14 CA CA132,496A patent/CA992982A/en not_active Expired
- 1972-01-14 SU SU1737763A patent/SU516331A3/ru active
- 1972-01-14 IT IT47743/72A patent/IT949650B/it active
- 1972-01-14 PL PL1972152914A patent/PL77353B1/pl unknown
- 1972-01-14 GB GB178572A patent/GB1367968A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL38504A0 (en) | 1972-03-28 |
| GB1367968A (en) | 1974-09-25 |
| IT949650B (it) | 1973-06-11 |
| US3847971A (en) | 1974-11-12 |
| CH561506A5 (member.php) | 1975-05-15 |
| IL38504A (en) | 1974-11-29 |
| CS166795B2 (member.php) | 1976-03-29 |
| DE2101698A1 (de) | 1972-09-07 |
| FR2122248A5 (member.php) | 1972-08-25 |
| BE778052A (fr) | 1972-07-14 |
| HU163829B (member.php) | 1973-11-28 |
| BR7200167D0 (pt) | 1973-06-26 |
| ZA72165B (en) | 1972-10-25 |
| SE367398B (member.php) | 1974-05-27 |
| NL7118143A (member.php) | 1972-07-18 |
| AT313633B (de) | 1974-02-25 |
| PL77353B1 (member.php) | 1975-04-30 |
| SU516331A3 (ru) | 1976-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU468250B2 (en) | 3-nitropyrazole derivatives | |
| AU462723B2 (en) | 2-nitro-5-imidazolyaldehyde derivatives | |
| AU461957B2 (en) | Lumilysergol derivatives | |
| CA992982A (en) | Substituted m-trifluormethylphenylurea derivatives | |
| CA1017335A (en) | Triazolyl-ethenyl-phenylene derivatives | |
| AU3845772A (en) | Dibenzocycloheptadioxolan derivatives | |
| AU470552B2 (en) | Aminocephalosporin derivatives | |
| AU472069B2 (en) | Dibenzoxirenazepine derivatives | |
| CA867769A (en) | Fluoracylamino-trichloromethyl-methane derivatives | |
| CA872805A (en) | 3-aryloxyalkylpiperidine derivatives | |
| AU458249B2 (en) | Tropan-3-ol derivatives | |
| CA872254A (en) | Indenopyridine derivatives | |
| CA919667A (en) | Carbonyldioxymorphinan derivatives | |
| AU463550B2 (en) | Nitrofurylpyrimidine derivatives | |
| CA872252A (en) | 4-substituted-benzocyclohepta-imidazole derivatives | |
| CA871723A (en) | Pyridyl-2-imidazolone derivatives | |
| CA871716A (en) | Norscopolamine derivatives | |
| CA869544A (en) | Thieno-benzothiazine derivatives | |
| CA868361A (en) | Thieno-benzothiazine derivatives | |
| CA883830A (en) | Dichloro-2-oxopolymethylenimines derivatives | |
| CA879103A (en) | 3-amino-propoxy-indole derivatives | |
| CA866804A (en) | Spiro-azatetramethylene derivatives | |
| CA863356A (en) | Indenopyridine derivatives | |
| CA862773A (en) | N-phenylsuccinimide derivatives | |
| CA862754A (en) | Benzothiazepin-4-one derivatives |