ZA717147B - 4-(4-(alpha-hydroxybenzyl)piperidino)-4'-fluorobutyrophenone derivatives - Google Patents
4-(4-(alpha-hydroxybenzyl)piperidino)-4'-fluorobutyrophenone derivativesInfo
- Publication number
- ZA717147B ZA717147B ZA717147A ZA717147A ZA717147B ZA 717147 B ZA717147 B ZA 717147B ZA 717147 A ZA717147 A ZA 717147A ZA 717147 A ZA717147 A ZA 717147A ZA 717147 B ZA717147 B ZA 717147B
- Authority
- ZA
- South Africa
- Prior art keywords
- fluorobutyrophenone
- hydroxybenzyl
- piperidino
- alpha
- derivatives
- Prior art date
Links
- INFXIXCWQPBBTA-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]butan-1-one Chemical class C=1C=CC=CC=1C(O)C(CC1)CCN1CCCC(=O)C1=CC=C(F)C=C1 INFXIXCWQPBBTA-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9349570A | 1970-11-27 | 1970-11-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA717147B true ZA717147B (en) | 1972-07-26 |
Family
ID=22239276
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA717147A ZA717147B (en) | 1970-11-27 | 1971-10-26 | 4-(4-(alpha-hydroxybenzyl)piperidino)-4'-fluorobutyrophenone derivatives |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5623985B2 (enFirst) |
| BE (1) | BE775593A (enFirst) |
| CA (1) | CA957376A (enFirst) |
| CH (1) | CH562215A5 (enFirst) |
| DE (1) | DE2158136C2 (enFirst) |
| DK (1) | DK135895B (enFirst) |
| ES (1) | ES397370A1 (enFirst) |
| FR (1) | FR2115451B1 (enFirst) |
| GB (1) | GB1314955A (enFirst) |
| IE (1) | IE35778B1 (enFirst) |
| IL (1) | IL38079A (enFirst) |
| NL (1) | NL175411C (enFirst) |
| NO (1) | NO135248C (enFirst) |
| PH (1) | PH9306A (enFirst) |
| SE (1) | SE369900B (enFirst) |
| ZA (1) | ZA717147B (enFirst) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE7409245L (enFirst) * | 1973-07-19 | 1975-01-20 | Robins Co Inc A H | |
| US4246268A (en) * | 1979-02-09 | 1981-01-20 | Richardson-Merrell Inc. | Neuroleptic-4-(naphthylmethyl)piperidine derivatives |
| IE49998B1 (en) * | 1979-08-06 | 1986-01-22 | Merrell Dow Pharma | 4-(naphthalenyloxy)piperidine derivatives |
| US4283404A (en) * | 1979-09-04 | 1981-08-11 | Richardson-Merrell Inc. | Aroylethenylpiperidinobutyrophenone antipsychotic agents |
| US4284636A (en) * | 1979-09-04 | 1981-08-18 | Richardson-Merrell Inc. | Cinnamoylpiperidinobutyrophenone antipsychotic agents |
| ZA806501B (en) * | 1979-10-27 | 1981-10-28 | Richardson Merrell Inc | 4-(4-alkyl-aroyl-1-piperidino)butyrophenone antipsychotic agents |
| US4783471A (en) * | 1985-07-02 | 1988-11-08 | Merrell Dow Pharmaceuticals Inc. | N-aralkyl piperidine methanol derivatives and the uses thereof |
| CA1280421C (en) * | 1985-07-02 | 1991-02-19 | Albert A. Carr | 1,4-disubstituted piperidinyl derivatives |
| IL117149A0 (en) * | 1995-02-23 | 1996-06-18 | Schering Corp | Muscarinic antagonists |
| BRPI0515275A (pt) * | 2004-09-13 | 2008-07-15 | Bayer Cropscience Ag | processos para a preparação de n-(arilmetil substituìdo)-4-(metil dissubstituìdo)piperidinas e intermediários |
-
1971
- 1971-10-26 ZA ZA717147A patent/ZA717147B/xx unknown
- 1971-10-27 IE IE1361/71A patent/IE35778B1/xx unknown
- 1971-10-27 GB GB4994271A patent/GB1314955A/en not_active Expired
- 1971-10-29 CA CA126,448A patent/CA957376A/en not_active Expired
- 1971-11-04 IL IL38079A patent/IL38079A/xx unknown
- 1971-11-16 PH PH13014*UA patent/PH9306A/en unknown
- 1971-11-17 CH CH1670071A patent/CH562215A5/xx not_active IP Right Cessation
- 1971-11-18 JP JP9200371A patent/JPS5623985B2/ja not_active Expired
- 1971-11-19 BE BE775593A patent/BE775593A/xx not_active IP Right Cessation
- 1971-11-24 NO NO4318/71A patent/NO135248C/no unknown
- 1971-11-24 SE SE15032/71A patent/SE369900B/xx unknown
- 1971-11-24 DE DE2158136A patent/DE2158136C2/de not_active Expired
- 1971-11-25 NL NLAANVRAGE7116194,A patent/NL175411C/xx not_active IP Right Cessation
- 1971-11-26 ES ES397370A patent/ES397370A1/es not_active Expired
- 1971-11-26 DK DK582171AA patent/DK135895B/da not_active IP Right Cessation
- 1971-11-26 FR FR7142529A patent/FR2115451B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7116194A (enFirst) | 1972-05-30 |
| GB1314955A (en) | 1973-04-26 |
| IE35778L (en) | 1972-05-27 |
| PH9306A (en) | 1975-08-18 |
| BE775593A (fr) | 1972-03-16 |
| NO135248B (enFirst) | 1976-11-29 |
| DK135895B (da) | 1977-07-11 |
| CA957376A (en) | 1974-11-05 |
| NO135248C (enFirst) | 1977-03-09 |
| SE369900B (enFirst) | 1974-09-23 |
| CH562215A5 (enFirst) | 1975-05-30 |
| DE2158136A1 (de) | 1972-05-31 |
| FR2115451B1 (enFirst) | 1975-02-07 |
| DK135895C (enFirst) | 1977-12-12 |
| JPS5623985B2 (enFirst) | 1981-06-03 |
| DE2158136C2 (de) | 1982-11-18 |
| NL175411B (nl) | 1984-06-01 |
| NL175411C (nl) | 1984-11-01 |
| IL38079A0 (en) | 1972-01-27 |
| FR2115451A1 (enFirst) | 1972-07-07 |
| ES397370A1 (es) | 1974-05-16 |
| IL38079A (en) | 1974-10-22 |
| IE35778B1 (en) | 1976-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA971968A (en) | 1-(1,3,4-thiadiazol-2-yl)-imidazolidinone-(2) derivatives | |
| IL37825A (en) | 1-phenyl-8-chloro-2,3,4-5-tetrahydro-1h-1,5-benzodiazepin-2-one derivatives | |
| MY7300309A (en) | 1,2,4 triazoles derivatives | |
| CA948207A (en) | 4-(2-pivaloyloxypropoxy)-2-methylindoles | |
| CA966841A (en) | 1-(1,3,4-thiadiazol-2-yl)-imidazolidinone-(2) derivatives | |
| IE35866B1 (en) | Pyrazole compounds | |
| ZA717147B (en) | 4-(4-(alpha-hydroxybenzyl)piperidino)-4'-fluorobutyrophenone derivatives | |
| AU3525471A (en) | Pyrazoline derivatives | |
| CA949560A (en) | Piperidine derivatives | |
| CA996565A (en) | 1-(sulphamoylaryl)-pyrrolidin-2-ones | |
| IE35162B1 (en) | Piperidine derivatives | |
| ZA716635B (en) | Choke unit | |
| ZA715156B (en) | Piperidine derivatives | |
| AU3387671A (en) | Thiazolone-%2< derivatives | |
| IL25028A (en) | 1-(3,4-dihydroxyphenyl)-2-hydroxyl-amino-propane and its derivatives | |
| ZA713032B (en) | Tetrahydropyridine derivatives | |
| CA983926A (en) | Triazole derivatives | |
| CA962384A (en) | Adoucisseur d'eau | |
| AU454886B2 (en) | 4- [4-(&- hydroxybenzyl) piperidino] - 4'-fluorobutyrophenone derivatives | |
| CA951318A (en) | '2-pyrrolidinone derivatives | |
| AU451515B2 (en) | 5 aminopyrazole derivatives | |
| AU3581371A (en) | 4- [4-(&- hydroxybenzyl) piperidino] - 4'-fluorobutyrophenone derivatives | |
| IL37063A (en) | 1,2,4-triazole derivatives | |
| ZA713111B (en) | Substituted carbamoyloxyphenylurea derivatives | |
| CA953176A (en) | Toilet bar |