ZA200404066B - 3,4-disubstituted, 3,5-disubstituted and 3,4,5-substituted piperidines and piperazines - Google Patents
3,4-disubstituted, 3,5-disubstituted and 3,4,5-substituted piperidines and piperazines Download PDFInfo
- Publication number
- ZA200404066B ZA200404066B ZA200404066A ZA200404066A ZA200404066B ZA 200404066 B ZA200404066 B ZA 200404066B ZA 200404066 A ZA200404066 A ZA 200404066A ZA 200404066 A ZA200404066 A ZA 200404066A ZA 200404066 B ZA200404066 B ZA 200404066B
- Authority
- ZA
- South Africa
- Prior art keywords
- alkyl
- alkoxy
- optionally substituted
- group
- chz
- Prior art date
Links
- 150000004885 piperazines Chemical class 0.000 title description 4
- 150000003053 piperidines Chemical class 0.000 title description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 643
- 150000001875 compounds Chemical class 0.000 claims description 182
- -1 1l-naphthyl Chemical group 0.000 claims description 131
- 125000003545 alkoxy group Chemical group 0.000 claims description 125
- 125000001424 substituent group Chemical group 0.000 claims description 119
- 229910052799 carbon Inorganic materials 0.000 claims description 102
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 96
- 208000024827 Alzheimer disease Diseases 0.000 claims description 62
- 125000003342 alkenyl group Chemical group 0.000 claims description 55
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 52
- 125000000304 alkynyl group Chemical group 0.000 claims description 51
- 201000010099 disease Diseases 0.000 claims description 50
- 238000000034 method Methods 0.000 claims description 49
- 206010012289 Dementia Diseases 0.000 claims description 38
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 35
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 27
- 238000011282 treatment Methods 0.000 claims description 26
- 150000002148 esters Chemical class 0.000 claims description 25
- 208000010877 cognitive disease Diseases 0.000 claims description 23
- 125000001072 heteroaryl group Chemical group 0.000 claims description 23
- 208000027061 mild cognitive impairment Diseases 0.000 claims description 23
- 125000003118 aryl group Chemical group 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 16
- 230000003412 degenerative effect Effects 0.000 claims description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 14
- 125000004568 thiomorpholinyl group Chemical group 0.000 claims description 14
- 201000010374 Down Syndrome Diseases 0.000 claims description 12
- 206010044688 Trisomy 21 Diseases 0.000 claims description 12
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 claims description 12
- 125000004193 piperazinyl group Chemical group 0.000 claims description 12
- 125000003386 piperidinyl group Chemical group 0.000 claims description 12
- 125000004076 pyridyl group Chemical group 0.000 claims description 12
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 12
- 125000001422 pyrrolinyl group Chemical group 0.000 claims description 12
- 208000005145 Cerebral amyloid angiopathy Diseases 0.000 claims description 11
- 229910052731 fluorine Inorganic materials 0.000 claims description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 125000002757 morpholinyl group Chemical group 0.000 claims description 11
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 10
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 claims description 10
- 210000004558 lewy body Anatomy 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 8
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000002883 imidazolyl group Chemical group 0.000 claims description 8
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 8
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 8
- 125000002971 oxazolyl group Chemical group 0.000 claims description 8
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 claims description 8
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 8
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 8
- 230000002792 vascular Effects 0.000 claims description 8
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 7
- 208000032843 Hemorrhage Diseases 0.000 claims description 7
- 208000018737 Parkinson disease Diseases 0.000 claims description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 7
- 230000001054 cortical effect Effects 0.000 claims description 7
- 230000007850 degeneration Effects 0.000 claims description 7
- 201000002212 progressive supranuclear palsy Diseases 0.000 claims description 7
- 230000000306 recurrent effect Effects 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 6
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 6
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 6
- 125000004600 benzothiopyranyl group Chemical group S1C(C=CC2=C1C=CC=C2)* 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000005046 dihydronaphthyl group Chemical group 0.000 claims description 6
- 125000002541 furyl group Chemical group 0.000 claims description 6
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 6
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 claims description 6
- 125000001041 indolyl group Chemical group 0.000 claims description 6
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 claims description 6
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 6
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 6
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 6
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 6
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 6
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 6
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 6
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 6
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 6
- 125000003107 substituted aryl group Chemical group 0.000 claims description 6
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 6
- 125000000335 thiazolyl group Chemical group 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000001425 triazolyl group Chemical group 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 5
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims description 4
- 208000018282 ACys amyloidosis Diseases 0.000 claims description 4
- 208000007487 Familial Cerebral Amyloid Angiopathy Diseases 0.000 claims description 4
- 208000032849 Hereditary cerebral hemorrhage with amyloidosis Diseases 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 claims description 4
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 claims description 4
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 claims description 4
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 4
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 claims description 4
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 claims description 4
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 claims description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- 125000005992 dihydrobenzisothiazinyl group Chemical group 0.000 claims description 4
- 125000005993 dihydrobenzisoxazinyl group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims description 4
- 125000005994 isobenzotetrahydrofuranyl group Chemical group 0.000 claims description 4
- 125000005995 isobenzotetrahydrothienyl group Chemical group 0.000 claims description 4
- 125000005990 isobenzothienyl group Chemical group 0.000 claims description 4
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 claims description 4
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 4
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 claims description 4
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 claims description 4
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 claims description 4
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 4
- 125000006413 ring segment Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 claims description 4
- 125000005958 tetrahydrothienyl group Chemical group 0.000 claims description 4
- 229930192474 thiophene Natural products 0.000 claims description 4
- 125000004306 triazinyl group Chemical group 0.000 claims description 4
- 125000004933 β-carbolinyl group Chemical group C1(=NC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 claims description 3
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 claims description 3
- 125000006288 3,5-difluorobenzyl group Chemical group [H]C1=C(F)C([H])=C(C([H])=C1F)C([H])([H])* 0.000 claims description 2
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 claims description 2
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 claims description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 150000005215 alkyl ethers Chemical class 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000004617 chromonyl group Chemical group O1C(=CC(C2=CC=CC=C12)=O)* 0.000 claims description 2
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 claims description 2
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 claims description 2
- 125000005052 dihydropyrazolyl group Chemical group N1(NCC=C1)* 0.000 claims description 2
- 125000005044 dihydroquinolinyl group Chemical group N1(CC=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000003151 isocoumarinyl group Chemical group C1(=O)OC(=CC2=CC=CC=C12)* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004620 quinolinyl-N-oxide group Chemical group 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 18
- NNJMFJSKMRYHSR-UHFFFAOYSA-N 4-phenylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=CC=C1 NNJMFJSKMRYHSR-UHFFFAOYSA-N 0.000 claims 3
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 claims 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 claims 3
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims 3
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 claims 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims 3
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims 2
- BGTWFLFIGDHQLW-UHFFFAOYSA-N naphthalene-1-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=C2C(C(=O)O)=CC=CC2=C1 BGTWFLFIGDHQLW-UHFFFAOYSA-N 0.000 claims 2
- XLBBQFVOBCYVAO-UHFFFAOYSA-N piperidin-3-yl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1CCCNC1 XLBBQFVOBCYVAO-UHFFFAOYSA-N 0.000 claims 2
- QQYNGKGFOZQMHD-UHFFFAOYSA-N (3-methoxyphenyl) acetate Chemical compound COC1=CC=CC(OC(C)=O)=C1 QQYNGKGFOZQMHD-UHFFFAOYSA-N 0.000 claims 1
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- GIVGMBPKVYSOKZ-UHFFFAOYSA-N 2-ethylhexanoic acid;hydrochloride Chemical compound Cl.CCCCC(CC)C(O)=O GIVGMBPKVYSOKZ-UHFFFAOYSA-N 0.000 claims 1
- RWFXDZIZBGXSNL-UHFFFAOYSA-N 2-methoxybenzoic acid;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C(O)=O RWFXDZIZBGXSNL-UHFFFAOYSA-N 0.000 claims 1
- JCGGLXLQYKVCJQ-UHFFFAOYSA-N 2-methylbenzoic acid;hydrochloride Chemical compound Cl.CC1=CC=CC=C1C(O)=O JCGGLXLQYKVCJQ-UHFFFAOYSA-N 0.000 claims 1
- DVPLHEDOLZCKHJ-UHFFFAOYSA-N 2-phenoxyacetic acid;hydrochloride Chemical compound Cl.OC(=O)COC1=CC=CC=C1 DVPLHEDOLZCKHJ-UHFFFAOYSA-N 0.000 claims 1
- RHOPUUFLVKWWFP-UHFFFAOYSA-N 2-phenylacetic acid;hydrochloride Chemical compound Cl.OC(=O)CC1=CC=CC=C1 RHOPUUFLVKWWFP-UHFFFAOYSA-N 0.000 claims 1
- ATDBEHGVBAPKRE-UHFFFAOYSA-N 3-(2-cyclohexylethoxy)-4-(furan-3-yl)piperidine Chemical compound C1NCCC(C2=COC=C2)C1OCCC1CCCCC1 ATDBEHGVBAPKRE-UHFFFAOYSA-N 0.000 claims 1
- FIUFLISGGHNPSM-UHFFFAOYSA-M 3-(4-methoxyphenyl)propanoate Chemical compound COC1=CC=C(CCC([O-])=O)C=C1 FIUFLISGGHNPSM-UHFFFAOYSA-M 0.000 claims 1
- FQXQBFUUVCDIRK-UHFFFAOYSA-M 3-(trifluoromethyl)benzoate Chemical compound [O-]C(=O)C1=CC=CC(C(F)(F)F)=C1 FQXQBFUUVCDIRK-UHFFFAOYSA-M 0.000 claims 1
- GURJTLNIHIJDTD-UHFFFAOYSA-N 3-benzyl-5-[(3,5-difluorophenyl)methoxy]piperidine;hydrochloride Chemical compound Cl.FC1=CC(F)=CC(COC2CC(CC=3C=CC=CC=3)CNC2)=C1 GURJTLNIHIJDTD-UHFFFAOYSA-N 0.000 claims 1
- OJTPAAHKZRTSMR-UHFFFAOYSA-N 3-benzyl-5-[(3-methylphenyl)methoxy]piperidine;hydrochloride Chemical compound Cl.CC1=CC=CC(COC2CC(CC=3C=CC=CC=3)CNC2)=C1 OJTPAAHKZRTSMR-UHFFFAOYSA-N 0.000 claims 1
- QCYSDQPAJYSSNZ-UHFFFAOYSA-N 3-benzyl-5-[[4-(trifluoromethyl)phenyl]methoxy]piperidine;hydrochloride Chemical compound Cl.C1=CC(C(F)(F)F)=CC=C1COC1CC(CC=2C=CC=CC=2)CNC1 QCYSDQPAJYSSNZ-UHFFFAOYSA-N 0.000 claims 1
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 claims 1
- LXWNTLBMNCXRQN-UHFFFAOYSA-N 4'-fluoro-1,1'-biphenyl-4-carboxylic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=C(F)C=C1 LXWNTLBMNCXRQN-UHFFFAOYSA-N 0.000 claims 1
- QUVFHVHLCFFINS-UHFFFAOYSA-N 4-(3-aminophenyl)benzoic acid Chemical compound NC1=CC=CC(C=2C=CC(=CC=2)C(O)=O)=C1 QUVFHVHLCFFINS-UHFFFAOYSA-N 0.000 claims 1
- SJIVTXJWSYIMDG-UHFFFAOYSA-N 4-(3-chlorophenyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=CC(Cl)=C1 SJIVTXJWSYIMDG-UHFFFAOYSA-N 0.000 claims 1
- RMDRPJICNOYAKA-UHFFFAOYSA-N 4-(furan-3-yl)-3-phenylmethoxypiperidine Chemical compound C=1C=CC=CC=1COC1CNCCC1C=1C=COC=1 RMDRPJICNOYAKA-UHFFFAOYSA-N 0.000 claims 1
- JJSAEPYHAATHJA-UHFFFAOYSA-N 4-iodobenzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=C(I)C=C1 JJSAEPYHAATHJA-UHFFFAOYSA-N 0.000 claims 1
- ZJARCXJVUWYDPB-UHFFFAOYSA-N 4-phenoxybenzoic acid;hydrochloride Chemical compound Cl.C1=CC(C(=O)O)=CC=C1OC1=CC=CC=C1 ZJARCXJVUWYDPB-UHFFFAOYSA-N 0.000 claims 1
- SRAWGZGWKCCCKW-UHFFFAOYSA-N 4-phenylbenzoic acid;hydrochloride Chemical compound Cl.C1=CC(C(=O)O)=CC=C1C1=CC=CC=C1 SRAWGZGWKCCCKW-UHFFFAOYSA-N 0.000 claims 1
- DZLGZIGLHCRIMF-UHFFFAOYSA-M 4-pyridin-4-ylbenzoate Chemical compound C1=CC(C(=O)[O-])=CC=C1C1=CC=NC=C1 DZLGZIGLHCRIMF-UHFFFAOYSA-M 0.000 claims 1
- PNLXQFOXOPGOGI-UHFFFAOYSA-N 4-tert-butylbenzoic acid;hydrochloride Chemical compound Cl.CC(C)(C)C1=CC=C(C(O)=O)C=C1 PNLXQFOXOPGOGI-UHFFFAOYSA-N 0.000 claims 1
- PTNWHEHDBNNKEO-UHFFFAOYSA-N 5-thiophen-2-ylthiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=CS1 PTNWHEHDBNNKEO-UHFFFAOYSA-N 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims 1
- RCBQTIDFCCOFBL-UHFFFAOYSA-N Cl.OC(=O)c1cccc(c1)-c1ccccc1 Chemical compound Cl.OC(=O)c1cccc(c1)-c1ccccc1 RCBQTIDFCCOFBL-UHFFFAOYSA-N 0.000 claims 1
- RENWPPCDYSOUFP-UHFFFAOYSA-N Cl.S1C(=CC=C1)C1=CC=C(C(=O)O)C=C1 Chemical compound Cl.S1C(=CC=C1)C1=CC=C(C(=O)O)C=C1 RENWPPCDYSOUFP-UHFFFAOYSA-N 0.000 claims 1
- 101100149256 Mus musculus Sema6b gene Proteins 0.000 claims 1
- 150000001204 N-oxides Chemical class 0.000 claims 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims 1
- 235000010582 Pisum sativum Nutrition 0.000 claims 1
- 240000004713 Pisum sativum Species 0.000 claims 1
- RRPFCEOETNGQTJ-PKTZIBPZSA-N [(3r,4r)-4-phenylpiperidin-3-yl] 4-phenylbenzoate Chemical compound C1([C@H]2CCNC[C@@H]2OC(=O)C=2C=CC(=CC=2)C=2C=CC=CC=2)=CC=CC=C1 RRPFCEOETNGQTJ-PKTZIBPZSA-N 0.000 claims 1
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 claims 1
- 125000000068 chlorophenyl group Chemical group 0.000 claims 1
- TXWRERCHRDBNLG-UHFFFAOYSA-N cubane Chemical compound C12C3C4C1C1C4C3C12 TXWRERCHRDBNLG-UHFFFAOYSA-N 0.000 claims 1
- 125000004212 difluorophenyl group Chemical group 0.000 claims 1
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 claims 1
- GPSDUZXPYCFOSQ-UHFFFAOYSA-M m-toluate Chemical compound CC1=CC=CC(C([O-])=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-M 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 1
- 150000002989 phenols Chemical class 0.000 claims 1
- UZEQRKHPZHDYRR-UHFFFAOYSA-N tert-butyl 3-(anthracen-9-ylmethoxy)-4-(furan-3-yl)piperidine-1-carboxylate Chemical compound C=12C=CC=CC2=CC2=CC=CC=C2C=1COC1CN(C(=O)OC(C)(C)C)CCC1C=1C=COC=1 UZEQRKHPZHDYRR-UHFFFAOYSA-N 0.000 claims 1
- CKDURKBNEJOOGV-UHFFFAOYSA-N tert-butyl 3-(cyclohexylmethoxy)-4-(furan-3-yl)piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C2=COC=C2)C1OCC1CCCCC1 CKDURKBNEJOOGV-UHFFFAOYSA-N 0.000 claims 1
- UOUFRTFWWBCVPV-UHFFFAOYSA-N tert-butyl 4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CC1)n1c(=O)[nH]c2ccsc2c1=O UOUFRTFWWBCVPV-UHFFFAOYSA-N 0.000 claims 1
- PIOSUACHAHKGBM-UHFFFAOYSA-N tert-butyl 4-(furan-3-yl)-3-(2-methylpropoxy)piperidine-1-carboxylate Chemical compound CC(C)COC1CN(C(=O)OC(C)(C)C)CCC1C1=COC=C1 PIOSUACHAHKGBM-UHFFFAOYSA-N 0.000 claims 1
- 125000004001 thioalkyl group Chemical group 0.000 claims 1
- 108010043324 Amyloid Precursor Protein Secretases Proteins 0.000 description 25
- 102000002659 Amyloid Precursor Protein Secretases Human genes 0.000 description 25
- 102100022704 Amyloid-beta precursor protein Human genes 0.000 description 21
- DZHSAHHDTRWUTF-SIQRNXPUSA-N amyloid-beta polypeptide 42 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)CC)C(C)C)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(C)C)C1=CC=CC=C1 DZHSAHHDTRWUTF-SIQRNXPUSA-N 0.000 description 21
- 101710137189 Amyloid-beta A4 protein Proteins 0.000 description 20
- 101710151993 Amyloid-beta precursor protein Proteins 0.000 description 20
- 101800001718 Amyloid-beta protein Proteins 0.000 description 18
- 230000002401 inhibitory effect Effects 0.000 description 18
- 108010090849 Amyloid beta-Peptides Proteins 0.000 description 17
- 102000013455 Amyloid beta-Peptides Human genes 0.000 description 17
- 210000004556 brain Anatomy 0.000 description 14
- 239000002552 dosage form Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 10
- 208000037259 Amyloid Plaque Diseases 0.000 description 9
- 241000282412 Homo Species 0.000 description 9
- 238000003776 cleavage reaction Methods 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 230000007017 scission Effects 0.000 description 8
- 206010008111 Cerebral haemorrhage Diseases 0.000 description 7
- 206010002022 amyloidosis Diseases 0.000 description 7
- 210000004027 cell Anatomy 0.000 description 7
- 239000003112 inhibitor Substances 0.000 description 7
- 102100033350 ATP-dependent translocase ABCB1 Human genes 0.000 description 6
- 101001017818 Homo sapiens ATP-dependent translocase ABCB1 Proteins 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- 206010059245 Angiopathy Diseases 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 230000002490 cerebral effect Effects 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 229940088598 enzyme Drugs 0.000 description 4
- 150000001413 amino acids Chemical class 0.000 description 3
- 230000036765 blood level Effects 0.000 description 3
- 230000001149 cognitive effect Effects 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 230000006735 deficit Effects 0.000 description 3
- 239000007943 implant Substances 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000035772 mutation Effects 0.000 description 3
- 210000002682 neurofibrillary tangle Anatomy 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 230000037361 pathway Effects 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- 239000007909 solid dosage form Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- 229940100578 Acetylcholinesterase inhibitor Drugs 0.000 description 2
- 208000031124 Dementia Alzheimer type Diseases 0.000 description 2
- UOACKFBJUYNSLK-XRKIENNPSA-N Estradiol Cypionate Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H](C4=CC=C(O)C=C4CC3)CC[C@@]21C)C(=O)CCC1CCCC1 UOACKFBJUYNSLK-XRKIENNPSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 2
- 230000019771 cognition Effects 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- XWAIAVWHZJNZQQ-UHFFFAOYSA-N donepezil hydrochloride Chemical compound [H+].[Cl-].O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 XWAIAVWHZJNZQQ-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003540 gamma secretase inhibitor Substances 0.000 description 2
- ZUFVXZVXEJHHBN-UHFFFAOYSA-N hydron;1,2,3,4-tetrahydroacridin-9-amine;chloride Chemical compound [Cl-].C1=CC=C2C([NH3+])=C(CCCC3)C3=NC2=C1 ZUFVXZVXEJHHBN-UHFFFAOYSA-N 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000007913 intrathecal administration Methods 0.000 description 2
- 230000003902 lesion Effects 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 208000015122 neurodegenerative disease Diseases 0.000 description 2
- 210000002569 neuron Anatomy 0.000 description 2
- 239000006201 parenteral dosage form Substances 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 230000000750 progressive effect Effects 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical class C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- 244000109331 Albuca major Species 0.000 description 1
- 208000000044 Amnesia Diseases 0.000 description 1
- 102000009091 Amyloidogenic Proteins Human genes 0.000 description 1
- 108010048112 Amyloidogenic Proteins Proteins 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 108010017640 Aspartic Acid Proteases Proteins 0.000 description 1
- 102000004580 Aspartic Acid Proteases Human genes 0.000 description 1
- 230000007351 Aβ plaque formation Effects 0.000 description 1
- 102100021257 Beta-secretase 1 Human genes 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 235000008247 Echinochloa frumentacea Nutrition 0.000 description 1
- 229940125373 Gamma-Secretase Inhibitor Drugs 0.000 description 1
- 229940121710 HMGCoA reductase inhibitor Drugs 0.000 description 1
- 101000823051 Homo sapiens Amyloid-beta precursor protein Proteins 0.000 description 1
- 101000894895 Homo sapiens Beta-secretase 1 Proteins 0.000 description 1
- 101000713575 Homo sapiens Tubulin beta-3 chain Proteins 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 208000009668 Neurobehavioral Manifestations Diseases 0.000 description 1
- 240000004072 Panicum sumatrense Species 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 108010033276 Peptide Fragments Proteins 0.000 description 1
- 102000007079 Peptide Fragments Human genes 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- 102100036790 Tubulin beta-3 chain Human genes 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000003942 amyloidogenic effect Effects 0.000 description 1
- 210000004102 animal cell Anatomy 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 229940039856 aricept Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000011888 autopsy Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 239000000544 cholinesterase inhibitor Substances 0.000 description 1
- 230000003920 cognitive function Effects 0.000 description 1
- 231100000870 cognitive problem Toxicity 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- ADEBPBSSDYVVLD-UHFFFAOYSA-N donepezil Natural products O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 ADEBPBSSDYVVLD-UHFFFAOYSA-N 0.000 description 1
- 229960003135 donepezil hydrochloride Drugs 0.000 description 1
- 239000002662 enteric coated tablet Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- KRNIZIYPWHDIOD-UHFFFAOYSA-N furan 1,2-oxazole Chemical compound O1N=CC=C1.O1C=CC=C1 KRNIZIYPWHDIOD-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000011813 knockout mouse model Methods 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 231100000863 loss of memory Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 206010027175 memory impairment Diseases 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 230000000508 neurotrophic effect Effects 0.000 description 1
- 239000003076 neurotropic agent Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- OIMWEHOYHJJPJD-UHFFFAOYSA-N pyridine;pyrimidine Chemical compound C1=CC=NC=C1.C1=CN=CN=C1 OIMWEHOYHJJPJD-UHFFFAOYSA-N 0.000 description 1
- 238000009790 rate-determining step (RDS) Methods 0.000 description 1
- 230000001953 sensory effect Effects 0.000 description 1
- 239000007892 solid unit dosage form Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 229960001685 tacrine Drugs 0.000 description 1
- 229960003565 tacrine hydrochloride Drugs 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US33270801P | 2001-11-19 | 2001-11-19 |
Publications (1)
Publication Number | Publication Date |
---|---|
ZA200404066B true ZA200404066B (en) | 2007-12-27 |
Family
ID=37390759
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
ZA200404066A ZA200404066B (en) | 2001-11-19 | 2004-05-25 | 3,4-disubstituted, 3,5-disubstituted and 3,4,5-substituted piperidines and piperazines |
Country Status (2)
Country | Link |
---|---|
CN (1) | CN1863530A (zh) |
ZA (1) | ZA200404066B (zh) |
Families Citing this family (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20110048491A (ko) * | 2008-07-28 | 2011-05-11 | 에자이 알앤드디 매니지먼트 가부시키가이샤 | 스피로아미노디하이드로티아진 유도체들 |
-
2002
- 2002-11-19 CN CN 02827271 patent/CN1863530A/zh active Pending
-
2004
- 2004-05-25 ZA ZA200404066A patent/ZA200404066B/en unknown
Also Published As
Publication number | Publication date |
---|---|
CN1863530A (zh) | 2006-11-15 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
AU2019264253B2 (en) | Factor XIIa inhibitors | |
EP2807160B1 (en) | Antifibrotic compounds and uses thereof | |
CA3094220A1 (en) | Factor xiia inhibitors | |
AU2002360403A1 (en) | (4-phenyl) piperidin-3-yl-phenylcarboxylate derivatives and related compounds as beta-secretase inhibitors for the treatment of Alzheimer's disease | |
JP2005504042A (ja) | γセクレターゼインヒビターのようなスルホンアミド誘導体 | |
WO2005070407A1 (en) | Methods of treatment of amyloidosis using aspartyl-protease inihibitors | |
US20060014737A1 (en) | Methods of treatment of amyloidosis using bi-aryl aspartyl protease inhibitors | |
CN101506198A (zh) | 取代的双环和三环凝血酶受体拮抗剂 | |
AU2006227199A1 (en) | Beta-lactamylalkanoic acids for treating premenstrual disorders | |
HU229864B1 (en) | Use of amide compounds for the preparation of medicaments | |
JP2005500319A (ja) | アルツハイマー病の治療に有用なβ−ヒドロキシアミン誘導体 | |
JP2005508940A (ja) | アルツハイマー病の治療に有用なアリルアミド | |
WO2021060453A1 (ja) | 架橋型光学活性2級アミン誘導体 | |
EP1127045B1 (en) | Triphenylbutene derivatives for the treatment of neurological disorders | |
EP2991963A2 (en) | Inhibitors of nhr2 and/or runx1/eto-tetramerization | |
WO1998037882A1 (en) | Method of using neurotrophic carbamates and ureas | |
BR112020016788A2 (pt) | Composto de anel de metil lactama e uso medicinal do mesmo | |
ZA200404066B (en) | 3,4-disubstituted, 3,5-disubstituted and 3,4,5-substituted piperidines and piperazines | |
CA3149916A1 (en) | Hybrid amide derivatives of amphotericin b | |
WO2004002483A1 (en) | Substituted 3- and 4- aminomethylpiperidines for use as beta-secretase in the treatment of alzheimer’s disease | |
JP2008543829A (ja) | セロトニン受容体アンタゴニストとしての1−[6−(1−エチル−1−ヒドロキシ−プロピル)−ピリジン−3−イル]−3−[2−(4−メチル−ピペラジン−1−イル)−ベンジル]−ピロリジン−2−オンの代謝産物 | |
US5124334A (en) | Benzylalcohol phospholipase A2 inhibitors | |
WO2006060192A2 (en) | Pyrazole derivatives | |
AU2020343585A1 (en) | Chronic kidney disease treatment or prevention method | |
EP3935057A1 (en) | Compounds for treating neurodegenerative diseases and cancers |