ZA200308669B - Oxalic acid derivatives. - Google Patents
Oxalic acid derivatives. Download PDFInfo
- Publication number
- ZA200308669B ZA200308669B ZA200308669A ZA200308669A ZA200308669B ZA 200308669 B ZA200308669 B ZA 200308669B ZA 200308669 A ZA200308669 A ZA 200308669A ZA 200308669 A ZA200308669 A ZA 200308669A ZA 200308669 B ZA200308669 B ZA 200308669B
- Authority
- ZA
- South Africa
- Prior art keywords
- phenyl
- isobutyl
- solvates
- acyl
- stereoisomers
- Prior art date
Links
- 150000002912 oxalic acid derivatives Chemical class 0.000 title description 2
- -1 COOA' Chemical group 0.000 claims description 112
- 150000001875 compounds Chemical class 0.000 claims description 72
- 150000003839 salts Chemical class 0.000 claims description 42
- 239000012453 solvate Substances 0.000 claims description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 26
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 20
- 125000002947 alkylene group Chemical group 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 108010074860 Factor Xa Proteins 0.000 claims description 16
- 150000003254 radicals Chemical class 0.000 claims description 16
- 238000011282 treatment Methods 0.000 claims description 15
- 206010028980 Neoplasm Diseases 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 12
- 208000007536 Thrombosis Diseases 0.000 claims description 11
- 239000003814 drug Substances 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 9
- 125000004434 sulfur atom Chemical group 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 8
- 125000002950 monocyclic group Chemical group 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 108010039209 Blood Coagulation Factors Proteins 0.000 claims description 6
- 102000015081 Blood Coagulation Factors Human genes 0.000 claims description 6
- 238000002399 angioplasty Methods 0.000 claims description 6
- 239000003114 blood coagulation factor Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 6
- 208000010125 myocardial infarction Diseases 0.000 claims description 6
- 206010002383 Angina Pectoris Diseases 0.000 claims description 5
- 206010003210 Arteriosclerosis Diseases 0.000 claims description 5
- 206010061218 Inflammation Diseases 0.000 claims description 5
- 206010022562 Intermittent claudication Diseases 0.000 claims description 5
- 206010027476 Metastases Diseases 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 208000011775 arteriosclerosis disease Diseases 0.000 claims description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 230000004054 inflammatory process Effects 0.000 claims description 5
- 239000003112 inhibitor Substances 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 230000014508 negative regulation of coagulation Effects 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000003386 piperidinyl group Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- 125000006239 protecting group Chemical group 0.000 claims description 5
- 208000037803 restenosis Diseases 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 208000019695 Migraine disease Diseases 0.000 claims description 4
- 235000010290 biphenyl Nutrition 0.000 claims description 4
- 239000004305 biphenyl Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 230000009401 metastasis Effects 0.000 claims description 4
- 206010027599 migraine Diseases 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000004450 alkenylene group Chemical group 0.000 claims description 3
- 125000004419 alkynylene group Chemical group 0.000 claims description 3
- 125000005047 dihydroimidazolyl group Chemical group N1(CNC=C1)* 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000002757 morpholinyl group Chemical group 0.000 claims description 3
- 125000004193 piperazinyl group Chemical group 0.000 claims description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 3
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical class O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 claims description 2
- 238000003797 solvolysis reaction Methods 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 14
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 claims 11
- 239000000203 mixture Substances 0.000 claims 11
- 238000004519 manufacturing process Methods 0.000 claims 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims 2
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 claims 2
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 239000005711 Benzoic acid Substances 0.000 claims 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical group CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims 1
- 150000001408 amides Chemical class 0.000 claims 1
- 235000010233 benzoic acid Nutrition 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- KUDHXGBCBMXELZ-UHFFFAOYSA-N n'-(3-carbamimidoylphenyl)-n'-(2-methylpropyl)-n-[4-(2-sulfamoylphenyl)phenyl]oxamide Chemical compound C=1C=CC(C(N)=N)=CC=1N(CC(C)C)C(=O)C(=O)NC(C=C1)=CC=C1C1=CC=CC=C1S(N)(=O)=O KUDHXGBCBMXELZ-UHFFFAOYSA-N 0.000 claims 1
- HUTDBTKDYVGFIG-UHFFFAOYSA-N n'-[(3-carbamimidoylphenyl)methyl]-n'-(2-methylpropyl)-n-[4-(2-oxopiperidin-1-yl)phenyl]oxamide Chemical compound C=1C=C(N2C(CCCC2)=O)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(N)=N)=C1 HUTDBTKDYVGFIG-UHFFFAOYSA-N 0.000 claims 1
- QPPKKDOFQZTICB-UHFFFAOYSA-N n'-[(3-carbamimidoylphenyl)methyl]-n'-(2-methylpropyl)-n-[4-(2-oxopyrrolidin-1-yl)phenyl]oxamide Chemical compound C=1C=C(N2C(CCC2)=O)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(N)=N)=C1 QPPKKDOFQZTICB-UHFFFAOYSA-N 0.000 claims 1
- MIIKKRDVWKBUNM-UHFFFAOYSA-N n'-[(3-carbamimidoylphenyl)methyl]-n-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-n'-(2,2,2-trifluoroethyl)oxamide Chemical compound CS(=O)(=O)C1=CC=CC=C1C(C=C1F)=CC=C1NC(=O)C(=O)N(CC(F)(F)F)CC1=CC=CC(C(N)=N)=C1 MIIKKRDVWKBUNM-UHFFFAOYSA-N 0.000 claims 1
- UHEAVKNGBLFYQV-UHFFFAOYSA-N n'-[(3-carbamimidoylphenyl)methyl]-n-[4-(2-methylsulfonylphenyl)phenyl]-n'-(2,2,2-trifluoroethyl)oxamide Chemical compound CS(=O)(=O)C1=CC=CC=C1C(C=C1)=CC=C1NC(=O)C(=O)N(CC(F)(F)F)CC1=CC=CC(C(N)=N)=C1 UHEAVKNGBLFYQV-UHFFFAOYSA-N 0.000 claims 1
- VGCUFWXLFFITQZ-UHFFFAOYSA-N n'-[(3-carbamimidoylphenyl)methyl]-n-[4-(2-sulfamoylphenyl)phenyl]-n'-(2,2,2-trifluoroethyl)oxamide Chemical compound NC(=N)C1=CC=CC(CN(CC(F)(F)F)C(=O)C(=O)NC=2C=CC(=CC=2)C=2C(=CC=CC=2)S(N)(=O)=O)=C1 VGCUFWXLFFITQZ-UHFFFAOYSA-N 0.000 claims 1
- CPPMDAOEDRVBAC-UHFFFAOYSA-N n'-[(3-carbamoylphenyl)methyl]-n'-(2-methylpropyl)-n-[4-(2-oxoazepan-1-yl)phenyl]oxamide Chemical compound C=1C=C(N2C(CCCCC2)=O)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(N)=O)=C1 CPPMDAOEDRVBAC-UHFFFAOYSA-N 0.000 claims 1
- HEJJPUJBOCVNFM-UHFFFAOYSA-N n'-[(3-carbamoylphenyl)methyl]-n'-(2-methylpropyl)-n-[4-(2-oxopiperidin-1-yl)phenyl]oxamide Chemical compound C=1C=C(N2C(CCCC2)=O)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(N)=O)=C1 HEJJPUJBOCVNFM-UHFFFAOYSA-N 0.000 claims 1
- QOXZAELFPSNRGE-UHFFFAOYSA-N n'-[(3-carbamoylphenyl)methyl]-n'-(2-methylpropyl)-n-[4-(2-oxopyrrolidin-1-yl)phenyl]oxamide Chemical compound C=1C=C(N2C(CCC2)=O)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(N)=O)=C1 QOXZAELFPSNRGE-UHFFFAOYSA-N 0.000 claims 1
- OEEAVXPBBVLUOG-UHFFFAOYSA-N n'-[[3-(aminomethyl)phenyl]methyl]-n'-(2-methylpropyl)-n-[4-(2-sulfamoylphenyl)phenyl]oxamide Chemical compound C=1C=C(C=2C(=CC=CC=2)S(N)(=O)=O)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(CN)=C1 OEEAVXPBBVLUOG-UHFFFAOYSA-N 0.000 claims 1
- CXSMNDVFQSUQKH-UHFFFAOYSA-N n'-[[3-(aminomethyl)phenyl]methyl]-n-[4-(2-oxoazepan-1-yl)phenyl]-n'-(2,2,2-trifluoroethyl)oxamide Chemical compound NCC1=CC=CC(CN(CC(F)(F)F)C(=O)C(=O)NC=2C=CC(=CC=2)N2C(CCCCC2)=O)=C1 CXSMNDVFQSUQKH-UHFFFAOYSA-N 0.000 claims 1
- LJHVWGBHPNGKSZ-UHFFFAOYSA-N n'-[[3-(aminomethyl)phenyl]methyl]-n-[4-(2-oxopiperidin-1-yl)phenyl]-n'-(2,2,2-trifluoroethyl)oxamide Chemical compound NCC1=CC=CC(CN(CC(F)(F)F)C(=O)C(=O)NC=2C=CC(=CC=2)N2C(CCCC2)=O)=C1 LJHVWGBHPNGKSZ-UHFFFAOYSA-N 0.000 claims 1
- GHESPBOUNNTLRX-UHFFFAOYSA-N n'-[[3-[(e)-n'-hydroxycarbamimidoyl]phenyl]methyl]-n'-(2-methylpropyl)-n-[4-(2-methylsulfonylphenyl)phenyl]oxamide Chemical compound C=1C=C(C=2C(=CC=CC=2)S(C)(=O)=O)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(=N)NO)=C1 GHESPBOUNNTLRX-UHFFFAOYSA-N 0.000 claims 1
- RBDLWHWGONUNOF-UHFFFAOYSA-N n-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-n'-[[3-[(z)-n'-hydroxycarbamimidoyl]phenyl]methyl]-n'-(2-methylpropyl)oxamide Chemical compound C=1C=C(C=2C(=CC=CC=2)S(C)(=O)=O)C=C(F)C=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(=N)NO)=C1 RBDLWHWGONUNOF-UHFFFAOYSA-N 0.000 claims 1
- QIHUYLMFQYMZGC-UHFFFAOYSA-N n-[4-[4-(aminomethyl)phenyl]phenyl]-n'-[(3-carbamimidoylphenyl)methyl]-n'-(2-methylpropyl)oxamide Chemical compound C=1C=C(C=2C=CC(CN)=CC=2)C=CC=1NC(=O)C(=O)N(CC(C)C)CC1=CC=CC(C(N)=N)=C1 QIHUYLMFQYMZGC-UHFFFAOYSA-N 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 230000005764 inhibitory process Effects 0.000 description 11
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 11
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 10
- 108090000190 Thrombin Proteins 0.000 description 9
- 229960004072 thrombin Drugs 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 8
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 8
- 239000003146 anticoagulant agent Substances 0.000 description 6
- 230000002785 anti-thrombosis Effects 0.000 description 5
- 229940127219 anticoagulant drug Drugs 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 230000009424 thromboembolic effect Effects 0.000 description 4
- 230000004913 activation Effects 0.000 description 3
- 230000023555 blood coagulation Effects 0.000 description 3
- 230000015271 coagulation Effects 0.000 description 3
- 238000005345 coagulation Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 108010014173 Factor X Proteins 0.000 description 2
- 102000009123 Fibrin Human genes 0.000 description 2
- 108010073385 Fibrin Proteins 0.000 description 2
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- 108010000499 Thromboplastin Proteins 0.000 description 2
- 102000002262 Thromboplastin Human genes 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000001772 blood platelet Anatomy 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 229950003499 fibrin Drugs 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical compound [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- 206010002388 Angina unstable Diseases 0.000 description 1
- 200000000007 Arterial disease Diseases 0.000 description 1
- 206010003178 Arterial thrombosis Diseases 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 208000021910 Cerebral Arterial disease Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 108010048049 Factor IXa Proteins 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 208000005764 Peripheral Arterial Disease Diseases 0.000 description 1
- 208000030831 Peripheral arterial occlusive disease Diseases 0.000 description 1
- 102000015795 Platelet Membrane Glycoproteins Human genes 0.000 description 1
- 108010010336 Platelet Membrane Glycoproteins Proteins 0.000 description 1
- 108010094028 Prothrombin Proteins 0.000 description 1
- 102100027378 Prothrombin Human genes 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- 206010038563 Reocclusion Diseases 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- 241001547816 Thrombus Species 0.000 description 1
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 1
- 108050006955 Tissue-type plasminogen activator Proteins 0.000 description 1
- 208000007814 Unstable Angina Diseases 0.000 description 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 1
- 206010047249 Venous thrombosis Diseases 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000002429 anti-coagulating effect Effects 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 230000003143 atherosclerotic effect Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000035602 clotting Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 239000003527 fibrinolytic agent Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001631 haemodialysis Methods 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 230000023597 hemostasis Effects 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 201000004332 intermediate coronary syndrome Diseases 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 238000002406 microsurgery Methods 0.000 description 1
- 230000004784 molecular pathogenesis Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 229940021317 other blood product in atc Drugs 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940039716 prothrombin Drugs 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003607 serino group Chemical class [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229960000103 thrombolytic agent Drugs 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- 229960005356 urokinase Drugs 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C257/00—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines
- C07C257/10—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. amidines
- C07C257/18—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. amidines having carbon atoms of amidino groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/45—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups at least one of the singly-bound nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfonamides
- C07C311/46—Y being a hydrogen or a carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
- C07D211/76—Oxygen atoms attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/06—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D223/08—Oxygen atoms
- C07D223/10—Oxygen atoms attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10117823A DE10117823A1 (de) | 2001-04-10 | 2001-04-10 | Oxalsäurederivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA200308669B true ZA200308669B (en) | 2005-02-07 |
Family
ID=7681049
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA200308669A ZA200308669B (en) | 2001-04-10 | 2003-11-06 | Oxalic acid derivatives. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US20040220411A1 (ru) |
| EP (1) | EP1377543A1 (ru) |
| CN (1) | CN1514823A (ru) |
| CA (1) | CA2445538A1 (ru) |
| CZ (1) | CZ20032935A3 (ru) |
| DE (1) | DE10117823A1 (ru) |
| HU (1) | HUP0303733A2 (ru) |
| MX (1) | MXPA03010205A (ru) |
| PL (1) | PL364901A1 (ru) |
| RU (1) | RU2003132539A (ru) |
| SK (1) | SK13382003A3 (ru) |
| WO (1) | WO2002083630A1 (ru) |
| ZA (1) | ZA200308669B (ru) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1558606A4 (en) * | 2002-10-02 | 2008-05-07 | Bristol Myers Squibb Co | DIAMINOALKYL CONTAINING LACTAM, BETA AMINO ACIDS, ALPHA AMINO ACIDS AND DERIVATIVES THEREOF AS FACTOR XA INHIBITORS |
| DE10302500A1 (de) * | 2003-01-23 | 2004-07-29 | Merck Patent Gmbh | Carbonsäureamidderivate |
| MXPA05010020A (es) * | 2003-03-24 | 2005-11-17 | Merck Patent Gmbh | Derivados de oxamida. |
| BRPI0413324A (pt) | 2003-08-06 | 2006-10-10 | Senomyx Inc | receptores de paladar hetero-oligoméricos t1r, linhas de células que expressam os ditos receptores, e compostos de paladar |
| AU2005216649B2 (en) * | 2004-02-27 | 2010-09-09 | Merck Serono Sa | Use of methylene amide derivatives in cardiovascular disorders |
| WO2006089954A2 (en) * | 2005-02-24 | 2006-08-31 | Novo Nordisk Health Care Ag | Compounds for stabilizing factor vii polypeptide formulations |
| US7662824B2 (en) | 2005-03-18 | 2010-02-16 | Janssen Pharmaceutica Nv | Acylhydrazones as kinase modulators |
| AU2008274655A1 (en) | 2007-07-10 | 2009-01-15 | Sanofi-Aventis | Malonamide derivatives with antithrombotic activity |
| CA2776242C (en) | 2009-10-08 | 2014-09-02 | Sanofi | Phenyloxadiazole derivatives as pgds inhibitors |
| WO2021110076A1 (zh) * | 2019-12-04 | 2021-06-10 | 深圳信立泰药业股份有限公司 | 草酰胺类衍生物、其制备方法及其在医药上的应用 |
| CN112079747B (zh) * | 2020-10-20 | 2022-08-16 | 浙江工业大学 | 一种n-苄氧基取代的对称草酰胺类化合物及其制备方法和应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2382751A1 (en) * | 1999-05-24 | 2000-11-30 | Cor Therapeutics, Inc. | Inhibitors of factor xa |
-
2001
- 2001-04-10 DE DE10117823A patent/DE10117823A1/de not_active Withdrawn
-
2002
- 2002-03-18 RU RU2003132539/04A patent/RU2003132539A/ru not_active Application Discontinuation
- 2002-03-18 PL PL02364901A patent/PL364901A1/xx unknown
- 2002-03-18 CA CA002445538A patent/CA2445538A1/en not_active Abandoned
- 2002-03-18 CZ CZ20032935A patent/CZ20032935A3/cs unknown
- 2002-03-18 EP EP02761892A patent/EP1377543A1/en not_active Withdrawn
- 2002-03-18 MX MXPA03010205A patent/MXPA03010205A/es not_active Application Discontinuation
- 2002-03-18 WO PCT/EP2002/002963 patent/WO2002083630A1/en not_active Application Discontinuation
- 2002-03-18 US US10/474,969 patent/US20040220411A1/en not_active Abandoned
- 2002-03-18 HU HU0303733A patent/HUP0303733A2/hu unknown
- 2002-03-18 SK SK1338-2003A patent/SK13382003A3/sk unknown
- 2002-03-18 CN CNA028116054A patent/CN1514823A/zh active Pending
-
2003
- 2003-11-06 ZA ZA200308669A patent/ZA200308669B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CZ20032935A3 (cs) | 2004-01-14 |
| HUP0303733A2 (hu) | 2004-03-01 |
| DE10117823A1 (de) | 2002-10-17 |
| SK13382003A3 (sk) | 2004-03-02 |
| RU2003132539A (ru) | 2005-04-20 |
| CA2445538A1 (en) | 2002-10-24 |
| WO2002083630A1 (en) | 2002-10-24 |
| PL364901A1 (en) | 2004-12-27 |
| MXPA03010205A (es) | 2004-03-10 |
| EP1377543A1 (en) | 2004-01-07 |
| US20040220411A1 (en) | 2004-11-04 |
| CN1514823A (zh) | 2004-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7273867B2 (en) | Phenyl derivatives | |
| ZA200305455B (en) | Carboxylic acid amide derivatives and their use in the treatment of thromboembolic diseases and tumours. | |
| AU2002227993A1 (en) | Phenyl derivatives | |
| ZA200308028B (en) | Phenyl derivatives 3. | |
| ZA200308669B (en) | Oxalic acid derivatives. | |
| US20050203127A1 (en) | 2-(Phenyl)-2h-pyrazole-3-carboxylic acid-n-4-(thioxo-heterocyclyl)-phenyl-amide derivatives and corresponding imino-heterocyclyl derivatives and relates compounds for use as inhibitors of the coagulation factors xa and/or viia for treating thromboses | |
| ZA200506730B (en) | Carboxamide derivatives and their use as factor XA inhibitors | |
| US7199133B2 (en) | Derivatives of phenoxy-n-′4-(isothiazolindin-1, 1-dioxid-2yl)phenyll-valerian-acid amide and other compounds as inhibitors of the coagulation factor xa in the treatment of thromboembolic diseases and tumors | |
| ZA200308060B (en) | Biurethane derivatives. | |
| US7902223B2 (en) | Phenyl derivatives as factor XA inhibitors | |
| US20050176760A1 (en) | N-'4-(2-imino-pyrrolidin-1-yl)phenyl!-acetamide and corresponding piperidine derivatives as factor xa inhibitors for the treatment of thrombo-embolic diseases | |
| US20030176465A1 (en) | Cyclic amino acid derivatives | |
| ZA200301471B (en) | N-substituted 1-amino-1,1-dialkylcarboxylic acid derivatives. | |
| US20040092517A1 (en) | Phenyl derivatives and their use in the treatment of thromboembolic disorders or tumours | |
| ZA200407903B (en) | Semicarbazide derivatives and their use as antithrombotics. | |
| AU2002250878A1 (en) | Phenyl derivatives and their use in the treatment of thromboembolic disorders or tumours | |
| US20030187037A1 (en) | Acetamide derivatives and the use thereof as inhibitors of coagulation factors xa and viia | |
| US20030171579A1 (en) | Urethane derivatives | |
| ZA200400486B (en) | Carbohydrate derivatives. | |
| AU2002308166A1 (en) | Oxalic acid derivatives |