WO2005073180A1 - ヒドロキサム酸誘導体、及び該誘導体を含むage生成阻害剤 - Google Patents
ヒドロキサム酸誘導体、及び該誘導体を含むage生成阻害剤 Download PDFInfo
- Publication number
- WO2005073180A1 WO2005073180A1 PCT/JP2004/019512 JP2004019512W WO2005073180A1 WO 2005073180 A1 WO2005073180 A1 WO 2005073180A1 JP 2004019512 W JP2004019512 W JP 2004019512W WO 2005073180 A1 WO2005073180 A1 WO 2005073180A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- group
- single bond
- hydrogen atom
- ethylene
- alkylene
- Prior art date
Links
- 239000003112 inhibitor Substances 0.000 title claims abstract description 21
- 239000002253 acid Substances 0.000 title description 69
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 title description 30
- 150000001875 compounds Chemical class 0.000 claims abstract description 578
- 239000000203 mixture Substances 0.000 claims abstract description 161
- 150000003839 salts Chemical class 0.000 claims abstract description 62
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 343
- 230000015572 biosynthetic process Effects 0.000 claims description 225
- 239000005977 Ethylene Substances 0.000 claims description 159
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 158
- -1 pyridine-2-yl group Chemical group 0.000 claims description 155
- 238000004519 manufacturing process Methods 0.000 claims description 103
- 125000000217 alkyl group Chemical group 0.000 claims description 89
- 125000004432 carbon atom Chemical group C* 0.000 claims description 87
- 125000002947 alkylene group Chemical group 0.000 claims description 84
- 125000003118 aryl group Chemical group 0.000 claims description 75
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 58
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 claims description 58
- 125000001072 heteroaryl group Chemical group 0.000 claims description 58
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 50
- 125000000623 heterocyclic group Chemical group 0.000 claims description 41
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 38
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 34
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 32
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 27
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 23
- 150000003254 radicals Chemical class 0.000 claims description 20
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 19
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 19
- 229910052799 carbon Inorganic materials 0.000 claims description 18
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 17
- 125000003342 alkenyl group Chemical group 0.000 claims description 15
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 150000001768 cations Chemical class 0.000 claims description 14
- 239000002537 cosmetic Substances 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical group CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 claims description 8
- 125000006491 4-t-butyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- 239000003814 drug Chemical group 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical group FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 claims description 4
- 150000001923 cyclic compounds Chemical class 0.000 claims description 4
- 125000001207 fluorophenyl group Chemical group 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 125000006178 methyl benzyl group Chemical group 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 239000006187 pill Substances 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- XBNGYFFABRKICK-UHFFFAOYSA-N 2,3,4,5,6-pentafluorophenol Chemical group OC1=C(F)C(F)=C(F)C(F)=C1F XBNGYFFABRKICK-UHFFFAOYSA-N 0.000 claims description 2
- ZOQOPXVJANRGJZ-UHFFFAOYSA-N 2-(trifluoromethyl)phenol Chemical group OC1=CC=CC=C1C(F)(F)F ZOQOPXVJANRGJZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 claims description 2
- WJQOZHYUIDYNHM-UHFFFAOYSA-N 2-tert-Butylphenol Chemical group CC(C)(C)C1=CC=CC=C1O WJQOZHYUIDYNHM-UHFFFAOYSA-N 0.000 claims description 2
- DUGOZIWVEXMGBE-UHFFFAOYSA-N Methylphenidate Chemical compound C=1C=CC=CC=1C(C(=O)OC)C1CCCCN1 DUGOZIWVEXMGBE-UHFFFAOYSA-N 0.000 claims description 2
- 108010021119 Trichosanthin Proteins 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000004175 fluorobenzyl group Chemical group 0.000 claims description 2
- 235000013373 food additive Nutrition 0.000 claims description 2
- 239000002778 food additive Substances 0.000 claims description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 125000004035 thiopropyl group Chemical group [H]SC([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004360 trifluorophenyl group Chemical group 0.000 claims description 2
- CHZCERSEMVWNHL-UHFFFAOYSA-N 2-hydroxybenzonitrile Chemical group OC1=CC=CC=C1C#N CHZCERSEMVWNHL-UHFFFAOYSA-N 0.000 claims 1
- OKTJSMMVPCPJKN-IGMARMGPSA-N Carbon-12 Chemical group [12C] OKTJSMMVPCPJKN-IGMARMGPSA-N 0.000 claims 1
- 101100033673 Mus musculus Ren1 gene Proteins 0.000 claims 1
- 239000000490 cosmetic additive Substances 0.000 claims 1
- 125000004212 difluorophenyl group Chemical group 0.000 claims 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- 239000000654 additive Substances 0.000 abstract description 9
- 230000000996 additive effect Effects 0.000 abstract description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 333
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 331
- 238000006243 chemical reaction Methods 0.000 description 244
- 238000003786 synthesis reaction Methods 0.000 description 207
- 239000002904 solvent Substances 0.000 description 185
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 184
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 177
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 162
- 239000000243 solution Substances 0.000 description 161
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 154
- XEKOWRVHYACXOJ-UHFFFAOYSA-N ethyl acetate Substances CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 151
- 239000007787 solid Substances 0.000 description 148
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 114
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 108
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 93
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 89
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 89
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 84
- 239000011347 resin Substances 0.000 description 79
- 229920005989 resin Polymers 0.000 description 79
- 238000010898 silica gel chromatography Methods 0.000 description 71
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 69
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 58
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 57
- 238000000034 method Methods 0.000 description 48
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 46
- 238000001914 filtration Methods 0.000 description 46
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- 239000007864 aqueous solution Substances 0.000 description 42
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 41
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- 230000008569 process Effects 0.000 description 40
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 38
- 239000012153 distilled water Substances 0.000 description 35
- 125000006239 protecting group Chemical group 0.000 description 35
- 238000003756 stirring Methods 0.000 description 35
- 239000003960 organic solvent Substances 0.000 description 33
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 32
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 31
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 30
- 239000010410 layer Substances 0.000 description 30
- 239000012044 organic layer Substances 0.000 description 30
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 28
- 238000005481 NMR spectroscopy Methods 0.000 description 28
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 27
- 239000003054 catalyst Substances 0.000 description 27
- 239000012298 atmosphere Substances 0.000 description 26
- 238000010586 diagram Methods 0.000 description 25
- 229910052739 hydrogen Inorganic materials 0.000 description 25
- 239000002585 base Substances 0.000 description 24
- 239000001257 hydrogen Substances 0.000 description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 23
- 238000001044 reversed-phase solid-phase extraction Methods 0.000 description 22
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 21
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 21
- 239000012312 sodium hydride Substances 0.000 description 21
- 229910000104 sodium hydride Inorganic materials 0.000 description 21
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 19
- 239000006260 foam Substances 0.000 description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- 239000003795 chemical substances by application Substances 0.000 description 18
- 238000001035 drying Methods 0.000 description 18
- 102000004169 proteins and genes Human genes 0.000 description 18
- 108090000623 proteins and genes Proteins 0.000 description 18
- ZXKINMCYCKHYFR-UHFFFAOYSA-N aminooxidanide Chemical compound [O-]N ZXKINMCYCKHYFR-UHFFFAOYSA-N 0.000 description 17
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 17
- 201000010099 disease Diseases 0.000 description 17
- 238000005406 washing Methods 0.000 description 17
- 238000005160 1H NMR spectroscopy Methods 0.000 description 16
- 239000007788 liquid Substances 0.000 description 15
- 230000002829 reductive effect Effects 0.000 description 14
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 14
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 13
- 230000002401 inhibitory effect Effects 0.000 description 13
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 125000003710 aryl alkyl group Chemical group 0.000 description 12
- NVSYANRBXPURRQ-UHFFFAOYSA-N naphthalen-1-ylmethanamine Chemical compound C1=CC=C2C(CN)=CC=CC2=C1 NVSYANRBXPURRQ-UHFFFAOYSA-N 0.000 description 12
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 12
- 229940024606 amino acid Drugs 0.000 description 11
- 150000001413 amino acids Chemical class 0.000 description 11
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 11
- 239000008194 pharmaceutical composition Substances 0.000 description 11
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 11
- 230000000875 corresponding effect Effects 0.000 description 10
- 206010012601 diabetes mellitus Diseases 0.000 description 10
- 235000013305 food Nutrition 0.000 description 10
- 229910052698 phosphorus Inorganic materials 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 9
- 229910000024 caesium carbonate Inorganic materials 0.000 description 9
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 9
- 239000012279 sodium borohydride Substances 0.000 description 9
- 229910000033 sodium borohydride Inorganic materials 0.000 description 9
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 9
- JFLSOKIMYBSASW-UHFFFAOYSA-N 1-chloro-2-[chloro(diphenyl)methyl]benzene Chemical compound ClC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 JFLSOKIMYBSASW-UHFFFAOYSA-N 0.000 description 8
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 8
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 8
- 230000009471 action Effects 0.000 description 8
- 150000001299 aldehydes Chemical class 0.000 description 8
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 8
- 238000003776 cleavage reaction Methods 0.000 description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- 229910052763 palladium Inorganic materials 0.000 description 8
- 230000007017 scission Effects 0.000 description 8
- 229920002472 Starch Polymers 0.000 description 7
- DIYMOBFUCJGKFJ-UHFFFAOYSA-N butane;hydroiodide Chemical compound I.CCCC DIYMOBFUCJGKFJ-UHFFFAOYSA-N 0.000 description 7
- KVFDZFBHBWTVID-UHFFFAOYSA-N cyclohexanecarbaldehyde Chemical compound O=CC1CCCCC1 KVFDZFBHBWTVID-UHFFFAOYSA-N 0.000 description 7
- 238000000502 dialysis Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 229940080818 propionamide Drugs 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000007790 solid phase Substances 0.000 description 7
- 239000008107 starch Substances 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- OTXINXDGSUFPNU-UHFFFAOYSA-N 4-tert-butylbenzaldehyde Chemical compound CC(C)(C)C1=CC=C(C=O)C=C1 OTXINXDGSUFPNU-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 108010005094 Advanced Glycation End Products Proteins 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 208000002177 Cataract Diseases 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 150000001721 carbon Chemical group 0.000 description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N pentanal Chemical compound CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- 235000003332 Ilex aquifolium Nutrition 0.000 description 5
- 241000209027 Ilex aquifolium Species 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 208000011775 arteriosclerosis disease Diseases 0.000 description 5
- 239000012752 auxiliary agent Substances 0.000 description 5
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 5
- 238000010511 deprotection reaction Methods 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- 210000003734 kidney Anatomy 0.000 description 5
- 210000002540 macrophage Anatomy 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 235000000346 sugar Nutrition 0.000 description 5
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 5
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 4
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 4
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 4
- 206010003210 Arteriosclerosis Diseases 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 208000002249 Diabetes Complications Diseases 0.000 description 4
- 206010012655 Diabetic complications Diseases 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000004472 Lysine Substances 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- CMWYAOXYQATXSI-UHFFFAOYSA-N n,n-dimethylformamide;piperidine Chemical compound CN(C)C=O.C1CCNCC1 CMWYAOXYQATXSI-UHFFFAOYSA-N 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 208000024891 symptom Diseases 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- 210000003556 vascular endothelial cell Anatomy 0.000 description 4
- FELYNDXDCAMDIB-SFHVURJKSA-N (2s)-2-(cyclohexylmethylamino)-n-hydroxy-4-(1-propylbenzimidazol-2-yl)butanamide Chemical compound N([C@@H](CCC=1N(C2=CC=CC=C2N=1)CCC)C(=O)NO)CC1CCCCC1 FELYNDXDCAMDIB-SFHVURJKSA-N 0.000 description 3
- DCLDGCLWTMRNQY-INIZCTEOSA-N (2s)-2-amino-3-[4-[(4-cyanophenyl)methoxy]phenyl]-n-hydroxypropanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCC1=CC=C(C#N)C=C1 DCLDGCLWTMRNQY-INIZCTEOSA-N 0.000 description 3
- ZPFMPSXRRNKJKF-LBPRGKRZSA-N (2s)-2-amino-4-(5,6-dichloro-1-pentylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound ClC1=C(Cl)C=C2N(CCCCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 ZPFMPSXRRNKJKF-LBPRGKRZSA-N 0.000 description 3
- BFRVIOVMALWWAV-JTQLQIEISA-N (2s)-2-amino-4-(5,6-dichloro-1-propylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound ClC1=C(Cl)C=C2N(CCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 BFRVIOVMALWWAV-JTQLQIEISA-N 0.000 description 3
- QCMPZVPZBYTCQJ-AWEZNQCLSA-N (2s)-2-amino-4-[1-(cyclohexylmethyl)benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound ONC(=O)[C@@H](N)CCC1=NC2=CC=CC=C2N1CC1CCCCC1 QCMPZVPZBYTCQJ-AWEZNQCLSA-N 0.000 description 3
- BWFYNKPTBBZODG-HNNXBMFYSA-N (2s)-2-amino-n-hydroxy-4-(1-octylbenzimidazol-2-yl)butanamide Chemical compound C1=CC=C2N(CCCCCCCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 BWFYNKPTBBZODG-HNNXBMFYSA-N 0.000 description 3
- WQFCMLCADJVMFB-KRWDZBQOSA-N (2s)-n-hydroxy-4-(1-methylbenzimidazol-2-yl)-2-(octylamino)butanamide Chemical compound C1=CC=C2N(C)C(CC[C@H](NCCCCCCCC)C(=O)NO)=NC2=C1 WQFCMLCADJVMFB-KRWDZBQOSA-N 0.000 description 3
- SACXSJNKZNDEBI-LBPRGKRZSA-N (2s)-n-hydroxy-4-(1-methylbenzimidazol-2-yl)-2-(propylamino)butanamide Chemical compound C1=CC=C2N(C)C(CC[C@H](NCCC)C(=O)NO)=NC2=C1 SACXSJNKZNDEBI-LBPRGKRZSA-N 0.000 description 3
- SNHKEQOYVVRBQO-UHFFFAOYSA-N 1,3-benzodioxole-5,6-diamine Chemical compound C1=C(N)C(N)=CC2=C1OCO2 SNHKEQOYVVRBQO-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- 208000024827 Alzheimer disease Diseases 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- 102000005622 Receptor for Advanced Glycation End Products Human genes 0.000 description 3
- 108010045108 Receptor for Advanced Glycation End Products Proteins 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- 125000003172 aldehyde group Chemical group 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 208000026106 cerebrovascular disease Diseases 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 208000029078 coronary artery disease Diseases 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 206010013781 dry mouth Diseases 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- ZMJLZDJLNRHSSQ-UHFFFAOYSA-N n-hydroxypentanamide Chemical compound CCCCC(=O)NO ZMJLZDJLNRHSSQ-UHFFFAOYSA-N 0.000 description 3
- 238000002414 normal-phase solid-phase extraction Methods 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000003642 reactive oxygen metabolite Substances 0.000 description 3
- 235000021067 refined food Nutrition 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- VMYONVRDGNYLMG-INIZCTEOSA-N (2s)-2-(cyclohexylmethylamino)-n-hydroxy-4-(1-methylbenzimidazol-2-yl)butanamide Chemical compound N([C@@H](CCC=1N(C2=CC=CC=C2N=1)C)C(=O)NO)CC1CCCCC1 VMYONVRDGNYLMG-INIZCTEOSA-N 0.000 description 2
- NEUCJQSTMITBGC-QMMMGPOBSA-N (2s)-2-amino-3-(4-aminophenyl)-n-hydroxypropanamide Chemical compound ONC(=O)[C@@H](N)CC1=CC=C(N)C=C1 NEUCJQSTMITBGC-QMMMGPOBSA-N 0.000 description 2
- FJQQOCALHBORAI-HNNXBMFYSA-N (2s)-2-amino-3-[4-[(2,4-difluorophenyl)methoxy]phenyl]-n-hydroxypropanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCC1=CC=C(F)C=C1F FJQQOCALHBORAI-HNNXBMFYSA-N 0.000 description 2
- QECJAPIZCKUKCJ-HNNXBMFYSA-N (2s)-2-amino-4-(1-cyclohexyl-5,6-dimethylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound C1=2C=C(C)C(C)=CC=2N=C(CC[C@H](N)C(=O)NO)N1C1CCCCC1 QECJAPIZCKUKCJ-HNNXBMFYSA-N 0.000 description 2
- XMWLNKUHEQSVLC-LBPRGKRZSA-N (2s)-2-amino-4-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound CC1=C(C)C=C2N(CCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 XMWLNKUHEQSVLC-LBPRGKRZSA-N 0.000 description 2
- JUFQLKPMCJCCMB-AWEZNQCLSA-N (2s)-2-amino-5-(dipentylamino)-n-hydroxypentanamide Chemical compound CCCCCN(CCCCC)CCC[C@H](N)C(=O)NO JUFQLKPMCJCCMB-AWEZNQCLSA-N 0.000 description 2
- VAVBEYFGTHXLEK-JTQLQIEISA-N (2s)-2-amino-5-(dipropylamino)-n-hydroxypentanamide Chemical compound CCCN(CCC)CCC[C@H](N)C(=O)NO VAVBEYFGTHXLEK-JTQLQIEISA-N 0.000 description 2
- FLHHQIMONZVQJE-FQEVSTJZSA-N (2s)-2-amino-5-[bis[(4-methylphenyl)methyl]amino]-n-hydroxypentanamide Chemical compound C1=CC(C)=CC=C1CN(CCC[C@H](N)C(=O)NO)CC1=CC=C(C)C=C1 FLHHQIMONZVQJE-FQEVSTJZSA-N 0.000 description 2
- WIKCHKNYPHCKKG-AWEZNQCLSA-N (2s)-2-amino-n-hydroxy-3-(1-pentylindol-3-yl)propanamide Chemical compound C1=CC=C2N(CCCCC)C=C(C[C@H](N)C(=O)NO)C2=C1 WIKCHKNYPHCKKG-AWEZNQCLSA-N 0.000 description 2
- KEQJRXXMBCXBBN-NSHDSACASA-N (2s)-2-amino-n-hydroxy-3-(4-propoxyphenyl)propanamide Chemical compound CCCOC1=CC=C(C[C@H](N)C(=O)NO)C=C1 KEQJRXXMBCXBBN-NSHDSACASA-N 0.000 description 2
- GHYVTYPNTILNPW-INIZCTEOSA-N (2s)-2-amino-n-hydroxy-3-[1-[(3-methyl-4-nitrophenyl)methyl]indol-3-yl]propanamide Chemical compound C1=C([N+]([O-])=O)C(C)=CC(CN2C3=CC=CC=C3C(C[C@H](N)C(=O)NO)=C2)=C1 GHYVTYPNTILNPW-INIZCTEOSA-N 0.000 description 2
- VPJKTNSUBSXXEB-INIZCTEOSA-N (2s)-2-amino-n-hydroxy-3-[4-[(4-methylphenyl)methylamino]phenyl]propanamide Chemical compound C1=CC(C)=CC=C1CNC1=CC=C(C[C@H](N)C(=O)NO)C=C1 VPJKTNSUBSXXEB-INIZCTEOSA-N 0.000 description 2
- LYMUUNXIKVANCL-HNNXBMFYSA-N (2s)-2-amino-n-hydroxy-3-[4-[(4-nitrophenyl)methoxy]phenyl]propanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCC1=CC=C([N+]([O-])=O)C=C1 LYMUUNXIKVANCL-HNNXBMFYSA-N 0.000 description 2
- SAPDTXJSWQTQGU-QMMMGPOBSA-N (2s)-2-amino-n-hydroxy-4-(1-methylbenzimidazol-2-yl)butanamide Chemical compound C1=CC=C2N(C)C(CC[C@H](N)C(=O)NO)=NC2=C1 SAPDTXJSWQTQGU-QMMMGPOBSA-N 0.000 description 2
- OFYHFCOJBVLLMM-JTQLQIEISA-N (2s)-2-amino-n-hydroxy-4-(1-propylbenzimidazol-2-yl)butanamide Chemical compound C1=CC=C2N(CCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 OFYHFCOJBVLLMM-JTQLQIEISA-N 0.000 description 2
- RPFNUAPCODGPBC-JTQLQIEISA-N (2s)-3-(4-acetamidophenyl)-2-amino-n-hydroxypropanamide Chemical compound CC(=O)NC1=CC=C(C[C@H](N)C(=O)NO)C=C1 RPFNUAPCODGPBC-JTQLQIEISA-N 0.000 description 2
- QDLZZKMFMKZLDN-LURJTMIESA-N (2s)-5-acetamido-2-amino-n-hydroxypentanamide Chemical compound CC(=O)NCCC[C@H](N)C(=O)NO QDLZZKMFMKZLDN-LURJTMIESA-N 0.000 description 2
- RRUYWEMUWIRRNB-LURJTMIESA-N (2s)-6-amino-2-[carboxy(methyl)amino]hexanoic acid Chemical compound OC(=O)N(C)[C@H](C(O)=O)CCCCN RRUYWEMUWIRRNB-LURJTMIESA-N 0.000 description 2
- OTPDWCMLUKMQNO-UHFFFAOYSA-N 1,2,3,4-tetrahydropyrimidine Chemical compound C1NCC=CN1 OTPDWCMLUKMQNO-UHFFFAOYSA-N 0.000 description 2
- IBLMYGXJKQIGSN-UHFFFAOYSA-N 1-(bromomethyl)-2,4-difluorobenzene Chemical compound FC1=CC=C(CBr)C(F)=C1 IBLMYGXJKQIGSN-UHFFFAOYSA-N 0.000 description 2
- QZNQSIHCDAGZIA-UHFFFAOYSA-N 1-(bromomethyl)-4-tert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(CBr)C=C1 QZNQSIHCDAGZIA-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- FJJYHTVHBVXEEQ-UHFFFAOYSA-N 2,2-dimethylpropanal Chemical compound CC(C)(C)C=O FJJYHTVHBVXEEQ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- CWIIQSWQPLDIHL-UHFFFAOYSA-N 2-amino-3-[1-[(3,4-difluorophenyl)methyl]indol-3-yl]-n-hydroxypropanamide Chemical compound C12=CC=CC=C2C(CC(N)C(=O)NO)=CN1CC1=CC=C(F)C(F)=C1 CWIIQSWQPLDIHL-UHFFFAOYSA-N 0.000 description 2
- HWQQCRWXUOTIED-UHFFFAOYSA-N 2-amino-3-[1-[(4-cyanophenyl)methyl]indol-3-yl]-n-hydroxypropanamide Chemical compound C12=CC=CC=C2C(CC(N)C(=O)NO)=CN1CC1=CC=C(C#N)C=C1 HWQQCRWXUOTIED-UHFFFAOYSA-N 0.000 description 2
- XQGYNEBAHHUOEH-UHFFFAOYSA-N 2-amino-3-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]-n-hydroxypropanamide Chemical compound C1=CC(C(C)(C)C)=CC=C1CN1C2=CC=CC=C2C(CC(N)C(=O)NO)=C1 XQGYNEBAHHUOEH-UHFFFAOYSA-N 0.000 description 2
- WIKCHKNYPHCKKG-UHFFFAOYSA-N 2-amino-n-hydroxy-3-(1-pentylindol-3-yl)propanamide Chemical compound C1=CC=C2N(CCCCC)C=C(CC(N)C(=O)NO)C2=C1 WIKCHKNYPHCKKG-UHFFFAOYSA-N 0.000 description 2
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 2
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- XSZYBMMYQCYIPC-UHFFFAOYSA-N 4,5-dimethyl-1,2-phenylenediamine Chemical compound CC1=CC(N)=C(N)C=C1C XSZYBMMYQCYIPC-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 238000003691 Amadori rearrangement reaction Methods 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 102000053028 CD36 Antigens Human genes 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
- 206010053567 Coagulopathies Diseases 0.000 description 2
- 208000007342 Diabetic Nephropathies Diseases 0.000 description 2
- 206010012689 Diabetic retinopathy Diseases 0.000 description 2
- 206010064553 Dialysis amyloidosis Diseases 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N Glycolaldehyde Chemical compound OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 208000029725 Metabolic bone disease Diseases 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- 206010049088 Osteopenia Diseases 0.000 description 2
- 206010034665 Peritoneal fibrosis Diseases 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 208000017442 Retinal disease Diseases 0.000 description 2
- 206010038923 Retinopathy Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000003875 Wang resin Substances 0.000 description 2
- NERFNHBZJXXFGY-UHFFFAOYSA-N [4-[(4-methylphenyl)methoxy]phenyl]methanol Chemical compound C1=CC(C)=CC=C1COC1=CC=C(CO)C=C1 NERFNHBZJXXFGY-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- 239000003463 adsorbent Substances 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 208000015294 blood coagulation disease Diseases 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- LJOODBDWMQKMFB-UHFFFAOYSA-N cyclohexylacetic acid Chemical compound OC(=O)CC1CCCCC1 LJOODBDWMQKMFB-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 208000033679 diabetic kidney disease Diseases 0.000 description 2
- XGZRAKBCYZIBKP-UHFFFAOYSA-L disodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[Na+] XGZRAKBCYZIBKP-UHFFFAOYSA-L 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 239000003889 eye drop Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 239000003906 humectant Substances 0.000 description 2
- 230000033444 hydroxylation Effects 0.000 description 2
- 238000005805 hydroxylation reaction Methods 0.000 description 2
- 201000001421 hyperglycemia Diseases 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 210000003584 mesangial cell Anatomy 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- FARGOOLSXWFBDO-JTQLQIEISA-N n-[(4s)-4-amino-5-(hydroxyamino)-5-oxopentyl]benzamide Chemical compound ONC(=O)[C@@H](N)CCCNC(=O)C1=CC=CC=C1 FARGOOLSXWFBDO-JTQLQIEISA-N 0.000 description 2
- USWGEKDSHYMQQI-HNNXBMFYSA-N n-[4-[(2s)-2-amino-3-(hydroxyamino)-3-oxopropyl]phenyl]-4-methylbenzamide Chemical compound C1=CC(C)=CC=C1C(=O)NC1=CC=C(C[C@H](N)C(=O)NO)C=C1 USWGEKDSHYMQQI-HNNXBMFYSA-N 0.000 description 2
- NZFHJBSDSXDUAO-UHFFFAOYSA-N o-tritylhydroxylamine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(ON)C1=CC=CC=C1 NZFHJBSDSXDUAO-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- 201000008482 osteoarthritis Diseases 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 238000013268 sustained release Methods 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- GIZBYELHYIBHIR-UHFFFAOYSA-N (1-chloro-2,2,2-trifluoroethyl)benzene Chemical compound FC(F)(F)C(Cl)C1=CC=CC=C1 GIZBYELHYIBHIR-UHFFFAOYSA-N 0.000 description 1
- CWIIQSWQPLDIHL-MRXNPFEDSA-N (2r)-2-amino-3-[1-[(3,4-difluorophenyl)methyl]indol-3-yl]-n-hydroxypropanamide Chemical compound C12=CC=CC=C2C(C[C@@H](N)C(=O)NO)=CN1CC1=CC=C(F)C(F)=C1 CWIIQSWQPLDIHL-MRXNPFEDSA-N 0.000 description 1
- SFTBEVKTNITADQ-MRXNPFEDSA-N (2r)-2-amino-4-[5,6-dimethyl-1-(4-methylphenyl)benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=CC(C)=CC=C1N1C2=CC(C)=C(C)C=C2N=C1CC[C@@H](N)C(=O)NO SFTBEVKTNITADQ-MRXNPFEDSA-N 0.000 description 1
- ZMKBXNGOEBHTRT-SNVBAGLBSA-N (2r)-2-amino-n-hydroxy-3-(1-methylindol-3-yl)propanamide Chemical compound C1=CC=C2N(C)C=C(C[C@@H](N)C(=O)NO)C2=C1 ZMKBXNGOEBHTRT-SNVBAGLBSA-N 0.000 description 1
- WIKCHKNYPHCKKG-CQSZACIVSA-N (2r)-2-amino-n-hydroxy-3-(1-pentylindol-3-yl)propanamide Chemical compound C1=CC=C2N(CCCCC)C=C(C[C@@H](N)C(=O)NO)C2=C1 WIKCHKNYPHCKKG-CQSZACIVSA-N 0.000 description 1
- LMWIHMWRYGAVOD-CQSZACIVSA-N (2r)-2-amino-n-hydroxy-4-[1-(4-methylphenyl)benzimidazol-2-yl]butanamide Chemical compound C1=CC(C)=CC=C1N1C2=CC=CC=C2N=C1CC[C@@H](N)C(=O)NO LMWIHMWRYGAVOD-CQSZACIVSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- GSDBOKDGJXGZIX-JEDNCBNOSA-N (2s)-2,6-diaminohexanoic acid;prop-2-enal Chemical compound C=CC=O.NCCCC[C@H](N)C(O)=O GSDBOKDGJXGZIX-JEDNCBNOSA-N 0.000 description 1
- AQTUACKQXJNHFQ-LURJTMIESA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCC(O)=O AQTUACKQXJNHFQ-LURJTMIESA-N 0.000 description 1
- VSRUUDYRQJVNOD-JTQLQIEISA-N (2s)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]pentanedioic acid Chemical compound CC(C)(C)OC(=O)[C@@](N)(C(O)=O)CCC(O)=O VSRUUDYRQJVNOD-JTQLQIEISA-N 0.000 description 1
- ICIMOJOJYLKBSL-HNNXBMFYSA-N (2s)-2-amino-3-(1-hexylindol-3-yl)-n-hydroxypropanamide Chemical compound C1=CC=C2N(CCCCCC)C=C(C[C@H](N)C(=O)NO)C2=C1 ICIMOJOJYLKBSL-HNNXBMFYSA-N 0.000 description 1
- KYGFAIZXKCHJCU-LBPRGKRZSA-N (2s)-2-amino-3-(4-butoxyphenyl)-n-hydroxypropanamide Chemical compound CCCCOC1=CC=C(C[C@H](N)C(=O)NO)C=C1 KYGFAIZXKCHJCU-LBPRGKRZSA-N 0.000 description 1
- UDAQEJYHAQBCHU-HNNXBMFYSA-N (2s)-2-amino-3-[4-[(4-fluorophenyl)methoxy]phenyl]-n-hydroxypropanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCC1=CC=C(F)C=C1 UDAQEJYHAQBCHU-HNNXBMFYSA-N 0.000 description 1
- BOOUDKPEARHXOL-SFHVURJKSA-N (2s)-2-amino-3-[4-[(4-tert-butylphenyl)methoxy]phenyl]-n-hydroxypropanamide Chemical compound C1=CC(C(C)(C)C)=CC=C1COC1=CC=C(C[C@H](N)C(=O)NO)C=C1 BOOUDKPEARHXOL-SFHVURJKSA-N 0.000 description 1
- VEENCXXODKJVFO-HNNXBMFYSA-N (2s)-2-amino-3-[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]-n-hydroxypropanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1NC(=O)CC1=CC=C(F)C=C1 VEENCXXODKJVFO-HNNXBMFYSA-N 0.000 description 1
- VWVVHVFTLWBSAK-AWEZNQCLSA-N (2s)-2-amino-4-(1-heptylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound C1=CC=C2N(CCCCCCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 VWVVHVFTLWBSAK-AWEZNQCLSA-N 0.000 description 1
- PLNBGVDWUIJQQP-ZDUSSCGKSA-N (2s)-2-amino-4-(1-hexylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound C1=CC=C2N(CCCCCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 PLNBGVDWUIJQQP-ZDUSSCGKSA-N 0.000 description 1
- NSCDZGXORMKERZ-ZDUSSCGKSA-N (2s)-2-amino-4-(5,6-dichloro-1-phenylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound ONC(=O)[C@@H](N)CCC1=NC2=CC(Cl)=C(Cl)C=C2N1C1=CC=CC=C1 NSCDZGXORMKERZ-ZDUSSCGKSA-N 0.000 description 1
- FRNDCWWNFXTZRA-AWEZNQCLSA-N (2s)-2-amino-4-(5,6-dimethyl-1-pentylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound CC1=C(C)C=C2N(CCCCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 FRNDCWWNFXTZRA-AWEZNQCLSA-N 0.000 description 1
- LQDULGBAORVZNL-HNNXBMFYSA-N (2s)-2-amino-4-(5,6-dimethyl-1-phenylbenzimidazol-2-yl)-n-hydroxybutanamide Chemical compound C1=2C=C(C)C(C)=CC=2N=C(CC[C@H](N)C(=O)NO)N1C1=CC=CC=C1 LQDULGBAORVZNL-HNNXBMFYSA-N 0.000 description 1
- PVBSCDDXZYQOLK-ZDUSSCGKSA-N (2s)-2-amino-4-[1-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=C(C)C(C)=CC2=C1N(CC(C)(C)C)C(CC[C@H](N)C(=O)NO)=N2 PVBSCDDXZYQOLK-ZDUSSCGKSA-N 0.000 description 1
- DCEKYWREBWEOKU-NSHDSACASA-N (2s)-2-amino-4-[1-(2,2-dimethylpropyl)benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=CC=C2N(CC(C)(C)C)C(CC[C@H](N)C(=O)NO)=NC2=C1 DCEKYWREBWEOKU-NSHDSACASA-N 0.000 description 1
- YHMVAPQSMYRMMU-HNNXBMFYSA-N (2s)-2-amino-4-[1-(4-fluorophenyl)-5,6-dimethylbenzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=2C=C(C)C(C)=CC=2N=C(CC[C@H](N)C(=O)NO)N1C1=CC=C(F)C=C1 YHMVAPQSMYRMMU-HNNXBMFYSA-N 0.000 description 1
- QMVJENDQQKGKDA-VIFPVBQESA-N (2s)-2-amino-4-[1-(5-chlorothiophen-2-yl)benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound ONC(=O)[C@@H](N)CCC1=NC2=CC=CC=C2N1C1=CC=C(Cl)S1 QMVJENDQQKGKDA-VIFPVBQESA-N 0.000 description 1
- IJAMMDPNKZDVDD-INIZCTEOSA-N (2s)-2-amino-4-[1-[(3,4-difluorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=2C=C(C)C(C)=CC=2N=C(CC[C@H](N)C(=O)NO)N1CC1=CC=C(F)C(F)=C1 IJAMMDPNKZDVDD-INIZCTEOSA-N 0.000 description 1
- ADSXATQRJWYIDR-INIZCTEOSA-N (2s)-2-amino-4-[1-[(4-fluorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=2C=C(C)C(C)=CC=2N=C(CC[C@H](N)C(=O)NO)N1CC1=CC=C(F)C=C1 ADSXATQRJWYIDR-INIZCTEOSA-N 0.000 description 1
- KYYAOKNCBSBFBN-AWEZNQCLSA-N (2s)-2-amino-4-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound ONC(=O)[C@@H](N)CCC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 KYYAOKNCBSBFBN-AWEZNQCLSA-N 0.000 description 1
- QCUFYRZLVAVAPJ-HNNXBMFYSA-N (2s)-2-amino-4-[5,6-dimethyl-1-(3-nitrophenyl)benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=2C=C(C)C(C)=CC=2N=C(CC[C@H](N)C(=O)NO)N1C1=CC=CC([N+]([O-])=O)=C1 QCUFYRZLVAVAPJ-HNNXBMFYSA-N 0.000 description 1
- SFTBEVKTNITADQ-INIZCTEOSA-N (2s)-2-amino-4-[5,6-dimethyl-1-(4-methylphenyl)benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=CC(C)=CC=C1N1C2=CC(C)=C(C)C=C2N=C1CC[C@H](N)C(=O)NO SFTBEVKTNITADQ-INIZCTEOSA-N 0.000 description 1
- WSENZEULXQZNFT-INIZCTEOSA-N (2s)-2-amino-4-[5,6-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]benzimidazol-2-yl]-n-hydroxybutanamide Chemical compound C1=2C=C(C)C(C)=CC=2N=C(CC[C@H](N)C(=O)NO)N1CC1=CC=C(C(F)(F)F)C=C1 WSENZEULXQZNFT-INIZCTEOSA-N 0.000 description 1
- KQKNOBHEHINIEA-JTQLQIEISA-N (2s)-2-amino-5-(cyclohexylamino)-n-hydroxypentanamide Chemical compound ONC(=O)[C@@H](N)CCCNC1CCCCC1 KQKNOBHEHINIEA-JTQLQIEISA-N 0.000 description 1
- LQRNFOFYUAOTCG-NSHDSACASA-N (2s)-2-amino-5-[(2-cyclohexylacetyl)amino]-n-hydroxypentanamide Chemical compound ONC(=O)[C@@H](N)CCCNC(=O)CC1CCCCC1 LQRNFOFYUAOTCG-NSHDSACASA-N 0.000 description 1
- MYPGMIDMFVWBCC-KRWDZBQOSA-N (2s)-2-amino-5-[[2-(3,5-ditert-butylphenyl)acetyl]amino]-n-hydroxypentanamide Chemical compound CC(C)(C)C1=CC(CC(=O)NCCC[C@H](N)C(=O)NO)=CC(C(C)(C)C)=C1 MYPGMIDMFVWBCC-KRWDZBQOSA-N 0.000 description 1
- RTPNVQYFSRVXAO-NSHDSACASA-N (2s)-2-amino-n-hydroxy-3-(1-pentylbenzimidazol-2-yl)propanamide Chemical compound C1=CC=C2N(CCCCC)C(C[C@H](N)C(=O)NO)=NC2=C1 RTPNVQYFSRVXAO-NSHDSACASA-N 0.000 description 1
- NRLRWGADICCJCC-SFHVURJKSA-N (2s)-2-amino-n-hydroxy-3-(4-naphthalen-2-yloxyphenyl)propanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OC1=CC=C(C=CC=C2)C2=C1 NRLRWGADICCJCC-SFHVURJKSA-N 0.000 description 1
- VSYYMBZHEZJTJR-ZDUSSCGKSA-N (2s)-2-amino-n-hydroxy-3-(4-pentoxyphenyl)propanamide Chemical compound CCCCCOC1=CC=C(C[C@H](N)C(=O)NO)C=C1 VSYYMBZHEZJTJR-ZDUSSCGKSA-N 0.000 description 1
- BTSZMLNQGRBCJO-KRWDZBQOSA-N (2s)-2-amino-n-hydroxy-3-[1-(2-phenylethyl)indol-3-yl]propanamide Chemical compound C12=CC=CC=C2C(C[C@H](N)C(=O)NO)=CN1CCC1=CC=CC=C1 BTSZMLNQGRBCJO-KRWDZBQOSA-N 0.000 description 1
- FGVRWLRVEYWYMN-ZDUSSCGKSA-N (2s)-2-amino-n-hydroxy-3-[1-(4-methylphenyl)benzimidazol-2-yl]propanamide Chemical compound C1=CC(C)=CC=C1N1C2=CC=CC=C2N=C1C[C@H](N)C(=O)NO FGVRWLRVEYWYMN-ZDUSSCGKSA-N 0.000 description 1
- JFQVMGYOEJEMLH-INIZCTEOSA-N (2s)-2-amino-n-hydroxy-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanamide Chemical compound C12=CC=CC=C2C(C[C@H](N)C(=O)NO)=CN1CC1=CC=C(C(F)(F)F)C=C1 JFQVMGYOEJEMLH-INIZCTEOSA-N 0.000 description 1
- PHHJNLOWRFSQEL-AWEZNQCLSA-N (2s)-2-amino-n-hydroxy-3-[4-(2-morpholin-4-ylethoxy)phenyl]propanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCCN1CCOCC1 PHHJNLOWRFSQEL-AWEZNQCLSA-N 0.000 description 1
- WZXSENRBVSRIKK-INIZCTEOSA-N (2s)-2-amino-n-hydroxy-3-[4-(2-phenylethoxy)phenyl]propanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCCC1=CC=CC=C1 WZXSENRBVSRIKK-INIZCTEOSA-N 0.000 description 1
- LILVGNFOBYTIRE-JTQLQIEISA-N (2s)-2-amino-n-hydroxy-3-[4-[(2,3,4,5,6-pentafluorophenyl)methoxy]phenyl]propanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCC1=C(F)C(F)=C(F)C(F)=C1F LILVGNFOBYTIRE-JTQLQIEISA-N 0.000 description 1
- YIFVQYPKQLVVJY-NRFANRHFSA-N (2s)-2-amino-n-hydroxy-3-[4-[(2-phenylphenyl)methoxy]phenyl]propanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCC1=CC=CC=C1C1=CC=CC=C1 YIFVQYPKQLVVJY-NRFANRHFSA-N 0.000 description 1
- SCYRVYUSUBEHAF-HNNXBMFYSA-N (2s)-2-amino-n-hydroxy-3-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanamide Chemical compound C1=CC(C[C@H](N)C(=O)NO)=CC=C1OCC1=CC=C(C(F)(F)F)C=C1 SCYRVYUSUBEHAF-HNNXBMFYSA-N 0.000 description 1
- BBCBKLPLHGBNBD-LBPRGKRZSA-N (2s)-2-amino-n-hydroxy-4-(1-pentylbenzimidazol-2-yl)butanamide Chemical compound C1=CC=C2N(CCCCC)C(CC[C@H](N)C(=O)NO)=NC2=C1 BBCBKLPLHGBNBD-LBPRGKRZSA-N 0.000 description 1
- LJOASYTZMZQEFC-ZDUSSCGKSA-N (2s)-2-amino-n-hydroxy-4-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]butanamide Chemical compound C1CN(C)CCC1N1C2=CC=CC=C2N=C1CC[C@H](N)C(=O)NO LJOASYTZMZQEFC-ZDUSSCGKSA-N 0.000 description 1
- ILTRSALNWJVPFC-KIYNQFGBSA-N (2s)-2-amino-n-hydroxy-4-[1-(2-methylbutyl)benzimidazol-2-yl]butanamide Chemical compound C1=CC=C2N(CC(C)CC)C(CC[C@H](N)C(=O)NO)=NC2=C1 ILTRSALNWJVPFC-KIYNQFGBSA-N 0.000 description 1
- ZMCZJDPFYYRCDQ-NSHDSACASA-N (2s)-2-amino-n-hydroxy-4-[1-(2-methylpropyl)benzimidazol-2-yl]butanamide Chemical compound C1=CC=C2N(CC(C)C)C(CC[C@H](N)C(=O)NO)=NC2=C1 ZMCZJDPFYYRCDQ-NSHDSACASA-N 0.000 description 1
- INZRKDYNHGQFMK-INIZCTEOSA-N (2s)-2-amino-n-hydroxy-4-[1-(4-methoxyphenyl)-5,6-dimethylbenzimidazol-2-yl]butanamide Chemical compound C1=CC(OC)=CC=C1N1C2=CC(C)=C(C)C=C2N=C1CC[C@H](N)C(=O)NO INZRKDYNHGQFMK-INIZCTEOSA-N 0.000 description 1
- SMXQSNICBNOMIV-SFHVURJKSA-N (2s)-2-amino-n-hydroxy-4-[1-(naphthalen-1-ylmethyl)benzimidazol-2-yl]butanamide Chemical compound C1=CC=C2C(CN3C4=CC=CC=C4N=C3CC[C@H](N)C(=O)NO)=CC=CC2=C1 SMXQSNICBNOMIV-SFHVURJKSA-N 0.000 description 1
- OMCHTYSJXVUVGX-ZDUSSCGKSA-N (2s)-2-amino-n-hydroxy-4-[1-(pyridin-2-ylmethyl)benzimidazol-2-yl]butanamide Chemical compound ONC(=O)[C@@H](N)CCC1=NC2=CC=CC=C2N1CC1=CC=CC=N1 OMCHTYSJXVUVGX-ZDUSSCGKSA-N 0.000 description 1
- WLUALNRHMJLGGT-AWEZNQCLSA-N (2s)-2-amino-n-hydroxy-4-[1-[(2-methoxyphenyl)methyl]benzimidazol-2-yl]butanamide Chemical compound COC1=CC=CC=C1CN1C2=CC=CC=C2N=C1CC[C@H](N)C(=O)NO WLUALNRHMJLGGT-AWEZNQCLSA-N 0.000 description 1
- PIXNNBDENMIRCQ-KRWDZBQOSA-N (2s)-2-amino-n-hydroxy-4-[1-[(4-methoxyphenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]butanamide Chemical compound C1=CC(OC)=CC=C1CN1C2=CC(C)=C(C)C=C2N=C1CC[C@H](N)C(=O)NO PIXNNBDENMIRCQ-KRWDZBQOSA-N 0.000 description 1
- FXJVZLUADPQWFB-KRWDZBQOSA-N (2s)-2-amino-n-hydroxy-5-[[2-(4-phenylphenyl)acetyl]amino]pentanamide Chemical compound C1=CC(CC(=O)NCCC[C@H](N)C(=O)NO)=CC=C1C1=CC=CC=C1 FXJVZLUADPQWFB-KRWDZBQOSA-N 0.000 description 1
- MGDOBCCPUYGNFJ-AWEZNQCLSA-N (2s)-n-hydroxy-2-(propylamino)-4-(1-propylbenzimidazol-2-yl)butanamide Chemical compound C1=CC=C2N(CCC)C(CC[C@H](NCCC)C(=O)NO)=NC2=C1 MGDOBCCPUYGNFJ-AWEZNQCLSA-N 0.000 description 1
- KOVQGYQQVNCUBR-UHFFFAOYSA-N (3-methyl-4-nitrophenyl)methanol Chemical compound CC1=CC(CO)=CC=C1[N+]([O-])=O KOVQGYQQVNCUBR-UHFFFAOYSA-N 0.000 description 1
- IIFVWLUQBAIPMJ-UHFFFAOYSA-N (4-fluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1 IIFVWLUQBAIPMJ-UHFFFAOYSA-N 0.000 description 1
- MPWSRGAWRAYBJK-UHFFFAOYSA-N (4-tert-butylphenyl)methanamine Chemical compound CC(C)(C)C1=CC=C(CN)C=C1 MPWSRGAWRAYBJK-UHFFFAOYSA-N 0.000 description 1
- GYPCWHHQAVLMKO-XXKQIVDLSA-N (7s,9s)-7-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-[(e)-n-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ylidene)amino]-c-methylcarbonimidoyl]-4-methoxy-8,10-dihydro-7h-tetracene-5,12-dione;hydrochloride Chemical group Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(\C)=N\N=C1CC(C)(C)N(O)C(C)(C)C1)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 GYPCWHHQAVLMKO-XXKQIVDLSA-N 0.000 description 1
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 description 1
- LNOLJFCCYQZFBQ-BUHFOSPRSA-N (ne)-n-[(4-nitrophenyl)-phenylmethylidene]hydroxylamine Chemical compound C=1C=C([N+]([O-])=O)C=CC=1C(=N/O)/C1=CC=CC=C1 LNOLJFCCYQZFBQ-BUHFOSPRSA-N 0.000 description 1
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 1
- PPLBPDUKNRCHGG-UHFFFAOYSA-N 1,2-dichloropentane Chemical compound CCCC(Cl)CCl PPLBPDUKNRCHGG-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- BLXSFCHWMBESKV-UHFFFAOYSA-N 1-iodopentane Chemical compound CCCCCI BLXSFCHWMBESKV-UHFFFAOYSA-N 0.000 description 1
- QZTWVDCKDWZCLV-UHFFFAOYSA-N 1-isocyanato-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(N=C=O)C=C1 QZTWVDCKDWZCLV-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- 239000005971 1-naphthylacetic acid Substances 0.000 description 1
- QWLCOOAYMQWDPR-UHFFFAOYSA-N 1-pentylindole Chemical compound C1=CC=C2N(CCCCC)C=CC2=C1 QWLCOOAYMQWDPR-UHFFFAOYSA-N 0.000 description 1
- VFYFMNCKPJDAPV-UHFFFAOYSA-N 2,2'-(5-oxo-1,3-dioxolan-4,4-diyl)diessigs Chemical compound C1N(C2)CN3CN1CN2C3.OC(=O)CC1(CC(O)=O)OCOC1=O VFYFMNCKPJDAPV-UHFFFAOYSA-N 0.000 description 1
- RXMTUVIKZRXSSM-UHFFFAOYSA-N 2,2-diphenylethanamine Chemical compound C=1C=CC=CC=1C(CN)C1=CC=CC=C1 RXMTUVIKZRXSSM-UHFFFAOYSA-N 0.000 description 1
- PSCITZRLRGWIHI-UHFFFAOYSA-N 2-(4-aminophenyl)pyridin-3-ol Chemical compound C1=CC(N)=CC=C1C1=NC=CC=C1O PSCITZRLRGWIHI-UHFFFAOYSA-N 0.000 description 1
- NOWXSWMFTGXVSR-UHFFFAOYSA-N 2-(4-tert-butylphenyl)-2-methylpropanal Chemical compound CC(C)(C)C1=CC=C(C(C)(C)C=O)C=C1 NOWXSWMFTGXVSR-UHFFFAOYSA-N 0.000 description 1
- KKFDCBRMNNSAAW-UHFFFAOYSA-N 2-(morpholin-4-yl)ethanol Chemical compound OCCN1CCOCC1 KKFDCBRMNNSAAW-UHFFFAOYSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- FYELSNVLZVIGTI-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-ethylpyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1CC)CC(=O)N1CC2=C(CC1)NN=N2 FYELSNVLZVIGTI-UHFFFAOYSA-N 0.000 description 1
- XHRCFGDFESIFRG-UHFFFAOYSA-N 2-chloro-n-ethyl-n-[(2-methylphenyl)methyl]ethanamine Chemical compound ClCCN(CC)CC1=CC=CC=C1C XHRCFGDFESIFRG-UHFFFAOYSA-N 0.000 description 1
- HBAHZZVIEFRTEY-UHFFFAOYSA-N 2-heptylcyclohex-2-en-1-one Chemical compound CCCCCCCC1=CCCCC1=O HBAHZZVIEFRTEY-UHFFFAOYSA-N 0.000 description 1
- UUXHICUVBOTXQS-UHFFFAOYSA-N 2-hydroxybutanamide Chemical compound CCC(O)C(N)=O UUXHICUVBOTXQS-UHFFFAOYSA-N 0.000 description 1
- STRVVRPNBAHXRJ-UHFFFAOYSA-N 2-hydroxynon-2-enal Chemical compound CCCCCCC=C(O)C=O STRVVRPNBAHXRJ-UHFFFAOYSA-N 0.000 description 1
- VIBOGIYPPWLDTI-UHFFFAOYSA-N 2-naphthylacetic acid Chemical compound C1=CC=CC2=CC(CC(=O)O)=CC=C21 VIBOGIYPPWLDTI-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- 125000006509 3,4-difluorobenzyl group Chemical group [H]C1=C(F)C(F)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- JCJCOOTYLKEQME-UHFFFAOYSA-N 3-[1-[(4-cyanophenyl)methyl]indol-3-yl]-2-[(2-methylpropan-2-yl)oxyamino]-n-trityloxypropanamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)ONC(=O)C(NOC(C)(C)C)CC(C1=CC=CC=C11)=CN1CC1=CC=C(C#N)C=C1 JCJCOOTYLKEQME-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 1
- IWFHBRFJOHTIPU-UHFFFAOYSA-N 4,5-dichlorobenzene-1,2-diamine Chemical compound NC1=CC(Cl)=C(Cl)C=C1N IWFHBRFJOHTIPU-UHFFFAOYSA-N 0.000 description 1
- JJIFTOPVKWDHJI-UHFFFAOYSA-N 4-(bromomethyl)-1,2-difluorobenzene Chemical compound FC1=CC=C(CBr)C=C1F JJIFTOPVKWDHJI-UHFFFAOYSA-N 0.000 description 1
- UMLFTCYAQPPZER-UHFFFAOYSA-N 4-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=C(C#N)C=C1 UMLFTCYAQPPZER-UHFFFAOYSA-N 0.000 description 1
- IIDAJRNSZSFFCB-UHFFFAOYSA-N 4-amino-5-methoxy-2-methylbenzenesulfonamide Chemical compound COC1=CC(S(N)(=O)=O)=C(C)C=C1N IIDAJRNSZSFFCB-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- NNJMFJSKMRYHSR-UHFFFAOYSA-N 4-phenylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=CC=C1 NNJMFJSKMRYHSR-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- VWYFITBWBRVBSW-UHFFFAOYSA-N 5-chlorothiophene-2-carbaldehyde Chemical compound ClC1=CC=C(C=O)S1 VWYFITBWBRVBSW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000037259 Amyloid Plaque Diseases 0.000 description 1
- 238000013258 ApoE Receptor knockout mouse model Methods 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- VHOMAPWVLKRQAZ-UHFFFAOYSA-N Benzyl propionate Chemical compound CCC(=O)OCC1=CC=CC=C1 VHOMAPWVLKRQAZ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- GNCDKZBBNYVCFE-LBPRGKRZSA-N CC(C)(C)OC(N(C([C@H](CC1=CNC2=CC=CC=C12)N)=O)O)=O Chemical compound CC(C)(C)OC(N(C([C@H](CC1=CNC2=CC=CC=C12)N)=O)O)=O GNCDKZBBNYVCFE-LBPRGKRZSA-N 0.000 description 1
- 108010045374 CD36 Antigens Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 235000010005 Catalpa ovata Nutrition 0.000 description 1
- 240000004528 Catalpa ovata Species 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- SBJKKFFYIZUCET-JLAZNSOCSA-N Dehydro-L-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(=O)C1=O SBJKKFFYIZUCET-JLAZNSOCSA-N 0.000 description 1
- SBJKKFFYIZUCET-UHFFFAOYSA-N Dehydroascorbic acid Natural products OCC(O)C1OC(=O)C(=O)C1=O SBJKKFFYIZUCET-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000032131 Diabetic Neuropathies Diseases 0.000 description 1
- 206010063547 Diabetic macroangiopathy Diseases 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 102000000802 Galectin 3 Human genes 0.000 description 1
- 108010001517 Galectin 3 Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010018364 Glomerulonephritis Diseases 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- 102000004457 Granulocyte-Macrophage Colony-Stimulating Factor Human genes 0.000 description 1
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 1
- 206010019663 Hepatic failure Diseases 0.000 description 1
- 101000611183 Homo sapiens Tumor necrosis factor Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 1
- 102000004218 Insulin-Like Growth Factor I Human genes 0.000 description 1
- 108010002352 Interleukin-1 Proteins 0.000 description 1
- 102000000589 Interleukin-1 Human genes 0.000 description 1
- 108090001005 Interleukin-6 Proteins 0.000 description 1
- 102000004889 Interleukin-6 Human genes 0.000 description 1
- 206010023230 Joint stiffness Diseases 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 229920006063 Lamide® Polymers 0.000 description 1
- 229920001543 Laminarin Polymers 0.000 description 1
- 101710134306 Macrophage scavenger receptor types I and II Proteins 0.000 description 1
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical compound O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 description 1
- 229920001367 Merrifield resin Polymers 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 206010029333 Neurosis Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102100029438 Nitric oxide synthase, inducible Human genes 0.000 description 1
- 101710089543 Nitric oxide synthase, inducible Proteins 0.000 description 1
- 208000001132 Osteoporosis Diseases 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 102100025386 Oxidized low-density lipoprotein receptor 1 Human genes 0.000 description 1
- 101710199789 Oxidized low-density lipoprotein receptor 1 Proteins 0.000 description 1
- 208000031848 Peritonitis sclerosing Diseases 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- LCTONWCANYUPML-UHFFFAOYSA-M Pyruvate Chemical compound CC(=O)C([O-])=O LCTONWCANYUPML-UHFFFAOYSA-M 0.000 description 1
- 208000001647 Renal Insufficiency Diseases 0.000 description 1
- 206010062237 Renal impairment Diseases 0.000 description 1
- 241000219061 Rheum Species 0.000 description 1
- 108091005487 SCARB1 Proteins 0.000 description 1
- 101100269370 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) AGE2 gene Proteins 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 208000034189 Sclerosis Diseases 0.000 description 1
- 206010039984 Senile osteoporosis Diseases 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 102000012607 Thrombomodulin Human genes 0.000 description 1
- 108010079274 Thrombomodulin Proteins 0.000 description 1
- 102000002262 Thromboplastin Human genes 0.000 description 1
- 108010000499 Thromboplastin Proteins 0.000 description 1
- 102000004887 Transforming Growth Factor beta Human genes 0.000 description 1
- 108090001012 Transforming Growth Factor beta Proteins 0.000 description 1
- 102100040247 Tumor necrosis factor Human genes 0.000 description 1
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 1
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 1
- HUFREHBVNZUPKR-UHFFFAOYSA-N [K].CCC Chemical compound [K].CCC HUFREHBVNZUPKR-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 210000002821 alveolar epithelial cell Anatomy 0.000 description 1
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 description 1
- 150000003862 amino acid derivatives Chemical class 0.000 description 1
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000033115 angiogenesis Effects 0.000 description 1
- PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 1
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 210000001188 articular cartilage Anatomy 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 230000003143 atherosclerotic effect Effects 0.000 description 1
- GHQPBDDZGPAVJP-UHFFFAOYSA-N azanium;methanol;hydroxide Chemical compound N.O.OC GHQPBDDZGPAVJP-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 125000005604 azodicarboxylate group Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N beta-monoglyceryl stearate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 239000001058 brown pigment Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- MSZJEPVVQWJCIF-UHFFFAOYSA-N butylazanide Chemical compound CCCC[NH-] MSZJEPVVQWJCIF-UHFFFAOYSA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001728 carbonyl compounds Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000012292 cell migration Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 210000001612 chondrocyte Anatomy 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 208000020832 chronic kidney disease Diseases 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000306 component Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 235000020960 dehydroascorbic acid Nutrition 0.000 description 1
- 239000011615 dehydroascorbic acid Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- PBWZKZYHONABLN-UHFFFAOYSA-N difluoroacetic acid Chemical compound OC(=O)C(F)F PBWZKZYHONABLN-UHFFFAOYSA-N 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000003176 fibrotic effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 125000005816 fluoropropyl group Chemical group [H]C([H])(F)C([H])([H])C([H])([H])* 0.000 description 1
- 210000000497 foam cell Anatomy 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229960002989 glutamic acid Drugs 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 230000013595 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 238000001631 haemodialysis Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000000322 hemodialysis Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 201000006370 kidney failure Diseases 0.000 description 1
- 230000003907 kidney function Effects 0.000 description 1
- DBTMGCOVALSLOR-VPNXCSTESA-N laminarin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)OC1O[C@@H]1[C@@H](O)C(O[C@H]2[C@@H]([C@@H](CO)OC(O)[C@@H]2O)O)O[C@H](CO)[C@H]1O DBTMGCOVALSLOR-VPNXCSTESA-N 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229910000032 lithium hydrogen carbonate Inorganic materials 0.000 description 1
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical compound [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 1
- 208000007903 liver failure Diseases 0.000 description 1
- 231100000835 liver failure Toxicity 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 210000003712 lysosome Anatomy 0.000 description 1
- 230000001868 lysosomic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229940118019 malondialdehyde Drugs 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- JJJSFAGPWHEUBT-UHFFFAOYSA-N methyl 2-(4-hydroxy-3-methoxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C(OC)=C1 JJJSFAGPWHEUBT-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 102000035118 modified proteins Human genes 0.000 description 1
- 108091005573 modified proteins Proteins 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- LRJWPGWHHRVDIM-JTQLQIEISA-N n-[(4s)-4-amino-5-(hydroxyamino)-5-oxopentyl]-4-nitrobenzamide Chemical compound ONC(=O)[C@@H](N)CCCNC(=O)C1=CC=C([N+]([O-])=O)C=C1 LRJWPGWHHRVDIM-JTQLQIEISA-N 0.000 description 1
- WJGHDACHGDWWNK-LBPRGKRZSA-N n-[4-[(2s)-2-amino-3-(hydroxyamino)-3-oxopropyl]phenyl]pentanamide Chemical compound CCCCC(=O)NC1=CC=C(C[C@H](N)C(=O)NO)C=C1 WJGHDACHGDWWNK-LBPRGKRZSA-N 0.000 description 1
- LVCDXCQFSONNDO-UHFFFAOYSA-N n-benzylhydroxylamine Chemical compound ONCC1=CC=CC=C1 LVCDXCQFSONNDO-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- QJQAMHYHNCADNR-UHFFFAOYSA-N n-methylpropanamide Chemical compound CCC(=O)NC QJQAMHYHNCADNR-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 210000002569 neuron Anatomy 0.000 description 1
- 201000001119 neuropathy Diseases 0.000 description 1
- 230000007823 neuropathy Effects 0.000 description 1
- 208000015238 neurotic disease Diseases 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 1
- HYDZPXNVHXJHBG-UHFFFAOYSA-N o-benzylhydroxylamine;hydron;chloride Chemical compound Cl.NOCC1=CC=CC=C1 HYDZPXNVHXJHBG-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 235000014593 oils and fats Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical compound O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000036542 oxidative stress Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000007310 pathophysiology Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- MYHOHFDYWMPGJY-UHFFFAOYSA-N pentafluorobenzoyl chloride Chemical compound FC1=C(F)C(F)=C(C(Cl)=O)C(F)=C1F MYHOHFDYWMPGJY-UHFFFAOYSA-N 0.000 description 1
- XDEPVFFKOVDUNO-UHFFFAOYSA-N pentafluorobenzyl bromide Chemical compound FC1=C(F)C(F)=C(CBr)C(F)=C1F XDEPVFFKOVDUNO-UHFFFAOYSA-N 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- AYEKKSTZQYEZPU-RYUDHWBXSA-N pentosidine Chemical compound OC(=O)[C@@H](N)CCCCN1C=CC=C2N=C(NCCC[C@H](N)C(O)=O)N=C12 AYEKKSTZQYEZPU-RYUDHWBXSA-N 0.000 description 1
- 229920002616 peptidyl amide Polymers 0.000 description 1
- 210000003668 pericyte Anatomy 0.000 description 1
- 208000033808 peripheral neuropathy Diseases 0.000 description 1
- 239000005426 pharmaceutical component Substances 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 150000003151 propanoic acid esters Chemical class 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000002683 reaction inhibitor Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 108091005451 scavenger receptor class A Proteins 0.000 description 1
- 102000035013 scavenger receptor class A Human genes 0.000 description 1
- 108091005484 scavenger receptor class B Proteins 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical class [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000006190 sub-lingual tablet Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- RAYDAZNGWRHBJP-UHFFFAOYSA-N tert-butyl 2-hydroxy-5-nitrobenzoate Chemical compound CC(C)(C)OC(=O)C1=CC([N+]([O-])=O)=CC=C1O RAYDAZNGWRHBJP-UHFFFAOYSA-N 0.000 description 1
- IWXDXDCALKLIKB-UHFFFAOYSA-N tert-butylperoxycarbonyl (2-methylpropan-2-yl)oxy carbonate Chemical compound CC(C)(C)OOC(=O)OC(=O)OOC(C)(C)C IWXDXDCALKLIKB-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- ZRKFYGHZFMAOKI-QMGMOQQFSA-N tgfbeta Chemical compound C([C@H](NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCSC)C(C)C)[C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(O)=O)C1=CC=C(O)C=C1 ZRKFYGHZFMAOKI-QMGMOQQFSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 235000015961 tonic Nutrition 0.000 description 1
- 230000001256 tonic effect Effects 0.000 description 1
- 229960000716 tonics Drugs 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000725 trifluoropropyl group Chemical group [H]C([H])(*)C([H])([H])C(F)(F)F 0.000 description 1
- FTVLMFQEYACZNP-UHFFFAOYSA-N trimethylsilyl trifluoromethanesulfonate Chemical compound C[Si](C)(C)OS(=O)(=O)C(F)(F)F FTVLMFQEYACZNP-UHFFFAOYSA-N 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23L—FOODS, FOODSTUFFS, OR NON-ALCOHOLIC BEVERAGES, NOT COVERED BY SUBCLASSES A21D OR A23B-A23J; THEIR PREPARATION OR TREATMENT, e.g. COOKING, MODIFICATION OF NUTRITIVE QUALITIES, PHYSICAL TREATMENT; PRESERVATION OF FOODS OR FOODSTUFFS, IN GENERAL
- A23L33/00—Modifying nutritive qualities of foods; Dietetic products; Preparation or treatment thereof
- A23L33/10—Modifying nutritive qualities of foods; Dietetic products; Preparation or treatment thereof using additives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/16—Drugs for disorders of the alimentary tract or the digestive system for liver or gallbladder disorders, e.g. hepatoprotective agents, cholagogues, litholytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
- A61P19/10—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease for osteoporosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/10—Ophthalmic agents for accommodation disorders, e.g. myopia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/12—Ophthalmic agents for cataracts
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q19/00—Preparations for care of the skin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/04—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids
- C07C259/06—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids having carbon atoms of hydroxamic groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/18—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D209/22—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with an aralkyl radical attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/16—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Definitions
- the present invention relates to a compound having an AGE production inhibitory activity, and an AGE production inhibitor. More specifically, an AGE formation inhibitor containing the compound as an active ingredient, a pharmaceutical composition used for treatment and prevention of a disease associated with AGE formation, an additive for food and cosmetics, and the compound containing the compound It concerns cosmetics.
- Non-Patent Document 1 The protein saccharification reaction (Maillard reaction) is a reaction that was discovered from the formation of a brown pigment when an amino acid and a reducing sugar were heated (Non-Patent Document 1). It was regarded as important in relation to the color tone and aroma of food, freshness and quality.
- reaction products accumulate in vivo. Furthermore, it has been shown that the accumulation of protein saccharification reaction products is closely related to the onset and progress of various diseases, and its physiological significance has become extremely important.
- the protein saccharification reaction is divided into an early reaction and a late reaction.
- the aldehyde group of the reducing sugar such as glucose
- aluminidine a relatively unstable Schiff base
- Amadori rearrangement is caused to stabilize, resulting in a ketoamine, a so-called Amadori compound.
- the Amadori compound undergoes complicated reactions such as dehydration, rearrangement, and condensation, and is diversified via a carbohydrate conjugate such as deoxydarcosone, dalioxal or methyldalioxal as an intermediate. And some of them form crosslinks within or between protein molecules.
- AGEs Advanced Glycosylation Endproducts
- Non-Patent Document 3 sugars, lipids, and amino acids present in the living body become targets for generated reactive oxygen species (ROSs) when the living body is in oxidative stress, and glyoxal, arabinose, glycolaldehyde, dehydroascorbic acid And various highly reactive carbohydrate conjugates such as malondialdehyde, hydroxynonenal and acrolein.
- ROSs reactive oxygen species
- Non-Patent Documents 4, 5 and 5 Advanced Lipoxidation Endproducts
- ALEs Advanced Lipoxidation Endproducts
- RAGE is expressed by AGE-Dani protein in vascular endothelial cells, smooth muscle cells, macrophages, vascular wall cells such as alveolar epithelial cells and pericytes, mesangial cells in kidney, and erythrocytes.
- the RAGE is thought to induce arterial sclerosis and angiogenesis by inducing biological reactions such as migration through TGF-
- Non-Patent Document 31 Recently, it was reported that the development of arteriosclerosis in apoE knockout mice that induced diabetes was significantly suppressed by administration of the extracellular domain of RAGE (sRAGE) (Non-Patent Document 31). Furthermore, in transgenic mice that specifically overexpress RAGE in blood vessels and iNOS in spleen
- Non-Patent Document 33 When AGE receptors present in mesangial cells of the kidney are stimulated by AGE, increased production of extracellular substrates (Non-Patent Document 33) and increased production of PDGF and TGF- ⁇ (Non-Patent Document 34) It is believed that it promotes kidney damage.
- Non-Patent Document 35 In Alzheimer's disease, the receptor is also present in neurons and fibrotic j8AP and PHF are AGE-induced, suggesting a relationship with neuropathy, and accumulating in articular cartilage to produce chondrocyte collagen. It has been suggested that the inhibition of metabolism may be associated with the progression of rheumatism and arthritis (Non-Patent Documents 36 and 37), and that peritoneal dialysis of peritoneal dialysis patients may cause AGEs to decrease the dialysis efficiency and cause sclerosing peritonitis.
- AGE and ALE-related diseases include diabetic complications (diabetic neuropathy, diabetic retinopathy, diabetic nephropathy), arteriosclerosis, cataract, Alzheimer's disease, rheumatoid arthritis. , Osteoarthritis, chronic renal insufficiency, dialysis amyloidosis, peritoneal sclerosis, etc., and measures to suppress the generation of AGE and ALE as a result are considered to be effective in preventing the onset and progress of these diseases.
- diabetic complications diabetic neuropathy, diabetic retinopathy, diabetic nephropathy
- arteriosclerosis cataract
- Alzheimer's disease rheumatoid arthritis.
- Osteoarthritis chronic renal insufficiency
- dialysis amyloidosis dialysis amyloidosis
- peritoneal sclerosis etc.
- measures to suppress the generation of AGE and ALE as a result are considered to be effective in preventing the onset and progress
- Patent Documents 1 to 12 Many compounds have been reported to suppress the production of AGE or ALE for the purpose of treating the above-mentioned diseases (Patent Documents 1 to 12), but none of them has been put to practical use as an AGE production inhibitor.
- Patent Document 13 discloses a compound having an active nitrogen-containing group (gua-dino group, some ⁇ is an amino group bonded to a gua-dino group) capable of reacting with an active carbo group in an Amadori rearrangement product. Discloses that a composition comprising the compound inhibits the production of secondary glycosylation end products, and specifically, aminoguanidine, a-hydrazinohistidine and lysine. However, at the time of filing the present application, these compounds have not been put into practical use as AGE production inhibitors, and their side effects and effects are not clear.
- Patent Document 1 Japanese Patent Application Laid-Open No. 9-40626
- Patent Document 2 JP-A-9-59233
- Patent Document 3 JP-A-9-124471
- Patent document 4 JP-A-9-221473
- Patent Document 5 JP-A-10-158244
- Patent Document 6 JP-A-10-17954
- Patent Document 7 JP-A-10-167965
- Patent Document 8 JP-A-11-124379
- Patent Document 9 JP-A-2002-256259
- Patent Document 10 Japanese Patent Application Laid-Open No. 2002-255813
- Patent Document 11 JP-A-2002-302472
- Patent Document 12 Patent No. 3267698
- Patent Document 13 JP-A-62-142114 [0014]
- Non-patent document 1 Maillard LC, CR Acad Sci 154: 66, 1912
- Non-Patent Document 2 Brownlee M, N End J Med 318: 1315-1321, 1988
- Non-patent document 3 Miyata T, Nephrol Dial Transplant 12: 255-258, 1997
- Non-patent document 4 Miyata T, Kidney Int 55: 389-399, 1999
- Non-patent document 5 Esterbauer H, Free Radic Bio Med 11: 81-128, 1991
- Non-patent document 6 Uchida K, Proc. Natl Acad Sci 95: 4882-4887, 1998
- Non-patent document 7 Sell DR, J Biol Chem 264: 21597-21602, 1989
- Non-patent document 8 Nakamura K, J Chem Soc Chem Commun 992-994, 1992
- Non-patent document 9 Hayase F, J Biol Chem 264: 3758-3764, 1989
- Non-patent document 10 Njoroge FG, Carbohydr Res 167: 211-220, 1987
- Non-patent document ll Konishi Y, Biosci Biotech Biochem 58: 1953-1955, 1994
- Non-patent document 12 Uchida K FEBS Lett 410: 313-318, 1997
- Non-patent document 13 WeU-Knecht KJ, J Org Chem 60: 6246-6247, 1995
- Non-patent document 14 Nagaraji RH, J Biol Chem 271: 19338-19345, 1996
- Non-patent document 15 Ahmed MU, J Biol Chem 261 : 4889-4894, 1986
- Non-Patent Document 16 Ahmed MU, Biochem J 324: 565-570, 1997
- Non-patent document 17 Shipanova IN, Arch Biochem Biophys 344: 29-36, 1997
- Non-patent document 18 Oya T, J Biol Chem 274: 18492-18502, 2000
- Non-patent document 19 Oya T, Biochem Biophys Res Commum 246: 267-271, 1998
- Non-patent document 20 Uchida K, J Biol Chem 273: 165058-16066, 1998
- Non-patent document 21 Requena JR, Biochem J 322: 317 -325, 1997
- Non-Patent Document 22 Requena JR, Biochem J 322: 317-325, 1997
- Non-Patent Document 23 Neeper M, J Biol Chem 267: 14998-15004, 1992
- Non-Patent Document 24 Takata K, J Biol Chem 263: 14819-14825, 1988
- Non-Patent Document 25 Vlassara H, Molecular Med 6: 634-646, 1995
- Non-patent document 26 Li Y, Proc Natl Acad Sci USA 93: 11047-11052, 1996
- Non-patent document 27 Jinnouchi Y, J Biochem (Tokyo) 123: 1208-1217, 1998
- Non-patent document 28 Fu MX, Diabetes 43 : 676-683, 1994
- Non-patent document 29 Schmidt AM, J Biol Chem 267: 14987-14997, 1992
- Non-patent document 30 Higashi T, Diabetes 46: 463-472, 1997
- Non-Patent Document 31 Park L, Nat Med 4: 1025-1031, 1998
- Non-patent document 32 Yamamoto Y, J Clin Invest 108: 261-268, 2001
- Non-Patent Document 33 Doi T, Proc Natl Acad Sci USA 89: 2873-2877, 1992
- Non-Patent Document 34 Throckmorton DC, Kidney Int 48: 111-117, 1995
- Non-Patent Document 35 Monnier VM, N Engl J Med 314: 403, 1986
- Non-Patent Document 36 Bank RA, Biochem J 330: 345-351, 1998
- Non-Patent Document 37 Takahashi M, Bri J Rheum 36: 637642, 1997
- Non-Patent Document 38 Miyata T, J Clin Invest 92: 1243-1252, 1993
- the present invention relates to a novel compound having an AGE generation inhibitory activity, in particular, a novel compound having an AGE generation inhibitory activity, which is capable of preventing the onset of various diseases considered to be caused by the AGE and ALE and suppressing the progress of symptoms.
- An object of the present invention is to provide a compound, an AGE production inhibitor containing the compound as an active ingredient, and a pharmaceutical composition used for treating and preventing a disease associated with AGE production.
- an object of the present invention is to provide an AGE formation inhibitory additive for cosmetics and foods, which contains the compound having the AGE formation inhibitory activity, a cosmetic product which is hardly deteriorated by AGE formation, and a carohydrate food.
- the present inventors synthesized various compounds in order to find compounds useful for preventing or treating the above-mentioned various diseases, and examined their AGE formation inhibitory activity. As a result, the following general formula (I) was obtained. Or a pharmaceutically acceptable salt thereof has excellent AGE production inhibitory activity.
- the present invention provides a hydroxamic acid derivative which is a compound represented by the following formula (I), and a pharmaceutically acceptable salt of the compound. [0021] [Formula 1]
- formula (I) represents a hydrogen atom, an alkyl group having 1 to 10 carbon atoms, an alkenyl group having 2 to 10 carbon atoms, an aryl group, a heteroaryl group, or a saturated heterocyclic group;
- A independently represents a single bond or an alkylene group having 1 to 6 carbon atoms.
- Q is -Y-A-R aromatic group Q heteroaromatic group Q or saturated cyclic
- Y is one O S-, -NR-, -CONR-, -NR CO- NR COO NR CON
- A represents a single bond or an alkylene group having 1 to 6 carbon atoms
- R is an alkyl group having 1 to 10 carbon atoms, an alkyl group having 2 to 10 carbon atoms,
- a heteroaryl group or a saturated heterocyclic group
- R and R each independently represent a hydrogen atom, an alkyl group, an alkyl group, an aryl group,
- R represents a -toro group, a cyano group or Y n represents an integer from 0 to 4,
- Y is a single bond, O—, — S -NR -CONR -NR CO—, — NR COO—, — N
- each R may be independently substituted on any carbon atom on the ring.
- R and R each independently represent an alkyl group, an alkenyl group, an aryl group, a heteroaryl group;
- Q represents a base selected from the following formula ( ⁇ -b),
- X represents O— or N (—Y—A—R) —, and X and X represent N
- Q may be substituted at any position, 3-10 membered hydrocarbon, or 1 each
- R is a hydrogen atom
- A is a single bond
- A is ethylene or ethylene.
- Q is Q
- R is Y—A R
- Y is an oxygen atom
- A is a methylene
- R is phenyl, R is a hydrogen atom, A is a single bond, A acetylene, and Q is Y—A—R
- R is a hydrogen atom, A is a single bond, A is ethylene, Q is Y—A—R
- A is alkylene
- Q is -Y-A-R
- Y is NR CO
- A is
- the present invention provides a compound of the following formula (III) or a pharmaceutically acceptable salt thereof.
- R represents a hydrogen atom, an alkyl group having 1 to 10 carbon atoms, an alkenyl group having 2 to 10 carbon atoms, an aryl group, a heteroaryl group, or a saturated heterocyclic group.
- a and A each independently represent a single bond or an alkylene group having 1 to 6 carbon atoms.
- R is independently each independently substituted with any carbon atom on the ring.
- R and R each independently represent an alkyl group, an alkenyl group, an aryl group, a heteroaryl group;
- n represents an integer of 0 to 4
- Y represents a single bond, CO—, or so—
- A represents a single bond or an alkylene group having 1 to 6 carbon atoms
- R is an alkyl group having 1 to 10 carbon atoms, an alkyl group having 2 to 10 carbon atoms,
- a heteroaryl group or a saturated heterocyclic group is A heteroaryl group or a saturated heterocyclic group.
- R represents a hydrogen atom, a halogen or an alkyl group.
- the present invention also provides a compound of the formula (III) having the following group, or a pharmaceutically acceptable salt thereof.
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n 0, Y and A are single bonds, and R represents a propyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, and Y is
- A is ethylene, and R represents a phenyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, and Y is
- Is a single bond is A-alkylene, and represents an R-trophin group
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 0, and Y and
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, and Y is
- Is a single bond is A-alkylene, and represents an R-methoxyphenyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, and Y is
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and And A is a single bond, and R represents an octyl group; or
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 0, and Y is
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R represents a 2,2-dimethylpropyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- 1 123 and A are a single bond and represent an R-isobutyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, and Y is
- 1123 is a single bond, is A-alkylene, and represents an R-force fluorophenyl group; or
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 0, and Y and
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R 1123 and A are a single bond, and R represents a cyclohexyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R represents a tetrahydropyran4yl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- 1123 and A are a single bond, and represent an R-methylbiperidine 4-yl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R represents a 2-methylbutyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R 1123 and A are a single bond, and R represents a heptyl group
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 0, and Y is
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, and Y is
- A-alkylene, and R represents a naphthalene-1-yl group; or R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 2
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- 1 1 2 3 and A are a single bond, and represent an R-force methyl group
- R is a propyl group, A is a single bond, A is ethylene, n is 0, Y and
- R 1123 and A are a single bond, and R represents a propyl group
- R is a cyclohexyl group, A acetylene, A is ethylene, and n is 0
- Y and A are a single bond and represent an R-methyl group
- R is a propyl group, A is methylene, A is ethylene, n is 0, and Y is
- 1123 and A are a single bond and represent an R-methyl group
- R is an octyl group
- A is methylene
- A is ethylene
- n is 0, and Y is
- 1123 and A are a single bond and represent an R-methyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, and the R
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a cyclohexyl group, A acetylene, A is ethylene, and n is 0
- Y and A are a single bond, and R represents a propyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- a tyl group which is present in the 5 and 6 positions, Y is a single bond, A acetylene, and R is
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 2
- a tyl group which is present at the 5 and 6 positions, Y is a single bond, A cation, and R force 3 ⁇ 4,
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- R 1123 and A are a single bond, and R represents a phenyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 2, and the R force
- R represents a radical; or R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 0, Y and
- 1 1 2 3 and A are a single bond, and represent an R-force methylphenol group
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- n is 2
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- 1 1 2 3 and A are a single bond, and represent an R-force methylphenol group
- R is a hydrogen atom
- A is a single bond
- n is 0, and Y force S
- Is a single bond is A-alkylene, and has an R-force of 4-t-butylphenyl group; or
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, R force S
- R is a hydrogen atom, A is a single bond, A is ethylene, n is 2, and R is
- the present invention provides a compound of the following formula (IV) or a pharmaceutically acceptable salt thereof.
- R represents a hydrogen atom, an alkyl group having 1 to 10 carbon atoms, an alkenyl group having 2 to 10 carbon atoms, an aryl group, a heteroaryl group, or a saturated heterocyclic group.
- a and A each independently represent a single bond or an alkylene group having 1 to 6 carbon atoms.
- R is each independently substituted with any carbon atom on the ring.
- R may form a ring
- R and R each represent an alkyl group, an aryl group, an aryl group, a heteroaryl group,
- n represents an integer of 0 to 4
- Y represents a single bond, CO—, or SO—
- A represents a single bond or an alkylene group having 1 to 6 carbon atoms, and R represents 1 carbon atom.
- R represents 1 carbon atom.
- R represents a hydrogen atom, or a compound thereof.
- salts that are acceptable.
- the aforementioned compound in which R represents a hydrogen atom and A represents a single bond, or a pharmaceutically acceptable salt thereof is preferable.
- the present invention also provides a compound of the formula (IV) having the following group, or a pharmaceutically acceptable salt thereof.
- R is a hydrogen atom, A is a single bond, A is methylene,
- n 0, Y is a single bond, A-force methylene, and R is 2,4-diphneololofe
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y force S
- Is a single bond is A-alkylene, and represents an R-force trifluorophenyl group
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y force S
- Is a single bond is A-alkylene, and represents an R-trophin group
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y force S
- A is ethylene, and R represents a phenyl group
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y force S
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y force S
- Is a single bond is A-alkylene, and represents an R-t-butylphenyl group; or
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y force S
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y force S A single bond, A-alkylene, and R represents a 3,4-difluorophenyl group;
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- 1 1 2 3 and A are a single bond, and represent an R-force methyl group
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- R 1123 and A are a single bond, and R represents a propyl group
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, Y and
- 1 123 and A are a single bond, and represent an R-force-methylbutyl group.
- the present invention provides a compound of the following formula (V) or a pharmaceutically acceptable salt thereof.
- R represents a hydrogen atom, an alkyl group having 1 to 10 carbon atoms, an alkenyl group having 2 to 10 carbon atoms, an aryl group, a heteroaryl group, or a saturated heterocyclic group;
- A each independently represent a single bond or an alkylene group having 1 to 6 carbon atoms.
- R is each independently substituted with any carbon atom on the ring.
- R may form a ring
- R and R each represent an alkyl group, an alkenyl group, an aryl group, a heteroaryl group,
- the present invention provides a compound represented by the formula (V), wherein A represents methylene, and R is a hydrogen atom.
- the compound or a pharmaceutically acceptable salt thereof is provided.
- the present invention provides the compound of the formula (V) having the following group, or a pharmaceutically acceptable salt thereof.
- R represents a hydrogen atom
- A represents a single bond
- R represents a -tro group
- R or OR R and R each represent Y—R, Y is a single bond, —CO
- R represents -OR, R represents -YR, Y represents ⁇
- R is a benzyl group
- the present invention provides a compound of the formula (V) having the following group, or a pharmaceutically acceptable salt thereof.
- R is a hydrogen atom
- A is a single bond
- R represents -Y-A-R, Y is -NRCO-, R is a hydrogen atom,
- A is a single bond and represents an R-methyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- YA— represents R
- Y is —NR CO—
- R is a hydrogen atom
- A is a single bond
- R represents a S4-methylphenyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y A— represents R, Y is —NR CO—, R is a hydrogen atom, A is a single bond,
- R represents a butyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y A— represents R, Y is —NR CO—, R is a hydrogen atom, A is a single bond,
- R represents a t-butyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0,
- Y A— represents R, Y is —NR CO—, R is a hydrogen atom, and A is methylene
- R represents a fluorophenyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y represents R—R, Y is —NR SO, R is a hydrogen atom, and A is a single bond
- R represents a methylphenyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y represents A—R
- Y is —NR CONR
- R and R are hydrogen atoms
- A is
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y A— represents R, Y is —NR COO—, R is a hydrogen atom, and A is a single bond
- R is a hydrogen atom, A is a single bond, A is methylene, n is 0,
- Y A — represents R, Y is —NR CONR, R is a hydrogen atom, and A is a single bond
- R is a hydrogen atom, A is a single bond, A is methylene, n is 0, and R is
- Y A— represents R, Y is —NR—, A is a single bond, and R and R are
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y represents A—R, Y is —NR—, A is methylene, R is a hydrogen atom,
- R represents a methylphenol group
- R is a hydrogen atom
- A is a single bond
- a acetylene is 0, and R
- R is a phenyl group, is A-camethylene, is A-camethylene, n is 0, and
- R represents a -toro group
- R is a pyridine 2-yl group, is A-camethylene, is A-camethylene, and n is 0
- R represents a nitro group
- R is a propyl group, A is a single bond, A is methylene, n is 0, and
- R represents a -toro group
- R is a cyclohexyl group, is Acamethylene, is Acamethylene, n is 0
- R represents a -toro group
- R is a propyl group, A is a single bond, A acetylene, n is 0,
- R represents a -toro group
- R is a cyclohexyl group, A is a single bond, A is methylene, n is 0,
- R represents a -toro group
- R-methylbiperazine 4-yl group A is a single bond and A is methylene
- N is 0 and R represents a -toro group
- R is a hydrogen atom, A is a single bond, A is methylene, n is 0, and R is
- Y A— represents R, Y is —O—, A is ethylene, and R is a phenyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0,
- Y A— represents R, Y is —O—, A is a single bond, and R represents a propyl group
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y A— represents R, Y is —O—, A is ethylene, and R is morpholine 4—
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- R is a hydrogen atom
- A is a single bond
- a alkylene is a single bond
- n is 0, and R is
- Y represents A—R
- Y represents —O—
- A represents a single bond
- R represents a pentyl group.
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y represents A—R, Y is —O—, A is S methylene, and R is fluoro
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y represents A—R, where Y is —O—, A cation, and R is naphthalene 2—
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y represents A—R, Y is —O—, A is S methylene, and R is S2—
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y A— represents R, where Y is —O—, A is S methylene, and R is trifluoromethane
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0,
- Y represents A—R, where Y is —O—, A is ethylene, and R is 2, 3, 4, 5, 6—
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y A— represents R, where Y is —O—, A force is S methylene, and R force is S 2—bihule-ru
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0, and R is
- Y represents A—R, where Y is —O—, A is ethylene, and R is 412
- R is a hydrogen atom, A is a single bond, A alkylene, n is 0,
- R is a hydrogen atom, A is a single bond, A acetylene, n is 0, and R is-
- Y represents A—R, where Y is —O—, A is S methylene, and R is S4—Cyanophe
- the present invention provides a compound of the following formula (VI) or a pharmaceutically acceptable salt thereof.
- R represents a hydrogen atom, an alkyl group having 1 to 10 carbon atoms, an alkenyl group having 2 to 10 carbon atoms, an aryl group, a heteroaryl group, or a saturated heterocyclic group.
- a and A each independently represent a single bond or an alkylene group having 1 to 6 carbon atoms.
- R is an alkyl group having 1 to 10 carbon atoms, an alkyl group having 2 to 10 carbon atoms,
- a heteroaryl group or a saturated heterocyclic group
- Y represents a single bond or a carboxyl group; Y represents a single bond, CO—, —COO—, CONR
- R and R represent a hydrogen atom, an alkyl group, an alkyl group, an aryl group,
- a reel group a saturated heterocyclic group, an aryl group or a heteroaryl group, and an alkylene group having 13 to 13 carbon atoms.
- the present invention provides the above-mentioned chemical formula, wherein in formula (VI), A represents ethylene or propylene. Or a pharmaceutically acceptable salt thereof. Further, the present invention provides the above compound, or a pharmaceutically acceptable salt thereof, wherein R represents a hydrogen atom and A represents a single bond in formula (VI).
- the present invention provides the compound of formula (VI) having the following group, or a pharmaceutically acceptable salt thereof.
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- Y is a carboyl group, Y is a single bond, R is a hydrogen atom, and R is naphtha
- R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carboyl group
- Y is a single bond
- R is a hydrogen atom
- R is a 4 t-butylphenyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carboyl group
- Y is a single bond
- R is a hydrogen atom
- R force fluorobenzyl group is
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- Y is a carbonyl group
- Y is a single bond
- R is a hydrogen atom
- R is a 4 t-butylbenzyl group
- R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carboyl group
- Y is a single bond, R is a hydrogen atom, and R represents a cyclohexyl group;
- R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carboyl group
- Y is a single bond
- R is a hydrogen atom
- R is 2,2-diphenyl-ruethyl
- R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carboyl group
- Y is a single bond
- R is a hydrogen atom
- R is pyridine 2-ylmethyl
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- Y is a carbonyl group
- Y is a single bond, R is a methyl group, and R represents a benzyl group; or R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carbonyl group
- Y is a single bond, R is an ethyl group, and R represents an ethyl group;
- R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carbonyl group
- Y is a single bond, and R and R are pentylene groups to form a ring;
- R is a hydrogen atom, A is a single bond, A is ethylene, Y is a carbonyl group
- Y is a single bond, R is a hydrogen atom, and R is an adamantane 1-yl group
- R is a hydrogen atom
- A is a single bond
- A is ethylene
- Y is a carbonyl group
- Y is a single bond, R is a hydrogen atom, and R represents a benzyl group;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is -CO-, R is a hydrogen atom and represents an R-methyl group;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is -CO-, R is a hydrogen atom, and represents an R-phenyl group; or
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y represents —CO—, R represents a hydrogen atom, and R represents —nitrophenyl group;
- R is a hydrogen atom
- A is a single bond
- A is propylene
- Y is a single bond
- Y is -CO-, R is a hydrogen atom, and R represents a nitrobenzinole group;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is -CO-, R is a hydrogen atom, and R represents a naphthalene 1-yl group;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is -CO-, R is a hydrogen atom, and R represents a naphthalene-2-yl group;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is -CO-, R is a hydrogen atom, and R is a cyclohexylmethyl group.
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond.
- Y is -CO-, R is a hydrogen atom, and R represents a hydrogen atom;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is —CO—, R is a hydrogen atom, and R represents a Benzhydryl group; or
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is —CO—
- R is a hydrogen atom
- R represents 2-phenylpentyl group.
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is -CO-
- R is a hydrogen atom
- R is 3,5-dibutylbutyl
- R is a hydrogen atom
- A is a single bond
- A is propylene
- Y is a single bond
- Y is -CO-, R is a hydrogen atom, and R represents a t-butyl group; or
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is a single bond, R is a propyl group, and R represents a propyl group;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is a single bond, R is a pentyl group, and R represents a pentyl group; or
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is a single bond, R is a hydrogen atom, and R represents a cyclohexyl group;
- R is a hydrogen atom, A is a single bond, A is propylene, and Y is a single bond
- Y is a single bond
- R is a methylbenzyl group
- R is methylbenzyl
- an AGE production inhibitor comprising a compound of the following formula (VII) or a pharmaceutically acceptable salt thereof.
- R represents an alkyl group having 1 to 10 carbon atoms, an aryl group,
- a and A each independently represent a single bond or an alkylene group having 1 to 6 carbon atoms.
- Q is -Y-A-R, an aromatic ring compound group Q, a heteroaromatic ring compound group Q, or a saturated ring
- Y is a single bond, O—, — S -NR -CONR -NR CO — NR COO—
- A represents a single bond or an alkylene group having 1 to 6 carbon atoms
- R is hydrogen atom, alkyl group having 1 to 10 carbon atoms, aryl group, heteroaryl
- R and R represent an alkyl group having 1 to 6 carbon atoms, an aryl group, and a heteroaryl, respectively.
- R is a hydrogen atom, a halogen, a nitro group, a cyano group, or Y A—Represents R,
- n an integer from 0 to 4
- R may be independently substituted on any carbon atom on the ring
- R and R may form a ring with each other
- R and R represent an alkyl group having 1 to 6 carbon atoms, an aryl group, and a heteroaryl, respectively.
- X represents one O—S— or N (—Y—A—R) —, X and
- Q may be substituted at any position, 3-10 membered hydrocarbon, or 1 each
- the present invention provides a medical composition, a food additive composition, and a cosmetic composition containing the AGE generation inhibitor.
- a medical composition comprising an additive composition for use in the present invention and the AGE production inhibitor.
- the AGE production inhibitor of the present invention can also be used as a Maillard reaction inhibitor or a protein-modified product inhibitor, and the pharmaceutical composition of the present invention is useful for treating diabetic complications. It is also used as a remedy and prophylactic, as well as a drug for Alzheimer's disease, dialysis amyloidosis and a preventive drug! / You can.
- the compound or salt of the present invention may be its enantiomer S or R, or a mixture of both in any ratio.
- inhibiting AGE production refers to inhibiting the progress of the protein sugar reaction and inhibiting the formation of AGE and ALE.
- an alkyl group is a general term for a functional group consisting of a straight-chain, branched-chain, or cyclic hydrocarbon, and means a group having 116 carbon atoms unless otherwise specified. Examples thereof include methyl and ethyl.
- the alkylene group is a general term for a functional group consisting of a straight-chain, branched-chain, or cyclic hydrocarbon, which is connected by substitution at the terminal and at the two positions indicated by the prefix.
- methylene 1- Examples include ethylene, 2-ethylene, 1-propylene, 2-propylene, 3-propylene, 1-butylene, 2-butylene, 3-butylene, and 4-butylene.
- the aryl group is a general term for an aromatic hydrocarbon group, and includes, for example, benzene, naphthalene, indene, anthracene, and phenanthrene.
- a heteroaryl group is an aromatic cyclic conjugate having one or more nitrogen, oxygen, sulfur, etc., for example, pyrrole, furan, thiophene, imidazole, thiazole, oxazole, triazole, pyridine, Pyrimidine, pyridazine, pyrazine, quinoline, isoquinoline, indole, benzofuran, benzothiophene and the like.
- the aralkyl group is a general term for a functional group having the above aryl group and an alkylene group, and includes, for example, benzyl, phenethyl, phenylpropyl, 1-naphthylmethyl and 2-naphthylmethyl.
- a haloalkyl group is a generic term for an alkyl group in which an arbitrary number of halogen atoms are substituted on the alkyl group, and includes, for example, trifluoromethyl, trifluoroethyl, pentafluoroethyl, trifluoropropyl, and heptapropyl. Fluoropropyl and the like.
- Saturation Heterocyclic group is a general term for a 3- to 7-membered cyclic alkyl group containing one or two oxygen atoms, nitrogen atoms and sulfur atoms, and examples thereof include oxysilane, thiirane, aziridine, tetrahydrofuran, tetrahydropyran, pyrrolidine, and pyrrolidine. There are peridine and piperazine.
- the asymmetric compound described in the present specification has an asymmetric center derived from the main skeleton or the side chain, and these are distinguished by the absolute configuration, and the prefix (R)-, ( S)-or (RS)-.
- the protecting group used in the present specification and represented by P is a normal protecting group usually used in peptidylamide, etc., for example, in the case of an amino group, a benzyloxycarbonyl group, There are t-butoxycarbol group, 9-fluorenylmethylcarbol group, benzyl group, formyl group and trityl group, and in the case of carboxyl group, methyl group, ethyl group, benzyl group, etc. In the case of the nitrogen atom on the indole ring, there are formyl group, trityl group, benzyl group, t_butoxycarbonyl group, etc. There are groups.
- an effective AGE production inhibitor and a pharmaceutical composition used for treatment and prevention of a disease associated with AGE production can be obtained. Further, in cosmetics and foods containing proteins and amino acids, the degradation of proteins and amino acids by AGE formation occurs in AGEs, so that the compounds of the present invention are also useful in cosmetics and foods. Therefore, according to the present invention, an AGE formation inhibitory additive for cosmetics and foods having an effective AGE formation inhibitory activity, and a cosmetic and processed food which are less likely to deteriorate due to AGE formation are obtained.
- FIG. 1 is an explanatory reaction diagram showing Production Example 1 which is a method for producing a compound of formula (VI) (linear hydroxamic acid derivative).
- FIG. 2 is a reaction explanatory diagram showing Production Example 2 which is a method for producing a compound of formula (VI) (linear hydroxamic acid derivative).
- FIG. 3 is a reaction explanatory diagram showing Production Example 3 which is a method for producing a compound of the formula (V) (furanalanine-type hydroxamic acid derivative).
- FIG. 4 shows a method for producing a compound of formula (V) (a phenylalanine-type hydroxamic acid derivative)
- FIG. 4 is an explanatory diagram of a reaction showing Production Example 4 as follows.
- FIG. 5 is a reaction explanatory diagram showing Production Example 5 which is a method for producing a compound of the formula (III) (benzimidazole-type hydroxamic acid derivative).
- FIG. 6 is a reaction explanatory diagram showing Production Example 6 which is a method for producing the compound of the formula (IV) (tributophan-type hydroxamic acid derivative).
- FIG. 7 is a reaction explanatory diagram showing Production Example 7 which is a method for producing a compound of the formula (III) (benzimidazole-type hydroxamic acid derivative).
- FIG. 8 is a reaction explanatory diagram showing Production Example 8 which is a method for producing a compound of the formula (III) (benzimidazole-type hydroxamic acid derivative).
- FIG. 9 is a reaction explanatory diagram showing Production Example 9 which is a method for producing a compound of the formula (IV) (tributophan-type hydroxamic acid derivative).
- FIG. 10 is a reaction explanatory diagram showing Production Example 10 which is a method for producing a compound of the formula (V) (a phenylalanine-type hydroxamic acid derivative).
- FIG. 11 is a reaction explanatory view showing Production Example 11 which is a method for producing a compound of the formula (V) (a phenylalanine-type hydroxamic acid derivative).
- FIG. 12 is a reaction explanatory diagram showing Production Example 12 which is a method for producing a compound of the formula (V) (a phenylalanine-type hydroxamic acid derivative).
- FIG. 13 is a reaction explanatory diagram showing Production Example 13 which is a method for producing a compound of the formula (V) (a phenylalanine-type hydroxamic acid derivative).
- the compound in the form of a pharmaceutically acceptable salt.
- the salts are addition salts of organic or inorganic acids.
- the inorganic acid addition salts include, for example, hydrofluoric acid, hydrochloride, hydrobromide, nitrate, sulfate, hydrogen sulfate, phosphate, monobasic phosphate, dibasic phosphate , Acetate and the like.
- salt formation can also be performed using a base compound, for example, sodium hydroxide, potassium hydroxide, calcium hydroxide, sodium carbonate, lithium hydrogen carbonate, or the like.
- Organic acid addition salts include fatty acids such as monocarboxylic acids, dicarboxylic acids, hydroxyalkanoic acids, hydroxyalkanediacids, and amino acids, or aromatic acids, fatty acids, and aromatic salts.
- Salts derived from non-toxic organic acids such as sulfonic acid, e.g., methanesulfonate, sulfamate, tartrate, fumarate, glycolate, citrate, maleate, lingoate Salt, succinate, acetate, benzoate, ascorbate, P-toluenesulfonate, benzenesulfonate, naphthalenesulfonate, propionate, lactate, pyruvate, oxalate, There are stearates, ky citrate, aspartate, salicylate, dalconate and the like.
- Such acid addition salts usually have favorable pharmaceutical and therapeutic properties with good dispersibility and absorbability.
- the acid addition salts are well known in the art of the present invention, and can be easily prepared by contact with a suitable acid or base.
- Production Example 1 is a method for producing a compound of the formula (VI) (linear hydroxamic acid derivative). The production method will be described based on the reaction explanatory diagram in FIG.
- DMF dimethylformamide
- THF tetrahydrofuran
- the compound (la) obtained in Step 1-1 is suspended in an organic solvent such as DMF, chloroform, methylene chloride and the like, and the protected amino acid represented by (lb) (n is an integer of 13; Represents a suitable protecting group.
- organic solvent such as DMF, chloroform, methylene chloride and the like
- DIC Diisopropylcarbodiimide
- WSCI dimethylaminopropylethylcarbodiimide
- HOBt 1-hydroxybenzotriazole
- the protecting group P in the compound (lc) obtained in Step 1-2 is removed under appropriate conditions. For example,
- a basic aqueous solution of sodium, lithium hydroxide, potassium carbonate or the like is added and reacted for 3 to 72 hours at room temperature to remove P to obtain a compound (Id).
- the compound (Id) obtained in Steps 1-3 is suspended in an organic solvent such as DMF, chloroform, methylene chloride, etc., and the amine represented by (le), a condensing agent such as DIC and WSCI hydrochloride, and
- the target compound (ID) is obtained by adding an auxiliary such as HOBt and stirring at room temperature for 2-72 hours.
- the target compound (lg) is obtained by performing the dispensing simultaneously or independently.
- the protecting group is a t-butoxycarbonyl group (hereinafter referred to as Boc)
- deprotection and cleavage can be performed simultaneously by the action of a strong acid such as trifluoroacetic acid.
- Production Example 2 is another method for producing the compound of the formula (VI) (linear hydroxamic acid derivative). The production method will be described with reference to the reaction explanatory diagram of FIG.
- the compound (la) obtained in the step 1-1 is suspended in an organic solvent such as DMF, chloroform and methylene chloride, and the protected amino acid represented by (2a) (n is an integer of 14; Represents a suitable protecting group.
- organic solvent such as DMF, chloroform and methylene chloride
- a condensing agent such as DIC or WSCI hydrochloride, and an auxiliary such as HOBt, and the mixture is stirred at room temperature for 2-72 hours to obtain the desired compound (2b).
- the protecting group P in the compound (2b) obtained in Step 2-1 is removed under appropriate conditions. For example,
- P is a 9-fluoromethoxycarbol group (hereinafter referred to as Fmoc), DMF, THF,
- the compound (2c) obtained in Step 2-2 is acylated or alkylated.
- the compound (2c) is suspended in an organic solvent such as DMF, chloroform and methylene chloride, and the acid represented by (2d) (R "is alkyl, aryl, etc., X is carboxyl
- the compound can be obtained by adding a condensing agent such as DIC or WSCI hydrochloride, and an auxiliary such as HOBt, and stirring at room temperature for 2-72 hours.
- the target compound (2D is obtained simultaneously or independently of each other.
- the protecting group is a t-butoxycarbonyl group
- deprotection and cleavage are simultaneously performed by the action of a strong acid such as trifluoroacetic acid. You can do it.
- Production Example 3 is a method for producing a compound of the formula (V) (a phenylalanine-type hydroxamic acid derivative). The production method will be described based on the reaction explanatory diagram of FIG.
- the compound (la) obtained in Step 1-1 is suspended in an organic solvent such as DMF, chloroform, methylene chloride, etc., and the protected amino acid represented by (3a), a condensing agent such as DIC or WSCI hydrochloride, and
- the target compound (3b) is obtained by adding an auxiliary such as HOBt and stirring at room temperature for 2-72 hours.
- the protecting group P in the compound (3b) obtained in Step 3-1 is removed under appropriate conditions. For example,
- Step 3-3 The compound obtained in Step 3-2 is acylated or alkylated.
- the compound (3c) is suspended in an organic solvent such as DMF, chloroform and methylene chloride, and the acid represented by (3d) (R ⁇ is alkyl, aryl, etc., X is carboxyl) DIC, or a condensing agent such as WSCI hydrochloride, and an auxiliary agent such as HOBt, and stirred at room temperature for 2 to 72 hours, and (3d) represents an acid chloride and an equivalent (X represents- C0C1, -SO Cl, or -NCO)
- the desired compound (3e) can be obtained by reacting with an base such as triethylamine or dimethylaminopyridine in an organic solvent such as DMF, and in the case of alkylation, it is represented by (3d).
- an base such as triethylamine or dimethylaminopyridine
- organic solvent such as DMF
- Aldehyde R represents an alkyl group, aryl group, etc.
- X represents an aldehyde group
- a reducing agent such as sodium borohydride, sodium cyanoborohydride, etc.
- the protecting group is a t-butoxycarbonyl group
- deprotection and cleavage can be performed simultaneously by the action of a strong acid such as trifluoroacetic acid. I can do it.
- Production Example 4 is another method for producing the compound of the formula (V) (a phenylalanine-type hydroxamic acid derivative). The production method will be described based on the reaction explanatory diagram of FIG.
- the compound (la) obtained in Step 1-1 is suspended in an organic solvent such as DMF, chloroform, methylene chloride, etc., and the protected amino acid represented by (4a), a condensing agent such as DIC or WSCI hydrochloride, and An auxiliary such as HOBt is added, and the mixture is stirred at room temperature for 2-72 hours, and further washed under basic conditions to obtain the desired compound (4b).
- an organic solvent such as DMF, chloroform, methylene chloride, etc.
- a condensing agent such as DIC or WSCI hydrochloride
- An auxiliary such as HOBt
- the compound (4b) obtained in Step 4-1 is acylated or alkylated.
- the compound (4b) is suspended in an organic solvent such as DMF, chloroform and methylene chloride, and a reagent having a leaving group represented by (4c) (R is an alkyl group, an aralkyl group, etc., X is A halogen atom, a tosyloxy group, etc.) and a base such as sodium hydride and cesium carbonate.
- an organic solvent such as DMF, chloroform and methylene chloride
- a reagent having a leaving group represented by (4c) R is an alkyl group, an aralkyl group, etc.
- X is A halogen atom, a tosyloxy group, etc.
- a base such as sodium hydride and cesium carbonate
- the target compound (4e) is obtained by performing the dispensing simultaneously or independently.
- the protecting group is a t-butoxycarbonyl group
- deprotection and cleavage can be performed simultaneously by the action of a strong acid such as trifluoroacetic acid.
- Production Example 5 is a method for producing a compound of the formula (III) (benzimidazole-type hydroxamic acid derivative). The production method will be described based on the reaction explanatory diagram of FIG.
- the compound (Id) obtained in step 1-3 is suspended in an organic solvent such as DMF, chloroform, methylene chloride, etc., and the 1,2-phenylenediamine represented by (5a) (R ′ is an alkyl Group, halogen atomic ruboxyl group, etc., and n represents the number of groups substituted at any position of 1-4), DIC, or a condensing agent such as WSCI hydrochloride, and an auxiliary agent such as HOBt.
- the target compound (5b) is obtained by stirring at room temperature for 2-72 hours.
- the compound (5b) obtained in Step 5-1 is suspended in an organic solvent such as DMF, chloroform and methylene chloride, and the aldehyde or ketone represented by (5c) (R "represents an alkyl or aryl group) In the case of ketones, R '"represents the same or different group as R" and has the same meaning as R ") and a combination of sodium borohydride, sodium cyanoborohydride or the like, or A reagent having a leaving group represented by (5c) (R ⁇ represents an alkyl group, an aralkyl group, X represents a halogen atom or a tosyloxy group) and a base such as sodium hydride, cesium carbonate, etc. Then, the compound (5d) is obtained.
- an organic solvent such as DMF, chloroform and methylene chloride
- R ' represents the same or different group as R" and has the same meaning as R ”
- the desired compound (5e) is obtained by suspending the compound (5d) obtained in the step 5-2 in an organic acid such as acetic acid and stirring the mixture at room temperature and 100 ° C for 1 to 72 hours.
- the target compound is obtained by removing the protecting group P in the compound (5e) obtained in Step 5-3.
- P is a t-butoxycarbol group
- a strong acid such as trifluoroacetic acid
- Production Example 6 is a method for producing a compound of the formula (IV) (tributophan-type hydroxamic acid derivative). The production method will be described with reference to the reaction explanatory diagram of FIG.
- step 1-1 The compound (la) obtained in step 1-1 is suspended in an organic solvent such as DMF, chloroform, methylene chloride, and the like, and the protected amino acid represented by (6a), a condensing agent such as DIC and WSCI hydrochloride, and An auxiliary such as HOBt is added, and the mixture is stirred at room temperature for 2-72 hours, and further washed under basic conditions to obtain the desired compound (6b).
- organic solvent such as DMF, chloroform, methylene chloride, and the like
- 6a condensing agent such as DIC and WSCI hydrochloride
- An auxiliary such as HOBt
- the protecting group P in the compound (6b) obtained in Step 6-1 is removed under appropriate conditions. For example,
- Step 6-2 The compound obtained in Step 6-2 is reacted with a reagent having a leaving group represented by (6d) (R represents an alkyl group, an aralkyl group, X represents a halogen atom or a tosyloxy group), sodium hydride, Combinations of bases such as cesium, or alcohols represented by (6d) (R represents an alkyl group, an aralkyl group, an aryl group, etc., and X represents a hydroxyl group), an azodicarboxylate, triphenylphosphine, etc. Alkylation gives compound (6e).
- the target compound (6D is obtained by simultaneously or independently removing the protecting group P1 and excising the supporting solid phase from the compound (6e) obtained in Step 6-3.
- deprotection and cleavage can be performed simultaneously by the action of a strong acid such as trifluoroacetic acid.
- Production Example 7 is a method for producing a compound of the formula (III) (benzimidazole-type hydroxamic acid derivative). The production method will be described with reference to the reaction explanatory diagram of FIG.
Abstract
Description
Claims
Priority Applications (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US10/583,856 US20080132539A1 (en) | 2003-12-25 | 2004-12-27 | Hydroxamic Acid Derivative And Age Generation Inhibitor Containing The Derivative |
JP2005517390A JPWO2005073180A1 (ja) | 2003-12-25 | 2004-12-27 | ヒドロキサム酸誘導体、及び該誘導体を含むage生成阻害剤 |
EP04807867A EP1707560A4 (en) | 2003-12-25 | 2004-12-27 | HYDROXAMIC ACID DERIVATIVE AND THE DERIVATIVE INHIBITOR OF THE GENERATION OF AGE |
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2003-428901 | 2003-12-25 | ||
JP2003428901 | 2003-12-25 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2005073180A1 true WO2005073180A1 (ja) | 2005-08-11 |
Family
ID=34815121
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/JP2004/019512 WO2005073180A1 (ja) | 2003-12-25 | 2004-12-27 | ヒドロキサム酸誘導体、及び該誘導体を含むage生成阻害剤 |
Country Status (4)
Country | Link |
---|---|
US (1) | US20080132539A1 (ja) |
EP (1) | EP1707560A4 (ja) |
JP (1) | JPWO2005073180A1 (ja) |
WO (1) | WO2005073180A1 (ja) |
Cited By (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US7375228B2 (en) * | 2003-03-17 | 2008-05-20 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
JP2021102645A (ja) * | 2016-04-18 | 2021-07-15 | ビーボリヨン・セラピューティクス・アーゲー | メプリンアルファ及びベータの新規な阻害剤 |
US11485705B2 (en) | 2015-07-24 | 2022-11-01 | Lumos Pharma, Inc. | Salts and prodrugs of 1-methyl-d-tryptophan |
Families Citing this family (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US8242174B2 (en) | 2007-02-01 | 2012-08-14 | Panthera Biopharma Llc | Hydroxamic acid derivatives of aniline useful as therapeutic agents for treating anthrax poisoning |
Citations (12)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB1221238A (en) * | 1967-12-22 | 1971-02-03 | Merck & Co Inc | 0-ethyl threonine and its derivatives |
US3950542A (en) * | 1967-02-21 | 1976-04-13 | L'oreal | Cysteamine derivatives for oral treatment of seborrhea |
US4077998A (en) * | 1975-10-28 | 1978-03-07 | Morton-Norwich Products, Inc. | Phthaloyl amino acid hydroxamic acids |
WO1990009380A1 (en) * | 1989-02-10 | 1990-08-23 | Otsuka Pharmaceutical Co., Ltd. | Indole derivatives, preparation thereof, and drug for preventing and treating nephritis containing same |
JPH0374370A (ja) * | 1989-08-16 | 1991-03-28 | Terumo Corp | ピラジン誘導体およびこれを含有する血小板凝集抑制剤または抗炎症剤 |
JPH0881443A (ja) * | 1994-09-12 | 1996-03-26 | Otsuka Pharmaceut Co Ltd | 細胞外マトリックス金属プロテアーゼ阻害剤 |
JP2001500533A (ja) * | 1997-07-10 | 2001-01-16 | フアルマシア・エ・アツプジヨン・エツセ・ピー・アー | マトリックスメタロプロテイナーゼ・インヒビター |
WO2001062296A2 (en) * | 2000-02-24 | 2001-08-30 | Monsanto Technology Llc | Non-aqueous injectable formulations for extended release of somatotropin |
WO2002000261A2 (en) * | 2000-06-26 | 2002-01-03 | Monsanto Technology Llc | Surfactant-containing formulations for extended release of somatotropin |
WO2002000593A2 (en) * | 2000-06-23 | 2002-01-03 | Sigma-Tau Industrie Farmaceutiche Riunite S.P.A. | Compounds useful for the preparation of medicaments with phosphodiesterase iv inhibitory activity |
WO2002069965A1 (en) * | 2001-03-05 | 2002-09-12 | Transtech Pharma, Inc. | Benzimidazole derivatives as therapeutic agents |
JP2003523994A (ja) * | 2000-02-24 | 2003-08-12 | スミスクライン ビーチャム パブリック リミテッド カンパニー | 新規cd23インヒビター |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3455783A (en) * | 1966-03-11 | 1969-07-15 | American Home Prod | Control of enzyme activity in nonfluid gels |
US5238938A (en) * | 1989-02-10 | 1993-08-24 | Otsuka Pharmaceutical Co., Ltd. | Indole derivatives |
CA2134347C (en) * | 1993-02-26 | 2003-04-29 | Koichi Yasumura | Thiazole or imidazole derivatives as maillard reaction inhibitors |
US5594006A (en) * | 1993-03-18 | 1997-01-14 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives as matrix metalloproteinases inhibitors |
JPH11124379A (ja) * | 1997-10-17 | 1999-05-11 | Ss Pharmaceut Co Ltd | ジチオリリデンアセトアミド誘導体 |
-
2004
- 2004-12-27 US US10/583,856 patent/US20080132539A1/en not_active Abandoned
- 2004-12-27 EP EP04807867A patent/EP1707560A4/en not_active Withdrawn
- 2004-12-27 JP JP2005517390A patent/JPWO2005073180A1/ja active Pending
- 2004-12-27 WO PCT/JP2004/019512 patent/WO2005073180A1/ja not_active Application Discontinuation
Patent Citations (12)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3950542A (en) * | 1967-02-21 | 1976-04-13 | L'oreal | Cysteamine derivatives for oral treatment of seborrhea |
GB1221238A (en) * | 1967-12-22 | 1971-02-03 | Merck & Co Inc | 0-ethyl threonine and its derivatives |
US4077998A (en) * | 1975-10-28 | 1978-03-07 | Morton-Norwich Products, Inc. | Phthaloyl amino acid hydroxamic acids |
WO1990009380A1 (en) * | 1989-02-10 | 1990-08-23 | Otsuka Pharmaceutical Co., Ltd. | Indole derivatives, preparation thereof, and drug for preventing and treating nephritis containing same |
JPH0374370A (ja) * | 1989-08-16 | 1991-03-28 | Terumo Corp | ピラジン誘導体およびこれを含有する血小板凝集抑制剤または抗炎症剤 |
JPH0881443A (ja) * | 1994-09-12 | 1996-03-26 | Otsuka Pharmaceut Co Ltd | 細胞外マトリックス金属プロテアーゼ阻害剤 |
JP2001500533A (ja) * | 1997-07-10 | 2001-01-16 | フアルマシア・エ・アツプジヨン・エツセ・ピー・アー | マトリックスメタロプロテイナーゼ・インヒビター |
WO2001062296A2 (en) * | 2000-02-24 | 2001-08-30 | Monsanto Technology Llc | Non-aqueous injectable formulations for extended release of somatotropin |
JP2003523994A (ja) * | 2000-02-24 | 2003-08-12 | スミスクライン ビーチャム パブリック リミテッド カンパニー | 新規cd23インヒビター |
WO2002000593A2 (en) * | 2000-06-23 | 2002-01-03 | Sigma-Tau Industrie Farmaceutiche Riunite S.P.A. | Compounds useful for the preparation of medicaments with phosphodiesterase iv inhibitory activity |
WO2002000261A2 (en) * | 2000-06-26 | 2002-01-03 | Monsanto Technology Llc | Surfactant-containing formulations for extended release of somatotropin |
WO2002069965A1 (en) * | 2001-03-05 | 2002-09-12 | Transtech Pharma, Inc. | Benzimidazole derivatives as therapeutic agents |
Non-Patent Citations (4)
Title |
---|
EL-EZABY M.S. ET AL: "Complexes of hydroxamates. V: Equilibrium and kinetics of the formation of the binary and ternary complexes involved in the nickel (II)- histidinehydroxamic acid-pyridoxal system", JOURNAL OF INORGANIC BIOCHEMISTRY, vol. 33, no. 3, 1988, pages 161 - 174, XP002990907 * |
LEE J. ET AL: "Methio analogs as inhibitors of methionyl-tRNA synthetase", BIOORGANIC & MEDICINAL CHEMISTRY LETTERS, vol. 8, no. 24, 1998, pages 3511 - 3514, XP004819383 * |
See also references of EP1707560A4 * |
VERLEYSEN K. ET AL: "Enantiomeric separation of some amino acids and derivatives by capillary electrophoresis with 18-crown-6-tetracarboxylic acid as chiral selector", JOURNAL OF MICROCOLUMN SEPARATIONS, vol. 11, no. 1, 1999, pages 37 - 43, XP002990906 * |
Cited By (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US7375228B2 (en) * | 2003-03-17 | 2008-05-20 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
US11485705B2 (en) | 2015-07-24 | 2022-11-01 | Lumos Pharma, Inc. | Salts and prodrugs of 1-methyl-d-tryptophan |
JP2021102645A (ja) * | 2016-04-18 | 2021-07-15 | ビーボリヨン・セラピューティクス・アーゲー | メプリンアルファ及びベータの新規な阻害剤 |
JP7179114B2 (ja) | 2016-04-18 | 2022-11-28 | ビボリョン セラピューティクス エヌブイ | メプリンアルファ及びベータの新規な阻害剤 |
Also Published As
Publication number | Publication date |
---|---|
EP1707560A4 (en) | 2007-10-17 |
US20080132539A1 (en) | 2008-06-05 |
JPWO2005073180A1 (ja) | 2008-01-10 |
EP1707560A1 (en) | 2006-10-04 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CN104910161B (zh) | 作为jak抑制剂的吡唑并嘧啶化合物和方法 | |
EP1861403B1 (fr) | NOUVEAUX DERIVES D'IMIDAZO[1,5-a]PYRIDINES, LEUR PROCEDE DE PREPARATION ET LES COMPOSITIONS PHARMACEUTIQUES LES CONTENANT | |
JP5822844B2 (ja) | 1H−ピラゾロ[3,4−b]ピリジンおよびその治療的使用 | |
RU2427582C2 (ru) | Пролекарства ингибитора каспазы | |
CN103958479B (zh) | 吡唑并喹啉酮衍生物、其制备和其治疗用途 | |
CN107207514A (zh) | 稠环杂芳基化合物及其作为trk抑制剂的用途 | |
CN103797006B (zh) | 用作端锚聚合酶抑制剂的4-哌啶基化合物 | |
JP2015180681A (ja) | Wntシグナル経路のインダゾール阻害剤およびその治療的使用 | |
CN110139864A (zh) | 作为αV整联蛋白抑制剂的吡咯酰胺 | |
TW201605850A (zh) | 經取代吡唑并[1,5-a]吡啶-3-羧醯胺類及其用途 | |
KR20110091550A (ko) | 5-ht2b 수용체 길항활성을 가지는 신규 피라졸-3-카복사미드 유도체 | |
WO2023246656A1 (zh) | Sos1蛋白降解靶向嵌合体及其组合物、制剂和用途 | |
WO2022253101A1 (zh) | 作为parp7抑制剂的哒嗪酮类化合物 | |
WO2005028476A1 (fr) | Derives d'indolizine 1,2,3,6,7,8 substituee, inhibiteurs des fgfs, leur procede de preparation et les compositions pharmaceutiques les contenant | |
WO2023284651A1 (zh) | N-(2-氨基苯基)苯甲酰胺类化合物及其应用 | |
JP3287574B2 (ja) | 2,7−置換オクタヒドロ−1h−ピリド[1,2−a]ピラジン誘導体 | |
WO2005073180A1 (ja) | ヒドロキサム酸誘導体、及び該誘導体を含むage生成阻害剤 | |
JP3537446B2 (ja) | 三環性ベンゾアゼピン化合物 | |
WO2019085996A1 (zh) | 作为mTORC1/2双激酶抑制剂的吡啶并嘧啶类化合物 | |
JP3874438B2 (ja) | 置換β−アミノ酸残基を有するフィブリノーゲン受容体拮抗物質およびそれを有効成分とする医薬製剤 | |
US5932606A (en) | Pyrazinone, pyridinone, piperidine and pyrrolidine thrombin inhibitors | |
JP2008179567A (ja) | ピラジン誘導体を有効成分とする抗がん剤 | |
JP2000512305A (ja) | 環縮合したジヒドロピラン類、その製造方法およびその使用 | |
CN113135929A (zh) | 呋喃并吡啶酮酰胺化合物及其制备方法和用途 | |
PT98902A (pt) | Processo para a preparacao de derivados de diazepina uteis como agentes terapeuticos |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
AK | Designated states |
Kind code of ref document: A1 Designated state(s): AE AG AL AM AT AU AZ BA BB BG BR BW BY BZ CA CH CN CO CR CU CZ DE DK DM DZ EC EE EG ES FI GB GD GE GH GM HR HU ID IL IN IS JP KE KG KP KR KZ LC LK LR LS LT LU LV MA MD MG MK MN MW MX MZ NA NI NO NZ OM PG PH PL PT RO RU SC SD SE SG SK SL SY TJ TM TN TR TT TZ UA UG US UZ VC VN YU ZA ZM ZW |
|
AL | Designated countries for regional patents |
Kind code of ref document: A1 Designated state(s): BW GH GM KE LS MW MZ NA SD SL SZ TZ UG ZM ZW AM AZ BY KG KZ MD RU TJ TM AT BE BG CH CY CZ DE DK EE ES FI FR GB GR HU IE IS IT LT LU MC NL PL PT RO SE SI SK TR BF BJ CF CG CI CM GA GN GQ GW ML MR NE SN TD TG |
|
121 | Ep: the epo has been informed by wipo that ep was designated in this application | ||
WWE | Wipo information: entry into national phase |
Ref document number: 2005517390 Country of ref document: JP |
|
NENP | Non-entry into the national phase |
Ref country code: DE |
|
WWW | Wipo information: withdrawn in national office |
Country of ref document: DE |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2004807867 Country of ref document: EP |
|
WWP | Wipo information: published in national office |
Ref document number: 2004807867 Country of ref document: EP |
|
WWE | Wipo information: entry into national phase |
Ref document number: 10583856 Country of ref document: US |
|
WWW | Wipo information: withdrawn in national office |
Ref document number: 2004807867 Country of ref document: EP |
|
WWP | Wipo information: published in national office |
Ref document number: 10583856 Country of ref document: US |