USRE37839E1 - O-benzyloxime ethers and crop protection agents containing these compounds - Google Patents
O-benzyloxime ethers and crop protection agents containing these compounds Download PDFInfo
- Publication number
- USRE37839E1 USRE37839E1 US08/627,377 US62737796A USRE37839E US RE37839 E1 USRE37839 E1 US RE37839E1 US 62737796 A US62737796 A US 62737796A US RE37839 E USRE37839 E US RE37839E
- Authority
- US
- United States
- Prior art keywords
- substituted
- unsubstituted
- alkyl
- phenyl
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 0 *=C(C(=O)[Y][1*])C1=CC=CC=C1.CC.CC.[3*]/C([4*])=N\OCC Chemical compound *=C(C(=O)[Y][1*])C1=CC=CC=C1.CC.CC.[3*]/C([4*])=N\OCC 0.000 description 27
- BBJPLYGBSPMDOU-UHFFFAOYSA-N [H]CC(=O)N(C)C(=O)N(C)C(=O)C[H] Chemical compound [H]CC(=O)N(C)C(=O)N(C)C(=O)C[H] BBJPLYGBSPMDOU-UHFFFAOYSA-N 0.000 description 2
- UJQLDFMZDSDZEY-UHFFFAOYSA-N [H]CC(=O)NC(=O)NC(=O)C[H] Chemical compound [H]CC(=O)NC(=O)NC(=O)C[H] UJQLDFMZDSDZEY-UHFFFAOYSA-N 0.000 description 2
- ZZFUVPDOJGQTKI-UHFFFAOYSA-N [H]CC1=C(CC2=C(C[H])C=CC=C2)C=CC=C1 Chemical compound [H]CC1=C(CC2=C(C[H])C=CC=C2)C=CC=C1 ZZFUVPDOJGQTKI-UHFFFAOYSA-N 0.000 description 2
- YQZBFMJOASEONC-UHFFFAOYSA-N [H]CCCC1=C(C[H])C=CC=C1 Chemical compound [H]CCCC1=C(C[H])C=CC=C1 YQZBFMJOASEONC-UHFFFAOYSA-N 0.000 description 2
- NUJILYKLNKQOOX-UHFFFAOYSA-N [H]CCCCC1=C(C[H])C=CC=C1 Chemical compound [H]CCCCC1=C(C[H])C=CC=C1 NUJILYKLNKQOOX-UHFFFAOYSA-N 0.000 description 2
- UVBMZKBIZUWTLV-UHFFFAOYSA-N [H]CCCN(C)CCC[H] Chemical compound [H]CCCN(C)CCC[H] UVBMZKBIZUWTLV-UHFFFAOYSA-N 0.000 description 2
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N C1=CC=C2C(=C1)CC1=CC=CC=C12 Chemical compound C1=CC=C2C(=C1)CC1=CC=CC=C12 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- CSWXODSOHUQCGN-KCUXUEJTSA-N CC.CO/C=C(/C(=O)OC)C1=C(CON2C(=O)C3=C(C=CC=C3)C2=O)C=CC=C1 Chemical compound CC.CO/C=C(/C(=O)OC)C1=C(CON2C(=O)C3=C(C=CC=C3)C2=O)C=CC=C1 CSWXODSOHUQCGN-KCUXUEJTSA-N 0.000 description 1
- YSSNKJAYFBYKSO-QTNJPTFUSA-N CC.CO/N=C(/C(=O)OC)C1=C(CON2C(=O)C3=C(C=CC=C3)C2=O)C=CC=C1 Chemical compound CC.CO/N=C(/C(=O)OC)C1=C(CON2C(=O)C3=C(C=CC=C3)C2=O)C=CC=C1 YSSNKJAYFBYKSO-QTNJPTFUSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/32—Oximes
- C07C251/34—Oximes with oxygen atoms of oxyimino groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C251/48—Oximes with oxygen atoms of oxyimino groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with the carbon atom of at least one of the oxyimino groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/44—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids
- A01N37/50—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids the nitrogen atom being doubly bound to the carbon skeleton
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/52—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing groups, e.g. carboxylic acid amidines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/14—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings
- A01N43/16—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom six-membered rings with oxygen as the ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/32—Oximes
- C07C251/50—Oximes having oxygen atoms of oxyimino groups bound to carbon atoms of substituted hydrocarbon radicals
- C07C251/60—Oximes having oxygen atoms of oxyimino groups bound to carbon atoms of substituted hydrocarbon radicals of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/63—Carboxylic acid nitriles containing cyano groups and nitrogen atoms further bound to other hetero atoms, other than oxygen atoms of nitro or nitroso groups, bound to the same carbon skeleton
- C07C255/64—Carboxylic acid nitriles containing cyano groups and nitrogen atoms further bound to other hetero atoms, other than oxygen atoms of nitro or nitroso groups, bound to the same carbon skeleton with the nitrogen atoms further bound to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C257/00—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines
- C07C257/04—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines without replacement of the other oxygen atom of the carboxyl group, e.g. imino-ethers
- C07C257/06—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines without replacement of the other oxygen atom of the carboxyl group, e.g. imino-ethers having carbon atoms of imino-carboxyl groups bound to hydrogen atoms, to acyclic carbon atoms, or to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/46—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having at least one of the nitrogen atoms, not being part of nitro or nitroso groups, further bound to other hetero atoms
- C07C323/47—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having at least one of the nitrogen atoms, not being part of nitro or nitroso groups, further bound to other hetero atoms to oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/56—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/60—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton with the carbon atom of at least one of the carboxyl groups bound to nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
- C07C327/20—Esters of monothiocarboxylic acids
- C07C327/22—Esters of monothiocarboxylic acids having carbon atoms of esterified thiocarboxyl groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/04—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/04—Systems containing only non-condensed rings with a four-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Definitions
- the present invention relates to novel O-benzyloxime ethers and a method for controlling pests, in particular fungi, insects, nematodes and spider mites with these compounds.
- X is CH 2 , CH—C 1 -C 4 -alkyl, CH—C 1 -C 4 -alkoxy, CH—C 1 -C 4 -alkylthio or N—C 1 -C 4 -alkoxy,
- Y is O, S or NR 5 ,
- R 1 , R 2 and R 5 are each H or C 1 -C 4 -alkyl
- Z 1 and Z 2 are identical or different and are each H, halogen, methyl, methoxy or cyano,
- R 3 and R 4 are identical or different and are each hydrogen, cyano, straight-chain or branched C 1 -C 10 -alkyl, C 1 -C 4 -haloalkyl, C 3 -C 6 -cycloalkyl, C 3 -C 6 -halocycloalkyl, C 3 -C 6 -cycloalkyl-C 1 -C 4 -alkyl, C 1 -C 4 -alkoxy-C 1 -C 4 -alkyl, C 1 -C 4 alkylthio-C 1 -C 4 -alkyl, arylthio-C 1 -C 4 -alkyl, C 2 -C 6 -alkenyl, C 2 -C 5 -haloalkenyl, C 3 -C 6 -cycloalkenyl, C 3 -C 6 -halocycloalkenyl, C 2 -C 6 -alkynyl, C 1 -C 6
- R 7 are identical or different and are each H or C 1 -C 4 -alkyl, substitutents, in addition to hydrogen, being halogen, cyano, nitro, C 1 -C 4 -alkyl, C 1 -C 4 -alkoxy, C 1 -C 4 -haloalkyl, C 1 -C 4 -haloalkoxy, C 1 -C 10 -alkoximino-C 1 - or C 2 -alkyl, aryl, aryloxy, benzyloxy, hetaryl, hetaryloxy, C 3 -C 6 -cycloalkyl, heterocyclyl or heterocyclyloxy, or
- R 3 and R 4 together may form a carbocyclic or heterocyclic ring which may be substituted by the above-mentioned substituents, and
- R 3 or R 4 may be halogen, or
- n is an integer from 1 to 4, and
- R 8 is, or, when n>1, the R 8 's are identical or different and are each, H, halogen, cyano, nitro or substituted or unsubstituted C 1 -C 4 -alkyl, C 1 -C 4 -alkoxy, C 1 -C 4 haloalkyl, C 1 -C 4 -haloalkoxy, aryl, aryloxy, benzyloxy, hetaryl or hetaryloxy,
- the fungicidal action is preferred.
- X may be C 1 -C 4 -alkylidene (eg. methylidene, ethylidene, nor isopropylidene, n-, iso-, sec- or tert-butylidene),
- C 1 -C 4 -alkoxymethylidene eg. methoxy-ethoxy-, n-propoxy, isopropoxy-, n-butoxy-, isobutoxy-, sec-butoxy- or tertbutoxymethylidene
- C 1 -C 4 -alkylthiomethylidene eg. methyl-, ethyl-, n-propyl-, isopropyl-, n-butylthio-, isobutylthio-, sec-butylthio- or tert-butylthiomethylidene
- C 1 -C 4 -alkoximino eg. methoximino, ethoximino, n-propoximino, isopropoximino, n-butoximino, isobutoximino, sec-butoximino or tert-butoximino
- Y may be O, S or NR 5 ,
- R 1 , R 2 and R 5 may each be H or C 1 -C 4 -alkyl (eg. methyl, ethyl, n- or isopropyl, n- or iso-, sec- or tert-butyl),
- Z 1 and Z 2 may be H, halogen (eg. fluorine, chlorine, bromine or iodine), methyl, methoxy or cyano, and
- R 3 and R 4 may be identical or different and are each hydrogen, cyano, straight-chain or branched C 1 -C 10 -alkyl (eg. methyl, ethyl, n- or isopropyl, n-, iso-, sec- or tert-butyl, n-, iso-, sec-, tert- or neopentyl, n-hexyl or n-decyl), C 1 -C 4 -haloalkyl (eg.
- cyclopent-1-enyl cyclopentadienyl or cyclohex-1-enyl
- C 3 -C 6 -halocycloalkenyl eg. pentafluorocyclopentadienyl or pentachlorocyclopentadienyl
- C 2 -C 4 -alkynyl eg. ethnyl, 1-propynyl or 1-propargyl
- C 1 -C 4 -alkoxy eg. methoxy, ethoxy, n- or isopropoxy or n-, iso-, sec- or tert-butoxy
- C 1 -C 4 -alkylthio eg.
- C 1 -C 4 -alkylcarbonyl eg. acetyl, propionyl, butyryl, isobutyryl or pivaloyl
- unsubstituted or substituted phenylcarbonyl eg. benzoyl or 4-chlorobenzoyl
- unsubstituted or substituted benzylcarbonyl eg. benzylcarbonyl
- C 1 -C 4 -alkoxycarbonyl eg.
- aminocarbonyl dimethylaminocarbonyl, diethylaminocarbonyl, diisopropylaminocarbonyl, phenylaminocarbonyl or N-methyl-N-phenylaminocarbonyl
- unsubstituted or substituted aryl eg. phenyl, naphthyl or anthryl
- unsubstituted or substituted aryloxy eg. phenoxy, naphthyloxy or anthryloxy
- unsubstituted or substituted arylthio eg. phenylthio
- unsubstituted or substituted aryl-C 1 -C 4 -alkyl eg.
- benzyl 1-phenethyl, 2-phenethyl, 1-phenylpropyl, 2-phenylpropyl, 3-phenylpropyl, 2-methyl-3-phenylpropyl, 2-methyl-2-phenylpropyl or 4-phenylbutyl), unsubstituted or substituted aryl-C 1 -C 4 -alkenyl (eg. phenyl-1-etheny 1,2-phenyl-1-propenyl, 2,2-diphexylethenyl, 1-phenyl-1-propen-2-yl or 1-phenyl-1-ethenyl), unsubstituted or substituted aryloxy-C 1 -C 4 -alkyl (eg.
- phenoxymethyl unsubstituted or substituted arylthio-C 1 -C 4 -alkyl (eg. phenylthiomethyl), unsubstituted or substituted hetaryl (eg. pyridyl; 2-pyridyl, 3-pyridyl, 4-pyridyl, pyrimidinyl, 2,6-pyrimidinyl, 1,5-pyrimidinyl, thienyl, 2-thienyl, 3-thienyl, furyl, 2-furyl, 3-furyl, 1-pyrrolyl, 1-imidazolyl, 1,2,4-triazolyl, 1,3,4-triazolyl, 4-thiazolyl or 2-benzothiazolyl), unsubstituted or substituted hetaryloxy (eg.
- 2-pyridyloxy or 2-pyrimidinyloxy unsubstituted or substituted hetarylthio (eg. 2-pyridylthio, 2-pyrimidinylthio or 2-benzothiazolylthio), unsubstituted or substituted hetaryl-C 1 -C 4 -alkyl (eg. 2-pyridylmethyl or 3-pyridylmethyl), unsubstituted or substituted hetaryloxy-C 1 -C 4 -alkyl (eg.
- oxiranyl 1-aziridinyl, 1-azetidinyl, 1-pyrrolidinyl, 2-tetrahydrofuryl, 2-tetrahydropyranyl, 3-tetrahydropyranyl, 1-piperidinyl, 1-morpholinyl, 1-piperazinyl, 1,3-dioxanyl or 3-tetrahydrothiopyranyl) or unsubstituted or substituted heterocyclyloxy (eg. 2-dihydropyranyloxy or 2-tetrahydropyranyloxy).
- radicals referred to above in connection with unsubstituted or substituted are, in addition to hydrogen, for example, fluorine, chlorine, bromine, iodine, cyano, nitro, methyl, ethyl, isopropyl, tert-butyl, methoxy, ethoxy, isopropoxy, tert-butoxy, trifluoromethyl, chloromethyl, dichloromethyl, trichloromethyl, trifluoromethoxy,1,1,2,2-tetrafluoroethoxy, methoximinomethyl, ethoximinomethyl, n-propoximinomethyl, n-butoximinomethyl, n-pentyloximinomethyl, n-hexyloximinomethyl, allyloximinomethyl, benzyloximinomethyl, isopropoximinomethyl, isobutoximinomethyl, tert-butoximinomethyl, methylimino-1-ethyl, ethoximin
- a carbocyclic or heterocyclic oxime eg. cyclopentanone oxime, cyclohexanone oxime, cycloheptanone oxime, 2-adamantanone oxime, D-camphor oxime, 1-tetralone oxime, 1-indanone oxime, 9-fluorenone oxime, 1-methyl-4-piperidone oxime, violaric acid or N,N-dimethylvioluric acid).
- a carbocyclic or heterocyclic oxime eg. cyclopentanone oxime, cyclohexanone oxime, cycloheptanone oxime, 2-adamantanone oxime, D-camphor oxime, 1-tetralone oxime, 1-indanone oxime, 9-fluorenone oxime, 1-methyl-4-piperidone oxime, violaric acid or N,N-dimethylvioluric acid.
- R 3 and R 4 together then form, for example, a cyclopentyl, cyclohexyl, cycloheptyl, adamantyl, camphenyl, tetralin, indane or fluorene ring.
- One of the radicals R 3 or R 4 may furthermore be halogen (eg. fluorine, chlorine, bromine or iodine).
- halogen eg. fluorine, chlorine, bromine or iodine
- n may be 1, 2, 3 or 4 and R 8 may be for example H, fluorine, chlorine, bromine, iodine, cyano, nitro, methyl, ethyl, isopropyl, tert-butyl, methoxy, ethoxy, isopropoxy, tert-butoxy, trifluoromethyl, chloromethyl, dichloromethyl, trichloromethyl, trifluoromethoxy, 1,1,2,2-tetrafluoromethoxy, phenyl, phenoxy, benzyloxy or pyrid-2-yl, where these radicals in turn may be substituted by fluorine, chlorine, bromine, iodine, cyano, methyl or methoxy.
- R 3 and R 4 are hydrogen
- the preferred compounds are those in which either only R 3 or only R 4 is hydrogen, in particular the compounds in which R 3 is hydrogen.
- R 1 is C 1 -C 4 -alkyl
- R 2 is H or methyl
- R 3 and R 4 are identical or different and each is hydrogen, cyano, straight-chain or branched C 1 -C 10 -alkyl, C 1 -C 4 -haloalkyl, C 3 -C 6 -cycloalkyl, C 3 -C 6 -halocycloalkyl, C 3 -C 6 -cycloalkyl-C 1 -C 4 -alkyl, C 1 -C 4 -alkoxy-C 1 -C 4 -alkyl, C 1 -C 4 -alkylthio-C 1 -C 4 -alkyl, arylthio-C 1 -C 4 -alkyl,
- novel compounds of the general formula I may be obtained in the preparation as E/Z isomer mixtures. These can be separated into the individual components in a conventional manner, for example by crystallization or chromatography.
- Both the individual isomeric compounds and mixtures thereof form subjects of the invention and can be used a pesticides.
- the compounds of the general formula I in which X is CH 2 , CH-alkyl or CH-alkoxy can be prepared, for example, from the ketoesters 4 by a Wittig or Wittig-Horner reaction (cf. European Patents 348,766 and 178,826 and DE 3 705 389).
- the similar compounds 5 are likewise obtained from the ketoesters 2.
- the intermediates of the formulae 3, 6 and 8 can be prepared from the compounds 2, 5 and 7 by halogenating the latter by a known method, for example with chlorine, bromine or N-bromosuccinimide, in an inert solvent (eg. CCl 4 or cyclohexane), with exposure to, for example, a Hg vapor lamp or in the presence of a free radical initiator, eg. dibenzoyl peroxide, or by introducing the radicals L, eg. mesylate, tosylate, acetate or triflate, via suitable intermediates (where L is halogen or OH).
- a free radical initiator eg. dibenzoyl peroxide
- the oxime ethers of the formula I where X is N-Oalkyl can be prepared from 4 a) by reaction with an O-alkylhydroxylamine hydrochloride or b) with hydroxylamine hydrochloride and subsequent alkylation with an alkylating agent (eg. an alkyl iodide, dialkyl sulfate, etc.) (cf. DE 3 623 921).
- an alkylating agent eg. an alkyl iodide, dialkyl sulfate, etc.
- a phenylacetic ester of the formula 9 can be converted with a base (eg. NaOMe, NaH, K tert-butylate, etc.) in a solvent (eg. diethyl ether, toluene, tert-butanol, etc.) by a method similar to that in European Patent 254,426 into its anion and can be converted into the oxime with a suitable nitrosating agent (such as methyl nitrite, amyl nitrate, tert-butyl nitrate, etc.).
- the resulting oximate is alkylated with an alkylating agent (eg. an alkyl iodide or dialkyl sulfate).
- Y—R 1 is usually alkoxy.
- the nitriles 12 can be converted in a known manner (cf. Organikum 16th edition, page 424 et seq. (1985) into the carboxylic acids 11.
- the resulting carboxylic acids 11 can be converted in a conventional manner into the acyl chlorides 14 (cf. Organikum 16th edition, page 423 et seq. (1985).
- the conversion of 14 into the amides 15 is effected by methods similar to that described in Organikum 16th edition, page 412 (1985).
- the thioesters 13 are obtained from the acyl chlorides 14 (similarly to Houben-Weyl Vol. 8, page 464 et seq. (1952)).
- the thioesters 13 can also be prepared from the acids 11 (similarly to Houben-Weyl Vol. E5, page 855 et seq. (1985)).
- the amides 15 in which R 1 and R 5 are each H can also be prepared from the nitriles 12 by processes known from the literature (cf. Synthesis 1980, 243).
- oximes required for the preparation of the compounds of the general formula I are either known or can be prepared by one of the processes shown in Scheme 3.
- aldoximes 19 can be chlorinated by known methods and can be reacted with, for example, a cyanide to give the derivatives 17 (R 4 ⁇ CN) (cf. M. R. Zimmermann J. f. prakt. Chemie 66 (1902), 359).
- R 3 is CN and R 4 is alkoxyalkyl are prepared according to European Patent 74,047, those in which R 3 is CN and R 4 is alkylthioalkyl according to European Patent 150,822 and those in which R 3 is CN and R 4 is alkyl according to DE 2 304 848.
- novel compounds of the general formula I as claimed in claim 1 are prepared, for example, by a method in which an oxime of the formula 17 is reacted with a substituted benzyl compound 6 in which L is a leaving group (eg. chloride, bromide, p-toluenesulfonate, methanesulfonate, triflate or acetate).
- L is a leaving group (eg. chloride, bromide, p-toluenesulfonate, methanesulfonate, triflate or acetate).
- R 1 -R 4 , X and Y have the abovementioned meanings.
- the reactions described can be carried out, for example, in an inert solvent (eg. acetone, acetonitrile, dimethyl sulfoxide, dimethylformamide, N-methylpyrrolidone or pyridine) with the use of a base (eg. sodium carbonate, potassium carbonate, sodium hydroxide, potassium hydroxide, sodium hydride or sodium methylate).
- an inert solvent eg. acetone, acetonitrile, dimethyl sulfoxide, dimethylformamide, N-methylpyrrolidone or pyridine
- a base eg. sodium carbonate, potassium carbonate, sodium hydroxide, potassium hydroxide, sodium hydride or sodium methylate.
- the reactions can also be carried out in a two-phase system (eg. dichloromethane or water) with the aid of a suitable phase transfer catalyst (eg. cetyltrimethylammonium chloride or benzyltrimethylammonium chloride).
- a suitable phase transfer catalyst eg. cetyltrimethylammonium chloride or benzyltrimethylammonium chloride.
- N-hydroxyphthalimide can be converted with a halide or sulfonic ester 6 in the presence of an acid acceptor (eg. triethylamine, potassium carbonate, etc.), in a suitable solvent (eg. N-methylpyrrolidone, dimethylformamide, etc.), into the imidoether 21.
- an acid acceptor eg. triethylamine, potassium carbonate, etc.
- a suitable solvent eg. N-methylpyrrolidone, dimethylformamide, etc.
- Cleavage to give the O-substituted hydroxylamine can be effected with a mineral acid (eg. HCl; cf. Houben-Weyl Vol. 10/1, page 1181 et seq.) or with a base (for example with hydrazine or ethanolamine).
- a mineral acid eg. HCl; cf. Houben-Weyl Vol. 10/1, page 1181 et seq.
- a base for example with hydrazine or ethanolamine
- novel compounds are extremely effective on a broad spectrum of phytopathogenic fungi, in particular those from the class consisting of the Ascomycetes and Basidiomycetes. Some of them have a systemic action and can be used as foliar and soil fungicides.
- the fungicidal compounds are of particular interest for controlling a large number of fungi in various crops or their seeds, especially wheat. rye, barley, oats, rice, indian corn, lawns, cotton, soybeans, coffee, sugar cane, fruit and ornamentals in horticulture and viticulture, and in vegetables such as cucumbers, beans and cucurbits.
- novel compounds are particularly useful for controlling the following plant diseases:
- the compounds are applied by spraying or dusting the plants with the active ingredients, or treating the seeds of the plants with the active ingredients. They may be applied before or after infection of the plants or seeds by the fungi. Either the fungi themselves, or the plants seed or materials to be protected against fungus attack, or the soil are treated with a fungicidally effective amount of the active ingredient.
- novel substances can be converted into conventional formulations such as solutions, emulsions, suspensions, dusts, powders, pastes and granules.
- the application forms depend entirely on the purposes for which they are intended they should at all events ensure a fine and uniform distribution of the active ingredient.
- the formulations are produced in known manner, for example by extending the active ingredient with solvents and/or carriers, with or without the use of emulsifiers and dispersants; if water is used as solvent, it is also possible to employ other organic solvents as auxiliary solvents.
- auxiliaries for this purpose are solvents such as aromatics (e.g., xylene), chlorinated aromatics (e.g., chlorobenzenes), paraffins (e.g., crude oil fractions), alcohols (e.g., methanol, butanol), ketones (e.g., cyclohexanone), amines (e.g., ethanolamine, dimethylformamide), and water; carriers such as ground natural minerals (e.g., kaolins, aluminas, talc and chalk) and ground synthetic minerals (e.g., highly disperse silica and silicates); emulsifiers such as nonionic and anonic emulsifiers (e.g., polyoxyethylene fatty alcohol ethers, alkyl sulfonates and aryl sulfonates); and dispersants such as ligninsulfite waste liquors and methylcellulose.
- solvents such as aromatics (e.g., xylene
- the fungicides generally contain from 0.1 to 95, and preferably from 0.5 to 90, wt % of active ingredient.
- the application rates are from 0.02 to 3 kg or more of active ingredient per hectare, depending on the type of effect desired.
- the novel compounds may also be used for protecting materials, e.g., on Paecilomyces variotii.
- the active ingredients are used for treating seed, amounts of from 0.001 to 50, and preferably from 0.01 to 10, g per kg of seed are generally required.
- agents and the ready-to-use formulations prepared from them are applied in conventional manner, for example by spraying, atomizing, dusting, scattering, dressing or watering.
- the agents according to the invention may also be present together with other active ingredients, for example herbicides, insecticides, growth regulators, and fungicides, and may furthermore be mixed and applied together with fertilizers. Admixture with other fungicides frequently results in a greater fungicidal action spectrum.
- the active ingredient used for comparison purposes was 2-(phenoxymethyl)-phenylglyoxylic acid-methyl ester-O-methyloxime (A) disclosed in EP 253,213.
- Leaves of pot-grown rice seedlings of the “Bahia” variety were sprayed to runoff with aqueous emulsions containing (dry basis) 80% of active ingredient and 20% of emulsifier, and inoculated 24 hours later with an aqueous spore suspension of Pyricularia oryzae.
- the plants were then set up in climatic cabinets at 22° to 24° C. and 95 to 99% relative humidity. The extent of fungus attack was assessed after 6 days.
- novel compounds are also suitable for effectively combating pests such as insects, arachnids and nematodes. They may be used as pesticides in crop protection and in the hygiene, stores protection and veterinary sector.
- injurious insects belonging to the Lepidoptera order are Agrotis ypsilon, Agrotis segetum, Alabama argillacea, Anticarsia gemmatalis, Argyresthia conjugella, Autographa gamma, Bupalus piniarius, Cacoecia murinana, Capua reticulana, Cheimatobia brumata, Choristoneura fumiferana, Choristoneura occidentalis, Cirphis unipuncta, Cydia pomonella, Oendrolimus pini, Diaphania nitidalis, Diatraea grandiosella, Earias insulana, Elasmopalpus lignosellus, Eupoecilia ambiguella, Evetria bouliana, Feltia subterranea, Galleria mellonella, Grapholita funebrana, Grapholita molesta, Heliothis armigera, Helio
- Examples from the Coleoptera order are Agrilus sinuatus, Agriotes lineatus, Agriotes obscurus, Amphimallus solstitialis, Anisandrus dispar, Anthonomus grandis, Anthonomus pomorum, Atomaria linearis, Blastophagus piniperda, Blitophaga undata, Bruchus rufimanus, Bruchus pisorum, Sruchus lentis, Byctiscus betulae, Cassida nebulosa, Cerotoma trifurcata, Ceuthorrhynchus assimilis, Ceuthorrynchus napi, Chaetocnema tibialis, Conoderus vespertinus, Crioceris asparagi, Oiabrotica longicornis, Diabrotica 12-punctata, Diabrotica virgifera, Epilachna varivestis, Epitrix hirtipennis, Eutinobothrus brasiliensis,
- Examples from the Diptera order are Aedes aegypti, Aedes vexans, Anastrepha ludens, Anopheles maculipennis, Ceratitis capitata, Chrysomya bezziana, Chrysomya hominivorax, Chrysomya macellaria, Contarinia sorghicola, Cordylobia anthropophaga, Culex pipiens, Dacus cucurbitae, oacus aleae, Dasineura brassicae, Fannia canicularis, Gasterophilus intestinalis, Glossia morsitans, Haematobia irritans, Haplodiplosis equestris, Hylemyia platura, Hypoderma lineata, Liriomyza sativae, Liriomyza trifolii, Lucilia caprina, Lucilia cuprina, Lucilia sericata, Lycoria pectoralis, Mayetiola
- Thysanoptera order examples are Frankliniella fusca, Frankliniella occidentalis, Frankliniella tritici, Scirtothrips citri, Thrips oryzae, Thrips palmi and Thrips tabaci.
- Hymenoptera order examples from the Hymenoptera order are Athalia rosae, Atta cephalotes, Atta sexdens, Atta texana, Hoplocampa minuta, Hoplocampa testudinea, Monomorium pharaonis, Solenopsis geminata and Solenopsis invicta.
- Heteroptera order examples from the Heteroptera order are Acrosternum hilare, Blissus leucopterus, Cyrtopeltis notatus, Oysdercus cingulatus, Oysdercus intermedius, Eurygaster integriceps, Euchistus impictiventris, Leptoglossus phyllopus, Lygus lineolaris, Lygus pratensis, Nezara viridula, Piesma quadrata, Solubea insularis and Thyanta perditor.
- nematodes class examples from the nematodes class are root-knot nematodes, e.g., Meloidogyne hapla, Meloidogyne incognita and Meloidogyne javanica, cyst-forming nematodes, e.g., Globodera rostochiensis, Heterodera avenae, Hetrodera glycinae, Heterodera schachtii and Heterodera trifolii, and stem and leaf eelworms, e.g., Belonolaimus longicaudatus, Ditylenchus destructor, Ditylenchus dipsaci, Heliocotylenchus multicinctus, Longidorus elongatus, Radopholus similis, Rotylenchus robustus, Trichodorus primitivus, Tylenchorhynchus claytoni, Tylenchorhynchus dubius,
- the concentrations in the finished formulations may vary over a wide range. Generally, the concentration is from 0.0001 to 10, and preferably from 0.001 to 0.1%.
- the active ingredients may also be successfully used in the ultra-low-volume method (ULV), where it is possible to apply formulations containing more than 95 wt % of active ingredient, or even the active ingredient without any additives.
- UUV ultra-low-volume method
- the application rates are from 0.01 to 10, and preferably from 0.1 to 1.0, kg/ha.
- Potted bush beans which had developed the first pair of true leaves and were heavily infested with all stages of the spider mite Tetranychus telarius were sprayed to runoff in a spray cabinet with aqueous formulations of the active ingredients.
- the plants were placed on a rotating disc and sprayed from all sides with 50 ml of spray liquor.
- the plants were heavily infested with mites and numerous eggs had been laid on them.
- the action was assessed after 5 days by means of a binocular microscope. During this period, the plants were kept under normal greenhouse conditions.
- Young kohlrabi leaves are dipped for 3 seconds into aqueous solutions of the candidate compounds, and then placed on a round filter paper 9 cm in diameter which has been moistened with 0.5 ml of water. The filter paper is then placed in a Petri dish 10 cm in diameter. 10 caterpillars in the 4th larval stage are then placed on each leaf and the Petri dish is closed. Ingestion inhibition is determined in % after 48 hours.
- Leaves of potted vines of the “Müller Thurgau” variety were sprayed with aqueous liquors containing (dry basis) 80% of active ingredient and 20% of emulsifier. To assess the duration of action of the active ingredients, the plants were, after the sprayed-on layer had dried, set up in the greenhouse for 8 days. Only then were the leaves infected with a zoospore suspension of Plasmopara viticola. The vines were then placed for 48 hours in a water-vapor-saturated chamber at 24° C. and then for 5 days in a greenhouse at from 20° to 30° C. To accelerate the sporangiophore discharge, the plants were then again set up in the moist chamber for 16 hours. The extent to which the leaves had been attacked was then assessed.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Wood Science & Technology (AREA)
- Environmental Sciences (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Zoology (AREA)
- Pest Control & Pesticides (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyrane Compounds (AREA)
- Indole Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Abstract
O-Benzyloxime ethers of the formula Iwherein5 x is substituted or unsubstituted CH2, NOalkylY is O, S, NR5R1, R2, R5 are H, alkylZ1, Z2 are H, halogen, methyl, methoxy, cyanoR3, R4 are hydrogen, cyano, substituted or unsubstituted alkyl, alkenyl, cycloalkyl, cycloalkenyl, alkynyl, alkoxy, haloalkoxy, alkylthio, benzylthio, alkylcarbonyl, substituted or unsubstituted benzylcarbonyl, alkoxycarbonyl, substituted or unsubstituted phenoxycarbonyl substituted or unsubstituted benzyloxycarbonyl,N(R6)2, where R6 is H, alkyl, substituted or unsubstituted phenyl,-CO-N(R7)2, where R7 is H, substituted or unsubstituted alkyl,substituted or unsubstituted aryl, substituted or unsubstituted aryloxy, substituted or unsubstituted arylthio, substituted or unsubstituted hetaryl, substituted or unsubstituted hetaryloxy, substituted or unsubstituted hetarylthio, substituted or unsubstituted heterocyclyl, substituted or unsubstituted heterocyclyloxy,R3 and R4 together may form a carbocyclic or heterocyclic ring which is substituted or unsubstituted, andR3 or R4 may be halogen, ormay bewheren is an integer from 1 to 4, andR8 is, or, when n>1, the R8's are identical or different and are each, H, halogen, cyano, nitro or substituted or unsubstituted C1-C4-alkyl, C1-C4-alkoxy, C1-C4-haloalkyl, C1-C4-haloalkoxy, aryl, aryloxy, benzyloxy, hetaryl or hetaryloxy,and crop protection agents containing these compounds.
Description
The present invention relates to novel O-benzyloxime ethers and a method for controlling pests, in particular fungi, insects, nematodes and spider mites with these compounds.
It is known that substituted phenylacetic acid oxime derivatives can be used as fungicides (European Patent 253,213). However, their action is unsatisfactory.
where
X is CH2, CH—C1-C4-alkyl, CH—C1-C4-alkoxy, CH—C1-C4-alkylthio or N—C1-C4-alkoxy,
Y is O, S or NR5,
R1, R2 and R5 are each H or C1-C4-alkyl,
Z1 and Z2 are identical or different and are each H, halogen, methyl, methoxy or cyano,
R3 and R4 are identical or different and are each hydrogen, cyano, straight-chain or branched C1-C10-alkyl, C1-C4-haloalkyl, C3-C6-cycloalkyl, C3-C6-halocycloalkyl, C3-C6-cycloalkyl-C1-C4-alkyl, C1-C4-alkoxy-C1-C4-alkyl, C1-C4alkylthio-C1-C4-alkyl, arylthio-C1-C4-alkyl, C2-C6-alkenyl, C2-C5-haloalkenyl, C3-C6-cycloalkenyl, C3-C6-halocycloalkenyl, C2-C6-alkynyl, C1-C6-alkoxy, C1-C4-haloalkoxy, C1-C4-alkylthio, benzylthio, C1-C4-alkylcarbonyl, unsubstituted or substituted phenylcarbonyl, unsubstituted or substituted benzylcarbonyl, C1-C4-alkoxycarbonyl, unsubstituted or substituted phenoxycarbonyl, unsubstituted or substituted benzyloxycarbonyl, unsubstituted or substituted aryl, unsubstituted or substituted aryloxy, unsubstituted or substituted arylthio, unsubstituted or substituted aryl-C1-C4-alkyl, unsubstituted or substituted aryl-C1-C4-alkenyl, unsubstituted or substituted aryloxy-C1-C6-alkyl, unsubstituted or substituted arylthio-C1-C4-alkyl, unsubstituted or substituted hetaryl, unsubstituted or substituted hetaryloxy, unsubstituted or substituted betarylthio, unsubstituted or substituted hetaryl-C1-C4-alkyl, unsubstituted or substituted hetaryl-C2-C4-alkenyl, unsubstituted or substituted heteryloxy-C1-C4-alkyl, unsubstituted or substituted heterocyclyl, unsubstituted or substituted heterocyclyloxy, N(R6)2, where the radicals R6 are identical or different and are each H, C1-C4-alkyl or unsubstituted or substituted phenyl, or
—CO—N(R7)2, where the radicals R7 are identical or different and are each H or C1-C4-alkyl, substitutents, in addition to hydrogen, being halogen, cyano, nitro, C1-C4-alkyl, C1-C4-alkoxy, C1-C4-haloalkyl, C1-C4-haloalkoxy, C1-C10-alkoximino-C1- or C2-alkyl, aryl, aryloxy, benzyloxy, hetaryl, hetaryloxy, C3-C6-cycloalkyl, heterocyclyl or heterocyclyloxy, or
R3 and R4 together may form a carbocyclic or heterocyclic ring which may be substituted by the above-mentioned substituents, and
where
n is an integer from 1 to 4, and
R8 is, or, when n>1, the R8's are identical or different and are each, H, halogen, cyano, nitro or substituted or unsubstituted C1-C4-alkyl, C1-C4-alkoxy, C1-C4haloalkyl, C1-C4-haloalkoxy, aryl, aryloxy, benzyloxy, hetaryl or hetaryloxy,
have excellent fungicidal, insecticidal, nematicidal and scaricidal activity which is better than that of the known phenylacetic acid derivatives.
The fungicidal action is preferred.
The radicals stated for the general formula I may, for example, have the following meanings:
X may be C1-C4-alkylidene (eg. methylidene, ethylidene, nor isopropylidene, n-, iso-, sec- or tert-butylidene),
C1-C4-alkoxymethylidene (eg. methoxy-ethoxy-, n-propoxy, isopropoxy-, n-butoxy-, isobutoxy-, sec-butoxy- or tertbutoxymethylidene), C1-C4-alkylthiomethylidene (eg. methyl-, ethyl-, n-propyl-, isopropyl-, n-butylthio-, isobutylthio-, sec-butylthio- or tert-butylthiomethylidene) or C1-C4-alkoximino (eg. methoximino, ethoximino, n-propoximino, isopropoximino, n-butoximino, isobutoximino, sec-butoximino or tert-butoximino),
Y may be O, S or NR5,
R1, R2 and R5 may each be H or C1-C4-alkyl (eg. methyl, ethyl, n- or isopropyl, n- or iso-, sec- or tert-butyl),
Z1 and Z2 may be H, halogen (eg. fluorine, chlorine, bromine or iodine), methyl, methoxy or cyano, and
R3 and R4 may be identical or different and are each hydrogen, cyano, straight-chain or branched C1-C10-alkyl (eg. methyl, ethyl, n- or isopropyl, n-, iso-, sec- or tert-butyl, n-, iso-, sec-, tert- or neopentyl, n-hexyl or n-decyl), C1-C4-haloalkyl (eg. trifluoromethyl, 2-fluoroethyl, 2,2,2-trifluoroethyl, pentafluoroethyl, fluorodichloromethyl, difluorochloromethyl, chloromethyl, dichloromethyl, trichloromethyl, 2-chloroethyl, 2,2,2-trichloroethyl or pentachloroethyl), C3-C6-cycloalkyl (eg. cyclopropyl, cyclobutyl, cyclopentyl or cyclohexyl), C3-C6-halocycloalkyl (eg. 2,2-difluorocyclopropyl, 2,2-dichlorocyclopropyl, 2,2-dibromocyclopropyl, 2,2-dichloro-3-methylcyclopropyl or tetrafluorocyclobutyl), C3-C8-cycloalkyl-C1-C4-alkyl (eg. 1-methylcyclopropyl, 2,2-dimethylcyclopropyl or 1-methylcyclohexyl), C1-C4-alkoxy-C1-C4-alkyl (eg. methoxymethyl, ethoxymethyl, n- or isopropoxymethyl, n-, iso-, sec- or tert-butoxymethyl, 2-methoxyprop-2-yl, 2-ethoxyprop-2-yl, 2-n- or isopropoxyprop-2-yl or 2-n-, iso-, sec- or tert-butoxyprop-2-yl), C1-C4-alkylthio-C1-C4-alkyl (eg. methylthiomethyl, ethylthiomethyl, n- or isopropylthiomethyl, n-, iso-, sec- or tert-butylthiomethyl, 2-methylthioprop-2-yl, 2-ethylthioprop-2-yl, 2-n- or isopropylthioprop-2-yl or 2-n-, iso-, sec- or tert-butylthioprop-2-yl), aryl(phenyl)thio-C1-C4-alkyl (eg. phenylthiomethyl or 2-chlorophenylthiomethyl), C2-C6-alkenyl (eg. vinyl, 1-propenyl, 2-propenyl, 2-butenyl, 3-butenyl, 1-methyl-2-propenyl, 3-methyl-2-butenyl or 2-methyl-2-penten-5-yl), C2-C5-haloalkenyl (eg. 2,2-difluorovinyl, 2,2-dichlorovinyl, 3,3,3-trifluoropropenyl, 3,3,3-trichloropropenyl or 3-chloro-2-propenyl), C3-C6-cycloalkenyl (eg. cyclopent-1-enyl, cyclopentadienyl or cyclohex-1-enyl), C3-C6-halocycloalkenyl (eg. pentafluorocyclopentadienyl or pentachlorocyclopentadienyl), C2-C4-alkynyl (eg. ethnyl, 1-propynyl or 1-propargyl), C1-C4-alkoxy (eg. methoxy, ethoxy, n- or isopropoxy or n-, iso-, sec- or tert-butoxy), C1-C4-alkylthio (eg. methylthio, ethylthio, n- or isopropylthio or n-, iso-, sec- or tert-butylthio) or banzylthio, C1-C4-haloalkoxy (eg. trifluoromethoxy, pentafluoroethoxy or 1,1,2,2-tetrafluoroethoxy), N(R6)2 (eg. amino, methylamino, dimethylamino, ethylamino, diethylamino, di-n-propylamino, diisopropylamino, di-n-butylamino or diisobutylamino), C1-C4-alkylcarbonyl (eg. acetyl, propionyl, butyryl, isobutyryl or pivaloyl), unsubstituted or substituted phenylcarbonyl (eg. benzoyl or 4-chlorobenzoyl), unsubstituted or substituted benzylcarbonyl (eg. benzylcarbonyl), C1-C4-alkoxycarbonyl (eg. methoxycarbonyl, ethoxycarbonyl, n- or isopropoxycarbonyl or n-, iso-, sec- or tertbutoxycarbonyl), unsubstituted or substituted phenoxycarbonyl (eg. phenoxycarbonyl or 4-chlorophenoxycarbonyl), unsubstituted or substituted benzyloxycarbonyl (eg. benzyloxycarbonyl), —CO—N(R7)2 (eg. aminocarbonyl, dimethylaminocarbonyl, diethylaminocarbonyl, diisopropylaminocarbonyl, phenylaminocarbonyl or N-methyl-N-phenylaminocarbonyl), unsubstituted or substituted aryl (eg. phenyl, naphthyl or anthryl), unsubstituted or substituted aryloxy (eg. phenoxy, naphthyloxy or anthryloxy), unsubstituted or substituted arylthio (eg. phenylthio), unsubstituted or substituted aryl-C1-C4-alkyl (eg. benzyl, 1-phenethyl, 2-phenethyl, 1-phenylpropyl, 2-phenylpropyl, 3-phenylpropyl, 2-methyl-3-phenylpropyl, 2-methyl-2-phenylpropyl or 4-phenylbutyl), unsubstituted or substituted aryl-C1-C4-alkenyl (eg. phenyl-1-etheny 1,2-phenyl-1-propenyl, 2,2-diphexylethenyl, 1-phenyl-1-propen-2-yl or 1-phenyl-1-ethenyl), unsubstituted or substituted aryloxy-C1-C4-alkyl (eg. phenoxymethyl), unsubstituted or substituted arylthio-C1-C4-alkyl (eg. phenylthiomethyl), unsubstituted or substituted hetaryl (eg. pyridyl; 2-pyridyl, 3-pyridyl, 4-pyridyl, pyrimidinyl, 2,6-pyrimidinyl, 1,5-pyrimidinyl, thienyl, 2-thienyl, 3-thienyl, furyl, 2-furyl, 3-furyl, 1-pyrrolyl, 1-imidazolyl, 1,2,4-triazolyl, 1,3,4-triazolyl, 4-thiazolyl or 2-benzothiazolyl), unsubstituted or substituted hetaryloxy (eg. 2-pyridyloxy or 2-pyrimidinyloxy), unsubstituted or substituted hetarylthio (eg. 2-pyridylthio, 2-pyrimidinylthio or 2-benzothiazolylthio), unsubstituted or substituted hetaryl-C1-C4-alkyl (eg. 2-pyridylmethyl or 3-pyridylmethyl), unsubstituted or substituted hetaryloxy-C1-C4-alkyl (eg. furfurylmethoxy, thienylmethoxy, 3-isoxazolylmethoxy, 2-oxazolylmethoxy or 2-pyridylmethoxy), unsubstituted or substituted hetaryl-C2-C4-alkenyl (eg. 2′-furyl-2-ethenyl, 2′-thienyl-2-ethenyl or 3′-pyridyl-2-ethenyl), unsubstituted or substituted heterocyclyl (eg. oxiranyl, 1-aziridinyl, 1-azetidinyl, 1-pyrrolidinyl, 2-tetrahydrofuryl, 2-tetrahydropyranyl, 3-tetrahydropyranyl, 1-piperidinyl, 1-morpholinyl, 1-piperazinyl, 1,3-dioxanyl or 3-tetrahydrothiopyranyl) or unsubstituted or substituted heterocyclyloxy (eg. 2-dihydropyranyloxy or 2-tetrahydropyranyloxy).
The radicals referred to above in connection with unsubstituted or substituted are, in addition to hydrogen, for example, fluorine, chlorine, bromine, iodine, cyano, nitro, methyl, ethyl, isopropyl, tert-butyl, methoxy, ethoxy, isopropoxy, tert-butoxy, trifluoromethyl, chloromethyl, dichloromethyl, trichloromethyl, trifluoromethoxy,1,1,2,2-tetrafluoroethoxy, methoximinomethyl, ethoximinomethyl, n-propoximinomethyl, n-butoximinomethyl, n-pentyloximinomethyl, n-hexyloximinomethyl, allyloximinomethyl, benzyloximinomethyl, isopropoximinomethyl, isobutoximinomethyl, tert-butoximinomethyl, methylimino-1-ethyl, ethoximino-1-ethyl, n-propoximino-1-ethyl, n-butoximino-1-ethyl, n-pentyloximino-1-ethyl, n-hexyloximino-1-ethyl, allyloximino-1-ethyl, benzyloximino-1-ethyl, phenyl, phenoxy, benzyloxy, imidazol-1-yl, piperazin-1-yl, 4-morpholinyl, piperidin-1-yl, pyrid-2-yloxy, cyclopropyl, cyclohexyl, oxiranyl, 1,3-dioxan-2yl, 1,3-dioxolan-2-yl and tetrahydropyran-2-yloxy.
may also be the radical of a carbocyclic or heterocyclic oxime (eg. cyclopentanone oxime, cyclohexanone oxime, cycloheptanone oxime, 2-adamantanone oxime, D-camphor oxime, 1-tetralone oxime, 1-indanone oxime, 9-fluorenone oxime, 1-methyl-4-piperidone oxime, violaric acid or N,N-dimethylvioluric acid).
R3 and R4 together then form, for example, a cyclopentyl, cyclohexyl, cycloheptyl, adamantyl, camphenyl, tetralin, indane or fluorene ring.
One of the radicals R3 or R4 may furthermore be halogen (eg. fluorine, chlorine, bromine or iodine).
n may be 1, 2, 3 or 4 and R8 may be for example H, fluorine, chlorine, bromine, iodine, cyano, nitro, methyl, ethyl, isopropyl, tert-butyl, methoxy, ethoxy, isopropoxy, tert-butoxy, trifluoromethyl, chloromethyl, dichloromethyl, trichloromethyl, trifluoromethoxy, 1,1,2,2-tetrafluoromethoxy, phenyl, phenoxy, benzyloxy or pyrid-2-yl, where these radicals in turn may be substituted by fluorine, chlorine, bromine, iodine, cyano, methyl or methoxy.
Among the compounds in which R3 and R4 are hydrogen, the preferred compounds are those in which either only R3 or only R4 is hydrogen, in particular the compounds in which R3 is hydrogen.
Also preferred are compounds of the formula II in which X is CH2, CHCH3, CHC2H5, CHOCH3, CHOC2H5, CHSCH3 or CHSC2H5, Y is 0, R1 is C1-C4-alkyl, R2 is H or methyl, R3 and R4 are identical or different and each is hydrogen, cyano, straight-chain or branched C1-C10-alkyl, C1-C4-haloalkyl, C3-C6-cycloalkyl, C3-C6-halocycloalkyl, C3-C6-cycloalkyl-C1-C4-alkyl, C1-C4-alkoxy-C1-C4-alkyl, C1-C4-alkylthio-C1-C4-alkyl, arylthio-C1-C4-alkyl, C2-C6-alkenyl, C2-C6-alkynyl, C2-C4-haloalkenyl, C1-C6-alkoxy, C1-C6-alkylthio, C1-C4-alkylcarbonyl, C1-C4-alkoxycarbonyl, substituted or unsubstituted aryl, substituted or unsubstituted aryloxy, substituted or unsubstituted arylthio, substituted or unsubstituted aryl-C1-C4-alkyl, substituted or unsubstituted aryl-C2-C4-alkenyl, substituted or unsubstituted aryloxy-C1-C4-alkyl, substituted or unsubstituted hetaryl, substituted or unsubstituted hetaryloxy, substituted or unsubstituted hetarylthio or substituted or unsubstituted heterocyclyl, or each is N(R6)2, R6 being identical or different and denoting H, C1-C6-alkyl, C3-C6-cycloalkyl or substituted or unsubstituted phenyl, or each is —CO—N(R7)2, R7 being identical or different and denoting H or C1-C4-alkyl, the term “substituted” denoting the radicals listed in claim 1, and R3 and R4 may together denote a carbocyclic or heterocyclic ring which may be substituted by the radicals given under “substituted”, and R3 and R4 may be halogen, and Z1 and Z2 are hydrogen, fluorine, chlorine, bromine, iodine, methyl, cyano or methoxy.
Owing to the C═C or C═N double bonds, the novel compounds of the general formula I may be obtained in the preparation as E/Z isomer mixtures. These can be separated into the individual components in a conventional manner, for example by crystallization or chromatography.
Both the individual isomeric compounds and mixtures thereof form subjects of the invention and can be used a pesticides.
The compounds of the general formula I as claimed in claim 1 are prepared, for example, as described in Scheme 1 (Z1 and Z2 are each H).
The compounds of the general formula I in which X is CH2, CH-alkyl or CH-alkoxy can be prepared, for example, from the ketoesters 4 by a Wittig or Wittig-Horner reaction (cf. European Patents 348,766 and 178,826 and DE 3 705 389). The similar compounds 5 are likewise obtained from the ketoesters 2.
Alternatively, it is also possible to adopt a procedure in which compounds of the formula 7 or 9 are condensed with suitable reagents, for example with formaldehyde where X is CH2 (cf. DE 3317356), a) with aldehydes (cf. D. M. Brown, J. Chem. Soc. 1948, 2147) or b) first with N,N-dimethylformamide dimethyl acetal, followed by reaction with a Grignard reagent (similarly to C. Jutz, Chem. Ber. 91 (1958), 1867) where X is CH-alkyl, or with a formate followed by alkylation (cf. European Patent 178,826) where X is CH—O-alkyl. Further preparation methods for the compounds of the formula 5 and I where X is CH—O-alkyl are described in European Patent 178,826.
Another possible method for preparing the compounds of the formula I where X is CH-alkyl and YR2 is COOAlk is to react ketene acetals with phenylchlorocarbenes (S. N. Slougui and G. Rousseau, Synth. Commun. 12 (5) (1982), 401-407).
For compounds of the general formula I where X is CH-S-alkyl, the preparation can be carried out by the methods described in European Patents 244077 or 310,954.
The intermediates of the formulae 3, 6 and 8 can be prepared from the compounds 2, 5 and 7 by halogenating the latter by a known method, for example with chlorine, bromine or N-bromosuccinimide, in an inert solvent (eg. CCl4 or cyclohexane), with exposure to, for example, a Hg vapor lamp or in the presence of a free radical initiator, eg. dibenzoyl peroxide, or by introducing the radicals L, eg. mesylate, tosylate, acetate or triflate, via suitable intermediates (where L is halogen or OH).
The oxime ethers of the formula I where X is N-Oalkyl can be prepared from 4 a) by reaction with an O-alkylhydroxylamine hydrochloride or b) with hydroxylamine hydrochloride and subsequent alkylation with an alkylating agent (eg. an alkyl iodide, dialkyl sulfate, etc.) (cf. DE 3 623 921).
Furthermore, a phenylacetic ester of the formula 9 can be converted with a base (eg. NaOMe, NaH, K tert-butylate, etc.) in a solvent (eg. diethyl ether, toluene, tert-butanol, etc.) by a method similar to that in European Patent 254,426 into its anion and can be converted into the oxime with a suitable nitrosating agent (such as methyl nitrite, amyl nitrate, tert-butyl nitrate, etc.). The resulting oximate is alkylated with an alkylating agent (eg. an alkyl iodide or dialkyl sulfate).
The same processes can also be applied to the compounds of the formulae 2 and 7, and the resulting oxime ethers 5 can be converted in a known manner (European Patent 254,426) via the intermediates 6 (L is, for example, halogen) into the desired compounds I.
In the preparation processes described above, Y—R1 is usually alkoxy.
The compounds in which YR1 is OH (11) can be prepared by methods known from the literature (Organikum 16th edition, pages 415 and 622), from the compounds of the general formula I where YR1 is COOAlkyl (10) (cf. Scheme 2):
Alternatively, the nitriles 12 can be converted in a known manner (cf. Organikum 16th edition, page 424 et seq. (1985) into the carboxylic acids 11.
The resulting carboxylic acids 11 can be converted in a conventional manner into the acyl chlorides 14 (cf. Organikum 16th edition, page 423 et seq. (1985). The conversion of 14 into the amides 15 is effected by methods similar to that described in Organikum 16th edition, page 412 (1985).
The thioesters 13 are obtained from the acyl chlorides 14 (similarly to Houben-Weyl Vol. 8, page 464 et seq. (1952)).
Alternatively, the thioesters 13 can also be prepared from the acids 11 (similarly to Houben-Weyl Vol. E5, page 855 et seq. (1985)).
The amides 15 in which R1 and R5 are each H can also be prepared from the nitriles 12 by processes known from the literature (cf. Synthesis 1980, 243).
The preparation of the compounds of the general formulae 2 and 7 with ortho-methyl substitution at the aromatic (R2═H) is known.
(YR1═OAlkyl; cf. European Patents 178,826 and 260,832).
The oximes required for the preparation of the compounds of the general formula I are either known or can be prepared by one of the processes shown in Scheme 3.
Methods for the conversion of 16 or 18 into 17 are described in Houben-Weyl, Vol. 10/4 (1968).
Furthermore, aldoximes 19 can be chlorinated by known methods and can be reacted with, for example, a cyanide to give the derivatives 17 (R4═CN) (cf. M. R. Zimmermann J. f. prakt. Chemie 66 (1902), 359).
The specific derivatives in which R3 is CN and R4 is alkoxyalkyl are prepared according to European Patent 74,047, those in which R3 is CN and R4 is alkylthioalkyl according to European Patent 150,822 and those in which R3 is CN and R4 is alkyl according to DE 2 304 848.
The method employing Me3SiO—NH—SiMe3 (R. U. Hoffmann and G. A. Buntain, Synthesis 1987, 831) is used for sterically hindered ketones.
The novel compounds of the general formula I as claimed in claim 1 are prepared, for example, by a method in which an oxime of the formula 17 is reacted with a substituted benzyl compound 6 in which L is a leaving group (eg. chloride, bromide, p-toluenesulfonate, methanesulfonate, triflate or acetate). R1-R4, X and Y have the abovementioned meanings.
The reactions described can be carried out, for example, in an inert solvent (eg. acetone, acetonitrile, dimethyl sulfoxide, dimethylformamide, N-methylpyrrolidone or pyridine) with the use of a base (eg. sodium carbonate, potassium carbonate, sodium hydroxide, potassium hydroxide, sodium hydride or sodium methylate).
The reactions can also be carried out in a two-phase system (eg. dichloromethane or water) with the aid of a suitable phase transfer catalyst (eg. cetyltrimethylammonium chloride or benzyltrimethylammonium chloride).
Another method for the preparation of compounds I (YR1═OAlkyl, X═CH—OAlkyl or N—OAlkyl and L═Cl, Br, tosylate or mesylate) is illustrated by Scheme 5:
This synthesis sequence is carried out, as far as compound 22, similarly to the methods described in European Patent 244,786.
For example, N-hydroxyphthalimide can be converted with a halide or sulfonic ester 6 in the presence of an acid acceptor (eg. triethylamine, potassium carbonate, etc.), in a suitable solvent (eg. N-methylpyrrolidone, dimethylformamide, etc.), into the imidoether 21.
Cleavage to give the O-substituted hydroxylamine can be effected with a mineral acid (eg. HCl; cf. Houben-Weyl Vol. 10/1, page 1181 et seq.) or with a base (for example with hydrazine or ethanolamine).
The conversion of amine 22 to I is carried out in a conventional manner (cf. D. Otzanak, J. C. S. Chem. Commun. 1986, 903).
The Examples and methods which follow are intended to illustrate the preparation of the novel active ingredients and of the novel intermediates.
12.0 g (0.17 mol) of hydroxylammonium hydrochloride and 18.9 g (0.1 mol) of 3,4-dichloroacetophenone are added to a mixture of 20 ml of H2O, 100 ml of methanol and 8 g (0.1 mol) of pyridine. Refluxing is carried out for 1 hour, after which the mixture is acidified with 2N HCl and extracted with 3×100 ml of tert-butyl methyl ether. The organic phase is washed with water, dried with Na2SO4 and evaporated down. 19.6 g (96% of theory) of crystals of melting point 92° C., which according to 1H-NMR consist of 90% of trans-oxime, are obtained.
265.4 g (2.05 mol) of tetrahydrofuran-2-carbaldehyde oxime in 2 l of diethyl ether are initially taken at from −55° to −60° C. 153.5 g (2.15 mol) of chlorine are then passed in and the temperature is increased to −20° C.; stirring is carried out for 1 hour, the mixture is then evaporated down in a rotary evaporator at 10° C., the residue is taken up in 1.5 l of diethyl ether and the solution is stirred overnight in the absence of light, while cooling with ice. The solution is then filtered and the filtrate is added dropwise, while cooling with ice, to 147.3 g (2.27 mol) of potassium cyanide in 1 l of methanol at 10°-15° C. (exothermic). Stirring is carried out for 5 hours at room temperature (20° C.), after which the precipitate is filtered off under suction and washed twice with diethyl ether. The organic phases are partitioned between tert-butyl methyl ether and water and the residue of the ether phases is crystallized from dichloromethane/n-hexane at 0° C.
After filtration under suction and drying, 208 g (66% of theory) of a spectroscopically pure substance of melting point 105°-106° C. remain.
53.6 g (0.46 mol) of 2-methoxy-2-methylpropionaldehyde oxime in ether (about 1M) are initially taken at from −5° to −10° C. 35.8 g (0.5 mol) of chlorine gas are passed in, after which stirring is carried out for 1 hour at this temperature and the mixture is then evaporated down at 10° C. and the residue is taken up in diethyl ether. 24.7 g (0.5 mol) of sodium cyanide in 375 ml of 20:1 methanol/H2O are initially taken at 10° C. and the above ethereal solution is rapidly added dropwise. After 4 hours at room temperature, the mixture is filtered under suction and the residue is washed with twice 100 ml of methanol. The combined solutions are evaporated down and the residue is partitioned between methyl tert-butyl ether and water. Drying the organic phase over Na2SO4, evaporating down and crystallizing from dichloromethane/n-hexane give 41.1 g (63% of theory) of a white powder of melting point 102°-104° C.
10 g (35 mmol) of methyl 3-methoxy-2-(2′-bromomethyl)-phenylacrylate, 5.7 g (35 mmol) of hydroxyphthalimide, 3.9 g (38.6 mmol) of triethylamine and 50 ml of N-methylpyrrolidone are combined and the mixture is stirred for 2 hours at 60° C. It is then poured onto ice water, and the residue is filtered off under suction, washed with water and isopropanol and dried under reduced pressure. 9.0 g (70% of theory) of a crystalline product of melting point 156°-158° C. remain.
1H-NMR (CDCl3) δ=3.60 (s, 3H); 3.75 (s, 3H); 5.12 (s, 2H); 7.13 (dbr, 1H); 7.35 (m, 2H); 7.62 (s, 1H); 7.7-7.9 (m, 5H)
10.0 g (27 mmol) of the product from Method 4 are dissolved in 150 ml of methanol and the solution is stirred with 1.4 g (27 mmol) of hydrazine hydrate for 2 hours at room temperature. The precipitate is filtered off under suction, the mother liquor is evaporated down, the residue is stirred with diethyl ether, the precipitate is filtered off under suction again and the mother liquor is evaporated down. 6.0 g (92% of theory) of a yellow oil result (purity according to 1H-NMR about 90%).
1H-NMR (CDCl3) δ=3.71 (s, 3H); 3.80 (s, 3H); 4.60 (s, 2H); (5.35 (sbr, 2H); 7.0-7.50 (m, 4H); 7.58 (s, 1H).
2.0 g (7 mmol) of methyl 2-methoximino-2-(2′-bromomethyl)-phenylacetate, 1.1 g (7 mmol) of hydroxyphthalimide and 0.8 g (7.7. mmol) of triethylamine are dissolved in 10 ml of N-methylpyrrolidone and the solution is stirred for 2 hours at 70° C. For working up, ice water is added, and the crystals are filtered off under suction, washed with water and methyl tert-butyl ether and dried.
1.5 g (58% of theory) of crystals of melting point 152°-155° C. remain.
1H-NMR (CDCl3) δ=3.83 (s, 3H); 3.98 (s, 3H); 5.07 (s, 2H); 7.15 (dbr, 1H); 7.45 (mc, 2H); 7.60-7.85 (m, 5H)
15.0 g (41 mmol) of the product from Method 6 are stirred with 2.1 g (42 mmol) of hydrazine hydrate in 150 ml of methanol for 2 hours at room temperature. The residue is again filtered off under suction, the mother liquor is evaporated down and triturated with diethyl ether, the residue is filtered off under suction and the mother liquor is evaporated down. 7.8 g (80% of theory) of an acid-sensitive oil remain.
1H-NMR (CDCl3): δ=3.90 (s, 3H); 4.03 (s, 3H); 4.59 (s, 2H); 5.35 (sbr, 2H); 7.15 (dbr, 1H); 7.40 (sbr, 3H)
0.6 g (25 mmol) of sodium hydride powder in 100 ml of acetonitrile is initially taken, 5.1 g (25 mmol) of 3,5-dichloroacetophenone oxime are added and the mixture is refluxed for 1 hour. Thereafter, 9.3 g (33 mmol) of methyl 2-(2′-bromomethyl)-phenyl-3-methoxyacrylate in 50 continued for a further 4 hours. The mixture is evaporated down under reduced pressure and then partitioned between methyl tert-butyl ether and saturated ammonium chloride solution, the organic phase is washed with water and the residue obtained by evaporation is crystallized from methyl butyl ether/n-hexane. 4.6 g (45% of theory) of a substance of melting point 87°-88° C. are obtained.
1H-NMR (CDCl3): δ=2.19 (s, 3H); 3.70 (s, 3H); 3.81 (s, 3H); 5.15 (s, 2H); 7.08 (m, 1H); 7.17 (m, 3H); 7.50 (m, 3H); 7.58 (s, 1H)
3.3 g (23 mmol) of 3-methoxy-3-methyl-2-oximinobutyronitrile, 6.6 g (23 mmol) of methyl 2-(2′-bromomethylphenyl)-3-methoxyacrylate and 3.2 g (23 mmol) of potassium carbonate in 60 ml of N,N-dimethylformamide are stirred for 15 hours at room temperature. The mixture is then evaporated down, the residue is taken up in ethyl acetate, the solution is washed with 3×50 ml of water and the organic phase is dried over sodium sulfate, evaporated down and chromatographed over silica gel using 40:1 toluene/ethyl acetate.
Yield: 7.0 g (88% of theory) of an oil.
IR (film): 1,285, 1,258, 1,189, 1,180, 1,131, 1,111, 1,069, 1,008 cm−1.
0.6 g (25 mmol) of NaH in 50 ml of acetonitrile is initially taken, and 5.1 g (25 mmol) of 3,5-dichloroacetophenone oxime are added at room temperature. Refluxing is carried out for 1 hour, after which 9.4 g (33 mmol) of methyl 2-methoximino-2-(2′-bromomethyl)-phenylacetate in 50 ml of acetonitrile are added dropwise and refluxing is continued for a further 4 hours. After evaporating down, partitioning the residue between water/methyl tert-butyl ether, washing the organic phase with water, drying the organic phase with sodium sulfate and evaporating down, the residue is subjected to column chromatography over silica gel using methyl tert-butyl ether/hexane, 5.4 g (53% of theory) of crystals of melting point 95°-97° C. result.
1H-NMR (CDCl3): δ=2.17 (s, 3H); 3.82 (s, 3H); 4.02 (s, 3H); 5.15 (s, 2H); 7.20 (dbr, 1H); 7.25-7.55 (m, 6H)
2.37 g (10 mmol) of methyl 3-methoxy-2-(2′-aminooxymethyl)-phenylacrylate, 1.99 g (10 mmol) of 4-bromoacetophenone, 2 ml of water, 0.8 g of pyridine and 10 ml of methanol are combined and the mixture is stirred for 24 hours at room temperature. The mixture is evaporated down, the residue is partitioned between water/methyl tert-butyl ether and the organic phase is washed with 2N HCl and washed neutral with NaH—CO3 and evaporated down, and the residue is chromatographed over SiO2 using methyl tert-butyl ether/hexane. 2.1 g (51% of theory) of crystals of melting point 105°-107° C. result.
1H-NMR (CDCl3): δ=2.22 (s, 3H); 3.70 (s, 3H); 3.80 (s, 3H); 5.15 (s, 2H); 7.16 (dbr, 1H); 7.33 (m, 2H); 7.45 (m, 5H); 7.58 (s, 1H)
2.38 g (10 mmol) of methyl 2-methoximino-2-(2′-aminooxymethyl)-phenylacetate, 1.65 g (10 mmol) of 4-nitroacetophenone, 2 ml of water, 0.8 g of pyridine and 10 ml of methanol are reacted as in Example 4. 2.1 g (55% of theory) of crystals of melting point 87°-89° C. are obtained.
1H-NMR (CDCl3): δ=2.22 (s, 3H); 3.81 (s, 3H); 4.02 (s, 3H); 5.18 (s, 2H); 7.20 (dd, 1H); 7.4 (m, 3H); 7.75 (dd, 2H); 8.18 (dd, 2H).
a) 5.5 g (15 mmol) of methyl 3-methoxy-2-[2′-(phthalimidooxy)-methyl]-phenylacrylate (from Method 4) in 100 ml of methanol are initially taken, and 0.75 g (15 mmol) of hydrazine hydrate is added at room temperature. After 15 minutes at this temperature, the mixture is evaporated down, the residue is triturated with methyl tert-butyl ether and the cleavage product is filtered off under suction. The mother liquor is evaporated down, the residue is taken up with 50 ml of methanol and 2.1 g (15 mmol) of 4-chlorobenzaldehyde in 50 ml of methanol plus 1 drop of pyridine are added dropwise.
Stirring was carried out overnight at 23° C., after which the product was filtered off under suction, washed with methanol and dried.
2.9 g (54% of theory) of crystals of melting point 87°-89° C. were obtained.
1H-NMR (CDCl3): δ=3.66 (s, 3H); 3.80 (s, 3H); 5.13 (s, 2H); 7.17 (m, 1H); 7.35 (m, 4H); 7.50 (me, 3H); 7.60 (s, 1H); 8.06 (s, 1H).
b) 50 ml of methanol are slowly added to 1.3 g (55 mmol) of NaH powder under a nitrogen atmosphere (evolution of hydrogen). 7.8 g (50 mmol) of 4-chlorobenzaldehyde oxime in 50 ml of methanol are then added at room temperature. Stirring is carried out for half an hour, after which 14.3 g (50 mmol) of methyl 3-methoxy-2-(2′-bromomethyl)-phenylacrylate in 50 ml of methanol are added dropwise and stirring is carried out at room temperature for a further 48 hours. The white residue is filtered off under suction, washed with methanol and dried. 1.9 g (11% of theory) of a product of melting point 82°-84° C. are obtained.
2.0 g (7 mmol) of methyl 2-methoxyimino-2-(2′-bromomethyl)-phenylacetate, 1.1 g (7 mmol) of hydroxyphthalimide and 0.8 g (7.7 mmol) of triethylamine are dissolved in 10 ml of N-methylpyrrolidone and the mixture is stirred for 2 hours at 70° C. Ice water is added and the crystals are filtered off under suction, washed with water and methyl tert-butyl ether and dried. There remain 1.5 g (58% of theory) of crystals of melting point 152°-155° C.
1H-NMR (CDCl3): δ=3.83 (s, 3H); 3.98 (s, 3H); 5.07 (s, 2H); 7.15 (dbr, 1H); 7.45 (mc, 2H); 7.60-7.85 (m, 5H).
The compounds listed in Tables I-IX can be prepared in a similar manner.
TABLE I |
|
No. | R3 | R4 | Data |
1 | Cl | Phenyl | |
2 | Cl | Cyano | |
3 | Cl | Ethoxycarbonyl | |
4 | Cl | Cyclopropyl | |
5 | CF3 | CF3 | |
6 | CF3 | Phenyl | |
7 | CCl3 | CCl3 | |
8 | CCl3 | Phenyl | |
9 | CH2Cl | Phenyl | |
10 | CH2CF3 | Phenyl | |
11 | CF2Cl | Phenyl | |
12 | CHCl2 | Phenyl | |
13 | Cyclopropyl | Cyclopropyl | |
14 | Cyclopropyl | Phenyl | oil; IR (film): 1190, 1129, 1056, 1032, 768 |
15 | Cyclopropyl | 4-Fluorophenyl | oil; IR (film): 1508, 1225, 1129, 998, 839 |
16 | Cyclopropyl | 4-Chlorophenyl | oil; IR (film): 1490, 1129, 1091, 1014, 1800 |
17 | Cyclopropyl | 4-Methoxyphenyl | oil; IR (film): 1251, 1177, 1129, 1033 |
18 | Cyclopropyl | 4-Ethoxyphenyl | |
19 | Cyclopropyl | 4-Phenoxyphenyl | |
20 | Cyclopropyl | Pentachlorophenyl | |
21 | Cyclopropyl | Pentafluorophenyl | |
22 | Cyclopentyl | Phenyl | |
23 | Cyclohexyl | Phenyl | |
24 | Phenyl | 2,2-Dichloro-1-methylcyclopropyl | |
25 | Phenyl | 2,2-Difluorocyclopropyl | |
26 | Phenyl | 2,2-Dichlorocyclopropyl | |
27 | Phenyl | 2,2-Dibromocyclopropyl | |
28 | Phenyl | 2,2,3,3-Tetrafluorocyclobutyl | |
29 | Phenyl | 2,2-Dimethylcyclopropyl | |
30 | Phenyl | 1-Methylcyclohexyl | |
31 | CN | Methoxymethyl | |
32 | CN | Ethoxymethyl | |
33 | CN | n-Propoxymethyl | |
34 | CN | iso-Propoxymethyl | |
35 | CN | tert.-Butoxymethyl | |
36 | CN | 2-Methoxyprop-2-yl | oil; IR (film): 1436, 1191, 1131, 1057, 1003 |
37 | CN | 2-Ethoxyprop-2-yl | oil; IR (film): 1191, 1177, 1131, 1095, 1010 |
38 | CN | 2-n-Propoxyprop-2-yl | oil; IR (film): 1191, 1175, 1131, 1060, 1005 |
39 | CN | 2-iso-Propoxyprop-2-yl | oil; IR (film): 1370, 1191, 1172, 1131, 998 |
40 | CN | 2-tert.-Butoxyprop-2-yl | |
41 | CN | Methylthiomethyl | |
42 | CN | tert.-Butylthiomethyl | |
43 | CN | 2-Methylthioprop-2-yl | oil; IR (film): 1436, 1191, 1131, 1114, 1086, 998 |
44 | CN | 2-iso-Propylthioprop-2-yl | |
45 | CN | 2-tert.-Butylthioprop-2-yl | oil; IR (film): 1366, 1191, 1132, 1113, 1012, 1000 |
46 | CN | Methyl | |
47 | CN | Ethyl | |
48 | CN | n-Propyl | |
49 | CN | iso-Propyl | oil; IR (film): 1285, 1258, 1189, 1131, 1111, 1069, 1006 |
50 | CN | n-Butyl | |
51 | CN | iso-Butyl | |
52 | CN | sec.-Butyl | |
53 | CN | tert.-Butyl | |
54 | CN | n-Hexyl | |
55 | CN | n-Decyl | |
56 | CN | Cyclopropyl | oil; IR (film): 1207, 1190, 1130, 1057, 1003 |
57 | CN | Cyclohexyl | |
58 | CN | Phenylthiomethyl | |
59 | CN | 2-Phenylthiomethyl | |
60 | CN | 2-(2′-Chlorophenylthio)prop-2-yl | |
61 | CN | Ethynyl | |
62 | CN | 1-Propynyl | |
63 | CN | Methoxy | |
64 | CN | Ethoxy | |
65 | CN | n-Propoxy | |
66 | CN | iso-Propoxy | |
67 | CN | n-Butoxy | |
68 | CN | iso-Butoxy | |
69 | CN | sec.-Butoxy | |
70 | CN | tert.-Butoxy | |
71 | CN | Methylthio | |
72 | CN | Ethylthio | |
73 | CN | n-Propylthio | |
74 | CN | iso-Propylthio | |
75 | CN | n-Butylthio | |
76 | CN | iso-Butylthio | |
77 | CN | sec.-Butylthio | |
78 | CN | tert.-Butylthio | |
79 | CN | Benzylthio | |
80 | CN | Trifluoromethoxy | |
81 | CN | Cyano | |
82 | CN | Amino | |
83 | CN | Methylamino | |
84 | CN | Dimethylamino | |
85 | CN | Ethylamino | |
86 | CN | Diethylamino | |
87 | CN | Di-n-Propylamino | |
88 | CN | Di-iso-Propylamino | |
89 | CN | Di-n-Butylamino | |
90 | CN | Di-iso-Butylamino | |
91 | CN | Acetyl | |
92 | CN | Propion-1-yl | |
93 | CN | Butyr-1-yl | |
94 | CN | iso-Butyr-1-yl | |
95 | CN | Pivaloyl | |
96 | CN | Benzoyl | |
97 | CN | 4-Chlorobenzoyl | |
98 | CN | Benzylcarbonyl | |
99 | CN | Methoxycarbonyl | |
100 | CN | Ethoxycarbonyl | |
101 | CN | n-Propoxycarbonyl | |
102 | CN | iso-Propoxycarbonyl | |
103 | CN | n-Butoxycarbonyl | |
104 | CN | iso-Butoxycarbonyl | |
105 | CN | sec.-Butoxycarbonyl | |
106 | CN | tert.-Butoxycarbonyl | |
107 | CN | n-Hexoxycarbonyl | |
108 | CN | Phenoxycarbonyl | |
109 | CN | 4-Chlorophenoxycarbonyl | |
110 | CN | Benzyloxycarbonyl | |
111 | CN | Aminocarbonyl | |
112 | CN | Dimethylaminocarbonyl | |
113 | CN | Diethylaminocarbonyl | |
114 | CN | Di-iso-Propylaminocarbonyl | |
115 | CN | Phenylaminocarbonyl | |
116 | CN | N-Methyl-N-Phenylaminocarbonyl | |
117 | CN | Phenyl | oil; IR (film): 1245, 1127, 1024, 1015, 767, 750 |
118 | CN | 2-Fluorophenyl | |
119 | CN | 3-Fluorophenyl | |
120 | CN | 4-Fluorophenyl | |
121 | CN | Pentafluorophenyl | |
122 | CN | 2-Chlorophenyl | |
123 | CN | 3-Chlorophenyl | |
124 | CN | 4-Chlorophenyl | |
125 | CN | Pentachlorophenyl | |
126 | CN | 2,3-Dichlorophenyl | |
127 | CN | 2,4-Dichlorophenyl | |
128 | CN | 2,5-Dichlorophenyl | |
129 | CN | 2,6-Dichlorophenyl | |
130 | CN | 3,4-Dichlorophenyl | |
131 | CN | 3,5-Dichlorophenyl | |
132 | CN | 2,3,4-Trichlorophenyl | |
133 | CN | 2,3,5-Trichlorophenyl | |
134 | CN | 2,3,6-Trichlorophenyl | |
135 | CN | 2,4,5-Trichlorophenyl | |
136 | CN | 2,4,6-Trichlorophenyl | |
137 | CN | 3,4,5-Trichlorophenyl | |
138 | CN | 2,3,4,6-Tetrachlorophenyl | |
139 | CN | 2,3,5,6-Tetrachlorophenyl | |
140 | CN | 2-Bromophenyl | |
141 | CN | 3-Bromophenyl | |
142 | CN | 4-Bromophenyl | |
143 | CN | 2,4-Dibromophenyl | |
144 | CN | 3-Bromo-4-fluorophenyl | |
145 | CN | 3-Bromo-4-methoxyphenyl | |
146 | CN | 2-Iodophenyl | |
147 | CN | 3-Iodophenyl | |
148 | CN | 4-Iodophenyl | |
149 | CN | 2-Chloro-4-fluorophenyl | |
150 | CN | 2-Chloro-5-fluorophenyl | |
151 | CN | 2-Chloro-6-fluorophenyl | |
152 | CN | 2-Chloro-4-bromophenyl | |
153 | CN | 2-Bromo-4-chlorophenyl | |
154 | CN | 2-Bromo-4-fluorophenyl | |
155 | CN | 3-Bromo-4-chlorophenyl | |
156 | CN | 3-Chloro-4-fluorophenyl | |
157 | CN | 3-Fluoro-4-chlorophenyl | |
158 | CN | 2-Cyanophenyl | |
159 | CN | 3-Cyanophenyl | |
160 | CN | 4-Cyanophenyl | |
161 | CN | 2-Nitrophenyl | |
162 | CN | 3-Nitrophenyl | |
163 | CN | 4-Nitrophenyl | |
164 | CN | 2-Methylphenyl | |
165 | CN | 3-Methylphenyl | |
166 | CN | 4-Methylphenyl | |
167 | CN | 2,4-Dimethylphenyl | |
168 | CN | 2,6-Dimethylphenyl | |
169 | CN | 3,4-Dimethylphenyl | |
170 | CN | 3,5-Dimethylphenyl | |
171 | CN | 2,3,4-Trimethylphenyl | |
172 | CN | 2,3,5-Trimethylphenyl | |
173 | CN | 2,3,6-Trimethylphenyl | |
174 | CN | 2,4,5-Trimethylphenyl | |
175 | CN | 2,4,6-Trimethylphenyl | |
176 | CN | 3,4,5-Trimethylphenyl | |
177 | CN | Pentamethylphenyl | |
178 | CN | 2-Ethylphenyl | |
179 | CN | 3-Ethylphenyl | |
180 | CN | 4-Ethylphenyl | |
181 | CN | 3,5-Diethylphenyl | |
182 | CN | 2-n-Propylphenyl | |
183 | CN | 3-n-Propylphenyl | |
184 | CN | 4-n-Propylphenyl | |
185 | CN | 2-iso-Propylphenyl | |
186 | CN | 3-iso-Propylphenyl | |
187 | CN | 4-iso-Propylphenyl | |
188 | CN | 2,4-Di-iso-Propylphenyl | |
189 | CN | 3,5-Di-iso-Propylphenyl | |
190 | CN | 4-n-Butylphenyl | |
191 | CN | 4-sec.-Butylphenyl | |
192 | CN | 4-iso-Butylphenyl | |
193 | CN | 4-tert.-Butylphenyl | |
194 | CN | 3-tert.-Butylphenyl | |
195 | CN | 2-tert.-Butylphenyl | |
196 | CN | 2,4-Di-tert.-Butylphenyl | |
197 | CN | 3,5-Di-tert.-Butylphenyl | |
198 | CN | 4-n-Hexylphenyl | |
199 | CN | 4-n-Dodecylphenyl | |
200 | CN | 2-Methyl-4-tert.-Butylphenyl | |
201 | CN | 2-Methyl-6-tert.-Butylphenyl | |
202 | CN | 2-Methyl-4-iso-Propylphenyl | |
203 | CN | 2-Methyl-4-Cyclophexylphenyl | |
204 | CN | 2-Methyl-4-Phenylphenyl | |
205 | CN | 2-Methyl-4-Benzylphenyl | |
206 | CN | 2-Methyl-4-Phenoxyphenyl | |
207 | CN | 2-Methyl-4-Benzyloxyphenyl | |
208 | CN | 2-Methyl-3-Chlorophenyl | |
209 | CN | 2-Methyl-4-Chlorophenyl | |
210 | CN | 2-Methyl-5-Chlorophenyl | |
211 | CN | 2-Methyl-6-Chlorophenyl | |
212 | CN | 2-Methyl-4-Fluorophenyl | |
213 | CN | 2-Methyl-3-Bromophenyl | |
214 | CN | 2-Methyl-4-Bromophenyl | |
215 | CN | 2-Methyl-3-Methoxyphenyl | |
216 | CN | 2-Methyl-4-Methoxyphenyl | |
217 | CN | 2-Methyl-5-methoxyphenyl | |
218 | CN | 2-Methyl-6-methoxyphenyl | |
219 | CN | 2-Methyl-4-iso-Propoxyphenyl | |
220 | CN | 2-Methyl-2,5-dimethoxyphenyl | |
221 | CN | 2-Methoxyphenyl | |
222 | CN | 3-Methoxyphenyl | |
223 | CN | 4-Methoxyphenyl | |
224 | CN | 2,3-Dimethoxyphenyl | |
225 | CN | 2,4-Dimethoxyphenyl | |
226 | CN | 2,5-Dimethoxyphenyl | |
227 | CN | 2,6-Dimethoxyphenyl | |
228 | CN | 3,4-Dimethoxyphenyl | |
229 | CN | 3,5-Dimethoxyphenyl | |
230 | CN | 3,6-Dimethoxyphenyl | |
231 | CN | 2,3,4-Trimethoxyphenyl | |
232 | CN | 2,3,5-Trimethoxyphenyl | |
233 | CN | 2,3,6-Trimethoxyphenyl | |
234 | CN | 2,4,5-Trimethoxyphenyl | |
235 | CN | 2,4,6-Trimethoxyphenyl | |
236 | CN | 3,4,5-Trimethoxyphenyl | |
237 | CN | 2-Ethoxyphenyl | |
238 | CN | 3-Ethoxyphenyl | |
239 | CN | 4-Ethoxyphenyl | |
240 | CN | 2-iso-Propoxyphenyl | |
241 | CN | 3-iso-Propoxyphenyl | |
242 | CN | 4-iso-Propoxyphenyl | |
243 | CN | 3-tert.-Butoxyphenyl | |
244 | CN | 4-tert.-Butoxyphenyl | |
245 | CN | 2-Trifluoromethoxyphenyl | |
246 | CN | 3-Trifluoromethoxyphenyl | |
247 | CN | 4-Trifluoromethoxyphenyl | |
248 | CN | 3-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
249 | CN | 4-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
250 | CN | 2-Chloromethylphenyl | |
251 | CN | 3-Chloromethylphenyl | |
252 | CN | 4-Chloromethylphenyl | |
253 | CN | 2-Trifluoromethylphenyl | |
254 | CN | 3-Trifluoromethylphenyl | |
255 | CN | 4-Trifluoromethylphenyl | |
256 | CN | 2-(Methoxyiminomethyl)phenyl | |
257 | CN | 3-(Methoxyiminomethyl)phenyl | |
258 | CN | 4-(Methoxyiminomethyl)phenyl | |
259 | CN | 2-(Ethoxyiminomethyl)phenyl | |
260 | CN | 3-(Ethoxyiminomethyl)phenyl | |
261 | CN | 4-(Ethoxyiminomethyl)phenyl | |
262 | CN | 2-(n-Propoxyiminomethyl)phenyl | |
263 | CN | 3-(n-Propoxyiminomethyl)phenyl | |
264 | CN | 4-(n-Propoxyiminomethyl)phenyl | |
265 | CN | 2-(iso-Propoxyiminomethyl)phenyl | |
266 | CN | 3-(iso-Propoxyiminomethyl)phenyl | |
267 | CN | 4-(iso-Propoxyiminomethyl)phenyl | |
268 | CN | 2-(n-Butoxyiminomethyl)phenyl | |
269 | CN | 3-(n-Butoxyiminomethyl)phenyl | |
270 | CN | 4-(n-Butoxyiminomethyl)phenyl | |
271 | CN | 2-(iso-Butoxyiminomethyl)phenyl | |
272 | CN | 3-(iso-Butoxyiminomethyl)phenyl | |
273 | CN | 4-(iso-Butoxyiminomethyl)phenyl | |
274 | CN | 2-(tert.-Butoxyiminomethyl)phenyl | |
275 | CN | 3-(tert.-Butoxyiminomethyl)phenyl | |
276 | CN | 4-(tert.-Butoxyiminomethyl)phenyl | |
277 | CN | 2-(n-Pentoxyiminomethyl)phenyl | |
278 | CN | 3-(n-Pentoxyiminomethyl)phenyl | |
279 | CN | 4-(n-Pentoxyiminomethyl)phenyl | |
280 | CN | 2-(n-Hexoxyiminomethyl)phenyl | |
281 | CN | 3-(n-Hexoxyiminomethyl)phenyl | |
282 | CN | 4-(n-Hexoxyiminomethyl)phenyl | |
283 | CN | 2-(Allyloxyiminomethyl)phenyl | |
284 | CN | 3-(Allyloxyiminomethyl)phenyl | |
285 | CN | 4-(Allyloxyiminomethyl)phenyl | |
286 | CN | 2-(Benzyloxyiminomethyl)phenyl | |
287 | CN | 3-(Benzyloxyiminomethyl)phenyl | |
288 | CN | 4-(Benzyloxyiminomethyl)phenyl | |
289 | CN | 2-(Methoxyimino-1′-ethyl)phenyl | |
290 | CN | 3-(Methoxyimino-1′-ethyl)phenyl | |
291 | CN | 4-(Methoxyimino-1′-ethyl)phenyl | |
292 | CN | 2-(Ethoxyimino-1′-ethyl)phenyl | |
293 | CN | 3-(Ethoxyimino-1′-ethyl)phenyl | |
294 | CN | 4-(Ethoxyimino-1′-ethyl)phenyl | |
295 | CN | 2-(n-Propoxyimino-1′-ethyl)phenyl | |
296 | CN | 3-(n-Propoxyimino-1′-ethyl)phenyl | |
297 | CN | 4-(n-Propoxyimino-1′-ethyl)phenyl | |
298 | CN | 2-(n-Butoxyimino-1′-ethyl)phenyl | |
299 | CN | 3-(n-Butoxyimino-1′-ethyl)phenyl | |
300 | CN | 4-(n-Butoxyimino-1′-ethyl)phenyl | |
301 | CN | 2-(n-Pentoxyimino-1′-ethyl)phenyl | |
302 | CN | 3-(n-Pentoxyimino-1′-ethyl)phenyl | |
303 | CN | 4-(n-Pentoxyimino-1′-ethyl)phenyl | |
304 | CN | 2-(n-Hexoxyimino-1′-ethyl)phenyl | |
305 | CN | 3-(n-Hexoxyimino-1′-ethyl)phenyl | |
306 | CN | 4-(n-Hexoxyimino-1′-ethyl)phenyl | |
307 | CN | 2-(Allyloxyimino-1′-ethyl)phenyl | |
308 | CN | 3-(Allyloxyimino-1′-ethyl)phenyl | |
309 | CN | 4-(Allyloxyimino-1′-ethyl)phenyl | |
310 | CN | 2-(Benzyloxyimino-1′-ethyl)phenyl | |
311 | CN | 3-(Benzyloxyimino-1′-ethyl)phenyl | |
312 | CN | 4-(Benzyloxyimino-1′-ethyl)phenyl | |
313 | CN | 2-Phenylphenyl | |
314 | CN | 3-Phenylphenyl | |
315 | CN | 4-Phenylphenyl | |
316 | CN | 2-Phenoxyphenyl | |
317 | CN | 3-Phenoxyphenyl | |
318 | CN | 4-Phenoxyphenyl | |
319 | CN | 2-Benzyloxyphenyl | |
320 | CN | 3-Benzyloxyphenyl | |
321 | CN | 4-Benzyloxyphenyl | |
322 | CN | 4-(Imidazol-1′-yl)phenyl | |
323 | CN | 4-(Piperazin-1′-yl)phenyl | |
324 | CN | 4-(Morpholin-1′-yl)phenyl | |
325 | CN | 4-(Piperidin-1′-yl)phenyl | |
326 | CN | 4-(Pyridyl-2′-oxy)phenyl | |
327 | CN | 2-Cyclopropylphenyl | |
328 | CN | 3-Cyclopropylphenyl | |
329 | CN | 4-Cyclopropylphenyl | |
330 | CN | 3-Cyclohexylphenyl | |
331 | CN | 4-Cyclohexylphenyl | |
332 | CN | 4-Oxiranylphenyl | |
333 | CN | 4-(1′,3′-Diozan-2′-yl)phenyl | |
334 | CN | 4-(Tetrahydropyran-2-yloxy)phenyl | |
335 | CN | 1-Naphthyl | |
336 | CN | 2-Naphthyl | |
337 | CN | 9-Anthryl | |
338 | CN | 1-Naphtoxy | |
339 | CN | 2-Naphtoxy | |
340 | CN | 9-Anthroxy | |
341 | CN | Phenoxy | |
342 | CN | 2-Chlorophenoxy | |
343 | CN | 3-Chlorophenoxy | |
344 | CN | 4-Chlorophenoxy | |
345 | CN | 4-Methylphenoxy | |
346 | CN | 4-tert.-Butylphenoxy | |
347 | CN | 4-Methoxyphenoxy | |
348 | CN | 4-Ethoxyphenoxy | |
349 | CN | 4-tert.-Butoxyphenoxy | |
350 | CN | Phenylthio | |
351 | CN | 2-Chlorophenylthio | |
352 | CN | 4-Chlorophenylthio | |
353 | CN | Benzyl | |
354 | CN | 2-Methylbenzyl | |
355 | CN | 3-Methylbenzyl | |
356 | CN | 4-Methylbenzyl | |
357 | CN | 4-tert.-Butylbenzyl | |
358 | CN | 2-Chlorobenzyl | |
359 | CN | 3-Chlorobenzyl | |
360 | CN | 4-Chlorobenzyl | |
361 | CN | 2,4-Dichlorobenzyl | |
362 | CN | 2,6-Dichlorobenzyl | |
363 | CN | 2,4,6-Trichlorobenzyl | |
364 | CN | 2-Trifluoromethylbenzyl | |
365 | CN | 3-Trifluoromethylbenzyl | |
366 | CN | 4-Trifluoromethylbenzyl | |
367 | CN | 2-Methoxybenzyl | |
368 | CN | 4-Methoxybenzyl | |
369 | CN | 4-tert.-Butoxybenzyl | |
370 | CN | 4-Phenoxybenzyl | |
371 | CN | 1-Phenethyl | |
372 | CN | 2-Phenethyl | |
373 | CN | 1-Phenylpropyl | |
374 | CN | 2-Phenylpropyl | |
375 | CN | 3-Phenylpropyl | |
376 | CN | 2-Methyl-2-phenylpropyl | |
377 | CN | 2-Methyl-3-phenylpropyl | |
378 | CN | 4-Phenylbutyl | |
379 | CN | 2-Phenyl-1-ethenyl | |
380 | CN | 1-Phenyl-1-ethenyl | |
381 | CN | 1-Phenyl-1-propenyl | |
382 | CN | 1-Phenyl-1-propen-2-yl | |
383 | CN | 2,2-Diphenylethenyl | |
384 | CN | Phenoxymethyl | |
385 | CN | 2-Pyridyl | |
386 | CN | 3-Pyridyl | |
387 | CN | 4-Pyridyl | |
388 | CN | 2,6-Pyrimidinyl | |
389 | CN | 1,5-Pyrimidinyl | |
390 | CN | 2-Thienyl | |
391 | CN | 3-Thienyl | |
392 | CN | 2-Furyl | |
393 | CN | 3-Furyl | |
394 | CN | 1-Pyrrolyl | |
395 | CN | 1-Imidazolyl | |
396 | CN | 1,2,4-Triazolyl | |
397 | CN | 1,3,4-Triazolyl | |
398 | CN | 4-Thiazolyl | |
399 | CN | 2-Benzothiazolyl | |
400 | CN | 2-Pyridyloxy | |
401 | CN | 2-Pyrimidinyloxy | |
402 | CN | 2-Pyridylthio | |
403 | CN | 2-Pyrimidinylthio | |
404 | CN | 2-Benzothiazolylthio | |
405 | CN | Phenylthiomethyl | |
406 | CN | 2-Pyridylmethyl | |
407 | CN | 3-Pyridylmethyl | |
408 | CN | Furfuryloxy | |
409 | CN | Thienylmethoxy | |
410 | CN | 3-Isoxazolylmethoxy | |
411 | CN | 2-Oxazolylmethoxy | |
412 | CN | 2-Pyridylmethoxy | |
413 | CN | 2′-Furyl-2-ethenyl | |
414 | CN | 2′-Thienyl-2-ethenyl | |
415 | CN | 3′-Pyridyl-2-ethenyl | |
416 | CN | Oxiranyl | |
417 | CN | 1-Aziridinyl | |
418 | CN | 1-Azetidinyl | |
419 | CN | 1-Pyrrolidinyl | |
420 | CN | 2-Tetrahydrofuryl | |
421 | CN | 2-Tetrahydropyranyl | |
422 | CN | 3-Tetrahydropyranyl | |
423 | CN | 1-Piperidinyl | |
424 | CN | 1-Morpholinyl | |
425 | CN | 1-Piperazinyl | |
426 | CN | 1,3-Dioxan-2-yl | |
427 | CN | 3-Tetrahydrothiopyranyl | |
428 | CN | 2-Dihydropyranyloxy | |
429 | CN | 2-Tetrahydropyranyloxy | oil; IR (film): 1205, 1131, 1087, 1047, 1004 |
430 | CN | (CH2)4 | |
431 | CN | (CH2)5 | |
432 | CN | (CH2)6 | |
433 | CN | ||
434 | CN | ||
435 | CN |
|
|
436 | CN |
|
|
437 | CN |
|
|
438 | CN |
|
|
439 | CN |
|
|
440 | CN |
|
|
441 | CN | CF3 | |
442 | CN | 2-Fluoroethyl | |
443 | CN | 2,2,2-Trifluoroethyl | |
444 | CN | Pentafluoroethyl | |
445 | CN | Chloromethyl | |
446 | CN | Dichloromethyl | |
447 | CN | Trichloromethyl | |
448 | CN | 2-Chloroethyl | |
449 | CN | 2,2,2-Trichloroethyl | |
450 | CN | Pentachloroethyl | |
451 | CN | Cyclopropyl | |
452 | CN | Cyclobutyl | |
453 | CN | Cyclopentyl | |
454 | CN | Cyclohexyl | |
455 | CN | 1-Methylcyclopropyl | |
456 | CN | 2,2-Dimethylcyclopropyl | |
457 | CN | 1-Methylcyclohexyl | |
458 | CN | 2,2-Difluorocyclopropyl | |
459 | CN | 2,2-Dichlorocyclopropyl | |
460 | CN | 2,2-Dibromocyclopropyl | |
461 | CN | 2,2-Dichloro-3-methylcyclopropyl | |
462 | CN | 2,2,3,3-Tetrafluorocyclopropyl | |
463 | CN | Ethenyl | |
464 | CN | 1-Propenyl | |
465 | CN | 2-Methyl-1-propenyl | |
466 | CN | 4-Methylpent-3-en-1-yl | |
467 | CN | 2-Propenyl | |
468 | CN | 2-Butenyl | |
469 | CN | 1-Methyl-2-propenyl | |
470 | CN | 3-Methyl-2-butenyl | |
471 | CN | 2,2-Difluoroenthenyl | |
472 | CN | 2,2-Dichloroenthenyl | |
473 | CN | 3,3,3-Trifluoropropenyl | |
474 | CN | 3,3,3-Trichloropropenyl | |
475 | CN | 3-Chloro-2-propenyl | |
476 | CN | Cyclopent-1-enyl | |
477 | CN | Cyclopentadienyl | |
478 | CN | Cyclohex-1-enyl | |
479 | CN | Pentafluorocyclopentadienyl | |
480 | CN | Pentachlorocyclopentadienyl | |
481 | CN | Styryl | |
482 | CH3 | Methoxymethyl | |
483 | CH3 | Ethoxymethyl | |
484 | CH3 | n-Propoxymethyl | |
485 | CH3 | iso-Propoxymethyl | |
486 | CH3 | tert.-Butoxymethyl | |
487 | CH3 | 2-Methoxyprop-2-yl | |
488 | CH3 | 2-Ethoxyprop-2-yl | |
489 | CH3 | 2-n-Propoxyprop-2-yl | |
490 | CH3 | 2-iso-Propoxyprop-2-yl | |
491 | CH3 | 2-tert.-Butoxyprop-2-yl | |
492 | CH3 | Methylthiomethyl | |
493 | CH3 | tert.-Butylthiomethyl | |
494 | CH3 | 2-Methylthioprop-2-yl | |
495 | CH3 | 2-iso-Propylthioprop-2-yl | |
496 | CH3 | 2-tert.-Butylthioprop-2-yl | |
497 | CH3 | Methyl | |
498 | CH3 | Ethyl | |
499 | CH3 | n-Propyl | |
500 | CH3 | iso-Propyl | |
501 | CH3 | n-Butyl | |
502 | CH3 | iso-Butyl | |
503 | CH3 | sec.-Butyl | |
504 | CH3 | tert.-Butyl | |
505 | CH3 | n-Hexyl | |
506 | CH3 | n-Decyl | |
507 | CH3 | Cyclopropyl | |
508 | CH3 | Cyclohexyl | |
509 | CH3 | Phenylthiomethyl | |
510 | CH3 | 2-Phenylthiomethyl | |
511 | CH3 | 2-(2′-Chlorophenylthio)prop-2-yl | |
512 | CH3 | Ethenyl | |
513 | CH3 | 1-Propynyl | |
514 | CH3 | Methoxy | |
515 | CH3 | Ethoxy | |
516 | CH3 | n-Propoxy | |
517 | CH3 | iso-Propoxy | |
518 | CH3 | n-Butoxy | |
519 | CH3 | iso-Butoxy | |
520 | CH3 | sec.-Butoxy | |
521 | CH3 | tert.-Butoxy | |
522 | CH3 | Methylthio | |
523 | CH3 | Ethylthio | |
524 | CH3 | n-Propylthio | |
525 | CH3 | iso-Propylthio | |
526 | CH3 | n-Butylthio | |
527 | CH3 | iso-Butylthio | |
528 | CH3 | sec.-Butylthio | |
529 | CH3 | tert.-Butylthio | |
530 | CH3 | Benzylthio | |
531 | CH3 | Trifluoromethoxy | |
532 | CH3 | Cyano | |
533 | CH3 | Amino | |
534 | CH3 | Methylamino | |
535 | CH3 | Dimethylamino | |
536 | CH3 | Ethylamino | |
537 | CH3 | Diethylamino | |
538 | CH3 | Di-n-Propylamino | |
539 | CH3 | Di-iso-Propylamino | |
540 | CH3 | Di-n-Butylamino | |
541 | CH3 | Di-iso-Butylamino | |
542 | CH3 | Acetyl | |
543 | CH3 | Propion-1-yl | |
544 | CH3 | Butyr-1-yl | |
545 | CH3 | iso-Butyr-1-yl | |
546 | CH3 | Pivaloyl | |
547 | CH3 | Benzoyl | |
548 | CH3 | 4-Chlorobenzoyl | |
549 | CH3 | Benzoylcarbonyl | |
550 | CH3 | Methoxycarbonyl | |
551 | CH3 | Ethoxycarbonyl | |
552 | CH3 | n-Propoxycarbonyl | |
553 | CH3 | iso-Propoxycarbonyl | |
554 | CH3 | n-Butoxycarbonyl | |
555 | CH3 | iso-Butoxycarbonyl | |
556 | CH3 | sec.-Butoxycarbonyl | |
557 | CH3 | tert.-Butoxycarbonyl | |
558 | CH3 | n-Hexoxycarbonyl | |
559 | CH3 | Phenoxycarbonyl | |
560 | CH3 | 4-Chlorophenoxycarbonyl | |
561 | CH3 | Benzyloxycarbonyl | |
562 | CH3 | Aminocarbonyl | |
563 | CH3 | Dimethylaminocarbonyl | |
564 | CH3 | Diethylaminocarbonyl | |
565 | CH3 | Di-iso-Propylaminocarbonyl | |
566 | CH3 | Phenylaminocarbonyl | |
567 | CH3 | N-Methyl-N-Phenylaminocarbonyl | |
568 | CH3 | Phenyl | |
569 | CH3 | 2-Fluorophenyl | oil; IR (film): 1708, 1634, 1257, 1129, 761 |
570 | CH3 | 3-Fluorophenyl | |
571 | CH3 | 4-Fluorophenyl | m. p.: 67-68° C.; IR (KBr): 1691, 1629, 1295, 1253, 1132, 1037, 848 |
572 | CH3 | Pentafluorophenyl | |
573 | CH3 | 2-Chlorophenyl | oil; — |
574 | CH3 | 3-Chlorophenyl | |
575 | CH3 | 4-Chlorophenyl | |
576 | CH3 | Pentachlorophenyl | |
577 | CH3 | 2,3-Dichlorophenyl | |
578 | CH3 | 2,4-Dichlorophenyl | oil; IR (film): 1708, 1634, 1256, 1129 |
579 | CH3 | 2,5-Dichlorophenyl | m. p.: 80-2° C.; IR (KBr): 1704, 1634, 1250, 1132, 934, 766 |
580 | CH3 | 2,6-Dichlorophenyl | |
581 | CH3 | 3,4-Dichlorophenyl | |
582 | CH3 | 3,5-Dichlorophenyl | m. p.: 87-88° C.; IR (KBr): 1699, 1303, 1071, 1015, 932, 835 |
583 | CH3 | 2,3,4-Trichlorophenyl | oil; IR (film): 1709, 1627, 1257, 1131, 1109 |
584 | CH3 | 2,3,5-Trichlorophenyl | |
585 | CH3 | 2,3,6-Trichlorophenyl | |
586 | CH3 | 2,4,5-Trichlorophenyl | |
587 | CH3 | 2,4,6-Trichlorophenyl | |
588 | CH3 | 3,4,5-Trichlorophenyl | |
589 | CH3 | 2,3,4,6-Tetrachlorophenyl | |
590 | CH3 | 2,3,5,6-Tetrachlorophenyl | |
591 | CH3 | 2-Bromophenyl | |
592 | CH3 | 3-Bromophenyl | m. p.: 60-2° C.; IR (KBr): 1708, 1635, 1253, 1129, 1113, 933, 773 |
593 | CH3 | 4-Bromophenyl | m. p.: 104-6° C.; IR (KBr): 1694, 1620, 1296, 1264, 1035, 938 |
594 | CH3 | 2,4-Dibromophenyl | |
595 | CH3 | 3-Bromo-4-Fluorophenyl | |
596 | CH3 | 3-Bromo-4-Methoxyphenyl | |
597 | CH3 | 2-Iodophenyl | |
598 | CH3 | 3-Iodophenyl | |
599 | CH3 | 4-Iodophenyl | |
600 | CH3 | 2-Chloro-4-fluorophenyl | |
601 | CH3 | 2-Chloro-5-fluorophenyl | |
602 | CH3 | 2-Chloro-6-fluorophenyl | |
603 | CH3 | 2-Chloro-4-bromophenyl | |
604 | CH3 | 2-Bromo-4-chlorophenyl | |
605 | CH3 | 2-Bromo-4-fluorophenyl | |
606 | CH3 | 3-Bromo-4-chlorophenyl | |
607 | CH3 | 3-Chloro-4-fluorophenyl | |
608 | CH3 | 3-Fluoro-4-chlorophenyl | |
609 | CH3 | 2-Cyanophenyl | |
610 | CH3 | 3-Cyanophenyl | |
611 | CH3 | 4-Cyanophenyl | |
612 | CH3 | 2-Nitrophenyl | |
613 | CH3 | 3-Nitrophenyl | |
614 | CH3 | 4-Nitrophenyl | |
615 | CH3 | 2-Methylphenyl | |
616 | CH3 | 3-Methylphenyl | oil; IR (film): 1709, 1634, 1256, 1129 |
617 | CH3 | 4-Methylphenyl | m. p.: 73-75° C.; IR (KBr): 1696, 1625, 1262, 1127, 1037, 930 |
618 | CH3 | 2,4-Dimethylphenyl | |
619 | CH3 | 2,6-Dimethylphenyl | |
620 | CH3 | 3,4-Dimethylphenyl | |
621 | CH3 | 3,5-Dimethylphenyl | |
622 | CH3 | 2,3,4-Trimethylphenyl | |
623 | CH3 | 2,3,5-Trimethylphenyl | |
624 | CH3 | 2,3,6-Trimethylphenyl | |
625 | CH3 | 2,4,5-Trimethylphenyl | |
626 | CH3 | 2,4,6-Trimethylphenyl | |
627 | CH3 | 3,4,5-Trimethylphenyl | |
628 | CH3 | Pentamethylphenyl | |
629 | CH3 | 2-Ethylphenyl | |
630 | CH3 | 3-Ethylphenyl | |
631 | CH3 | 4-Ethylphenyl | |
632 | CH3 | 3,5-Diethylphenyl | |
633 | CH3 | 2-n-Propylphenyl | |
634 | CH3 | 3-n-Propylphenyl | |
635 | CH3 | 4-n-Propylphenyl | |
636 | CH3 | 2-iso-Propylphenyl | |
637 | CH3 | 3-iso-Propylphenyl | |
638 | CH3 | 4-iso-Propylphenyl | |
639 | CH3 | 2,4-Di-iso-Propylphenyl | |
640 | CH3 | 3,5-Di-iso-Propylphenyl | |
641 | CH3 | 4-n-Butylphenyl | |
642 | CH3 | 4-sec.-Butylphenyl | |
643 | CH3 | 4-iso-Butylphenyl | |
644 | CH3 | 4-tert.-Butylphenyl | |
645 | CH3 | 3-tert.-Butylphenyl | |
646 | CH3 | 2-tert.-Butylphenyl | |
647 | CH3 | 2,4-Di-tert.-Butylphenyl | |
648 | CH3 | 3,5-Di-tert.-Butylphenyl | |
649 | CH3 | 4-n-Hexylphenyl | |
650 | CH3 | 4-n-Dodecylphenyl | |
651 | CH3 | 2-Methyl-4-tert.-Butylphenyl | |
652 | CH3 | 2-Methyl-6-tert.-Butylphenyl | |
653 | CH3 | 2-Methyl-4-iso-Propylphenyl | |
654 | CH3 | 2-Methyl-4-Cyclohexylphenyl | |
655 | CH3 | 2-Methyl-4-Phenylphenyl | |
656 | CH3 | 2-Methyl-4-Benzylphenyl | |
657 | CH3 | 2-Methyl-4-Phenoxyphenyl | |
658 | CH3 | 2-Methyl-4-Benzyloxyphenyl | |
659 | CH3 | 2-Methyl-3-Chlorophenyl | |
660 | CH3 | 2-Methyl-4-Chlorophenyl | |
661 | CH3 | 2-Methyl-5-Chlorophenyl | |
662 | CH3 | 2-Methyl-6-Chlorophenyl | |
663 | CH3 | 2-Methyl-4-Fluorophenyl | |
664 | CH3 | 2-Methyl-3-Bromophenyl | |
665 | CH3 | 2-Methyl-4-Bromophenyl | |
666 | CH3 | 2-Methyl-3-Methoxyphenyl | |
667 | CH3 | 2-Methyl-4-Methoxyphenyl | |
668 | CH3 | 2-Methyl-5-Methoxyphenyl | |
669 | CH3 | 2-Methyl-6-Methoxyphenyl | |
670 | CH3 | 2-Methyl-4-iso-Propoxyphenyl | |
671 | CH3 | 2-Methyl-2,5-Dimethoxyphenyl | |
672 | CH3 | 2-Methoxyphenyl | |
673 | CH3 | 3-Methoxyphenyl | oil; IR (film): 1708, 1634, 1285, 1256, 1129, 1111 |
674 | CH3 | 4-Methoxyphenyl | oil; IR (film): 1708, 1235, 1129 |
675 | CH3 | 2,3-Dimethoxyphenyl | |
676 | CH3 | 2,4-Dimethoxyphenyl | |
677 | CH3 | 2,5-Dimethoxyphenyl | |
678 | CH3 | 2,6-Dimethoxyphenyl | |
679 | CH3 | 3,4-Dimethoxyphenyl | |
680 | CH3 | 3,5-Dimethoxyphenyl | |
681 | CH3 | 3,6-Dimethoxyphenyl | |
682 | CH3 | 2,3,4-Trimethoxyphenyl | |
683 | CH3 | 2,3,5-Trimethoxyphenyl | |
684 | CH3 | 2,3,6-Trimethoxyphenyl | |
685 | CH3 | 2,4,5-Trimethoxyphenyl | |
686 | CH3 | 2,4,6-Trimethoxyphenyl | |
687 | CH3 | 3,4,5-Trimethoxyphenyl | |
688 | CH3 | 2-Ethoxyphenyl | |
689 | CH3 | 3-Ethoxyphenyl | |
690 | CH3 | 4-Ethoxyphenyl | |
691 | CH3 | 2-iso-Propoxyphenyl | |
692 | CH3 | 3-iso-Propoxyphenyl | |
693 | CH3 | 4-iso-Propoxyphenyl | |
694 | CH3 | 3-tert.-Butoxyphenyl | |
695 | CH3 | 4-tert.-Butoxyphenyl | |
696 | CH3 | 2-Trifluoromethoxyphenyl | |
697 | CH3 | 3-Trifluoromethoxyphenyl | |
698 | CH3 | 4-Trifluoromethoxyphenyl | |
699 | CH3 | 3-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
700 | CH3 | 4-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
701 | CH3 | 2-Chloromethylphenyl | |
702 | CH3 | 3-Chloromethylphenyl | |
703 | CH3 | 4-Chloromethylphenyl | |
704 | CH3 | 2-Trifluoromethylphenyl | oil; IR (film): 1705, 1634, 1313, 1130, 1107, 767 |
705 | CH3 | 3-Trifluoromethylphenyl | oil; IR (film): 1710, 1635, 1276, 1128 |
706 | CH3 | 4-Trifluoromethylphenyl | m. p.: 104-5° C.; IR (KBr): 1697, 1628, 1323, 1123 |
707 | CH3 | 2-(Methoxyiminomethyl)phenyl | |
708 | CH3 | 3-(Methoxyiminomethyl)phenyl | |
709 | CH3 | 4-(Methoxyiminomethyl)phenyl | |
710 | CH3 | 2-(Ethoxyiminomethyl)phenyl | |
711 | CH3 | 3-(Ethoxyiminomethyl)phenyl | |
712 | CH3 | 4-(Ethoxyiminomethyl)phenyl | |
713 | CH3 | 2-(n-Propoxyiminomethyl)phenyl | |
714 | CH3 | 3-(n-Propoxyiminomethyl)phenyl | |
715 | CH3 | 4-(n-Propoxyiminomethyl)phenyl | |
716 | CH3 | 2-(iso-Propoxyiminomethyl)phenyl | |
717 | CH3 | 3-(iso-Propoxyiminomethyl)phenyl | |
718 | CH3 | 4-(iso-Propoxyiminomethyl)phenyl | |
719 | CH3 | 2-(n-Butoxyiminomethyl)phenyl | |
720 | CH3 | 3-(n-Butoxyiminomethyl)phenyl | |
721 | CH3 | 4-(n-Butoxyiminomethyl)phenyl | |
722 | CH3 | 2-(iso-Butoxyiminomethyl)phenyl | |
723 | CH3 | 3-(iso-Butoxyiminomethyl)phenyl | |
724 | CH3 | 4-(iso-Butoxyiminomethyl)phenyl | |
725 | CH3 | 2-(tert.-Butoxyiminomethyl)phenyl | |
726 | CH3 | 3-(tert.-Butoxyiminomethyl)phenyl | |
727 | CH3 | 4-(tert.-Butoxyiminomethyl)phenyl | |
728 | CH3 | 2-(n-Pentoxyiminomethyl)phenyl | |
729 | CH3 | 3-(n-Pentoxyiminomethyl)phenyl | |
730 | CH3 | 4-(n-Pentoxyiminomethyl)phenyl | |
731 | CH3 | 2-(n-Hexoxyiminomethyl)phenyl | |
732 | CH3 | 3-(n-Hexoxyiminomethyl)phenyl | |
733 | CH3 | 4-(n-Hexoxyiminomethyl)phenyl | |
734 | CH3 | 2-(Allyloxyiminomethyl)phenyl | |
735 | CH3 | 3-(Allyloxyiminomethyl)phenyl | |
736 | CH3 | 4-(Allyloxyiminomethyl)phenyl | |
737 | CH3 | 2-(Benzyloxyiminomethyl)phenyl | |
738 | CH3 | 3-(Benzyloxyiminomethyl)phenyl | |
739 | CH3 | 4-(Benzyloxyiminomethyl)phenyl | |
740 | CH3 | 2-(Methoxyimino-1′-ethyl)phenyl | |
741 | CH3 | 3-(Methoxyimino-1′-ethyl)phenyl | |
742 | CH3 | 4-(Methoxyimino-1′-ethyl)phenyl | |
743 | CH3 | 2-(Ethoxyimino-1′-ethyl)phenyl | |
744 | CH3 | 3-(Ethoxyimino-1′-ethyl)phenyl | |
745 | CH3 | 4-(Ethoxyimino-1′-ethyl)phenyl | |
746 | CH3 | 2-(n-Propoxyimino-1′-ethyl)phenyl | |
747 | CH3 | 3-(n-Propoxyimino-1′-ethyl)phenyl | |
748 | CH3 | 4-(n-Propoxyimino-1′-ethyl)phenyl | |
749 | CH3 | 2-(n-Butoxyimino-1′-ethyl)phenyl | |
750 | CH3 | 3-(n-Butoxyimino-1′-ethyl)phenyl | |
751 | CH3 | 4-(n-Butoxyimino-1′-ethyl)phenyl | |
752 | CH3 | 2-(n-Pentoxyimino-1′-ethyl)phenyl | |
753 | CH3 | 3-(n-Pentoxyimino-1′-ethyl)phenyl | |
754 | CH3 | 4-(n-Pentoxyimino-1′-ethyl)phenyl | |
755 | CH3 | 2-(n-Hexoxyimino-1′-ethyl)phenyl | |
756 | CH3 | 3-(n-Hexoxyimino-1′-ethyl)phenyl | |
757 | CH3 | 4-(n-Hexoxyimino-1′-ethyl)phenyl | |
758 | CH3 | 2-(Allyloxyimino-1′-ethyl)phenyl | |
759 | CH3 | 3-(Allyloxyimino-1′-ethyl)phenyl | |
760 | CH3 | 4-(Allyloxyimino-1′-ethyl)phenyl | |
761 | CH3 | 2-(Benzyloxyimino-1′-ethyl)phenyl | |
762 | CH3 | 3-(Benzyloxyimino-1′-ethyl)phenyl | |
763 | CH3 | 4-(Benzyloxyimino-1′-ethyl)phenyl | |
764 | CH3 | 2-Phenylphenyl | |
765 | CH3 | 3-Phenylphenyl | |
766 | CH3 | 4-Phenylphenyl | |
767 | CH3 | 2-Phenoxyphenyl | |
768 | CH3 | 3-Phenoxyphenyl | |
769 | CH3 | 4-Phenoxyphenyl | oil; IR (film): 1708, 1489, 1240, 1129 |
770 | CH3 | 2-Benzyloxyphenyl | |
771 | CH3 | 3-Benzyloxyphenyl | |
772 | CH3 | 4-Benzyloxyphenyl | |
773 | CH3 | 4-(Imidazol-1′-yl)phenyl | |
774 | CH3 | 4-(Piperazin-1′-yl)phenyl | |
775 | CH3 | 4-(Morpholin-1′-yl)phenyl | |
776 | CH3 | 4-(Piperidin-1′-yl)phenyl | |
777 | CH3 | 4-(Pyridyl-1′-yl)phenyl | |
778 | CH3 | 2-Cyclopropylphenyl | |
779 | CH3 | 3-Cyclopropylphenyl | |
780 | CH3 | 4-Cyclopropylphenyl | |
781 | CH3 | 3-Cyclohexylphenyl | |
782 | CH3 | 4-Cyclohexylphenyl | |
783 | CH3 | 4-Oxiranylphenyl | |
784 | CH3 | 4-(1′,3′-Dioxan-2′-yl)phenyl | |
785 | CH3 | 4-(Tetrahydropyran-2-yloxy)phenyl | |
786 | CH3 | 1-Naphthyl | |
787 | CH3 | 2-Naphthyl | |
788 | CH3 | 9-Anthryl | |
789 | CH3 | 1-Naphthoxy | |
790 | CH3 | 2-Naphthoxy | |
791 | CH3 | 9-Anthroxy | |
792 | CH3 | Phenoxy | |
793 | CH3 | 2-Chlorophenoxy | |
794 | CH3 | 3-Chlorophenoxy | |
795 | CH3 | 4-Chlorophenoxy | |
796 | CH3 | 4-Methylphenoxy | |
797 | CH3 | 4-tert.-Butylphenoxy | |
798 | CH3 | 4-Methoxyphenoxy | |
799 | CH3 | 4-Ethoxyphenoxy | |
800 | CH3 | 4-tert.-Butoxyphenoxy | |
801 | CH3 | Phenylthio | |
802 | CH3 | 2-Chlorophenylthio | |
803 | CH3 | 4-Chlorophenylthio | |
804 | CH3 | Benzyl | |
805 | CH3 | 2-Methylbenzyl | |
806 | CH3 | 3-Methylbenzyl | |
807 | CH3 | 4-Methylbenzyl | |
808 | CH3 | 4-tert.-Butylbenzyl | |
809 | CH3 | 2-Chlorobenzyl | |
810 | CH3 | 3-Chlorobenzyl | |
811 | CH3 | 4-Chlorobenzyl | |
812 | CH3 | 2,4-Dichlorobenzyl | |
813 | CH3 | 2,6-Dichlorobenzyl | |
814 | CH3 | 2,4,6-Trichlorobenzyl | |
815 | CH3 | 2-Trifluoromethylbenzyl | |
816 | CH3 | 3-Trifluoromethylbenzyl | |
817 | CH3 | 4-Trifluoromethylbenzyl | |
818 | CH3 | 2-Methoxybenzyl | |
819 | CH3 | 4-Methoxybenzyl | |
820 | CH3 | 4-tert.-Butoxybenzyl | |
821 | CH3 | 4-Phenoxybenzyl | |
822 | CH3 | 1-Phenethyl | |
823 | CH3 | 2-Phenethyl | |
824 | CH3 | 1-Phenylpropyl | |
825 | CH3 | 2-Phenylpropyl | |
826 | CH3 | 3-Phenylpropyl | |
827 | CH3 | 2-Methyl-2-phenylpropyl | |
828 | CH3 | 2-Methyl-3-phenylpropyl | |
829 | CH3 | 4-Phenylbutyl | |
830 | CH3 | 2-Phenyl-1-ethenyl | |
831 | CH3 | 1-Phenyl-1-ethenyl | |
832 | CH3 | 1-Phenyl-1-propenyl | |
833 | CH3 | 1-Phenyl-1-propen-2-yl | |
834 | CH3 | 2,3-Diphenylethenyl | |
835 | CH3 | Phenoxymethyl | |
836 | CH3 | 2-Pyridyl | |
837 | CH3 | 3-Pyridyl | |
838 | CH3 | 4-Pyridyl | |
839 | CH3 | 2,6-Pyrimidienyl | |
840 | CH3 | 1,5-Pyrimidienyl | |
841 | CH3 | 2-Thienyl | |
842 | CH3 | 3-Thienyl | |
843 | CH3 | 2-Furyl | |
844 | CH3 | 3-Furyl | |
845 | CH3 | 1-Pyrrolyl | |
846 | CH3 | 1-Imidazolyl | |
847 | CH3 | 1,2,4-Triazolyl | |
848 | CH3 | 1,3,4-Triazolyl | |
849 | CH3 | 4-Thiazolyl | |
850 | CH3 | 3-Benzothiazolyl | |
851 | CH3 | 2-Pyridyloxy | |
852 | CH3 | 2-Pyrimidinyloxy | |
853 | CH3 | 2-Pyridylthio | |
854 | CH3 | 2-Pyrimidinylthio | |
855 | CH3 | 2-Benzothiazolylthio | |
856 | CH3 | Phenylthiomethyl | |
857 | CH3 | 2-Pyridylmethyl | |
858 | CH3 | 3-Pyridylmethyl | |
859 | CH3 | Furfuryloxy | |
860 | CH3 | Thienylmethoxy | |
861 | CH3 | 3-Isoazolylmethoxy | |
862 | CH3 | 2-Oxazolylmethoxy | |
863 | CH3 | 2-Pyridylmethoxy | |
864 | CH3 | 2′-Furyl-2-ethenyl | |
865 | CH3 | 2′-Thienyl-2-ethenyl | |
866 | CH3 | 3′-Pyridyl-2-ethenyl | |
867 | CH3 | Oziranyl | |
868 | CH3 | 1-Aziridinyl | |
869 | CH3 | 1-Azetidinyl | |
870 | CH3 | 1-Pyrrolidinyl | |
871 | CH3 | 2-Tetrahydrofuryl | |
872 | CH3 | 2-Tetrahydropyranyl | |
873 | CH3 | 3-Tetrahydropyranyl | |
874 | CH3 | 1-Piperidinyl | |
875 | CH3 | 1-Morpholinyl | |
876 | CH3 | 1-Piperazinyl | |
877 | CH3 | 1,3-Dioxan-2-yl | |
878 | CH3 | 3-Tetrahydrothiopyranyl | |
879 | CH3 | 2-Dihydropyranyloxy | |
880 | CH3 | 2-Tetrahydropyranyloxy | |
881 | CH3 | CF3 | |
882 | CH3 | 2-Fluoroethyl | |
883 | CH3 | 2,2,2-Trifluoroethyl | |
884 | CH3 | Pentafluoroethyl | |
885 | CH3 | Chloromethyl | |
886 | CH3 | Dichloromethyl | |
887 | CH3 | Trichloromethyl | |
888 | CH3 | 2-Chloroethyl | |
889 | CH3 | 2,2,2-Trichloroethyl | |
890 | CH3 | Pentachloroethyl | |
891 | CH3 | Cyclopropyl | |
892 | CH3 | Cyclobutyl | |
893 | CH3 | Cyclopentyl | |
894 | CH3 | Cyclohexyl | |
895 | CH3 | 1-Methylcyclopropyl | |
896 | CH3 | 2,2-Dimethylcyclopropyl | |
897 | CH3 | 1-Methylcyclohexyl | |
898 | CH3 | 2,2-Difluorocyclopropyl | |
899 | CH3 | 2,2-Dichlorocyclopropyl | |
900 | CH3 | 2,2-Dibromocyclopropyl | |
901 | CH3 | 2,2-Dichloro-3-methylcyclopropyl | |
902 | CH3 | 2,2,3,3-Tetrafluorocyclobutyl | |
903 | CH3 | Ethenyl | |
904 | CH3 | 1-Propenyl | |
905 | CH3 | 2-Methyl-1-propenyl | |
906 | CH3 | 4-Methylpent-3-en-1-yl | |
907 | CH3 | 2-Propenyl | |
908 | CH3 | 2-Butenyl | |
909 | CH3 | 1-Methyl-2-propenyl | |
910 | CH3 | 3-Methyl-2-butenyl | |
911 | CH3 | 2,2-Difluoroethenyl | |
912 | CH3 | 2,2-Dichloroethenyl | |
913 | CH3 | 3,3,3-Trifluoropropenyl | |
914 | CH3 | 3,3,3-Trichloropropenyl | |
915 | CH3 | 3-Chloro-2-propenyl | |
916 | CH3 | Cyclopent-1-enyl | |
917 | CH3 | Cyclopentadienyl | |
918 | CH3 | Cyclohex-1-enyl | |
919 | CH3 | Pentafluorocyclopentadienyl | |
920 | CH3 | Pentachlorocyclopentadienyl | |
921 | Phenyl | Phenyl | |
922 | Phenyl | 2-Fluorophenyl | |
923 | Phenyl | 4-Fluorophenyl | |
924 | Phenyl | 2-Chlorophenyl | |
925 | Phenyl | 3-Chlorophenyl | |
926 | Phenyl | 4-Chlorophenyl | |
927 | Phenyl | 3,4-Dichlorophenyl | |
928 | Phenyl | 4-Nitrophenyl | |
929 | Phenyl | 2-CF3-Phenyl | |
930 | Phenyl | 3-CF3-Phenyl | |
931 | Phenyl | 4-CF3-Phenyl | |
932 | Phenyl | 2-Methylphenyl | |
933 | Phenyl | 3-Methylphenyl | |
934 | Phenyl | 4-Methylphenyl | |
935 | Phenyl | 2,4-Dimethylphenyl | |
936 | Phenyl | 4-tert.-Butylphenyl | |
937 | Phenyl | 4-Methoxyphenyl | |
938 | 4-Fluorophenyl | 4-Fluorophenyl | |
939 | 2-Fluorophenyl | 4-Fluorophenyl | |
940 | 2-Chlorophenyl | 4-Fluorophenyl | |
941 | 2-Chlorophenyl | 2-Chlorophenyl | |
942 | 3-Chlorophenyl | 3-Chlorophenyl | |
943 | 4-Chlorophenyl | 4-Chlorophenyl | |
944 | 2-Chlorophenyl | 4-Chlorophenyl | |
945 | 4-Methoxyphenyl | 4-Methoxyphenyl | |
946 | 4-Dimethylaminophenyl | 4-Dimethylaminophenyl | |
947 | Phenyl | Naphthyl | |
948 | Ethyl | Ethyl | |
949 | Ethyl | n-Propyl | |
950 | Ethyl | iso-Propyl | |
951 | Ethyl | n-Butyl | |
952 | Ethyl | iso-Butyl | |
953 | Ethyl | 2-Methyl-butyl | |
954 | Ethyl | Benzyl | |
955 | n-Propyl | n-Propyl | |
956 | iso-Propyl | iso-Propyl | |
957 | n-Butyl | n-Butyl | |
958 | iso-Butyl | iso-Butyl | |
959 | tert.-Butyl | tert.-Butyl | |
960 | Benzyl | Benzyl | |
961 | Pentachloroethyl | Pentachloroethyl | |
962 | n-Hexyl | n-Hexyl | |
963 | Ethoxycarbonyl | Ethoxycarbonyl | |
964 | Phenyl | Benzoyl | |
965 | Ethyl | Phenyl | |
966 | n-Butyl | Phenyl | |
967 | Styryl | Styryl | |
968 | 2-Pyridyl | 2-Pyridyl | |
969 | 3-Pyridyl | 3-Pyridyl | |
970 | CH3 | 3,5-Dibenzyloxyphenyl | IR (film): 1707, 1581, 1256, 1157, 1129 |
TABLE II |
|
No. | R3 | R4 | Data |
1 | Cl | Phenyl | |
2 | Cl | Cyano | |
3 | Cl | Ethoxycarbonyl | |
4 | Cl | Cyclopropyl | |
5 | CF3 | CF3 | |
6 | CF3 | Phenyl | |
7 | CCl3 | CCl3 | |
8 | CCl3 | Phenyl | |
9 | CH2Cl | Phenyl | |
10 | CF2CF3 | Phenyl | |
11 | CF2Cl | Phenyl | |
12 | CHCl2 | Phenyl | |
13 | Cyclopropyl | Cyclopropyl | |
14 | Cyclopropyl | Phenyl | oil; IR (film): 1437, 1321, 1219, 1045, 983, 766 |
15 | Cyclopropyl | 4-Fluorophenyl | oil; IR (film): 1508, 1321, 1222, 1046, 985, 839 |
16 | Cyclopropyl | 4-Chlorophenyl | oil; IR (film): 1489, 1321, 1218, 1090, 1046, 829 |
17 | Cyclopropyl | 4-Methoxyphenyl | oil; IR (film): 1300, 1250, 1218, 983, 833 |
18 | Cyclopropyl | 4-Ethoxyphenyl | |
19 | Cyclopropyl | 4-Phenoxyphenyl | |
20 | Cyclopropyl | Pentachlorophenyl | |
21 | Cyclopropyl | Pentafluorophenyl | |
22 | Cyclopentyl | Phenyl | |
23 | Cyclohexyl | Phenyl | |
24 | Phenyl | 2,2-Dichloro-1-methylcyclopropyl | |
25 | Phenyl | 2,2-Difluorocyclopropyl | |
26 | Phenyl | 2,2-Dichlorocyclopropyl | |
27 | Phenyl | 2,2-Dibromocyclopropyl | |
28 | Phenyl | 2,2,3,3-Tetrafluorocyclobutyl | |
29 | Phenyl | 2,2-Dimethylcyclopropyl | |
30 | Phenyl | 1-Methylcyclohexyl | |
31 | CN | Methoxymethyl | |
32 | CN | Ethoxymethyl | |
33 | CN | n-Propoxymethyl | |
34 | CN | iso-Propoxymethyl | |
35 | CN | tert.-Butoxymethyl | |
36 | CN | 2-Methoxyprop-2-yl | m.p.: 83° C.; |
IR (KBr): 1437, 1223, 1206, 1069, 1006 | |||
37 | CN | 2-Ethoxyprop-2-yl | oil; IR (film): 1439, 3122, 1221, 1202, 1048 |
38 | CN | 2-n-Propoxyprop-2-yl | oil; IR (film): 1438, 1322, 1221, 1203, 1048 |
39 | CN | 2-iso-Propoxyprop-2-yl | m.p.: 74-5° C.; |
IR (KBr): 1302, 1231, 1169, 1108, 1079, 997, 757 | |||
40 | CN | 2-tert.-Butoxyprop-2-yl | |
41 | CN | Methylthiomethyl | |
42 | CN | tert.-Butylthiomethyl | |
43 | CN | 2-Methylthioprop-2-yl | m.p.: 107° C.; |
IR (KBr): 1434, 1297, 1126, 1066, 1010, 769 | |||
44 | CN | 2-iso-Propylthioprop-2-yl | oil; IR (film): 1438, 1366, 1321, 1221, 1202 |
45 | CN | 2-tert.-Butylthioprop-2-yl | |
46 | CN | Methyl | |
47 | CN | Ethyl | |
48 | CN | n-Propyl | |
49 | CN | iso-Propyl | oil; IR (film): 1439, 1321, 1222, 1012, 767 |
50 | CN | n-Butyl | |
51 | CN | iso-Butyl | |
52 | CN | sec.-Butyl | |
53 | CN | tert.-Butyl | |
54 | CN | n-Hexyl | |
55 | CN | n-Decyl | |
56 | CN | Cyclopropyl | m.p.: 74-75° C.; IR (KBr): 1433, 1223, 1043, 763 |
57 | CN | Cyclohexyl | |
58 | CN | Phenylthiomethyl | |
59 | CN | 2-Phenylthiomethyl | |
60 | CN | 2-(2′-Chlorophenylthio)prop-2-yl | |
61 | CN | Ethynyl | |
62 | CN | 1-Propynyl | |
63 | CN | Methoxy | |
64 | CN | Ethoxy | |
65 | CN | n-Propoxy | |
66 | CN | iso-Propoxy | |
67 | CN | n-Butoxy | |
68 | CN | iso-Butoxy | |
69 | CN | sec.-Butoxy | |
70 | CN | tert.-Butoxy | |
71 | CN | Methylthio | |
72 | CN | Ethylthio | |
73 | CN | n-Propylthio | |
74 | CN | iso-Propylthio | |
75 | CN | n-Butylthio | |
76 | CN | iso-Butylthio | |
77 | CN | sec.-Butylthio | |
78 | CN | tert.-Butylthio | |
79 | CN | Benzylthio | |
80 | CN | Trifluoromethoxy | |
81 | CN | Cyano | |
82 | CN | Amino | |
83 | CN | Methylamino | |
84 | CN | Dimethylamino | |
85 | CN | Ethylamino | |
86 | CN | Diethylamino | |
87 | CN | Di-n-Propylamino | |
88 | CN | Di-iso-Propylamino | |
89 | CN | Di-n-Butylamino | |
90 | CN | Di-iso-Butylamino | |
91 | CN | Acetyl | |
92 | CN | Propion-1-yl | |
93 | CN | Butyr-1-yl | |
94 | CN | iso-Butyr-1-yl | |
95 | CN | Pivaloyl | |
96 | CN | Benzoyl | |
97 | CN | 4-Chlorobenzoyl | |
98 | CN | Benzylcarbonyl | |
99 | CN | Methoxycarbonyl | |
100 | CN | Ethoxycarbonyl | |
101 | CN | n-Propoxycarbonyl | |
102 | CN | iso-Propoxycarbonyl | |
103 | CN | n-Butoxycarbonyl | |
104 | CN | iso-Butoxycarbonyl | |
105 | CN | sec.-Butoxycarbonyl | |
106 | CN | tert.-Butoxycarbonyl | |
107 | CN | n-Hexoxycarbonyl | |
108 | CN | Phenoxycarbonyl | |
109 | CN | 4-Chlorophenoxycarbonyl | |
110 | CN | Benzyloxycarbonyl | |
111 | CN | Aminocarbonyl | |
112 | CN | Dimethylaminocarbonyl | |
113 | CN | Diethylaminocarbonyl | |
114 | CN | Di-iso-Propylaminocarbonyl | |
115 | CN | Phenylaminocarbonyl | |
116 | CN | N-Methyl-N-Phenylaminocarbonyl | |
117 | CN | Phenyl | m.p.: 99-100° C.; |
IR (KBr): 1436, 1215, 1208, 1097, 1026, 944, 766, 690 | |||
118 | CN | 2-Fluorophenyl | |
119 | CN | 3-Fluorophenyl | |
120 | CN | 4-Fluorophenyl | |
121 | CN | Pentafluorophenyl | |
122 | CN | 2-Chlorophenyl | |
123 | CN | 3-Chlorophenyl | |
124 | CN | 4-Chlorophenyl | |
125 | CN | Pentachlorophenyl | |
126 | CN | 2,3-Dichlorophenyl | |
127 | CN | 2,4-Dichlorophenyl | |
128 | CN | 2,5-Dichlorophenyl | |
129 | CN | 2,6-Dichlorophenyl | |
130 | CN | 3,4-Dichlorophenyl | |
131 | CN | 3,5-Dichlorophenyl | |
132 | CN | 2,3,4-Trichlorophenyl | |
133 | CN | 2,3,5-Trichlorophenyl | |
134 | CN | 2,3,6-Trichlorophenyl | |
135 | CN | 2,4,5-Trichlorophenyl | |
136 | CN | 2,4,6-Trichlorophenyl | |
137 | CN | 3,4,5-Trichlorophenyl | |
138 | CN | 2,3,4,6-Tetrachlorophenyl | |
139 | CN | 2,3,5,6-Tetrachlorophenyl | |
140 | CN | 2-Bromophenyl | |
141 | CN | 3-Bromophenyl | |
142 | CN | 4-Bromophenyl | |
143 | CN | 2,4-Dibromophenyl | |
144 | CN | 3-Bromo-4-fluorophenyl | |
145 | CN | 3-Bromo-4-methoxyphenyl | |
146 | CN | 2-Iodophenyl | |
147 | CN | 3-Iodophenyl | |
148 | CN | 4-Iodophenyl | |
149 | CN | 2-Chloro-4-fluorophenyl | |
150 | CN | 2-Chloro-5-fluorophenyl | |
151 | CN | 2-Chloro-6-fluorophenyl | |
152 | CN | 2-Chloro-4-bromophenyl | |
153 | CN | 2-Bromo-4-chlorophenyl | |
154 | CN | 2-Bromo-4-fluorophenyl | |
155 | CN | 3-Bromo-4-chlorophenyl | |
156 | CN | 3-Chloro-4-fluorophenyl | |
157 | CN | 3-Fluoro-4-chlorophenyl | |
158 | CN | 2-Cyanophenyl | |
159 | CN | 3-Cyanophenyl | |
160 | CN | 4-Cyanophenyl | |
161 | CN | 2-Nitrophenyl | |
162 | CN | 3-Nitrophenyl | |
163 | CN | 4-Nitrophenyl | |
164 | CN | 2-Methylphenyl | |
165 | CN | 3-Methylphenyl | |
166 | CN | 4-Methylphenyl | |
167 | CN | 2,4-Dimethylphenyl | |
168 | CN | 2,6-Dimethylphenyl | |
169 | CN | 3,4-Dimethylphenyl | |
170 | CN | 3,5-Dimethylphenyl | |
171 | CN | 2,3,4-Trimethylphenyl | |
172 | CN | 2,3,5-Trimethylphenyl | |
173 | CN | 2,3,6-Trimethylphenyl | |
174 | CN | 2,4,5-Trimethylphenyl | |
175 | CN | 2,4,6-Trimethylphenyl | |
176 | CN | 3,4,5-Trimethylphenyl | |
177 | CN | Pentamethylphenyl | |
178 | CN | 2-Ethylphenyl | |
179 | CN | 3-Ethylphenyl | |
180 | CN | 4-Ethylphenyl | |
181 | CN | 3,5-Diethylphenyl | |
182 | CN | 2-n-Propylphenyl | |
183 | CN | 3-n-Propylphenyl | |
184 | CN | 4-n-Propylphenyl | |
185 | CN | 2-iso-Propylphenyl | |
186 | CN | 3-iso-Propylphenyl | |
187 | CN | 4-iso-Propylphenyl | |
188 | CN | 2,4-Di-iso-Propylphenyl | |
189 | CN | 3,5-Di-iso-Propylphenyl | |
190 | CN | 4-n-Butylphenyl | |
191 | CN | 4-sec.-Butylphenyl | |
192 | CN | 4-iso-Butylphenyl | |
193 | CN | 4-tert.-Butylphenyl | |
194 | CN | 3-tert.-Butylphenyl | |
195 | CN | 2-tert.-Butylphenyl | |
196 | CN | 2,4-Di-tert.-Butylphenyl | |
197 | CN | 3,5-Di-tert.-Butylphenyl | |
198 | CN | 4-n-Hexylphenyl | |
199 | CN | 4-n-Dodecylphenyl | |
200 | CN | 2-Methyl-4-tert.-Butylphenyl | |
201 | CN | 2-Methyl-6-tert.-Butylphenyl | |
202 | CN | 2-Methyl-4-iso-Propylphenyl | |
203 | CN | 2-Methyl-4-Cyclohexylphenyl | |
204 | CN | 2-Methyl-4-Phenylphenyl | |
205 | CN | 2-Methyl-4-Benxylphenyl | |
206 | CN | 2-Methyl-4-Phenoxyphenyl | |
207 | CN | 2-Methyl-4-Benxyloxyphenyl | |
208 | CN | 2-Methyl-3-Chlorophenyl | |
209 | CN | 2-Methyl-4-Chlorophenyl | |
210 | CN | 2-Methyl-5-Chlorophenyl | |
211 | CN | 2-Methyl-6-Chlorophenyl | |
212 | CN | 2-Methyl-4-Fluorophenyl | |
213 | CN | 2-Methyl-3-Bromophenyl | |
214 | CN | 2-Methyl-4-Bromophenyl | |
215 | CN | 2-Methyl-3-Methoxyphenyl | |
216 | CN | 2-Methyl-4-Methoxyphenyl | |
217 | CN | 2-Methyl-5-Methoxyphenyl | |
218 | CN | 2-Methyl-6-Methoxyphenyl | |
219 | CN | 2-Methyl-4-iso-Propoxyphenyl | |
220 | CN | 2-Methyl-2-,5-Dimethoxyphenyl | |
221 | CN | 2-Methoxyphenyl | |
222 | CN | 3-Methoxyphenyl | |
223 | CN | 4-Methoxyphenyl | |
224 | CN | 2,3-Dimethoxyphenyl | |
225 | CN | 2,4-Dimethoxyphenyl | |
226 | CN | 2,5-Dimethoxyphenyl | |
227 | CN | 2,6-Dimethoxyphenyl | |
228 | CN | 3,4-Dimethoxyphenyl | |
229 | CN | 3,5-Dimethoxyphenyl | |
230 | CN | 3,6-Dimethoxyphenyl | |
231 | CN | 2,3,4-Trimethoxyphenyl | |
232 | CN | 2,3,5-Trimethoxyphenyl | |
233 | CN | 2,3,6-Trimethoxyphenyl | |
234 | CN | 2,4,5-Trimethoxyphenyl | |
235 | CN | 2,4,6-Trimethoxyphenyl | |
236 | CN | 3,4,5-Trimethoxyphenyl | |
237 | CN | 2-Ethoxyphenyl | |
238 | CN | 3-Ethoxyphenyl | |
239 | CN | 4-Ethoxyphenyl | |
240 | CN | 2-iso-Propoxyphenyl | |
241 | CN | 3-iso-Propoxyphenyl | |
242 | CN | 4-iso-Propoxyphenyl | |
243 | CN | 3-tert.-Butoxyphenyl | |
244 | CN | 4-tert.-Butoxyphenyl | |
245 | CN | 2-Trifluoromethoxyphenyl | |
246 | CN | 3-Trifluoromethoxyphenyl | |
247 | CN | 4-Trifluoromethoxyphenyl | |
248 | CN | 3-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
249 | CN | 4-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
250 | CN | 2-Chloromethylphenyl | |
251 | CN | 3-Chloromethylphenyl | |
252 | CN | 4-Chloromethylphenyl | |
253 | CN | 2-Trifluoromethylphenyl | |
254 | CN | 3-Trifluoromethylphenyl | |
255 | CN | 4-Trifluoromethylphenyl | |
256 | CN | 2-(Methoxyiminomethyl)phenyl | |
257 | CN | 3-(Methoxyiminomethyl)phenyl | |
258 | CN | 4-(Methoxyiminomethyl)phenyl | |
259 | CN | 2-(Ethoxyiminomethyl)phenyl | |
260 | CN | 3-(Ethoxyiminomethyl)phenyl | |
261 | CN | 4-(Ethoxyiminomethyl)phenyl | |
262 | CN | 2-(n-Propoxyiminomethyl)phenyl | |
263 | CN | 3-(n-Propoxyiminomethyl)phenyl | |
264 | CN | 4-(n-Propoxyiminomethyl)phenyl | |
265 | CN | 2-(iso-Propoxyiminomethyl)phenyl | |
266 | CN | 3-(iso-Propoxyiminomethyl)phenyl | |
267 | CN | 4-(iso-Propoxyiminomethyl)phenyl | |
268 | CN | 2-(n-Butoxyiminomethyl)phenyl | |
269 | CN | 3-(n-Butoxyiminomethyl)phenyl | |
270 | CN | 4-(n-Butoxyiminomethyl)phenyl | |
271 | CN | 2-(iso-Butoxyiminomethyl)phenyl | |
272 | CN | 3-(iso-Butoxyiminomethyl)phenyl | |
273 | CN | 4-(iso-Butoxyiminomethyl)phenyl | |
274 | CN | 2-(tert.-Butoxyiminomethyl)phenyl | |
275 | CN | 3-(tert.-Butoxyiminomethyl)phenyl | |
276 | CN | 4-(tert.-Butoxyiminomethyl)phenyl | |
277 | CN | 2-(n-Pentoxyiminomethyl)phenyl | |
278 | CN | 3-(n-Pentoxyiminomethyl)phenyl | |
279 | CN | 4-(n-Pentoxyiminomethyl)phenyl | |
280 | CN | 2-(n-Hexoxyiminomethyl)phenyl | |
281 | CN | 3-(n-Hexoxyiminomethyl)phenyl | |
282 | CN | 4-(n-Hexoxyiminomethyl)phenyl | |
283 | CN | 2-(Allyloxyiminomethyl)phenyl | |
284 | CN | 3-(Allyloxyiminomethyl)phenyl | |
285 | CN | 4-(Allyloxyiminomethyl)phenyl | |
286 | CN | 2-(Benzyloxyiminomethyl)phenyl | |
287 | CN | 3-(Benzyloxyiminomethyl)phenyl | |
288 | CN | 4-(Benzyloxyiminomethyl)phenyl | |
289 | CN | 2-(Methoxyimino-1′-ethyl)phenyl | |
290 | CN | 3-(Methoxyimino-1′-ethyl)phenyl | |
219 | CN | 4-(Methoxyimino-1′-ethyl)phenyl | |
292 | CN | 2-(Ethoxyimino-1′-ethyl)phenyl | |
293 | CN | 3-(Ethoxyimino-1′-ethyl)phenyl | |
294 | CN | 4-(Ethoxyimino-1′-ethyl)phenyl | |
295 | CN | 2-(n-Propoxyimino-1′-ethyl)phenyl | |
296 | CN | 3-(n-Propoxyimino-1′-ethyl)phenyl | |
297 | CN | 4-(n-Propoxyimino-1′-ethyl)phenyl | |
298 | CN | 2-(n-Butoxyamino-1′-ethyl)phenyl | |
299 | CN | 3-(n-Butoxyamino-1′-ethyl)phenyl | |
300 | CN | 4-(n-Butoxyamino-1′-ethyl)phenyl | |
301 | CN | 2-(n-Pentoxyimino-1′-ethyl)phenyl | |
302 | CN | 3-(n-Pentoxyimino-1′-ethyl)phenyl | |
303 | CN | 4-(n-Pentoxyimino-1′-ethyl)phenyl | |
304 | CN | 2-(n-Hexoxyimino-1′-ethyl)phenyl | |
305 | CN | 3-(n-Hexoxyimino-1′-ethyl)phenyl | |
306 | CN | 4-(n-Hexoxyimino-1′-ethyl)phenyl | |
307 | CN | 2-(Allyloxyimino-1′-ethyl)phenyl | |
308 | CN | 3-(Allyloxyimino-1′-ethyl)phenyl | |
309 | CN | 4-(Allyloxyimino-1′-ethyl)phenyl | |
310 | CN | 2-(Benzyloxyimino-1′-ethyl)phenyl | |
311 | CN | 3-(Benzyloxyimino-1′-ethyl)phenyl | |
312 | CN | 4-(Benzyloxyimino-1′-ethyl)phenyl | |
313 | CN | 2-Phenylphenyl | |
314 | CN | 3-Phenylphenyl | |
315 | CN | 4-Phenylphenyl | |
316 | CN | 2-Phenoxyphenyl | |
317 | CN | 3-Phenoxyphenyl | |
318 | CN | 4-Phenoxyphenyl | |
319 | CN | 2-Benzyloxyphenyl | |
320 | CN | 3-Benzyloxyphenyl | |
321 | CN | 4-Benzyloxyphenyl | |
322 | CN | 4-(Imidazol-1′-yl)phenyl | |
323 | CN | 4-(Piperazin-1′-yl)phenyl | |
324 | CN | 4-(Morpholin-1′-yl)phenyl | |
325 | CN | 4-(Piperdin-1′-yl)phenyl | |
326 | CN | 4-(Pyridyl-2′-oxy)phenyl | |
327 | CN | 2-Cyclopropylphenyl | |
328 | CN | 3-Cyclopropylphenyl | |
329 | CN | 4-Cyclopropylphenyl | |
330 | CN | 3-Cyclohexylphenyl | |
331 | CN | 4-Cyclohexylphenyl | |
332 | CN | 4-Oxiranylphenyl | |
333 | CN | 4-(1′,3′-Dioxan-2′-yl)phenyl | |
334 | CN | 4-(Tetrahydropyran-2-yloxy)phenyl | |
335 | CN | 1-Naphthyl | |
336 | CN | 2-Naphthyl | |
337 | CN | 9-Anthryl | |
338 | CN | 1-Naphthoxy | |
339 | CN | 2-Naphthoxy | |
340 | CN | 9-Anthroxy | |
341 | CN | Phenoxy | |
342 | CN | 2-Chlorophenoxy | |
343 | CN | 3-Chlorophenoxy | |
344 | CN | 4-Chlorophenoxy | |
345 | CN | 4-Methylphenoxy | |
346 | CN | 4-tert.-Butylphenoxy | |
347 | CN | 4-Methoxyphenoxy | |
348 | CN | 4-Ethoxyphenoxy | |
349 | CN | 4-tert.-Butoxyphenoxy | |
350 | CN | Phenylthio | |
351 | CN | 2-Chlorophenylthio | |
352 | CN | 4-Chlorophenylthio | |
353 | CN | Benzyl | |
354 | CN | 2-Methylbenzyl | |
355 | CN | 3-Methylbenzyl | |
356 | CN | 4-Methylbenzyl | |
357 | CN | 4-tert.-Butylbenzyl | |
358 | CN | 2-Chlorobenzyl | |
359 | CN | 3-Chlorobenzyl | |
360 | CN | 4-Chlorobenzyl | |
361 | CN | 2,4-Dichlorobenzyl | |
362 | CN | 2,6-Dichlorobenzyl | |
363 | CN | 2,4,6-Trichlorobenzyl | |
364 | CN | 2-Trifluoromethylbenzyl | |
365 | CN | 3-Trifluoromethylbenzyl | |
366 | CN | 4-Trifluoromethylbenzyl | |
367 | CN | 2-Methoxybenzyl | |
368 | CN | 4-Methoxybenzyl | |
369 | CN | 4-tert.-Butoxybenzyl | |
370 | CN | 4-Phenoxybenzyl | |
371 | CN | 1-Phenethyl | |
372 | CN | 2-Phenethyl | |
373 | CN | 1-Phenylpropyl | |
374 | CN | 2-Phenylpropyl | |
375 | CN | 3-Phenylpropyl | |
376 | CN | 2-Methyl-2-phenylpropyl | |
377 | CN | 2-Methyl-3-phenylpropyl | |
378 | CN | 4-Phenylbutyl | |
379 | CN | 2-Phenyl-1-ethenyl | |
380 | CN | 1-Phenyl-1-ethenyl | |
381 | CN | 1-Phenyl-1-propenyl | |
382 | CN | 1-Phenyl-1-propen-2-yl | |
383 | CN | 2,2-Diphenylethenyl | |
384 | CN | Phenoxymethyl | |
385 | CN | 2-Pyridyl | |
386 | CN | 3-Pyridyl | |
387 | CN | 4-Pyridyl | |
388 | CN | 2,6-Pyrimidinyl | |
389 | CN | 1,5-Pyrimidinyl | |
390 | CN | 2-Thienyl | |
391 | CN | 3-Thienyl | |
392 | CN | 2-Furyl | |
393 | CN | 3-Furyl | |
394 | CN | 1-Pyrrolyl | |
395 | CN | 1-Imidazolyl | |
396 | CN | 1,2,4-Trimzolyl | |
397 | CN | 1,3,4-Triazolyl | |
398 | CN | 4-Thiazolyl | |
399 | CN | 2-Benzothiazolyl | |
400 | CN | 2-Pyridyloxy | |
401 | CN | 2-Pyrimidimyloxy | |
402 | CN | 2-Pyridylthio | |
403 | CN | 2-Pyrimidimylthio | |
404 | CN | 2-Benzothiazolythio | |
405 | CN | Phenylthiomethyl | |
406 | CN | 2-Pyridylmethyl | |
407 | CN | 3-Pyridylmethyl | |
408 | CN | Ferfuryloxy | |
409 | CN | Thienylmethoxy | |
410 | CN | 3-Isozazolylmethoxy | |
411 | CN | 2-Oxazolylmethoxy | |
412 | CN | 2-Pyridylmethoxy | |
413 | CN | 2′-Furyl-2-ethenyl | |
414 | CN | 2′-Thienyl-2-ethenyl | |
415 | CN | 3′-Pyridyl-2-ethenyl | |
416 | CN | Oxionyl | |
417 | CN | 1-Aziridinyl | |
418 | CN | 1-Azoxidinyl | |
419 | CN | 1-Pyrrolidinyl | |
420 | CN | 2-Tetrahydrofuryl | |
421 | CN | 2-Tetrahydropyranyl | |
422 | CN | 3-Tetrahydropyranyl | |
423 | CN | 1-Piperidinyl | |
424 | CN | 1-Morphotinyl | |
425 | CN | 1-Piperazinyl | |
426 | CN | 1,3-Dioxan-2-yl | |
427 | CN | 3-Tetrahydrothiopyranyl | |
428 | CN | 2-Dihydropyranyloxy | |
429 | CN | 2-Tetrahydrophyranyloxy | oil; IR (film): 1439, 1228, 1209, 1050, 1025, 767 |
430 | CN | (CH2)4 | |
431 | CN | (CH2)5 | |
432 | CN | (CH2)6 | |
433 | CN | ||
434 | CN | ||
435 | CN |
|
|
436 | CN |
|
|
437 | CN |
|
|
438 | CN |
|
|
439 | CN |
|
|
440 | CN |
|
|
441 | CN | CF3 | |
442 | CN | 2-Fluoroethyl | |
443 | CN | 2,2,2-Trifluoroethyl | |
444 | CN | Pentafluoroethyl | |
445 | CN | Chloromethyl | |
446 | CN | Dichloromethyl | |
447 | CN | Trichloromethyl | |
448 | CN | 2-Chloroethyl | |
449 | CN | 2,2,2-Trichloroethyl | |
450 | CN | Pentachloroethyl | |
451 | CN | Cyclopropyl | |
452 | CN | Cyclobutyl | |
453 | CN | Cyclopenyl | |
454 | CN | Cyclohexyl | |
455 | CN | 1-Methylcyclopropyl | |
456 | CN | 2,2-Dimethylcyclopropyl | |
457 | CN | 1-Methylcyclohexyl | |
458 | CN | 2,2-Difluorocyclopropyl | |
459 | CN | 2,2-Dichlorocyclopropyl | |
460 | CN | 2,2-Dibromocyclopropyl | |
461 | CN | 2,2-Dichloro-3-Methylcyclopropyl | |
462 | CN | 2,2,3,3-Tetrafluorocyclobutyl | |
463 | CN | Ethenyl | |
464 | CN | 1-Propenyl | |
465 | CN | 2-Methyl-1-propenyl | |
466 | CN | 4-Methylpent-3-en-1-yl | |
467 | CN | 2-Propenyl | |
468 | CN | 2-Butenyl | |
469 | CN | 1-Methyl-2-propenyl | |
470 | CN | 3-Methyl-2-butenyl | |
471 | CN | 2,2-Difluoroethenyl | |
472 | CN | 2,2-Dichloroethenyl | |
473 | CN | 3,3,3-Trifluoropropenyl | |
474 | CN | 3,3,3-Trichloropropenyl | |
475 | CN | 3-Chloro-2-propenyl | |
476 | CN | Cyclopent-1-enyl | |
477 | CN | Cyclopentadienyl | |
478 | CN | Cyclohex-1-enyl | |
479 | CN | Pentafluorocyclopentadienyl | |
480 | CN | Pentachlorocyclopentadienyl | |
481 | CN | Styryl | |
482 | CH3 | Methoxymethyl | |
483 | CH3 | Ethoxymethyl | |
484 | CH3 | n-Propoxymethyl | |
485 | CH3 | iso-Propoxymethyl | |
486 | CH3 | tert.-Butoxymethyl | |
487 | CH3 | 2-Methoxyprop-2-yl | |
488 | CH3 | 2-Ethoxyprop-2-yl | |
489 | CH3 | 2-n-Propoxyprop-2-yl | |
490 | CH3 | 2-iso-Propoxyprop-2-yl | |
491 | CH3 | 2-tert.-Butoxyprop-2-yl | |
492 | CH3 | Methylthiomethyl | |
493 | CH3 | tert.-Butylthiomethyl | |
494 | CH3 | 2-Methylthioprop-2-yl | |
495 | CH3 | 2-iso-Propylthioprop-2-yl | |
496 | CH3 | 2-tert.-Butylthioprop-2-yl | |
497 | CH3 | Methyl | m.p. 68-71° C.; IR (KBr): 1137, 1298, 1067, 1023, 1007, 771 |
498 | CH3 | Ethyl | |
499 | CH3 | n-Propyl | |
500 | CH3 | iso-Propyl | |
501 | CH3 | n-Butyl | |
502 | CH3 | iso-Butyl | |
503 | CH3 | sec.-Butyl | |
504 | CH3 | tert.-Butyl | |
505 | CH3 | n-Hexyl | |
506 | CH3 | n-Decyl | |
507 | CH3 | Cyclopropyl | |
508 | CH3 | Cyclohexyl | |
509 | CH3 | Phenylthiomethyl | |
510 | CH3 | 2-Phenylthiomethyl | |
511 | CH3 | 2-(2′-Chlorophenylthio)prop-2-yl) | |
512 | CH3 | Ethynyl | |
513 | CH3 | 1-Propynyl | |
514 | CH3 | Methoxy | |
515 | CH3 | Ethoxy | |
516 | CH3 | n-Propoxy | |
517 | CH3 | iso-Propoxy | |
518 | CH3 | n-Butoxy | |
519 | CH3 | iso-Butoxy | |
520 | CH3 | sec.-Butoxy | |
521 | CH3 | tert.-Butoxy | |
522 | CH3 | Methylthio | |
523 | CH3 | Ethylthio | |
524 | CH3 | n-Propylthio | |
525 | CH3 | iso-Propylthio | |
526 | CH3 | n-Butylthio | |
527 | CH3 | iso-Butylthio | |
528 | CH3 | sec.-Butylthio | |
529 | CH3 | tert.-Butylthio | |
530 | CH3 | Benzylthio | |
531 | CH3 | Trifluoromethoxy | |
532 | CH3 | Cyano | |
533 | CH3 | Amino | |
534 | CH3 | Methylamino | |
535 | CH3 | Dimethylamino | |
536 | CH3 | Ethylamino | |
537 | CH3 | Diethylamino | |
538 | CH3 | Di-n-Propylamino | |
539 | CH3 | Di-iso-Propylamino | |
540 | CH3 | Di-n-Butylamino | |
541 | CH3 | Di-iso-Butylamino | |
542 | CH3 | Acetyl | |
543 | CH3 | Propion-1-yl | |
544 | CH3 | Butyr-1-yl | |
545 | CH3 | iso-Butyr-1-yl | |
546 | CH3 | Pivaloyl | |
547 | CH3 | Benzoyl | |
548 | CH3 | 4-Chlorobenzoyl | |
549 | CH3 | Benzylcarbonyl | |
550 | CH3 | Methoxycarbonyl | |
551 | CH3 | Ethoxycarbonyl | |
552 | CH3 | n-Propoxycarbonyl | |
553 | CH3 | iso-Propoxycarbonyl | |
554 | CH3 | n-Butoxycarbonyl | |
555 | CH3 | iso-Butoxycarbonyl | |
556 | CH3 | sec.-Butoxycarbonyl | |
557 | CH3 | tert.-Butoxycarbonyl | |
558 | CH3 | n-Hexoxycarbonyl | |
559 | CH3 | Phenoxycarbonyl | |
560 | CH3 | 4-Chlorophenoxycarbonyl | |
561 | CH3 | Benzyloxycarbonyl | |
562 | CH3 | Aminocarbonyl | |
563 | CH3 | Dimethylaminocarbonyl | |
564 | CH3 | Diethylaminocarbonyl | |
565 | CH3 | Di-iso-Propylaminocarbonyl | |
566 | CH3 | Phenylaminocarbonyl | |
567 | CH3 | N-Methyl-N-Phenylaminocarbonyl | |
568 | CH3 | Phenyl | |
569 | CH3 | 2-Fluorophenyl | m.p.: 89-91° C.; IR (KBr): 1732, 1071, 1012, 998, 768 |
570 | CH3 | 3-Fluorophenyl | m.p.: 83-85° C.; IR (KBr): 1724, 1204, 1067, 1031, 1015, 955 |
571 | CH3 | 4-Fluorophenyl | m.p.: 76-8° C.; |
IR (KBr): 1737, 1510, 1302, 1224, 1072, 1031, 1015, 933 | |||
572 | CH3 | Pentafluorophenyl | |
573 | CH3 | 2-Chlorophenyl | |
574 | CH3 | 3-Chlorophenyl | m.p.: 61-63° C.; IR (KBr): 1735, 1070, 1015, 1022, 785 |
575 | CH3 | 4-Chlorophenyl | oil; IR (film): 1708, 1634, 1256, 1129 |
576 | CH3 | Pentachlorophenyl | |
577 | CH3 | 2,3-Dichlorophenyl | |
578 | CH3 | 2,4-Dichlorophenyl | |
579 | CH3 | 2,5-Dichlorophenyl | |
580 | CH3 | 2,6-Dichlorophenyl | |
581 | CH3 | 3,4-Dichlorophenyl | |
582 | CH3 | 3,5-Dichlorophenyl | m.p.: 95-7° C.; |
IR (KBr): 1723, 1536, 1224, 1067, 1030, 1014, 937 | |||
583 | CH3 | 2,3,4-Trichlorophenyl | m.p.: 110-20° C.; |
584 | CH3 | 2,3,5-Trichlorophenyl | |
585 | CH3 | 2,3,6-Trichlorophenyl | |
586 | CH3 | 2,4,5-Trichlorophenyl | |
587 | CH3 | 2,4,6-Tirchlorophenyl | |
588 | CH3 | 3,4,5-Trichlorophenyl | |
589 | CH3 | 2,3,4,6-Tetrachlorophenyl | |
590 | CH3 | 2,3,5,6-Tetrachlorophenyl | |
591 | CH3 | 2-Bromophenyl | |
592 | CH3 | 3-Bromophenyl | m.p.: 80-4° C.; |
IR (KBr): 1723, 1556, 1224, 1067, 1030, 1014, 957 | |||
593 | CH3 | 4-Bromophenyl | m.p.: 73-75° C.; |
IR (KBr): 1736, 1071, 1029, 1015, 932 | |||
594 | CH3 | 2,4-Dibromophenyl | |
595 | CH3 | 3-Bromo-4-fluorophenyl | |
596 | CH3 | 3-Bromo-4-methoxyphenyl | |
597 | CH3 | 2-Iodophenyl | |
598 | CH3 | 3-Iodophenyl | |
599 | CH3 | 4-Iodophenyl | |
600 | CH3 | 2-Chloro-4-fluorophenyl | |
601 | CH3 | 2-Chloro-5-fluorophenyl | |
602 | CH3 | 2-Chloro-6-fluorophenyl | |
603 | CH3 | 2-Chloro-4-bromophenyl | |
604 | CH3 | 2-Bromo-4-chlorophenyl | |
605 | CH3 | 2-Bromo-4-fluorophenyl | |
606 | CH3 | 3-Bromo-4-chlorophenyl | |
607 | CH3 | 3-Chloro-4-fluorophenyl | |
608 | CH3 | 3-Fluoro-4-chlorophenyl | |
609 | CH3 | 2-Cyanophenyl | |
610 | CH3 | 3-Cyanophenyl | |
611 | CH3 | 4-Cyanophenyl | |
612 | CH3 | 2-Nitrophenyl | |
613 | CH3 | 3-Nitrophenyl | |
614 | CH3 | 4-Nitrophenyl | m.p.: 88-90° C.; |
IR (KBr): 1725, 1512, 1342, 1219, 1068, 1009, 854 | |||
615 | CH3 | 2-Methylphenyl | |
616 | CH3 | 3-Methylphenyl | m.p.: 93-96° C.; |
617 | CH3 | 4-Methylphenyl | m.p.: 82-84° C.; IR (KBr): 1722, 1068, 1038, 1015, 920 |
618 | CH3 | 2,4-Dimethylphenyl | |
619 | CH3 | 2,6-Dimethylphenyl | |
620 | CH3 | 3,4-Dimethylphenyl | |
621 | CH3 | 3,5-Dimethylphenyl | |
622 | CH3 | 2,3,4-Trimethylphenyl | |
623 | CH3 | 2,3,5-Trimethylphenyl | |
624 | CH3 | 2,3,6-Trimethylphenyl | |
625 | CH3 | 2,4,5-Trimethylphenyl | |
626 | CH3 | 2,4,6-Trimethylphenyl | |
627 | CH3 | 3,4,5-Trimethylphenyl | |
628 | CH3 | Pentamethylphenyl | |
629 | CH3 | 2-Ethylphenyl | |
630 | CH3 | 3-Ethylphenyl | |
631 | CH3 | 4-Ethylphenyl | |
632 | CH3 | 3,5-Diethylphenyl | |
633 | CH3 | 2-n-Propylphenyl | |
634 | CH3 | 3-n-Propylphenyl | |
635 | CH3 | 4-n-Propylphenyl | |
636 | CH3 | 2-iso-Propylphenyl | |
637 | CH3 | 3-iso-Propylphenyl | |
638 | CH3 | 4-iso-Propylphenyl | |
639 | CH3 | 2,4-Di-iso-Propylphenyl | |
640 | CH3 | 3,5-Di-iso-Propylphenyl | |
641 | CH3 | 4-n-Butylphenyl | |
642 | CH3 | 4-sec.-Butylphenyl | |
643 | CH3 | 4-iso-Butylphenyl | |
644 | CH3 | 4-tert.-Butylphenyl | m.p. 45-50° C.; |
645 | CH3 | 3-tert.-Butylphenyl | |
646 | CH3 | 2-tert.-Butylphenyl | |
647 | CH3 | 2,4-Di-tert.-Butylphenyl | |
648 | CH3 | 3,5-Di-tert.-Butylphenyl | |
649 | CH3 | 4-n-Hexylphenyl | |
650 | CH3 | 4-n-Dodecylphenyl | |
651 | CH3 | 2-Methyl-4-tert.-Butylphenyl | |
652 | CH3 | 2-Methyl-6-tert.-Butylphenyl | |
653 | CH3 | 2-Methyl-4-iso-Propylphenyl | |
654 | CH3 | 2-Methyl-4-Cyclohexylphenyl | |
655 | CH3 | 2-Methyl-4-Phenylphenyl | |
656 | CH3 | 2-Methyl-4-Benzylphenyl | |
657 | CH3 | 2-Methyl-4-Phenoxyphenyl | |
658 | CH3 | 2-Methyl-4-Benzyloxyphenyl | |
659 | CH3 | 2-Methyl-3-Chlorophenyl | |
660 | CH3 | 2-Methyl-4-Chlorophenyl | |
661 | CH3 | 2-Methyl-5-Chlorophenyl | |
662 | CH3 | 2-Methyl-6-chlorophenyl | |
663 | CH3 | 2-Methyl-4-fluorophenyl | |
664 | CH3 | 2-Methyl-3-bromophenyl | |
665 | CH3 | 2-Methyl-4-bromophenyl | |
666 | CH3 | 2-Methyl-3-methoxyphenyl | |
667 | CH3 | 2-Methyl-4-methoxyphenyl | |
668 | CH3 | 2-Methyl-5-methoxyphenyl | |
669 | CH3 | 2-Methyl-6-methoxyphenyl | |
670 | CH3 | 2-Methyl-4-iso-Propoxyphenyl | |
671 | CH3 | 2-Methyl-2,5-dimethoxyphenyl | |
672 | CH3 | 2-Methoxyphenyl | m.p.: 74-6° C.; |
IR (KBr): 1741, 1433, 1295, 1249, 1224, 1067, 1022, 878 | |||
673 | CH3 | 3-Methoxyphenyl | |
674 | CH3 | 4-Methoxyphenyl | m.p.: 89-91° C.; |
675 | CH3 | 2,3-Dimethoxyphenyl | |
676 | CH3 | 2,4-Dimethoxyphenyl | |
677 | CH3 | 2,5-Dimethoxyphenyl | |
678 | CH3 | 2,6-Dimethoxyphenyl | |
679 | CH3 | 3,4-Dimethoxyphenyl | |
680 | CH3 | 3,5-Dimethoxyphenyl | |
681 | CH3 | 3,6-Dimethoxyphenyl | |
682 | CH3 | 2,3,4-Trimethoxyphenyl | |
683 | CH3 | 2,3,5-Trimethoxyphenyl | |
684 | CH3 | 2,3,6-Trimethoxyphenyl | |
685 | CH3 | 2,4,5-Trimethoxyphenyl | |
686 | CH3 | 2,4,6-Trimethoxyphenyl | |
687 | CH3 | 3,4,5-Trimethoxyphenyl | |
688 | CH3 | 2-Ethoxyphenyl | |
689 | CH3 | 3-Ethoxyphenyl | |
690 | CH3 | 4-Ethoxyphenyl | |
691 | CH3 | 2-iso-Propoxyphenyl | |
692 | CH3 | 3-iso-propoxyphenyl | |
693 | CH3 | 4-iso-propoxyphenyl | |
694 | CH3 | 3-tert.-Butoxyphenyl | |
695 | CH3 | 4-tert.-Butoxyphenyl | |
696 | CH3 | 2-Trifluoromethoxyphenyl | |
697 | CH3 | 3-Trifluoromethoxyphenyl | |
698 | CH3 | 4-Trifluoromethoxyphenyl | |
699 | CH3 | 3-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
700 | CH3 | 4-(1′,1′,2′,2′-Tetrafluoro)ethoxyphenyl | |
701 | CH3 | 2-Chloromethylphenyl | |
702 | CH3 | 3-Chloromethylphenyl | |
703 | CH3 | 4-Chloromethylphenyl | |
704 | CH3 | 2-Trifluoromethylphenyl | m.p.: 78-80° C.; IR (KBr): 1741, 1315, 1116, 1068, 1010 |
705 | CH3 | 3-Trifluoromethylphenyl | m.p.: 70-72° C.; |
IR (KBr): 1740, 1297, 1281, 1164, 1124, 1073, 1010 | |||
706 | CH3 | 4-Trifluoromethylphenyl | m.p.: 57-58° C.; (IR (KBr): 1728, 1333, 1318, 1106, 1069, 986 |
707 | CH3 | 2-(Methoxyiminomethyl)phenyl | |
708 | CH3 | 3-(Methoxyiminomethyl)phenyl | |
709 | CH3 | 4-(Methoxyiminomethyl)phenyl | |
710 | CH3 | 2-(Ethoxyiminomethyl)phenyl | |
711 | CH3 | 3-(Ethoxyiminomethyl)phenyl | |
712 | CH3 | 4-(Ethoxyiminomethyl)phenyl | |
713 | CH3 | 2-(n-Propoxyiminomethyl)phenyl | |
714 | CH3 | 3-(n-Propoxyiminomethyl)phenyl | |
715 | CH3 | 4-(n-Propoxyiminomethyl)phenyl | |
716 | CH3 | 2-(iso-Propoxyiminomethyl)phenyl | |
717 | CH3 | 3-(iso-Propoxyiminomethyl)phenyl | |
718 | CH3 | 4-(iso-Propoxyiminomethyl)phenyl | |
719 | CH3 | 2-(n-Butoxyiminomethyl)phenyl | |
720 | CH3 | 3-(n-Butoxyiminomethyl)phenyl | |
721 | CH3 | 4-(n-Butoxyiminomethyl)phenyl | |
722 | CH3 | 2-(iso-Butoxyiminomethyl)phenyl | |
723 | CH3 | 3-(iso-Butoxyiminomethyl)phenyl | |
724 | CH3 | 4-(iso-Butoxyiminomethyl)phenyl | |
725 | CH3 | 2-(tert.-Butoxyiminomethyl)phenyl | |
726 | CH3 | 3-(tert.-Butoxyiminomethyl)phenyl | |
727 | CH3 | 4-(tert.-Butoxyiminomethyl)phenyl | |
728 | CH3 | 2-(n-Pentoxyiminomethyl)phenyl | |
729 | CH3 | 3-(n-Pentoxyiminomethyl)phenyl | |
730 | CH3 | 4-(n-Pentoxyiminomethyl)phenyl | |
731 | CH3 | 2-(n-Hexoxyiminomethyl)phenyl | |
732 | CH3 | 3-(n-Hexoxyiminomethyl)phenyl | |
733 | CH3 | 4-(n-Hexoxyiminomethyl)phenyl | |
734 | CH3 | 2-(Allyloxyiminomethyl)phenyl | |
735 | CH3 | 3-(Allyloxyiminomethyl)phenyl | |
736 | CH3 | 4-(Allyloxyiminomethyl)phenyl | |
737 | CH3 | 2-(Benzyloxyiminomethyl)phenyl | |
738 | CH3 | 3-(Benzyloxyiminomethyl)phenyl | |
739 | CH3 | 4-(Benzyloxyiminomethyl)phenyl | |
740 | CH3 | 2-(Methoxyimino-1′-ethyl)phenyl | |
741 | CH3 | 3-(Methoxyimino-1′-ethyl)phenyl | |
742 | CH3 | 4-(Methoxyimino-1′-ethyl)phenyl | |
743 | CH3 | 2-(Ethoxyimino-1′-ethyl)phenyl | |
744 | CH3 | 3-(Ethoxyimino-1′-ethyl)phenyl | |
745 | CH3 | 4-(Ethoxyimino-1′-ethyl)phenyl | |
746 | CH3 | 2-(n-Propoxyimino-1′-ethyl)phenyl | |
747 | CH3 | 3-(n-Propoxyimino-1′-ethyl)phenyl | |
748 | CH3 | 4-(n-Propoxyimino-1′-ethyl)phenyl | |
749 | CH3 | 2-(n-Butoxyamino-1′-ethyl)phenyl | |
750 | CH3 | 3-(n-Butoxyamino-1′-ethyl)phenyl | |
751 | CH3 | 4-(n-Butoxyamino-1′-ethyl)phenyl | |
752 | CH3 | 2-(n-Pentoxyimino-1′-ethyl)phenyl | |
753 | CH3 | 3-(n-Pentoxyimino-1′-ethyl)phenyl | |
754 | CH3 | 4-(n-Pentoxyimino-1′-ethly)phenyl | |
755 | CH3 | 2-(n-Hexoxyimino-1′-ethyl)phenyl | |
756 | CH3 | 3-(n-Hexoxyimino-1′-ethyl)phenyl | |
757 | CH3 | 4-(n-Hexoxyimino-1′-ethyl)phenyl | |
758 | CH3 | 2-(Allyloxyimino-1′-ethyl)phenyl | |
759 | CH3 | 3-(Allyloxyimino-1′-ethyl)phenyl | |
760 | CH3 | 4-(Allyloxyimino-1′-ethyl)phenyl | |
761 | CH3 | 2-(Benzyloxyimino-1′-ethyl)phenyl | |
762 | CH3 | 3-(Benzyloxyimino-1′-ethyl)phenyl | |
763 | CH3 | 4-(Benzyloxyimino-1′-ethyl)phenyl | |
764 | CH3 | 2-Phenylphenyl | |
765 | CH3 | 3-Phenylphenyl | |
766 | CH3 | 4-Phenylphenyl | |
767 | CH3 | 2-Phenoxyphenyl | |
768 | CH3 | 3-Phenoxyphenyl | |
769 | CH3 | 4-Phenoxyphenyl | m.p.: 91-3° C.; |
IR (KBr): 1732, 1587, 1491, 1241, 1071, 1014, 995, 769 | |||
770 | CH3 | 2-Benzyloxyphenyl | |
771 | CH3 | 3-Benzyloxyphenyl | |
772 | CH3 | 4-Benzyloxyphenyl | |
773 | CH3 | 4-(Imidazol-1′-yl)phenyl | |
774 | CH3 | 4-(Piperazin-1′-yl)phenyl | |
775 | CH3 | 4-(Morpholin-1′-yl)phenyl | |
776 | CH3 | 4-(Piperadin-1′-yl)phenyl | |
777 | CH3 | 4-(Pyridyl-2′-oxy)phenyl | |
778 | CH3 | 2-Cyclopropylphenyl | |
779 | CH3 | 3-Cyclopropylphenyl | |
780 | CH3 | 4-Cyclopropylphenyl | |
781 | CH3 | 3-Cyclohexylphenyl | |
782 | CH3 | 4-Cyclohexylphenyl | m.p.: 53-5° C.; |
783 | CH3 | 4-Oxiramylphenyl | |
784 | CH3 | 4-(1′,3′-Dioxan-2′-yl)phenyl | |
785 | CH3 | 4-(Tetrahydropyro-2-yloxy)phenyl | |
786 | CH3 | 1-Naphthyl | |
787 | CH3 | 2-Naphthyl | |
788 | CH3 | 9-Anthryl | |
789 | CH3 | 1-Naphthoxy | |
790 | CH3 | 2-Naphthoxy | |
791 | CH3 | 9-Anthroxy | |
792 | CH3 | Phenoxy | |
793 | CH3 | 2-Chlorophenoxy | |
794 | CH3 | 3-Chlorophenoxy | |
795 | CH3 | 4-Chlorophenoxy | |
796 | CH3 | 4-Methylphenoxy | |
797 | CH3 | 4-tert.-Butylphenoxy | |
798 | CH3 | 4-Methoxyphenoxy | |
799 | CH3 | 4-Ethoxyphenoxy | |
800 | CH3 | 4-tert.-Butoxyphenoxy | |
801 | CH3 | Phenylthio | |
802 | CH3 | 2-Chlorophenylthio | |
803 | CH3 | 4-Chlorophenylthio | |
804 | CH3 | Benzyl | |
805 | CH3 | 2-Methylbenzyl | |
806 | CH3 | 3-Methylbenzyl | |
807 | CH3 | 4-Methylbenzyl | |
808 | CH3 | 4-tert.-Butylbenzyl | |
809 | CH3 | 2-Chlorobenzyl | |
810 | CH3 | 3-Chlorobenzyl | |
811 | CH3 | 4-Chlorobenzyl | |
812 | CH3 | 2,4-Dichlorobenzyl | |
813 | CH3 | 2,6-Dichlorobenzyl | |
814 | CH3 | 2,4,6-Trichlorobenzyl | |
815 | CH3 | 2-Trifluoromethylbenzyl | |
816 | CH3 | 3-Trifluoromethylbenzyl | |
817 | CH3 | 4-Trifluoromethylbenzyl | |
818 | CH3 | 2-Methoxybenzyl | |
819 | CH3 | 4-Methoxybenzyl | |
820 | CH3 | 4-tert.-Butoxybenzyl | |
821 | CH3 | 4-Phenoxybenzyl | |
822 | CH3 | 1-Phenethyl | |
823 | CH3 | 2-Phenethyl | |
824 | CH3 | 1-Phenylpropyl | |
825 | CH3 | 2-Phenylpropyl | |
826 | CH3 | 3-Phenylpropyl | |
827 | CH3 | 2-Methyl-2-phenylpropyl | |
828 | CH3 | 2-Methyl-3-phenylpropyl | |
829 | CH3 | 4-Phenylbutyl | |
830 | CH3 | 2-Phenyl-1-ethenyl | |
831 | CH3 | 1-Phenyl-1-ethenyl | |
832 | CH3 | 1-Phenyl-1-propenyl | |
833 | CH3 | 1-Phenyl-1-propen-2-yl | |
834 | CH3 | 2,2-Diphenylethenyl | |
835 | CH3 | Phenoxymethyl | |
836 | CH3 | 2-Pyridyl | |
837 | CH3 | 3-Pyridyl | |
838 | CH3 | 4-Pyridyl | |
839 | CH3 | 2,6-Pyrimidinyl | |
840 | CH3 | 1,5-Pyrimidinyl | |
841 | CH3 | 2-Thienyl | |
842 | CH3 | 3-Thienyl | |
843 | CH3 | 2-Furyl | |
844 | CH3 | 3-Furyl | |
845 | CH3 | 1-Pyrrolyl | |
846 | CH3 | 1-Imidazolyl | |
847 | CH3 | 1,2,4-Triazolyl | |
848 | CH3 | 1,3,4-Triazolyl | |
849 | CH3 | 4-Thiazolyl | |
850 | CH3 | 2-Benzothiazolyl | |
851 | CH3 | 2-Pyridyloxy | |
852 | CH3 | 2-Pyrimidiayloxy | |
853 | CH3 | 2-Pyridylthio | |
854 | CH3 | 2-Pyrimidinylthio | |
855 | CH3 | 2-Benzothiazolythio | |
856 | CH3 | Phenylthiomethyl | |
857 | CH3 | 2-Pyridylmethyl | |
858 | CH3 | 3-Pyridylmethyl | |
859 | CH3 | Furfuryloxy | |
860 | CH3 | Thienylmethoxy | |
861 | CH3 | 3-Isoxazolylmethoxy | |
862 | CH3 | 2-Oxoxazolymethoxy | |
863 | CH3 | 2-Pyridylmethoxy | |
864 | CH3 | 2′-Furyl-2-ethenyl | |
865 | CH3 | 2′-Thienyl-2-ethenyl | |
866 | CH3 | 3′-Pyridyl-2-ethenyl | |
867 | CH3 | Oxinanyl | |
868 | CH3 | 1-Azinidinyl | |
869 | CH3 | 1-Azinidinyl | |
870 | CH3 | 1-Pyrrolidinyl | |
871 | CH3 | 2-Tetrahydrofuryl | |
872 | CH3 | 2-Tetrahydropyranyl | |
873 | CH3 | 3-Tetrahydropyranyl | |
874 | CH3 | 1-Piperdinyl | |
875 | CH3 | 1-Morpholinyl | |
876 | CH3 | 1-Piperezinyl | |
877 | CH3 | 1,3-Dioxan-2-yl | |
878 | CH3 | 3-Tetrahydrothiopyranyl | |
879 | CH3 | 2-Dihydropyranyloxy | |
880 | CH3 | 2-Tetrahydropyranyloxy | |
881 | CH3 | CF3 | |
882 | CH3 | 2-Fluoroethyl | |
883 | CH3 | 2,2,2-Trifluoroethyl | |
884 | CH3 | Pentafluoroethyl | |
885 | CH3 | Chloromethyl | |
886 | CH3 | Dichloromethyl | |
887 | CH3 | Trichloromethyl | |
888 | CH3 | 2-Chloroethyl | |
889 | CH3 | 2,2,2-Trichloromethyl | |
890 | CH3 | Pentachloroethyl | |
891 | CH3 | Cyclopropyl | |
892 | CH3 | Cyclobutyl | |
893 | CH3 | Cyclopentyl | |
894 | CH3 | Cyclohexyl | |
895 | CH3 | 1-Methylcyclopropyl | |
896 | CH3 | 2,2-Dimethylcyclopropyl | |
897 | CH3 | 1-Methylcyclohexyl | |
898 | CH3 | 2,2-Difluorocyclopropyl | |
899 | CH3 | 2,2-Dichlorocyclopropyl | |
900 | CH3 | 2,2-Dibromocyclopropyl | |
901 | CH3 | 2,2-Dichloro-3-Methylcyclopropyl | |
902 | CH3 | 2,2,3,3-Tetrafluorocyclobutyl | |
903 | CH3 | Ethenyl | |
904 | CH3 | 1-Propenyl | |
905 | CH3 | 2-Methyl-1-propenyl | |
906 | CH3 | 4-Methylpent-3-en-1-yl | |
907 | CH3 | 2-Propenyl | |
908 | CH3 | 2-Bucanyl | |
909 | CH3 | 1-Methyl-2-propenyl | |
910 | CH3 | 3-Methyl-2-butenyl | |
911 | CH3 | 2,2-Difluoroethenyl | |
912 | CH3 | 2,2-Dichloroethenyl | |
913 | CH3 | 3,3,3-Trifluoropropenyl | |
914 | CH3 | 3,3,3-Trichloropropenyl | |
915 | CH3 | 3-Chloro-2-propenyl | |
916 | CH3 | Cyclopent-1-enyl | |
917 | CH3 | Cyclopentadienyl | |
918 | CH3 | Cyclohex-1-enyl | |
919 | CH3 | Pentafluorocyclopentadienyl | |
920 | CH3 | Pentachlorocyclopentadienyl | |
921 | Phenyl | Phenyl | |
922 | Phenyl | 2-Fluorophenyl | |
923 | Phenyl | 4-Fluorophenyl | |
924 | Phenyl | 2-Chlorophenyl | |
925 | Phenyl | 3-Chlorophenyl | |
926 | Phenyl | 4-Chlorophenyl | |
927 | Phenyl | 3,4-Dichlorophenyl | |
928 | Phenyl | 4-Nitrophenyl | |
929 | Phenyl | 2-CF3-Phenyl | |
930 | Phenyl | 3-CF3-Phenyl | |
931 | Phenyl | 4-CF3-Phenyl | |
932 | Phenyl | 2-Methylphenyl | |
933 | Phenyl | 3-Methylphenyl | |
934 | Phenyl | 4-Methylphenyl | |
935 | Phenyl | 2,4-Dimethylphenyl | |
936 | Phenyl | 4-tert.-Butylphenyl | |
937 | Phenyl | 4-Methoxyphenyl | |
938 | 4-Fluorophenyl | 4-Fluorophenyl | |
939 | 2-Fluorophenyl | 4-Fluorophenyl | |
940 | 2-Chlorophenyl | 4-Fluorophenyl | |
941 | 2-Chlorophenyl | 2-Chlorophenyl | |
942 | 3-Chlorophenyl | 3-Chlorophenyl | |
943 | 4-Chlorophenyl | 4-Chlorophenyl | |
944 | 2-Chlorophenyl | 4-Chlorophenyl | |
945 | 4-Methoxyphenyl | 4-Methoxyphenyl | |
946 | 4-Dimethylaminophenyl | 4-Dimethylaminophenyl | |
947 | Phenyl | Naphethyl | |
948 | Ethyl | Ethyl | |
949 | Ethyl | n-Propyl | |
950 | Ethyl | iso-Propyl | |
951 | Ethyl | n-Butyl | |
952 | Ethyl | iso-Butyl | |
953 | Ethyl | 2-Methyl-butyl | |
954 | Ethyl | Benzyl | |
955 | n-Propyl | n-Propyl | |
956 | iso-Propyl | iso-Propyl | |
957 | n-Butyl | n-Butyl | |
958 | iso-Butyl | iso-Butyl | |
959 | tert.-Butyl | tert.-Butyl | |
960 | Benzyl | Benzyl | |
961 | Pentachloroethyl | Pentachloroethyl | |
962 | n-Hexyl | n-Hexyl | |
963 | Ethoxycarbonyl | Ethoxycarbonyl | |
964 | Phenyl | Benzoyl | |
965 | Ethyl | Phenyl | |
966 | N-Butyl | Phenyl | |
967 | Styryl | Styryl | |
968 | 2-Pyridyl | 2-Pyridyl | |
969 | 3-Pyridyl | 3-Pyridyl | |
970 | Ethyl | 2-Pyridyl | m.p.: 84-86° C.; |
971 |
|
m.p.: 103-105° C.; |
TABLE III |
|
No. | X | Y | R1 | R2 = H | R3 | R4 | Data |
1 | CHS—CH3 | O | CH3 | CF3 | Phenyl | ||
2 | CHS—CH3 | O | CH3 | Cyclopropyl | Phenyl | ||
3 | CHS—CH3 | O | CH3 | Cyclopropyl | 4-Chlorophenyl | ||
4 | CHS—CH3 | O | CH3 | Cyclopropyl | 4-Methoxyphenyl | ||
5 | CHS—CH3 | O | CH3 | Cyclopropyl | 4-tert.-butylphenyl | ||
6 | CHS—CH3 | O | CH3 | CN | Methylthio | ||
7 | CHS—CH3 | O | CH3 | CN | 2-Methoxyprop-2-yl | ||
8 | CHS—CH3 | O | CH3 | CN | 2-Methylthioprop-2-yl | ||
9 | CHS—CH3 | O | CH3 | CN | Phenylthio | ||
10 | CHS—CH3 | O | CH3 | CN | iso-Propyl | ||
11 | CHS—CH3 | O | CH3 | CN | CN | ||
12 | CHS—CH3 | O | CH3 | CN | Acetyl | ||
13 | CHS—CH3 | O | CH3 | CN | Benzoyl | ||
14 | CHS—CH3 | O | CH3 | CN | Methoxycarbonyl | ||
15 | CHS—CH3 | O | CH3 | CN | Phenyl | ||
16 | CHS—CH3 | O | CH3 | CN | 2-Chlorophenyl | ||
17 | CHS—CH3 | O | CH3 | CN | 4-Chlorophenyl | ||
18 | CHS—CH3 | O | CH3 | CN | 2-Methylphenyl | ||
19 | CHS—CH3 | O | CH3 | CN | 4-tert.-butylphenyl | ||
20 | CHS—CH3 | O | CH3 | CN | 4-n-Butoxyiminomethyl)phenyl | ||
21 | CHS—CH3 | O | CH3 | CN | 2-Pyridyl | ||
22 | CHS—CH3 | O | CH3 | CN | Styryl | ||
23 | CHS—CH3 | O | CH3 | CN | 1-Propenyl | ||
24 | CHS—CH3 | O | CH3 | CH3 | Phenylthio | ||
25 | CHS—CH3 | O | CH3 | CH3 | Benzyl | ||
26 | CHS—CH3 | O | CH3 | CH3 | tert.-Butyl | ||
27 | CHS—CH3 | O | CH3 | CH3 | iso-Propyl | ||
28 | CHS—CH3 | O | CH3 | CH3 | 2-Methylbutyl | ||
29 | CHS—CH3 | O | CH3 | CH3 | iso-Butyl | ||
30 | CHS—CH3 | O | CH3 | CH3 | Phenyl | ||
31 | CHS—CH3 | O | CH3 | CH3 | 2-Chlorophenyl | ||
32 | CHS—CH3 | O | CH3 | CH3 | 4-Chlorophenyl | ||
33 | CHS—CH3 | O | CH3 | CH3 | 2-Methylphenyl | ||
34 | CHS—CH3 | O | CH3 | CH3 | Naphthyl | ||
35 | CHS—CH3 | O | CH3 | CH3 | 1-Pyridyl | ||
36 | CHS—CH3 | O | CH3 | iso-Butyl | iso-Butyl | ||
37 | CHS—CH3 | O | CH3 | Phenyl | Phenyl | ||
38 | CHS—CH3 | O | CH3 | CH2CH2CH2CH2 |
39 | CHS—CH3 | O | CH3 | CH2CH2CH2CH2CH2 |
40 | CH—CH3 | O | CH3 | CF3 | Phenyl | ||
41 | CH—CH3 | O | CH3 | Cyclopropyl | Phenyl | ||
42 | CH—CH3 | O | CH3 | Cyclopropyl | 4-Chlorophenyl | ||
43 | CH—CH3 | O | CH3 | Cyclopropyl | 4-Methoxyphenyl | ||
44 | CH—CH3 | O | CH3 | Cyclopropyl | 4-tert.-butylphenyl | ||
45 | CH—CH3 | O | CH3 | CN | Methylthio | ||
46 | CH—CH3 | O | CH3 | CN | 2-Methoxyprop-2-yl | IR (film): 1717, 1436, 1367, 1256, | |
1210, 1179, 1070, 1037, 1009, 759 | |||||||
47 | CH—CH3 | O | CH3 | CN | 2-Methylthioprop-2-yl | 1H-NMR (CDCl3): δ = 1.45s, 1.6d, | |
1.8s, 3.7s, 5.1s, 7.1-7.5m | |||||||
48 | CH—CH3 | O | CH3 | CN | Phenylthio | ||
49 | CH—CH3 | O | CH3 | CN | iso-Propyl | 1H-NMR (CDCl3): δ = 1.2d, 1.6d, | |
2.7m, 3.67s, 5.1s, 7.0-7.5m | |||||||
50 | CH—CH3 | O | CH3 | CN | CN | ||
51 | CH—CH3 | O | CH3 | CN | Acetyl | ||
52 | CH—CH3 | O | CH3 | CN | Benzoyl | ||
53 | CH—CH3 | O | CH3 | CN | Methoxycarbonyl | ||
54 | CH—CH3 | O | CH3 | CN | Phenyl | 1H-NMR (CDCl3): δ = 1.6d, 3.7s, | |
5.2s, 7.0-1.8m | |||||||
55 | CH—CH3 | O | CH3 | CN | 2-Chlorophenyl | ||
56 | CH—CH3 | O | CH3 | CN | 4-Chlorophenyl | ||
57 | CH—CH3 | O | CH3 | CN | 2-Methylphenyl | ||
58 | CH—CH3 | O | CH3 | CN | 4-tert.-butylphenyl | ||
59 | CH—CH3 | O | CH3 | CN | 4-(n-Butoxyiminomethyl)phenyl | ||
60 | CH—CH3 | O | CH3 | CN | 2-Pyridyl | ||
61 | CH—CH3 | O | CH3 | CN | Styryl | ||
62 | CH—CH3 | O | CH3 | CN | 1-Propenyl | ||
63 | CH—CH3 | O | CH3 | CH3 | Phenylthio | ||
64 | CH—CH3 | O | CH3 | CH3 | Benzyl | ||
65 | CH—CH3 | O | CH3 | CH3 | tert.-Butyl | ||
66 | CH—CH3 | O | CH3 | CH3 | iso-Propyl | ||
67 | CH—CH3 | O | CH3 | CH3 | 2-Methylbutyl | ||
68 | CH—CH3 | O | CH3 | CH3 | iso-Butyl | ||
69 | CH—CH3 | O | CH3 | CH3 | Phenyl | ||
70 | CH—CH3 | O | CH3 | CH3 | 2-Chlorophenyl | ||
71 | CH—CH3 | O | CH3 | CH3 | 4-Chlorophenyl | IR (film): 1716, 1490, 1434, 1253, | |
1206, 1096, 1036, 1012, 820, 760 | |||||||
72 | CH—CH3 | O | CH3 | CH3 | 2-Methylphenyl | ||
73 | CH—CH3 | O | CH3 | CH3 | Naphthyl | ||
74 | CH—CH3 | O | CH3 | CH3 | 1-Pyridyl | ||
75 | CH—CH3 | O | CH3 | iso-Butyl | iso-Butyl | ||
76 | CH—CH3 | O | CH3 | Phenyl | Phenyl | ||
77 | CH—CH3 | O | CH3 | CH2CH2CH2CH2 |
78 | CH—CH3 | O | CH3 | CH2CH2CH2CH2CH2 |
79 | CH2 | O | CH3 | CF3 | Phenyl | ||
80 | CH2 | O | CH3 | Cyclopropyl | Phenyl | ||
81 | CH2 | O | CH3 | Cyclopropyl | 4-Chlorophenyl | ||
82 | CH2 | O | CH3 | Cyclopropyl | 4-Methoxyphenyl | ||
83 | CH2 | O | CH3 | Cyclopropyl | 4-tert.-butylphenyl | ||
84 | CH2 | O | CH3 | CN | Methylthio | ||
85 | CH2 | O | CH3 | CN | 2-Methoxyprop-2-yl | ||
86 | CH2 | O | CH3 | CN | 2-Methylthioprop-2-yl | ||
87 | CH2 | O | CH3 | CN | Phenylthio | ||
88 | CH2 | O | CH3 | CN | iso-Propyl | ||
89 | CH2 | O | CH3 | CN | CN | ||
90 | CH2 | O | CH3 | CN | Acetyl | ||
91 | CH2 | O | CH3 | CN | Benzoyl | ||
92 | CH2 | O | CH3 | CN | Methoxycarbonyl | ||
93 | CH2 | O | CH3 | CN | Phenyl | ||
94 | CH2 | O | CH3 | CN | 2-Chlorophenyl | ||
95 | CH2 | O | CH3 | CN | 4-Chlorophenyl | ||
96 | CH2 | O | CH3 | CN | 2-Methylphenyl | ||
97 | CH2 | O | CH3 | CN | 4-tert.-butylphenyl | ||
98 | CH2 | O | CH3 | CN | 4-(n-Butoxyiminomethyl)phenyl | ||
99 | CH2 | O | CH3 | CN | 2-Pyridyl | ||
100 | CH2 | O | CH3 | CN | Styryl | ||
101 | CH2 | O | CH3 | CN | 1-Propenyl | ||
102 | CH2 | O | CH3 | CH3 | Phenylthio | ||
103 | CH2 | O | CH3 | CH3 | Benzyl | ||
104 | CH2 | O | CH3 | CH3 | tert.-Butyl | ||
105 | CH2 | O | CH3 | CH3 | iso-Propyl | ||
106 | CH2 | O | CH3 | CH3 | 2-Methylbutyl | ||
107 | CH2 | O | CH3 | CH3 | iso-Butyl | ||
108 | CH2 | O | CH3 | CH3 | Phenyl | ||
109 | CH2 | O | CH3 | CH3 | 2-Chlorophenyl | ||
110 | CH2 | O | CH3 | CH3 | 4-Chlorophenyl | ||
111 | CH2 | O | CH3 | CH3 | 2-Methylphenyl | ||
112 | CH2 | O | CH3 | CH3 | Naphthyl | ||
113 | CH2 | O | CH3 | CH3 | 1-Pyridyl | ||
114 | CH2 | O | CH3 | iso-Butyl | iso-Butyl | ||
115 | CH2 | O | CH3 | Phenyl | Phenyl | ||
116 | CH2 | O | CH3 | CH2CH2CH2CH2 |
117 | CH2 | O | CH3 | CH2CH2CH2CH2CH2 |
118 | N—OCH3 | S | CH3 | CF3 | Phenyl | ||
119 | N—OCH3 | S | CH3 | Cyclopropyl | Phenyl | ||
120 | N—OCH3 | S | CH3 | Cyclopropyl | 4-Chlorophenyl | ||
121 | N—OCH3 | S | CH3 | Cyclopropyl | 4-Methoxyphenyl | ||
122 | N—OCH3 | S | CH3 | Cycloproyl | 4-tert.-butylphenyl | ||
123 | N—OCH3 | S | CH3 | CN | Methylthio | ||
124 | N—OCH3 | S | CH3 | CN | 2-Methoxyprop-2-yl | ||
125 | N—OCH3 | S | CH3 | CN | 2-Methylthioprop-2-yl | ||
126 | N—OCH3 | S | CH3 | CN | Phenylthio | ||
127 | N—OCH3 | S | CH3 | CN | iso-Propyl | ||
128 | N—OCH3 | S | CH3 | CN | CN | ||
129 | N—OCH3 | S | CH3 | CN | Acetyl | ||
130 | N—OCH3 | S | CH3 | CN | Benzoyl | ||
131 | N—OCH3 | S | CH3 | CN | Methoxycarbonyl | ||
132 | N—OCH3 | S | CH3 | CN | Phenyl | ||
133 | N—OCH3 | S | CH3 | CN | 2-Chlorophenyl | ||
134 | N—OCH3 | S | CH3 | CN | 4-Chlorophenyl | ||
135 | N—OCH3 | S | CH3 | CN | 2-Methylphenyl | ||
136 | N—OCH3 | S | CH3 | CN | 4-tert.-butylphenyl | ||
137 | N—OCH3 | S | CH3 | CN | 4-(n-Butoxyiminomethyl)phenyl | ||
138 | N—OCH3 | S | CH3 | CN | 2-Pyridyl | ||
139 | N—OCH3 | S | CH3 | CN | Styryl | ||
140 | N—OCH3 | S | CH3 | CN | 1-Propenyl | ||
141 | N—OCH3 | S | CH3 | CH3 | Phenylthio | ||
142 | N—OCH3 | S | CH3 | CH3 | Benzyl | ||
143 | N—OCH3 | S | CH3 | CH3 | tert.-Butyl | ||
144 | N—OCH3 | S | CH3 | CH3 | iso-Propyl | ||
145 | N—OCH3 | S | CH3 | CH3 | 2-Methylbutyl | ||
146 | N—OCH3 | S | CH3 | CH3 | iso-Butyl | ||
147 | N—OCH3 | S | CH3 | CH3 | Phenyl | ||
148 | N—OCH3 | S | CH3 | CH3 | 2-Chlorophenyl | ||
149 | N—OCH3 | S | CH3 | CH3 | 4-Chlorophenyl | ||
150 | N—OCH3 | S | CH3 | CH3 | 2-Methylphenyl | ||
151 | N—OCH3 | S | CH3 | CH3 | Naphthyl | ||
152 | N—OCH3 | S | CH3 | CH3 | 1-Pyridyl | ||
153 | N—OCH3 | S | CH3 | iso-butyl | iso-Butyl | ||
154 | N—OCH3 | S | CH3 | Phenyl | Phenyl | ||
155 | N—OCH3 | S | CH3 | CH2CH2CH2CH2 |
156 | N—OCH3 | S | CH3 | CH2CH2CH2CH2CH2 |
157 | N—OCH3 | NH | CH3 | CF3 | Phenyl | ||
158 | N—OCH3 | NH | CH3 | Cyclopropyl | Phenyl | ||
159 | N—OCH3 | NH | CH3 | Cyclopropyl | 4-Chlorophenyl | m.p.: 71-74° C. | |
IR (KBr): 3348, 1663, 1529, 1042, | |||||||
1030, 982 | |||||||
160 | N—OCH3 | NH | CH3 | Cyclopropyl | 4-Methoxyphenyl | ||
161 | N—OCH3 | NH | CH3 | Cyclopropyl | 4-tert.-butylphenyl | ||
162 | N—OCH3 | NH | CH3 | CN | Methylthio | ||
163 | N—OCH3 | NH | CH3 | CN | 2-Methoxyprop-2-yl | ||
164 | N—OCH3 | NH | CH3 | CN | 2-Methylthioprop-2-yl | ||
165 | N—OCH3 | NH | CH3 | CN | Phenylthio | ||
166 | N—OCH3 | NH | CH3 | CN | iso-Propyl | ||
167 | N—OCH3 | NH | CH3 | CN | CN | ||
168 | N—OCH3 | NH | CH3 | CN | Acetyl | ||
169 | N—OCH3 | NH | CH3 | CN | Benzoyl | ||
170 | N—OCH3 | NH | CH3 | CN | Methoxycarbonyl | ||
171 | N—OCH3 | NH | CH3 | CN | Phenyl | ||
172 | N—OCH3 | NH | CH3 | CN | 2-Chlorophenyl | ||
173 | N—OCH3 | NH | CH3 | CN | 4-Chlorophenyl | ||
174 | N—OCH3 | NH | CH3 | CN | 2-Methylphenyl | ||
175 | N—OCH3 | NH | CH3 | CN | 4-tert.-butylphenyl | ||
176 | N—OCH3 | NH | CH3 | CN | 4-(n-Butoxyiminomethyl)phenyl | ||
177 | N—OCH3 | NH | CH3 | CN | 2-Pyridyl | ||
178 | N—OCH3 | NH | CH3 | CN | Styryl | ||
179 | N—OCH3 | NH | CH3 | CN | 1-Propenyl | ||
180 | N—OCH3 | NH | CH3 | CH3 | Phenylthio | ||
181 | N—OCH3 | NH | CH3 | CH3 | Benzyl | ||
182 | N—OCH3 | NH | CH3 | CH3 | tert.-Butyl | ||
183 | N—OCH3 | NH | CH3 | CH3 | iso-Propyl | ||
184 | N—OCH3 | NH | CH3 | CH3 | 2-Methylbutyl | ||
185 | N—OCH3 | NH | CH3 | CH3 | iso-Butyl | ||
186 | N—OCH3 | NH | CH3 | CH3 | Phenyl | ||
187 | N—OCH3 | NH | CH3 | CH3 | 2-Chlorophenyl | ||
188 | N—OCH3 | NH | CH3 | CH3 | 4-Chlorophenyl | m.p.: 119-121° C. | |
IR (KBr): 3421, 1676, 1037, 985, | |||||||
933, 752 | |||||||
189 | N—OCH3 | NH | CH3 | CH3 | 2-Methylphenyl | ||
No. | X | Y | R1 | R2 | R3 | R4 | Data |
190 | N—OCH3 | NH | CH3 | H | CH3 | Naphthyl | |
191 | N—OCH3 | NH | CH3 | H | CH3 | 1-Pyridyl | |
192 | N—OCH3 | NH | CH3 | H | iso-Butyl | iso-Butyl | |
193 | N—OCH3 | NH | CH3 | H | Phenyl | Phenyl | |
194 | N—OCH3 | NH | CH3 | H | CH2CH2CH2CH2 |
195 | N—OCH3 | NH | CH3 | H | CH2CH2CH2CH2CH2 |
196 | N—OCH3 | O | C2H5 | H | CH3 | Phenyl | |
197 | CH—OCH3 | O | C2H5 | H | CH3 | Phenyl | |
198 | N—OCH3 | O | n-C3H5 | H | CH3 | Phenyl | |
199 | CHOCH3 | O | n-C3H5 | H | CH3 | Phenyl | |
200 | CHC2H5 | O | CH3 | H | CH3 | Phenyl | |
201 | N—OCH3 | O | CH3 | CH3 | CH3 | Phenyl | |
202 | CHOCH3 | O | CH3 | CH3 | CH3 | Phenyl | |
203 | N—OCH3 | O | CH3 | CH3 | CN | Phenyl | |
204 | CHOCH3 | O | CH3 | CH3 | CN | Phenyl | |
205 | CHS—CH3 | O | CH3 | H | H | Phenyl | |
206 | CH—CH3 | O | CH3 | H | H | Phenyl | |
207 | CH2 | O | CH3 | H | H | Phenyl | |
208 | NOCH3 | S | CH3 | H | H | Phenyl | |
209 | CHOCH3 | S | CH3 | H | H | Phenyl | |
210 | CHOCH3 | NH | CH3 | H | H | Phenyl | |
211 | NOCH3 | NH | CH3 | H | H | Phenyl | |
212 | CH—OCH3 | S | CH3 | H | CN | Methylthio | |
No. | X | Y | R1 | R2 = H | R3 | R4 | Data |
213 | CH—OCH3 | S | CH3 | CN | 2-Methoxyprop-2-yl | ||
214 | CH—OCH3 | S | CH3 | CN | 2-Methylthioprop-2-yl | ||
215 | CH—OCH3 | S | CH3 | CN | Phenylthio | ||
216 | CH—OCH3 | S | CH3 | CN | iso-Propyl | ||
217 | CH—OCH3 | S | CH3 | CN | CN | ||
218 | CH—OCH3 | S | CH3 | CN | Acetyl | ||
219 | CH—OCH3 | S | CH3 | CN | Benzoyl | ||
220 | CH—OCH3 | S | CH3 | CN | Methoxycarbonyl | ||
221 | CH—OCH3 | S | CH3 | CN | Phenyl | ||
222 | CH—OCH3 | S | CH3 | CN | 2-Chlorophenyl | ||
223 | CH—OCH3 | S | CH3 | CN | 4-Chlorophenyl | ||
224 | CH—OCH3 | S | CH3 | CN | 2-Methylphenyl | ||
225 | CH—OCH3 | S | CH3 | CN | 4-tert.-butylphenyl | ||
226 | CH—OCH3 | S | CH3 | CN | 4-(n-Butoxyiminomethyl)phenyl | ||
227 | CH—OCH3 | S | CH3 | CN | 2-Pyridyl | ||
228 | CH—OCH3 | S | CH3 | CN | Styryl | ||
229 | CH—OCH3 | S | CH3 | CN | 1-Propenyl | ||
230 | CH—OCH3 | S | CH3 | CN | Methylthio | ||
231 | CH—OCH3 | NH | CH3 | CN | 2-Methoxyprop-2-yl | ||
232 | CH—OCH3 | NH | CH3 | CN | 2-Methylthioprop-2-yl | ||
233 | CH—OCH3 | NH | CH3 | CN | Phenylthio | ||
234 | CH—OCH3 | NH | CH3 | CN | iso-Propyl | ||
235 | CH—OCH3 | NH | CH3 | CN | CN | ||
236 | CH—OCH3 | NH | CH3 | CN | Acetyl | ||
237 | CH—OCH3 | NH | CH3 | CN | Benzoyl | ||
238 | CH—OCH3 | NH | CH3 | CN | Methoxycarbonyl | ||
239 | CH—OCH3 | NH | CH3 | CN | Phenyl | ||
240 | CH—OCH3 | NH | CH3 | CN | 2-Chlorophenyl | ||
241 | CH—OCH3 | NH | CH3 | CN | 4-Chlorophenyl | ||
242 | CH—OCH3 | NH | CH3 | CN | 2-Methylphenyl | ||
243 | CH—OCH3 | NH | CH3 | CN | 4-tert.-butylphenyl | ||
244 | CH—OCH3 | NH | CH3 | CN | 4-(n-Butoxyiminomethyl)phenyl | ||
245 | CH—OCH3 | NH | CH3 | CN | 2-Pyridyl | ||
246 | CH—OCH3 | NH | CH3 | CN | Styryl | ||
247 | CH—OCH3 | NH | CH3 | CN | 1-Propenyl | ||
248 | N—OCH3 | NH | CH3 | CH3 | 3-Chlorophenyl | m.p.: 71-74° C. | |
249 | N—OCH3 | NH | CH3 | CH3 | 3,5-Dichlorophenyl | m.p.: 94-97° C. | |
250 | N—OCH3 | NH | CH3 | CH3 | 2,3,4-Trichlorophenyl | m.p.: 110-112° C. | |
251 | N—OCH3 | NH | CH3 | CH3 | 3-Bromophenyl | m.p.: 74-77° C. | |
252 | N—OCH3 | NH | CH3 | CH3 | 4-Methylphenyl | m.p.: 69-72° C. | |
253 | N—OCH3 | NH | CH3 | CH3 | 4-Nitrophenyl | m.p.: 134-137° C. | |
254 | CH—CH3 | O | CH3 | CN | 2-Ethoxy-prop-2-yl | IR (film): 2982, 1717, 1436, 1255, 1210, | |
1192, 1067, 1037, 1010 | |||||||
255 | CH—CH3 | O | CH3 | CN | 2-i-Propoxy-prop-2-yl | IR (film): 2983, 1718, 1383, 1370, 1255, | |
1173, 1119, 1109, 1037, 1002 | |||||||
256 | CH—CH3 | O | CH3 | CN | 2-n-Butyoxy-prop-2-yl | IR (film): 2957, 1718, 1435, 1255, 1176, | |
1036, 1010, 759 | |||||||
257 | CH—CH3 | O | CH3 | CN | 2-i-Butyoxy-prop-2-yl | IR (film): 2956, 1717, 1435, 1366, 1255, | |
1209, 1176, 1064, 1037, 1008 | |||||||
258 | CH—CH3 | O | CH3 | CN | Cyclopropyl | 1H-NMR (CDCl3): δ = 0.9m, 1.6d, | |
2.3m, 3.67s, 5.15s, 7.05-7.4m | |||||||
259 | CH—CH3 | O | CH3 | CN | 2-Ethylthio-prop-2-yl | 1H-NMR (CDCl3): δ = 1.1t, 1,5s, | |
1.6d, 2.2q, 3.7s, 5.1s, 7.1-7.5m | |||||||
260 | CH—CH3 | O | CH3 | CN | 2-i-Propylthio-pro-2-yl | 1H-NMR (CDCl3): δ = 1.15s, 1.5s, | |
1.6d, 2.6m, 3.7s, 5.1s, 7.1-7.5m | |||||||
261 | CH—CH3 | O | CH3 | CN | 2-Tetrahydropyranyl | 1H-NMR (CDCl3): δ = 1.4-1.9m, | |
1.6d, 3.5m, 3.7s, 4.1m, 5.1s, | |||||||
7.0-7.5m | |||||||
TABLE IV |
|
No. | X | Y | R1 | R3 | R4 | Data |
1 | CH—OCH3 | O | CH3 | CH3 | Phenyl | |
2 | CH—OCH3 | O | CH3 | CH3 | 3-Bromophenyl | |
3 | CH—OCH3 | O | CH3 | CH3 | 4-Phenoxyphenyl | |
4 | CH—OCH3 | O | CH3 | CH3 | 4-Cyclohexylphenyl | |
5 | NOCH3 | O | CH3 | CH3 | Phenyl | |
6 | NOCH3 | O | CH3 | CH3 | 3-Bromophenyl | oil: IR (film): 1727, 1436, 1312, 1240, 1032 |
7 | NOCH3 | O | CH3 | CH3 | 4-Phenoxyphenyl | oil: IR (film): 1727, 1489, 1239, 1031, 683 |
8 | NOCH3 | O | CH3 | CH3 | 4-Cyclohexylphenyl | oil: IR (film): 2925, 1728, 1447, 1239, 1164, 1077, 1032 |
9 | CHOCH3 | O | CH3 | CN | iso-Propyl | 2970, 2220, 1710, 1127 |
10 | CHOCH3 | O | CH3 | CN | 2-Methoxyprop-2-yl | oil: IR (film): 2980, 2220, 1710, 1127 |
11 | CHOCH3 | O | CH3 | CN | 2-Methylthioprop-2-yl | oil: IR (film): 2980, 2220, 1709, 1127 |
12 | CHOCH3 | O | CH3 | CN | 2-Tetrahydrofuranyl | oil: IR (film): 2945, 2850, 2220, 1709, 1127 |
13 | CHOCH3 | O | CH3 | CN | Phenyl | oil: IR (film): 2940, 2220, 1709, 1127, 1030 |
TABLE V |
|
No. | R3 | R4 | Data |
1 | H | H | |
2 | H | Methoxymethyl | |
3 | H | Ethoxymethyl | |
4 | H | n-Propoxymethyl | |
5 | H | iso-Propoxymethyl | |
6 | H | tert.-Butoxymethyl | |
7 | H | 2-Methoxyprop-2-yl | |
8 | H | 2-Ethoxyprop-2-yl | |
9 | H | 2-n-Propoxyprop-2-yl | |
10 | H | 2-iso-Propoxyprop-2-yl | |
11 | H | 2-tert.-Butoxyprop-2-yl | |
12 | H | Methylthiomethyl | |
13 | H | tert.-Butylthioprop-2-yl | |
14 | H | 2-Methylthioprop-2-yl | |
15 | H | 2-iso-Propylthioprop-2-yl | |
16 | H | 2-tert.-Butylthioprop-2-yl | |
17 | H | Methyl | |
18 | H | Ethyl | |
19 | H | n-Propyl | |
20 | H | iso-Propyl | |
21 | H | n-Butyl | |
22 | H | iso-Butyl | |
23 | H | sec.-Butyl | |
24 | H | tert.-Butyl | |
25 | H | n-Hexyl | |
26 | H | n-Decyl | |
27 | H | Cyclopropyl | |
28 | H | Cyclohexyl | |
29 | H | Phenylthiomethyl | |
30 | H | 2-Phenylthiomethyl | |
31 | H | 2-(2′-Chlorophenylthio)prop-2-yl | |
32 | H | Ethynyl | |
33 | H | 1-Propynyl | |
34 | H | Methoxy | |
35 | H | Ethoxy | |
36 | H | n-Propoxy | |
37 | H | iso-Propoxy | |
38 | H | n-Butoxy | |
39 | H | iso-Butoxy | |
40 | H | sec.-Butoxy | |
41 | H | tert.-Butoxy | |
42 | H | Methylthio | |
43 | H | Ethylthio | |
44 | H | n-Propylthio | |
45 | H | iso-Propylthio | |
46 | H | n-Butylthio | |
47 | H | iso-Butyl | |
48 | H | sec.-Butyl | |
49 | H | tert.-Butyl | |
50 | H | Benzylthio | |
51 | H | Trifluoromethoxy | |
52 | H | Cyano | |
53 | H | Amin | |
54 | H | Methylamino | |
55 | H | Dimethylamino | |
56 | H | Ethylamino | |
57 | H | Diethylamino | |
58 | H | Di-n-Propylamino | |
59 | H | Di-iso-Propylamino | |
60 | H | Di-n-Butylamino | |
61 | H | Di-iso-Butylamino | |
62 | H | Acetyl | |
63 | H | Propion-1-yl | |
64 | H | Butyr-1-yl | |
65 | H | iso-Butyr-1-yl | |
66 | H | Pivaloyl | |
67 | H | Benzoyl | |
68 | H | 4-Chlorobenzoyl | |
69 | H | Benzylcarbonyl | |
70 | H | Methoxycarbonyl | |
71 | H | Ethoxycarbonyl | |
72 | H | n-Propoxycarbonyl | |
73 | H | iso-Propoxycarbonyl | |
74 | H | n-Butoxycarbonyl | |
75 | H | iso-Butoxycarbonyl | |
76 | H | sec.-Butoxycarbonyl | |
77 | H | tert.-Butoxycarbonyl | |
78 | H | n-Hexoxycarbonyl | |
79 | H | Phenoxycarbonyl | |
80 | H | 4-Chlorophenoxycarbonyl | |
81 | H | Benzyloxycarbonyl | |
82 | H | Aminocarbonyl | |
83 | H | Dimethylaminocarbonyl | |
84 | H | Diethylaminocarbonyl | |
85 | H | Di-iso-Propylaminocarbonyl | |
86 | H | Phenylaminocarbonyl | |
87 | H | N-Methyl-N-Phenylamino- | |
carbonyl | |||
88 | H | Phenyl | |
89 | H | 2-Fluorophenyl | m.p.: 69-71° C. |
90 | H | 3-Fluorophenyl | m.p.: 74-77° C. |
91 | H | 4-Fluorophenyl | m.p.: 73-76° C. |
IR (KBr): 1699, | |||
1278, 1271, 1256, | |||
1225 | |||
92 | H | Pentafluorophenyl | m.p.: 94-96° C.; |
IR (KBr): 1704, | |||
1527, 1494, 1133 | |||
93 | H | 2-Chlorophenyl | 1H-NMR (CDCl3): |
δ = 3.70s, | |||
3.82s, 5.15s, 7.15- | |||
7.40m, 7.52m, | |||
7.60s, 7.85m, 8.52s | |||
94 | H | 3-Chlorophenyl | m.p.: 48-50° C.; |
95 | H | 4-Chlorophenyl | (v. Example 6) |
96 | H | Pentachlorophenyl | |
97 | H | 2,3-Dichlorophenyl | m.p.: 103-105° C.; |
98 | H | 2,4-Dichlorophenyl | m.p.: 94-96° C.; |
99 | H | 2,5-Dichlorophenyl | |
100 | H | 2,6-Dichlorophenyl | m.p.: 118-120° C.; |
101 | H | 3,4-Dichlorophenyl | m.p.: 82-84° C.; |
102 | H | 3,5-Dichlorophenyl | m.p.: 94-96° C.; |
103 | H | 2,3,4-Trichlorophenyl | |
104 | H | 2,3,5-Trichlorophenyl | |
105 | H | 2,3,6-Trichlorophenyl | |
106 | H | 2,4,5-Trichlorophenyl | |
107 | H | 2,3,6-Trichlorophenyl | |
108 | H | 3,4,5-Trichlorophenyl | |
109 | H | 2,3,4,6-Tetrachlorophenyl | |
110 | H | 2,3,5,6-Tetrachlorophenyl | |
111 | H | 2-Bromophenyl | m.p.: 85-87° C.; |
112 | H | 3-Bromophenyl | 1H-NMR (CDCl3): |
δ = 3.68s, 3.79s, | |||
5.13, 7.15-7.54 m, | |||
7.59s 7.74s, 8.00s | |||
113 | H | 4-Bromophenyl | m.p.: 131-134° C.; |
114 | H | 2,4-Dibromophenyl | |
115 | H | 3-Brom-4-fluorophenyl | |
116 | H | 3-Brom-4-methoxyphenyl | |
117 | H | 2-Iodophenyl | |
118 | H | 3-Iodophenyl | |
119 | H | 4-Iodophenyl | |
120 | H | 2-Chloro-4-fluorophenyl | m.p.: 112-115° C.; |
121 | H | 2-Chloro-5-fluorophenyl | |
122 | H | 2-Chloro-6-fluorophenyl | m.p.: 80-82° C.; |
123 | H | 2-Chloro-4-bromophenyl | |
124 | H | 2-Bromo-4-chlorophenyl | |
125 | H | 2-Bromo-4-bromophenyl | |
126 | H | 3-Bromo-4-chlorophenyl | |
127 | H | 3-Chloro-4-fluorophenyl | |
128 | H | 3-Fluoro-4-chlorophenyl | |
129 | H | 2-Cyanophenyl | |
130 | H | 3-Cyanophenyl | |
131 | H | 4-Cyanophenyl | |
132 | H | 2-Nitrophenyl | |
133 | H | 3-Nitrophenyl | |
134 | H | 4-Nitrophenyl | m.p.: 147-155° C.; |
135 | H | 2-Methylphenyl | m.p.: 57-59° C.; |
136 | H | 3-Methylphenyl | m.p.: 54-56° C.; |
137 | H | 4-Methylphenyl | m.p.: 86-88° C.; |
138 | H | 2,4-Dimethylphenyl | m.p.: 75-77° C.; |
139 | H | 2,6-Dimethylphenyl | |
140 | H | 3,4-Dimethylphenyl | |
141 | H | 3,5-Dimethylphenyl | |
142 | H | 2,3,4-Trimethylphenyl | |
143 | H | 2,3,5-Trimethylphenyl | |
144 | H | 2,3,6-Trimethylphenyl | |
145 | H | 2,4,5-Trimethylphenyl | |
146 | H | 2,4,6-Trimethylphenyl | |
147 | H | 3,4,5-Trimethylphenyl | |
148 | H | Pentamethylphenyl | |
149 | H | 2-Ethylphenyl | |
150 | H | 3-Ethylphenyl | |
151 | H | 4-Ethylphenyl | |
152 | H | 3,5-Diethylphenyl | |
153 | H | 2-n-Propylphenyl | |
154 | H | 3-n-Propylphenyl | |
155 | H | 4-n-Propylphenyl | |
156 | H | 2-iso-Propylphenyl | |
157 | H | 3-iso-Propylphenyl | |
158 | H | 4-iso-Propylphenyl | |
159 | H | 2,4-Di-iso-Propylphenyl | |
160 | H | 3,5-Di-iso-Propylphenyl | |
161 | H | 4-n-Butylphenyl | |
162 | H | 4-sec.-Butylphenyl | |
163 | H | 4-iso-Butylphenyl | |
164 | H | 4-tert.-Butylphenyl | m.p.: 71-73° C. |
165 | H | 3-tert.-Butylphenyl | |
166 | H | 2-tert.-Butylphenyl | |
167 | H | 2,4-Di-tert.-Butylphenyl | |
168 | H | 3,5-Di-tert.-Butylphenyl | |
169 | H | 4-n-Hexylphenyl | |
170 | H | 4-n-Dodecylphenyl | |
171 | H | 2-Methyl-4-tert.-Butylphenyl | |
172 | H | 2-Methyl-6-tert.-Butylphenyl | |
173 | H | 2-Methyl-4-iso-Butylphenyl | |
174 | H | 2-Methyl-4-cyclohexylphenyl | |
175 | H | 2-Methyl-4-phenylphenyl | |
176 | H | 2-Methyl-4-benzylphenyl | |
177 | H | 2-Methyl-4-phenoxyphenyl | |
178 | H | 2-Methyl-4-benzyloxyphenyl | |
179 | H | 2-Methyl-3-chlorophenyl | |
180 | H | 2-Methyl-4-chlorophenyl | |
181 | H | 2-Methyl-5-chlorophenyl | |
182 | H | 2-Methyl-6-chlorophenyl | |
183 | H | 2-Methyl-4-fluorophenyl | |
184 | H | 2-Methyl-3-bromophenyl | |
185 | H | 2-Methyl-4-bromophenyl | |
186 | H | 2-Methyl-3-methoxyphenyl | |
187 | H | 2-Methyl-4-methoxyphenyl | |
188 | H | 2-Methyl-5-methoxyphenyl | |
189 | H | 2-Methyl-6-methoxyphenyl | |
190 | H | 2-Methyl-4-iso-Propoxyphenyl | |
191 | H | 2-Methyl-2,5-dimethoxyphenyl | |
192 | H | 2-Methoxyphenyl | m.p.: 52-54° C. |
193 | H | 3-Methoxyphenyl | 1H-NMR (CDCl3): |
δ = 3.65s, | |||
3.76s, 3.80s, 5.12s, | |||
6.88-7.54m, 7.58s | |||
8.05s | |||
194 | H | 4-Methoxyphenyl | m.p.: 61-63° C. |
195 | H | 2,3-Dimethoxyphenyl | |
196 | H | 2,4-Dimethoxyphenyl | m.p.: 70-72° C. |
197 | H | 2,5-Dimethoxyphenyl | |
198 | H | 2,6-Dimethoxyphenyl | |
199 | H | 3,4-Dimethoxyphenyl | |
200 | H | 3,5-Dimethoxyphenyl | m.p.: 79-82° C. |
201 | H | 3,6-Dimethoxyphenyl | |
202 | H | 2,3,4-Trimethoxyphenyl | |
203 | H | 2,3,5-Trimethoxyphenyl | |
204 | H | 2,3,6-Trimethoxyphenyl | |
205 | H | 2,4,5-Trimethoxyphenyl | |
206 | H | 2,3,6-Trimethoxyphenyl | |
207 | H | 3,4,5-Trimethoxyphenyl | |
208 | H | 2-Ethoxyphenyl | |
209 | H | 3-Ethoxyphenyl | 1H-NMR (CDCl3): |
δ = 1.39t, | |||
3.67s, 3.80s, 4.02q, | |||
5.12s, 6.87- | |||
7.54m, 7.58s, 8.05s | |||
210 | H | 4-Ethoxyphenyl | m.p.: 93-94° C. |
211 | H | 2-iso-Propoxyphenyl | |
212 | H | 3-iso-Propoxyphenyl | |
213 | H | 4-iso-Propoxyphenyl | |
214 | H | 3-tert.-Butoxyphenyl | |
215 | H | 4-tert.-Butoxyphenyl | 1H-NMR (CDCl3): |
δ = 1.36s, | |||
3.68s, 3.78s, 5.09s, | |||
6.94-7.53m, | |||
7.58s, 8.07s | |||
216 | H | 2-Trifluoromethoxyphenyl | |
217 | H | 3-Trifluoromethoxyphenyl | |
218 | H | 4-Trifluoromethoxyphenyl | |
219 | H | 3-(1′,1′,2′,2′- | |
Tetrafluoro)ethoxyphenyl | |||
220 | H | 4-(1′,1′,2′,2′- | |
Tetrafluoro)ethoxyphenyl | |||
221 | H | 2-Chloromethylphenyl | |
222 | H | 3-Chloromethylphenyl | |
223 | H | 4-Chloromethylphenyl | |
224 | H | 2-Trifluoromethylphenyl | m.p.: 75-77° C. |
225 | H | 3-Trifluoromethylphenyl | |
226 | H | 4-Trifluoromethylphenyl | m.p.: 111-114° C. |
227 | H | 2-(Methoxyiminomethyl)phenyl | |
228 | H | 3-(Methoxyiminomethyl)phenyl | |
229 | H | 4-(Methoxyiminomethyl)phenyl | |
230 | H | 2-(Ethoxyiminomethyl)phenyl | |
231 | H | 3-(Ethoxyiminomethyl)phenyl | |
232 | H | 4-(Ethoxyiminomethyl)phenyl | |
233 | H | 2-(n-Propoxyiminomethyl)phenyl | |
234 | H | 3-(n-Propoxyiminomethyl)phenyl | |
235 | H | 4-(n-Propoxyiminomethyl)phenyl | |
236 | H | 2-(iso-Propoxyiminomethyl)- | |
phenyl | |||
237 | H | 3-(iso-Propoxyiminomethyl)- | |
phenyl | |||
238 | H | 4-(iso-Propoxyiminomethyl)- | |
phenyl | |||
239 | H | 2-(n-Butoxyiminomethyl)phenyl | |
240 | H | 3-(n-Butoxyiminomethyl)phenyl | |
241 | H | 4-(n-Butoxyiminomethyl)phenyl | |
242 | H | 2-(iso-Butoxyiminomethyl)phenyl | |
243 | H | 3-(iso-Butoxyiminomethyl)phenyl | |
244 | H | 4-(iso-Butoxyiminomethyl)phenyl | |
245 | H | 2-(tert.-Butoxyiminomethyl)- | |
phenyl | |||
246 | H | 3-(tert.-Butoxyiminomethyl)- | |
phenyl | |||
247 | H | 4-(tert.-Butoxyiminomethyl)- | |
phenyl | |||
248 | H | 2-(n-Pentoxyiminomethyl)phenyl | |
249 | H | 3-(n-Pentoxyiminomethyl)phenyl | |
250 | H | 4-(n-Pentoxyiminomethyl)phenyl | |
251 | H | 2-(n-Hexoxyiminomethyl)phenyl | |
252 | H | 3-(n-Hexoxyiminomethyl)phenyl | |
253 | H | 4-(n-Hexoxyiminomethyl)phenyl | |
254 | H | 2-(Allyloxyiminomethyl)phenyl | |
255 | H | 3-(Allyloxyiminomethyl)phenyl | |
256 | H | 4-(Allyloxyiminomethyl)phenyl | |
257 | H | 2-(Benzyloxyiminomethyl)phenyl | |
258 | H | 3-(Benzyloxyiminomethyl)phenyl | |
259 | H | 4-(Benzyloxyiminomethyl)phenyl | |
260 | H | 2-(Methoxyimino-1′-ethyl)phenyl | |
261 | H | 3-(Methoxyimino-1′-ethyl)phenyl | |
262 | H | 4-(Methoxyimino-1′-ethyl)phenyl | |
263 | H | 2-(Ethoxyimino-1′-ethyl)phenyl | |
264 | H | 3-(Ethoxyimino-1′-ethyl)phenyl | |
265 | H | 4-(Ethoxyimino-1′-ethyl)phenyl | |
266 | H | 2-(n-Propoxyimino-1′-ethyl)- | |
phenyl | |||
267 | H | 3-(n-Propoxyimino-1′-ethyl)- | |
phenyl | |||
268 | H | 4-(n-Propoxyimino-1′-ethyl)- | |
phenyl | |||
269 | H | 2-(n-Butoxyamino-1′-ethyl)phenyl | |
270 | H | 3-(n-Butoxyamino-1′-ethyl)phenyl | |
271 | H | 4-(n-Butoxyamino-1′-ethyl)phenyl | |
272 | H | 2-(n-Pentoxyimino-1′-ethyl)- | |
phenyl | |||
273 | H | 3-(n-Pentoxyimino-1′-ethyl)- | |
phenyl | |||
274 | H | 4-(n-Pentoxyimino-1′-ethyl)- | |
phenyl | |||
275 | H | 2-(n-Hexoxyimino-1′-ethyl)phenyl | |
276 | H | 3-(n-Hexoxyimino-1′-ethyl)phenyl | |
277 | H | 4-(n-Hexoxyimino-1′-ethyl)phenyl | |
278 | H | 2-(Allyloxyimino-1′-ethyl)phenyl | |
279 | H | 3-(Allyloxyimino-1′-ethyl)phenyl | |
280 | H | 4-(Allyloxyimino-1′-ethyl)phenyl | |
281 | H | 2-(Benzyloxyimino-1′-ethyl)- | |
phenyl | |||
282 | H | 3-(Benzyloxyimino-1′-ethyl)- | |
phenyl | |||
283 | H | 4-(Benzyloxyimino-1′-ethyl)- | |
phenyl | |||
284 | H | 2-Phenylphenyl | |
285 | H | 3-Phenylphenyl | |
286 | H | 4-Phenylphenyl | m.p.: 94-96° C. |
287 | H | 2-Phenoxyphenyl | |
288 | H | 3-Phenoxyphenyl | |
289 | H | 4-Phenoxyphenyl | |
290 | H | 2-Benzyloxyphenyl | |
291 | H | 3-Benzyloxyphenyl | |
292 | H | 4-Benzyloxyphenyl | m.p.: 94-96° C. |
293 | H | 4-(Imidazol-1′-yl)phenyl | |
294 | H | 4-(Piperazin-1′-yl)phenyl | |
295 | H | 4-(Morpholin-1′-yl)phenyl | |
296 | H | 4-(Piperazin-1′-yl)phenyl | |
297 | H | 4-(Pyridyl-2′-oxy)phenyl | |
298 | H | 2-Cyclopropylphenyl | |
299 | H | 3-Cyclopropylphenyl | |
300 | H | 4-Cyclopropylphenyl | |
301 | H | 3-Cyclohexylphenyl | |
302 | H | 4-Cyclohexylphenyl | |
303 | H | 4-Oxiramylphenyl | |
304 | H | 4-(1′,3′-Dioxo-2′-yl)phenyl | |
305 | H | 4-(Tetrahydropyran-2-yloxy)- | |
phenyl | |||
306 | H | 1-Naphthyl | |
307 | H | 2-Naphthyl | oil: IR (film): 1707, |
1633, 1257, 1129, 110 | |||
308 | H | 9-Anthryl | |
309 | H | 1-Naphthoxy | |
310 | H | 2-Naphthoxy | |
311 | H | 9-Anthroxy | |
312 | H | Phenoxy | |
313 | H | 2-Chlorophenoxy | |
314 | H | 3-Chlorophenoxy | |
315 | H | 4-Chlorophenoxy | |
316 | H | 4-Methylphenoxy | |
317 | H | 4-tert.-Butylphenoxy | |
318 | H | 4-Methylphenoxy | |
319 | H | 4-Ethoxyphenoxy | |
320 | H | 4-tert.-Butoxyphenoxy | |
321 | H | Phenylthio | |
322 | H | 2-Chlorophenylthio | |
323 | H | 4-Chlorophenylthio | |
324 | H | Benzyl | |
325 | H | 2-Methylbenzyl | |
326 | H | 3-Methylbenzyl | |
327 | H | 4-Methylbenzyl | |
328 | H | 4-tert.-Butylbenzyl | |
329 | H | 2-Chlorobenzyl | |
330 | H | 3-Chlorobenzyl | |
331 | H | 4-Chlorobenzyl | |
332 | H | 2,4-Dichlorobenzyl | |
333 | H | 2,6-Dichlorobenzyl | |
334 | H | 2,4,6-Trichlorobenzyl | |
335 | H | 2-Trifluoromethylbenzyl | |
336 | H | 3-Trifluoromethylbenzyl | |
337 | H | 4-Trifluoromethylbenzyl | |
338 | H | 2-Methoxybenzyl | |
339 | H | 4-Methoxybenzyl | |
340 | H | 4-tert.-Butoxybenzyl | |
341 | H | 4-Phenoxybenzyl | |
342 | H | 1-Phenethyl | |
343 | H | 2-Phenethyl | |
344 | H | 1-Phenylpropyl | |
345 | H | 2-Phenylpropyl | |
346 | H | 3-Phenylpropyl | |
347 | H | 2-Methyl-2-phenylpropyl | |
348 | H | 2-Methyl-3-phenylpropyl | |
349 | H | 4-Phenylbutyl | |
350 | H | 2-Phenyl-1-ethenyl | |
351 | H | 1-Phenyl-1-ethenyl | |
352 | H | 1-Phenyl-1-propenyl | |
353 | H | 1-Phenyl-1-propen-2-yl | |
354 | H | 2,2-Diphenylethenyl | |
355 | H | Phenoxymethyl | |
356 | H | 2-Pyridyl | |
357 | H | 3-Pyridyl | |
358 | H | 4-Pyridyl | |
359 | H | 2,6-Pyrimidinyl | |
360 | H | 1,5-Pyrimidinyl | |
361 | H | 2-Thienyl | |
362 | H | 3-Thienyl | |
363 | H | 2-Furyl | |
364 | H | 3-Furyl | |
365 | H | 1-Pyrrolyl | |
366 | H | 1-Imidazolyl | |
367 | H | 1,2,4-Triazolyl | |
368 | H | 1,3,4-Triazolyl | |
369 | H | 4-Thiazolyl | |
370 | H | 2-Benzothiazolyl | |
371 | H | 2-Pyridyloxy | |
372 | H | 2-Pyrimidinyloxy | |
373 | H | 2-Pyridylthio | |
374 | H | 2-Pyrimidinylthio | |
375 | H | 2-Benzothiazolylthio | |
376 | H | Phenylthiomethyl | |
377 | H | 2-Pyridylmethyl | |
378 | H | 3-Pyridylmethyl | |
379 | H | Furfuryloxy | |
380 | H | Thienylmethoxy | |
381 | H | 3-Isoxazolylmethoxy | |
382 | H | 2-Oxazolylmethoxy | |
383 | H | 2-Pyridylmethoxy | |
384 | H | 2′-Furyl-2-ethenyl | |
385 | H | 2′-Thienyl-2-thenyl | |
386 | H | 3′-Pyridyl-2-ethenyl | |
387 | H | Oxiranyl | |
388 | H | 1-Azinidiayl | |
389 | H | 1-Azetidinyl | |
390 | H | 1-Pyrrolidinyl | |
391 | H | 2-Tetrahydrofuryl | |
392 | H | 2-Tetrahydropyranyl | |
393 | H | 3-Tetrahydropyranyl | |
394 | H | 1-Piperidinyl | |
395 | H | 1-Morpholinyl | |
396 | H | 1-Piperazinyl | |
397 | H | 1,3-Dioxan-2-yl | |
398 | H | 3-Tetrahydrothiopyranyl | |
399 | H | 2-Dihydropyranyloxy | |
400 | H | 2-Tetrahydropyranyloxy | |
401 | H | CF3 | |
402 | H | 2-Fluoroethyl | |
403 | H | 2,2,2-Trifluoroethyl | |
404 | H | Pentafluoroethyl | |
405 | H | Chloromethyl | |
406 | H | Dichloromethyl | |
407 | H | Trichloromethyl | |
408 | H | 2-Chloroethyl | |
409 | H | 2,2,2-Trichloroethyl | |
410 | H | Pentachoroethyl | |
411 | H | Cyclopropyl | |
412 | H | Cycloburyl | |
413 | H | Cyclopentyl | |
414 | H | Cyclohexyl | |
415 | H | 1-Methylcyclopropyl | |
416 | H | 2,2-Dimethylcyclopropyl | |
417 | H | 1-Methylcyclohexyl | |
418 | H | 2,2-Difluorocyclopropyl | |
419 | H | 2,2-Dichlorocyclopropyl | |
420 | H | 2,2-Dibromocyclopropyl | |
421 | H | 2,2-Dichloro-3-Methylcyclo- | |
propyl | |||
422 | H | 2,2,3,3-Tetrafluorocyclobutyl | |
423 | H | Ethenyl | |
424 | H | 1-Propenyl | |
425 | H | 2-Methyl-1-propenyl | |
426 | H | 4-Methylpem-3-en-1-yl | |
427 | H | 2-Propenyl | |
428 | H | 2-Butenyl | |
429 | H | 2-Methyl-1-propenyl | |
430 | H | 3-Methyl-2-butenyl | |
431 | H | 2,2-Difluoroethenyl | |
432 | H | 2,2-Dichloroethenyl | |
433 | H | 3,3,3-Trifluoropropenyl | |
434 | H | 3,3,3-Trichloropropenyl | |
435 | H | 3-Chloro-2-propenyl | |
436 | H | Cyclopent-1-enyl | |
437 | H | Cyclopentadienyl | |
438 | H | Cyclohex-1-enyl | |
439 | H | Pentafluorocyclopentadienyl | |
440 | H | Pentachlorocyclopentadienyl | |
441 | H | 4-Dimethylaminophenyl | m.p.: 90-92° C. |
442 | H | 4-n-Butoxyphenyl | m.p.: 79-82° C. |
TABLE VI |
|
No. | R3 | R4 | Data |
1 | H | H | m.p.: 94-95° C. |
2 | H | Methoxymethyl | |
3 | H | Ethoxymethyl | |
4 | H | n-Propoxymethyl | |
5 | H | iso-Propoxymethyl | |
6 | H | tert.-Butoxymethyl | |
7 | H | 2-Methoxyprop-2-yl | |
8 | H | 2-Ethoxyprop-2-yl | |
9 | H | 2-n-Propoxyprop-2-yl | |
10 | H | 2-iso-Propoxyprop-2-yl | |
11 | H | 2-tert.-Butoxyprop-2-yl | |
12 | H | Methylthiomethyl | |
13 | H | tert.-Butylthiomethyl | |
14 | H | 2-Methylthioprop-2-yl | |
15 | H | 2-iso-Propylthioprop-2-yl | |
16 | H | 2-tert.-Butylthioprop-2-yl | |
17 | H | Methyl | |
18 | H | Ethyl | |
19 | H | n-Propyl | |
20 | H | iso-Propyl | |
21 | H | n-Butyl | |
22 | H | iso-Butyl | |
23 | H | sec.-Butyl | |
24 | H | tert.-Butyl | |
25 | H | n-Hexyl | |
26 | H | n-Decyl | |
27 | H | Cyclopropyl | |
28 | H | Cyclohexyl | |
29 | H | Phenylthiomethyl | |
30 | H | 2-Phenylthiomethyl | |
31 | H | 2-(2′-Chlorophenylthio)prop-2-yl | |
32 | H | Ethynyl | |
33 | H | I-Propynyl | |
34 | H | Methoxy | |
35 | H | Ethoxy | |
36 | H | n-Propoxy | |
37 | H | iso-propoxy | |
38 | H | n-Butoxy | |
39 | H | iso-Butoxy | |
40 | H | sec.-Butoxy | |
41 | H | tert.-Butoxy | |
42 | H | Methylthio | |
43 | H | Ethylthio | |
44 | H | n-Propylthio | |
45 | H | iso-Propylthio | |
46 | H | n-Butylthio | |
47 | H | iso-Butylthio | |
48 | H | sec.-Butylthio | |
49 | H | tert.-Butylthio | |
50 | H | Benzylthio | |
51 | H | Trifluoromethoxy | |
52 | H | Cyano | |
53 | H | Amino | |
54 | H | Methylamino | |
55 | H | Dimethylamino | |
56 | H | Ethylamino | |
57 | H | Diethylamino | |
58 | H | Di-n-Propylamino | |
59 | H | Di-iso-Propylamino | |
60 | H | Di-n-Butylamino | |
61 | H | Di-iso-Butylamino | |
62 | H | Acetyl | |
63 | H | Propion-1-yl | |
64 | H | Butyr-1-yl | |
65 | H | iso-Butyr-1-yl | |
66 | H | Pivaloyl | |
67 | H | Benzoyl | |
68 | H | 4-Chlorobenzoyl | |
69 | H | Benzylcarbonyl | |
70 | H | Methoxycarbonyl | |
71 | H | Ethoxycarbonyl | |
72 | H | n-Propoxycarbonyl | |
73 | H | iso-Propoxycarbonyl | |
74 | H | n-Butoxycarbonyl | |
75 | H | iso-Butoxycarbonyl | |
76 | H | sec.-Butoxycarbonyl | |
77 | H | tert.-Butoxycarbonyl | |
78 | H | n-Hexoxycarbonyl | |
79 | H | Phenoxycarbonyl | |
80 | H | 4-Chlorophenoxycarbonyl | |
81 | H | Benzyloxycarbonyl | |
82 | H | Aminocarbonyl | |
83 | H | Dimethylaminocarbonyl | |
84 | H | Diethylaminocarbonyl | |
85 | H | Di-iso-Propylaminocarbonyl | |
86 | H | Phenylaminocarbonyl | |
87 | H | N-Methyl-N-Phenylamino- | |
carbonyl | |||
88 | H | Phenyl | m.p.: 92-95° C. |
89 | H | 2-Fluorophenyl | m.p.: 92-95° C. |
90 | H | 3-Fluorophenyl | m.p.: 58-60° C. |
91 | H | 4-Fluorophenyl | m.p.: 110-111° C. |
92 | H | Pentafluorophenyl | m.p.: 118-120° C. |
93 | H | 2-Chlorophenyl | 1H—NMR (CDCl3): |
δ = 3.70s, | |||
3.82s, 5.15s, 7.15- | |||
7.40m, 7.52m, | |||
7.60s, 7.85m, 8.52s | |||
94 | H | 3-Chlorophenyl | m.p.: 58-60° C. |
95 | H | 4-Chlorophenyl | m.p.: 146-148° C. |
96 | H | Pentachlorophenyl | |
97 | H | 2,3-Dichlorophenyl | m.p.: 95-97° C. |
98 | H | 2,4-Dichlorophenyl | m.p.: 58-62° C. |
99 | H | 2,5-Dichlorophenyl | |
100 | H | 2,6-Dichlorophenyl | m.p.: 136-140° C. |
101 | H | 3,4-Dichlorophenyl | m.p.: 94-97° C. |
102 | H | 3,5-Dichlorophenyl | m.p.: 88-91° C. |
103 | H | 2,3,4-Trichlorophenyl | |
104 | H | 2,3,5-Trichlorophenyl | |
105 | H | 2,3,6-Trichlorophenyl | |
106 | H | 2,4,5-Trichlorophenyl | |
107 | H | 2,4,6-Trichlorophenyl | |
108 | H | 3,4,5-Trichlorophenyl | |
109 | H | 2,3,4,6-Tetrachlorophenyl | |
110 | H | 2,3,5,6-Tetrachlorophenyl | |
111 | H | 2-Bromophenyl | m.p.: 91-94° C. |
112 | H | 3-Bromophenyl | m.p.: 63-64° C. |
113 | H | 4-Bromophenyl | m.p.: 145-147° C. |
114 | H | 2,4-Dibromophenyl | |
115 | H | 3-Bromo-4-Fluorophenyl | |
116 | H | 3-Bromo-4-Methoxyphenyl | |
117 | H | 2-Iodophenyl | |
118 | H | 3-Iodophenyl | |
119 | H | 4-Iodophenyl | |
120 | H | 2-Chloro-4-Fluorophenyl | m.p.: 90-93° C. |
121 | H | 2-Chloro-5-Fluorophenyl | |
122 | H | 2-Chloro-6-Fluorophenyl | m.p.: 111-113° C. |
123 | H | 2-Chloro-4-Bromophenyl | |
124 | H | 2-Bromo-4-Chlorophenyl | |
125 | H | 2-Bromo-4-Fluorophenyl | |
126 | H | 3-Bromo-4-Chlorophenyl | |
127 | H | 3-Chloro-4-Fluorophenyl | |
128 | H | 3-Fluoro-4-Chlorophenyl | |
129 | H | 2-Cyanophenyl | |
130 | H | 3-Cyanophenyl | |
131 | H | 4-Cyanophenyl | |
132 | H | 2-Nitrophenyl | |
133 | H | 3-Nitrophenyl | |
134 | H | 4-Nitrophenyl | m.p.: 142-146° C. |
135 | H | 2-Methylphenyl | m.p.: 58-60° C. |
136 | H | 3-Methylphenyl | m.p.: 70-72° C. |
137 | H | 4-Methylphenyl | m.p.: 99-102° C. |
138 | H | 2,4-Dimethylphenyl | m.p.: 54-56° C. |
139 | H | 2,6-Dimethylphenyl | |
140 | H | 3,4-Dimethylphenyl | |
141 | H | 3,5-Dimethylphenyl | |
142 | H | 2,3,4-Trimethylphenyl | |
143 | H | 2,3,5-Trimethylphenyl | |
144 | H | 2,3,6-Trimethylphenyl | |
145 | H | 2,4,5-Trimethylphenyl | |
146 | H | 2,4,6-Trimethylphenyl | |
147 | H | 3,4,5-Trimethylphenyl | |
148 | H | Pentamethylphenyl | |
149 | H | 2-Ethylphenyl | |
150 | H | 3-Ethylphenyl | |
151 | H | 4-Ethylphenyl | |
152 | H | 3,5-Diethylphenyl | |
153 | H | 2-n-Propylphenyl | |
154 | H | 3-n-Propylphenyl | |
155 | H | 4-n-Propylphenyl | |
156 | H | 2-iso-Propylphenyl | |
157 | H | 3-iso-Propylphenyl | |
158 | H | 4-iso-Propylphenyl | |
159 | H | 2,4-Di-iso-Propylphenyl | |
160 | H | 3,5-Di-iso-Propylphenyl | |
161 | H | 4-n-Butylphenyl | |
162 | H | 4-sec.-Butylphenyl | |
163 | H | 4-iso-Butylphenyl | |
164 | H | 4-tert.-Butylphenyl | m.p.: 82-84° C. |
165 | H | 3-tert.-Butylphenyl | |
166 | H | 2-tert.-Butylphenyl | |
167 | H | 2,4-Di-tert.-Butylphenyl | |
168 | H | 3,5-Di-tert.-Butylphenyl | |
169 | H | 4-n-Hexylphenyl | |
170 | H | 4-n-Dodecylphenyl | |
171 | H | 2-Methyl-4-tert.-Butylphenyl | |
172 | H | 2-Methyl-6-tert.-Butylphenyl | |
173 | H | 2-Methyl-4-iso-Propylphenyl | |
174 | H | 2-Methyl-4-Cyclohexylphenyl | |
175 | H | 2-Methyl-4-Phenylphenyl | |
176 | H | 2-Methyl-4-Benzylphenyl | |
177 | H | 2-Methyl-4-Phenoxyphenyl | |
178 | H | 2-Methyl-4-Benzyloxyphenyl | |
179 | H | 2-Methyl-3-Chlorophenyl | |
180 | H | 2-Methyl-4-Chlorophenyl | |
181 | H | 2-Methyl-5-Chlorophenyl | |
182 | H | 2-Methyl-6-Chlorophenyl | |
183 | H | 2-Methyl-4-Fluorophenyl | |
184 | H | 2-Methyl-3-Bromophenyl | |
185 | H | 2-Methyl-4-Bromophenyl | |
186 | H | 2-Methyl-3-Methoxyphenyl | |
187 | H | 2-Methyl-4-Methoxyphenyl | |
188 | H | 2-Methyl-5-Methoxyphenyl | |
189 | H | 2-Methyl-6-Methoxyphenyl | |
190 | H | 2-Methyl-4-iso-Propoxyphenyl | |
191 | H | 2-Methyl-2,5-Dimethoxyphenyl | |
192 | H | 2-Methoxyphenyl | m.p.: 65-68° C. |
193 | H | 3-Methoxyphenyl | m.p.: 83-84° C. |
194 | H | 4-Methoxyphenyl | m.p.: 88-90° C. |
195 | H | 2,3-Dimethoxyphenyl | |
196 | H | 2,4-Dimethoxyphenyl | m.p.: 90-93° C. |
197 | H | 2,5-Dimethoxyphenyl | |
198 | H | 2,6-Dimethoxyphenyl | |
199 | H | 3,4-Dimethoxyphenyl | m.p.: 70-72° C. |
200 | H | 3,5-Dimethoxyphenyl | m.p.: 92-99° C. |
201 | H | 3,6-Dimethoxyphenyl | |
202 | H | 2,3,4-Trimethoxyphenyl | |
203 | H | 2,3,5-Trimethoxyphenyl | |
204 | H | 2,3,6-Trimethoxyphenyl | |
205 | H | 2,4,5-Trimethoxyphenyl | |
206 | H | 2,4,6-Trimethoxyphenyl | |
207 | H | 3,4,5-Trimethoxyphenyl | m.p.: 105-109° C. |
208 | H | 2-Ethoxyphenyl | |
209 | H | 3-Ethoxyphenyl | m.p.: 90-92° C. |
210 | H | 4-Ethoxyphenyl | m.p.: 97-98° C. |
211 | H | 2-iso-Propoxyphenyl | |
212 | H | 3-iso-Propoxyphenyl | |
213 | H | 4-iso-Propoxyphenyl | |
214 | H | 3-tert.-Butoxyphenyl | |
215 | H | 4-tert.-Butoxyphenyl | m.p.: 78-83° C. |
216 | H | 2-Trifluoromethoxyphenyl | |
217 | H | 3-Trifluoromethoxyphenyl | |
218 | H | 4-Trifluoromethoxyphenyl | |
219 | H | 3-(1′,1′,2′,2′- | |
Tetrafluoro)ethoxyphenyl | |||
220 | H | 4-(1′,1′,2′,2′- | |
Tetrafluoro)ethoxyphenyl | |||
221 | H | 2-Chloromethylphenyl | |
222 | H | 3-Chloromethylphenyl | |
223 | H | 4-Chloromethylphenyl | |
224 | H | 2-Trifluoromethylphenyl | m.p.: 58-60° C. |
225 | H | 3-Trifluoromethylphenyl | m.p.: 74-77° C. |
226 | H | 4-Trifluoromethylphenyl | m.p.: 120-122° C. |
227 | H | 2-(Methoxyiminomethyl)phenyl | |
228 | H | 3-(Methoxyiminomethyl)phenyl | |
229 | H | 4-(Methoxyiminomethyl)phenyl | |
230 | H | 2-(Ethoxyiminomethyl)phenyl | |
231 | H | 3-(Ethoxyiminomethyl)phenyl | |
232 | H | 4-(Ethoxyiminomethyl)phenyl | |
233 | H | 2-(n-Propoxyiminomethyl)phenyl | |
234 | H | 3-(n-Propoxyiminomethyl)phenyl | |
235 | H | 4-(n-Propoxyiminomethyl)phenyl | |
236 | H | 2-(iso-Propoxyiminomethy)- | |
phenyl | |||
237 | H | 3-(iso-Propoxyiminomethyl)- | |
phenyl | |||
238 | H | 4-(iso-Porpoxyiminomethyl)- | |
phenyl | |||
239 | H | 2-(n-Butoxyiminomethyl)phenyl | |
240 | H | 3-(n-Butoxyiminomethyl)phenyl | |
241 | H | 4-(n-Butoxyiminomethyl)phenyl | |
242 | H | 2-(iso-Butoxyiminomethyl)phenyl | |
243 | H | 3-(iso-Butoxyiminomethyl)phenyl | |
244 | H | 4-(iso-Butoxyiminomethyl)phenyl | |
245 | H | 2-(tert.-Butoxyiminomethyl)- | |
phenyl | |||
246 | H | 3-(tert.-Butoxyiminomethyl)- | |
phenyl | |||
247 | H | 4-(tert.-Butoxyiminomethyl)- | |
phenyl | |||
248 | H | 2-(n-Pentoxyiminomethyl)phenyl | |
249 | H | 3-(n-Pentoxyiminomethyl)phenyl | |
250 | H | 4-(n-Pentoxyiminomethyl)phenyl | |
251 | H | 2-(n-Hexoxyiminomethyl)phenyl | |
252 | H | 3-(n-Hexoxyiminomethyl)phenyl | |
253 | H | 4-(n-Hexoxyiminomethyl)phenyl | |
254 | H | 2-(Allyloxyiminomethyl)phenyl | |
255 | H | 3-(Allyloxyiminomethyl)phenyl | |
256 | H | 4-(Allyloxyiminomethyl)phenyl | |
257 | H | 2-(Benzyloxyiminomethyl)phenyl | |
258 | H | 3-(Benzyloxyiminomethyl)phenyl | |
259 | H | 4-(Benzyloxyiminomethyl)phenyl | |
260 | H | 2-(Methoxyimino-1′-ethyl)phenyl | |
261 | H | 3-(Methoxyimino-1′-ethyl)phenyl | |
262 | H | 4-(Methoxyimino-1′-ethyl)phenyl | |
263 | H | 2-(Ethoxyimino-1′-ethyl)phenyl | |
264 | H | 3-(Ethoxyimino-1′-ethyl)phenyl | |
265 | H | 4-(Ethoxyimino-1′-ethyl)phenyl | |
266 | H | 2-(n-Propoxyimino-1′-ethyl)- | |
phenyl | |||
267 | H | 3-(n-Propoxyimino-1′-ethyl)- | |
phenyl | |||
268 | H | 4-(n-Propoxyimino-1′-ethyl)- | |
phenyl | |||
269 | H | 2-(n-Butoxyamino-1′-ethyl)phenyl | |
270 | H | 3-(n-Butoxyamino-1′-ethyl)phenyl | |
271 | H | 4-(n-Butoxyamino-1′-ethyl)phenyl | |
272 | H | 2-(n-Pentoxyimino-1′-ethyl)- | |
phenyl | |||
273 | H | 3-(n-Pentoxyimino-1′-ethyl)- | |
phenyl | |||
274 | H | 4-(n-Pentoxyimino-1′-ethyl)- | |
phenyl | |||
275 | H | 2-(n-Hexoxyimino-1′-ethyl)phenyl | |
276 | H | 3-(n-Hexoxyimino-1′-ethyl)phenyl | |
277 | H | 4-(n-Hexoxyimino-1′-ethyl)phenyl | |
278 | H | 2-(Allyloxyimino-1′-ethyl)phenyl | |
279 | H | 3-(Allyloxyimino-1′-ethyl)phenyl | |
280 | H | 4-(Allyloxyimino-1′-ethyl)phenyl | |
281 | H | 2-(Benzyloxyimino-′-ethyl)- | |
phenyl | |||
282 | H | 3-(Benzyloxyimino-1′-ethyl)- | |
phenyl | |||
283 | H | 4-(Benzyloxyimino-1′-ethyl)- | |
phenyl | |||
284 | H | 2-Phenylphenyl | |
285 | H | 3-Phenylphenyl | |
286 | H | 4-Phenylphenyl | m.p.: 100-102° C. |
287 | H | 2-Phenoxyphenyl | |
288 | H | 3-Phenoxyphenyl | IR (film): 1728, |
1489, 1247, 1214, | |||
1070, 1020 | |||
289 | H | 4-Phenoxyphenyl | m.p.: 85-87° C. |
290 | H | 2-Benzyloxyphenyl | m.p.: 83-85° C. |
291 | H | 3-Benzyloxyphenyl | m.p.: 66-68° C. |
292 | H | 4-Benzyloxyphenyl | m.p.: 104-106° C. |
293 | H | 4-(Imidazol-1′-yl)phenyl | |
294 | H | 4-(Piperazin-1′-yl)phenyl | |
295 | H | 4-(Morpholin-1′-yl)phenyl | |
296 | H | 4-(Piperazin-1′-yl)phenyl | |
297 | H | 4-(Pyridyl-2′-oxy)phenyl | |
298 | H | 2-Cyclopropylphenyl | |
299 | H | 3-Cyclopropylphenyl | |
300 | H | 4-Cyclopropylphenyl | |
301 | H | 3-Cyclohexylphenyl | |
302 | H | 4-Cyclohexylphenyl | |
303 | H | 4-Oxiranylphenyl | |
304 | H | 4-(1′,3′-Dioxan-2′-yl)phenyl | |
305 | H | 4-(Tetrahydropyran-2-yloxy)- | |
phenyl | |||
306 | H | 1-Naphthyl | m.p.: 70-73° C. |
307 | H | 2-Naphyhyl | m.p.: 125-126° C. |
308 | H | 9-Anthryl | |
309 | H | 1-Naphthoxy | |
310 | H | 2-Naphthoxy | |
311 | H | 9-Anthroxy | |
312 | H | Phenoxy | |
313 | H | 2-Chlorophenoxy | |
314 | H | 3-Chlorophenoxy | |
315 | H | 4-Chlorophenoxy | |
316 | H | 4-Methylphenoxy | |
317 | H | 4-tert.-Butylphenoxy | |
318 | H | 4-Methoxyphenoxy | |
319 | H | 4-Ethoxyphenoxy | |
320 | H | 4-tert.-Butoxyphenoxy | |
321 | H | Phenylthio | |
322 | H | 2-Chlorophenylthio | |
323 | H | 4-Chlorophenylthio | |
324 | H | Benzyl | |
325 | H | 2-Methylbenzyl | |
326 | H | 3-Methylbenzyl | |
327 | H | 4-Methylbenzyl | |
328 | H | 4-tert.-Butylbenzyl | |
329 | H | 2-Chlorobenzyl | |
330 | H | 3-Chlorobenzyl | |
331 | H | 4-Chlorobenzyl | |
332 | H | 2,4-Dichlorobenzyl | |
333 | H | 2,6-Dichlorobenzyl | |
334 | H | 2,4,6-Trichlorobenzyl | |
335 | H | 2-Trifluoromethylbenzyl | |
336 | H | 3-Trifluoromethylbenzyl | |
337 | H | 4-Trifluoromethylbenzyl | |
338 | H | 2-Methoxybenzyl | |
339 | H | 4-Methoxybenzyl | |
340 | H | 4-tert.-Butoxybenzyl | |
341 | H | 4-Phenoxybenzyl | |
342 | H | 1-Phenethyl | |
343 | H | 2-Phenethyl | |
344 | H | 1-Phenylpropyl | |
345 | H | 2-Phenylpropyl | |
346 | H | 3-Phenylpropyl | |
347 | H | 2-Methyl-2-phenylpropyl | |
348 | H | 2-Methyl-3-phenylpropyl | |
349 | H | 4-Phenylbutyl | |
350 | H | 2-Phenyl-1-ethenyl | |
351 | H | 1-Phenyl-1-ethenyl | |
352 | H | 1-Phenyl-1-propenyl | |
353 | H | 1-Phenyl-1-porpen-2-yl | |
354 | H | 2,2-Diphenylethenyl | |
355 | H | Phenoxymethyl | |
356 | H | 2-Pyridyl | |
357 | H | 3-Pyridyl | |
358 | H | 4-Pyridyl | |
359 | H | 2,6-Pyrimidinyl | |
360 | H | 1,5-Pyrimidinyl | |
361 | H | 2-Thienyl | |
362 | H | 3-Thienyl | |
363 | H | 2-Furyl | |
364 | H | 3-Furyl | |
365 | H | 1-Pyrrolyl | |
366 | H | 1-Imidazolyl | |
367 | H | 1,2,4-Triamolyl | |
368 | H | 1,3,4-Triamolyl | |
369 | H | 4-Thiazolyl | |
370 | H | 2-Benzothiazolyl | |
371 | H | 2-Pyridyloxy | |
372 | H | 2-Pyrimidinyloxy | |
373 | H | 2-Pyridylthio | |
374 | H | 2-Pyrimidinylthio | |
375 | H | 2-Benzothimzolylthio | |
376 | H | Phenylthiomethyl | |
377 | H | 2-Pyridylmethyl | |
378 | H | 3-Pyridylmethyl | |
379 | H | Perfuryloxy | |
380 | H | Thienylmethoxy | |
381 | H | 3-hexazolylmethoxy | |
382 | H | 2-Oxazolylmethoxy | |
383 | H | 2-Pyridylmethoxy | |
384 | H | 2′-Furyl-2-ethenyl | |
385 | H | 2′-Thienyl-2-ethenyl | |
386 | H | 3′-Pyridyl-2-ethenyl | |
387 | H | Oxiramyl | |
388 | H | 1-Aziridinyl | |
389 | H | 1-Azazidinyl | |
390 | H | 1-Pyrrodidinyl | |
391 | H | 2-Tetrahydrofuryl | |
392 | H | 2-Tetrahydropyraryl | |
393 | H | 3-Tetrahydropyraryl | |
394 | H | 1-Piperidinyl | |
395 | H | 1-Morpholinyl | |
396 | H | 1-Piperazinyl | |
397 | H | 1,3-Dioxan-2-yl | |
398 | H | 3-Tetrahydrothiopyranyl | |
399 | H | 2-Dihydropyranyloxy | |
400 | H | 2-Tetrahydropyranyloxy | |
401 | H | CF3 | |
402 | H | 2-Fluoroethyl | |
403 | H | 2,2,2-Trifluoroethyl | |
404 | H | Pentafluoroethyl | |
405 | H | Chloromethyl | |
406 | H | Dichloromethyl | |
407 | H | Trichloromethyl | |
408 | H | 2-Chloroethyl | |
409 | H | 2,2,2-Trichloroethyl | |
410 | H | Pentachloroethyl | |
411 | H | Cyclopropyl | |
412 | H | Cyclobutyl | |
413 | H | Cyclopentyl | |
414 | H | Cyclohexyl | |
415 | H | 1-Methylcyclopropyl | |
416 | H | 2,2-Dimethylcyclopropyl | |
417 | H | 1-Methylcyclohexyl | |
418 | H | 2,2-Difluorocyclopropyl | |
419 | H | 2,2-Dichlorocyclopropyl | |
420 | H | 2,2-Dibromocyclopropyl | |
421 | H | 2,2-Dichloro-3-methylcyclo- | |
propyl | |||
422 | H | 2,2,3,3-Tetrafluorocyclobutyl | |
423 | H | Ethenyl | |
424 | H | 1-Propenyl | |
425 | H | 2-Methyl-1-propenyl | |
426 | H | 4-Methylpent-3-en-1-yl | |
427 | H | 2-Propenyl | |
428 | H | 2-Butenyl | |
429 | H | 1-Methyl-2-propenyl | |
430 | H | 3-Methyl-2-butenyl | |
431 | H | 2,2-Difluoroethenyl | |
432 | H | 2,2-Dichloroethenyl | |
433 | H | 3,3,3-Trifluoropropenyl | |
434 | H | 3,3,3-Trichloropropenyl | |
435 | H | 3-Chloro-2-propenyl | |
436 | H | Cyclopent-1-enyl | |
437 | H | Cyclopentadienyl | |
438 | H | Cyclohex-1-enyl | |
439 | H | Pentafluorocyclopentadienyl | |
440 | H | Pentachlorocyclopentadienyl | |
441 | H | 4-Dimethylaminophenyl | m.p.: 70-71° C. |
442 | H | 4-Allyloxyphenyl | m.p.: 81-83° C. |
443 | H | Diphenylmethyl | m.p.: 66-68° C. |
444 | H | Dimethylbenzyl | 1H—NMR (CDCl3): |
δ = 1.45s | |||
3.78s, 4.03s, 5.00s, | |||
7.17-7.41m | |||
TABLE VII |
|
No. | R8 n | Data |
1 | H | m.p. 156-158° C. |
2 | 3-Fluoro | |
3 | 4-Fluoro | |
4 | 3-Chloro | |
5 | 4-Chloro | |
6 | 3-Bromo | |
7 | 4-Bromo | |
8 | 3-Iodo | |
9 | 4-Iodo | |
10 | 3,4-Dichloro | |
11 | 3,5-Dichloro | |
12 | 3,6-Dichloro | |
13 | 4,5-Dichloro | |
14 | 3,4,5-Trichloro | |
15 | 3,4,6-Trichloro | |
16 | 3,4,5,6-Tetrachloro | |
17 | 3,4,5,6-Tetrafluoro | |
18 | 3,4,5,6-Tetrabromo | |
19 | 3,5-Difluoro | |
20 | 3,5-Dibromo | |
21 | 3-Methyl | |
22 | 4-Methyl | |
23 | 3-Ethyl | |
24 | 4-Ethyl | |
25 | 3-iso-Propyl | |
26 | 4-iso-Propyl | |
27 | 3-tert.-Butyl | |
28 | 4-tert.-Butyl | |
29 | 3,4-Dimethyl | |
30 | 3,5-Dimethyl | |
31 | 3,6-Dimethyl | |
32 | 4,5-Dimethyl | |
33 | 3,4,5-Trimethyl | |
34 | 3,4,6-Trimethyl | |
35 | 3,4,5,6-Tetramethyl | |
36 | 3-Nitro | |
37 | 4-Nitro | |
38 | 3,5-Dinitro | |
39 | 3-Cyano | |
40 | 4-Cyano | |
41 | 3-Methoxy | |
42 | 4-Methoxy | |
43 | 3-tert.-Butoxy | |
44 | 4-tert.-Butoxy | |
45 | 3-Trifluoromethyl | |
46 | 4-Trifluoromethyl | |
47 | 3-Chloromethyl | |
48 | 4-Chloromethyl | |
49 | 3-Trifluoromethoxy | |
50 | 4-Trifluoromethoxy | |
51 | 3-Benzyloxy | |
52 | 4-Benzyloxy | |
53 | 4,5-Dibenzyloxy | |
54 | 3-Phenoxy | |
55 | 4-Phenoxy | |
56 | 3-Phenyl | |
57 | 4-Phenyl | |
58 | 3-Pyrid-2′-yl | |
59 | 4-Pyrid-2′-yl | |
60 | 3-Pyrid-2′-yloxy | |
61 | 4-Pyrid-2′-yloxy | |
TABLE VIII |
|
No. | R8 n | Data |
1 | H | m.p. 152-155° C. |
2 | 3-Fluoro | |
3 | 4-Fluoro | |
4 | 3-Chloro | |
5 | 4-Chloro | |
6 | 3-Bromo | |
7 | 4-Bromo | |
8 | 3-Iodo | |
9 | 4-Iodo | |
10 | 3,4-Dichloro | |
11 | 3,5-Dichloro | |
12 | 3,6-Dichloro | |
13 | 4,5-Dichloro | |
14 | 3,4,5-Trichloro | |
15 | 3,4,6-Trichloro | |
16 | 3,4,5,6-Tetrachloro | |
17 | 3,4,5,6-Tetrafluoro | |
18 | 3,4,5,6-Tetrabromo | |
19 | 3,5-Difluoro | |
20 | 3,5-Dibromo | |
21 | 3-Methyl | |
22 | 4-Methyl | |
23 | 3-Ethyl | |
24 | 4-Ethyl | |
25 | 3-iso-Propyl | |
26 | 4-iso-Propyl | |
27 | 3-tert-Butyl | |
28 | 4-tert-Butyl | |
29 | 3,4-Dimethyl | |
30 | 3,5-Dimethyl | |
31 | 3,6-Dimethyl | |
32 | 4,5-Dimethyl | |
33 | 3,4,5-Trimethyl | |
34 | 3,4,6-Trimethyl | |
35 | 3,4,5,6-Tetramethyl | |
36 | 3-Nitro | |
37 | 4-Nitro | |
38 | 3,5-Dinitro | |
39 | 3-Cyano | |
40 | 4-Cyano | |
41 | 3-Methoxy | |
42 | 4-Methoxy | |
43 | 3-tert.Butoxy | |
44 | 4-tert.Butoxy | |
45 | 3-Trifluoromethyl | |
46 | 4-Trifluoromethyl | |
47 | 3-Chloromethyl | |
48 | 4-Chloromethyl | |
49 | 3-Trifluoromethoxy | |
50 | 4-Trifluoromethoxy | |
51 | 3-Benzyloxy | |
52 | 4-Benzyloxy | |
53 | 4,5-Dibenzyloxy | |
54 | 3-Phenoxy | |
55 | 4-Phenoxy | |
56 | 3-Phenyl | |
57 | 4-Phenyl | |
58 | 3-Pyrid-2′-yl | |
59 | 4-Pyrid-2′-yl | |
60 | 3-Pyrid-2′-yloxy | |
61 | 4-Pyrid-2′-yloxy | |
TABLE IX |
|
No. | X | Y | R1 | R8 | Data |
1 | CH—SCH3 | O | CH3 | H |
2 | CH—SCH3 | NH | CH3 | H |
3 | CH—SCH3 | S | CH3 | H |
4 | CH2 | O | CH3 | H |
5 | CH2 | NH | CH3 | H |
6 | CH2 | S | CH3 | H |
7 | CH—CH3 | O | CH3 | H |
8 | CH—CH3 | NH | CH3 | H |
9 | CH—CH3 | S | CH3 | H |
10 | CH—CH3 | O | CH3 | Perchloro |
11 | CH—CH3 | NH | CH3 | Perchloro |
12 | CH—CH3 | S | CH3 | Perchloro |
13 | CH—OCH3 | NH | CH3 | H |
14 | CH—OCH3 | S | CH3 | H |
15 | CH—OCH3 | NH | CH3 | Perchloro |
16 | CH—OCH3 | S | CH3 | Perchloro |
17 | N—OCH3 | NH | CH3 | H |
18 | N—OCH3 | S | CH3 | H |
19 | N—OCH3 | NH | CH3 | Perchloro |
20 | N—OCH3 | S | CH3 | Perchloro |
In general terms, the novel compounds are extremely effective on a broad spectrum of phytopathogenic fungi, in particular those from the class consisting of the Ascomycetes and Basidiomycetes. Some of them have a systemic action and can be used as foliar and soil fungicides.
The fungicidal compounds are of particular interest for controlling a large number of fungi in various crops or their seeds, especially wheat. rye, barley, oats, rice, indian corn, lawns, cotton, soybeans, coffee, sugar cane, fruit and ornamentals in horticulture and viticulture, and in vegetables such as cucumbers, beans and cucurbits.
The novel compounds are particularly useful for controlling the following plant diseases:
Erysiphe graminis in cereals,
Erysiphe cichoracearum and Sphaerotheca fuliginea in curcurbits,
Podosphaera leucotricha in apples,
Uncinula necator in vines,
Puccinia species in cereals,
Rhizoctonia solani in cotton,
Ustilago species in cereals and sugar cane,
Venturia inaequalis scab in apples,
Helminthosporium species in cereals,
Septoria nodorum in wheat,
Botrytis cinerea gray mold in strawberries and grapes,
Cercospora arachidicola in groundnuts,
Pseudocercosporella herpotrichoides in wheat and barley,
Pyricularia oryzae in rice,
Phytophthora infestans in potatoes and tomatoes,
Fusarium and Verticillium species in various plants,
Plasmopara viticola in grapes,
Alternaria species in fruit and vegetables.
The compounds are applied by spraying or dusting the plants with the active ingredients, or treating the seeds of the plants with the active ingredients. They may be applied before or after infection of the plants or seeds by the fungi. Either the fungi themselves, or the plants seed or materials to be protected against fungus attack, or the soil are treated with a fungicidally effective amount of the active ingredient.
The novel substances can be converted into conventional formulations such as solutions, emulsions, suspensions, dusts, powders, pastes and granules. The application forms depend entirely on the purposes for which they are intended they should at all events ensure a fine and uniform distribution of the active ingredient. The formulations are produced in known manner, for example by extending the active ingredient with solvents and/or carriers, with or without the use of emulsifiers and dispersants; if water is used as solvent, it is also possible to employ other organic solvents as auxiliary solvents. Suitable auxiliaries for this purpose are solvents such as aromatics (e.g., xylene), chlorinated aromatics (e.g., chlorobenzenes), paraffins (e.g., crude oil fractions), alcohols (e.g., methanol, butanol), ketones (e.g., cyclohexanone), amines (e.g., ethanolamine, dimethylformamide), and water; carriers such as ground natural minerals (e.g., kaolins, aluminas, talc and chalk) and ground synthetic minerals (e.g., highly disperse silica and silicates); emulsifiers such as nonionic and anonic emulsifiers (e.g., polyoxyethylene fatty alcohol ethers, alkyl sulfonates and aryl sulfonates); and dispersants such as ligninsulfite waste liquors and methylcellulose.
The fungicides generally contain from 0.1 to 95, and preferably from 0.5 to 90, wt % of active ingredient. The application rates are from 0.02 to 3 kg or more of active ingredient per hectare, depending on the type of effect desired. The novel compounds may also be used for protecting materials, e.g., on Paecilomyces variotii. When the active ingredients are used for treating seed, amounts of from 0.001 to 50, and preferably from 0.01 to 10, g per kg of seed are generally required.
The agents and the ready-to-use formulations prepared from them, such as solutions, emulsions, suspensions, powders, dusts, pastes and granules, are applied in conventional manner, for example by spraying, atomizing, dusting, scattering, dressing or watering.
Examples of formulations are given below.
I. A solution of 90 parts by weight of compound no. 429 (Table I) and 10 parts by weight of N-methyl-α-pyrrolidone, which is suitable for application in the form of very fine drops.
II. A mixture of 20 parts by weight of compound no. 14 (Table II), 80 parts by weight of xylene, 10 parts by weight of the adduct of 8 to 10 moles of ethylene oxide and 1 mole of oleic acid-N-monoethanolamide, 5 parts by weight of the calcium salt of dodecylbenzenesulfonic acid and 5 parts by weight of the adduct of 40 moles of ethylene oxide and 1 mole of castor oil. By finely dispersing the mixture in water, an aqueous dispersion is obtained.
III. An aqueous dispersion of 20 parts by weight of compound no. 49 (Table I), 40 parts by weight of cyclohexanone, 30 parts by weight of isobutanol, 20 parts by weight of the adduct of 40 moles of ethylene oxide and 1 mole of castor oil. By finely dispersing the solution in water, an aqueous dispersion is obtained.
IV. An aqueous dispersion of 20 parts by weight of compound no. 56 (Table I), 25 parts by weight of cyclohexanol, 65 parts by weight of a mineral oil fraction having a boiling point between 210° and 280° C., and 10 parts by weight of the adduct of 40 moles of ethylene oxide and 1 mole of castor oil. By finely distributing the solution in water, an aqueous dispersion is obtained.
V. A hammer-milled mixture of 80 parts by weight of compound no. 14 (Table I), 3 parts by weight of the sodium salt of diisobutylnaphthalene-α-sulfonic acid, 10 parts by weight of the sodium salt of a lignin-sulfonic acid obtained from a sulfite waste liquor, and 7 parts by weight of powdered silica gel. By finely dispersing the mixture in water, a spray liquor is obtained.
VI. An intimate mixture of 3 parts by weight of compound no. 17 (Table II) and 97 parts by weight of particulate kaolin. The dust contains 3 wt % of the active ingredient.
VII. An intimate mixture of 30 parts by weight of compound no. 17 (Table I), 92 parts by weight of powdered silica gel and 8 parts by weight of paraffin oil sprayed onto the surface of this silica gel. This formulation of the active ingredient exhibits good adherence.
VIII. A stable aqueous dispersion of 40 parts by weight of compound no. 571 (Table I), 10 parts of the sodium salt of a phenolsulfonic acid-urea-formaldehyde condensate, 2 parts of silica gel and 48 parts by weight of water, which dispersion can be further diluted.
IX. A stable oily dispersion of 20 parts by weight of compound no. 616 (Table I), 2 parts by weight of the calcium salt of dodecylbenzenesulfonic acid, 8 parts by weight of a fatty alcohol polyglycol ether, 2 parts by weight of the sodium salt of a phenolsulfonic acid-urea-formaldehyde condensate and 68 parts by weight of a paraffinic mineral oil.
In these application forms, the agents according to the invention may also be present together with other active ingredients, for example herbicides, insecticides, growth regulators, and fungicides, and may furthermore be mixed and applied together with fertilizers. Admixture with other fungicides frequently results in a greater fungicidal action spectrum.
The active ingredient used for comparison purposes was 2-(phenoxymethyl)-phenylglyoxylic acid-methyl ester-O-methyloxime (A) disclosed in EP 253,213.
Leaves of pot-grown wheat seedlings of the “Kanzler” variety were dusted with spores of brown rust (Puccinia recondita). The pots were then placed for 24 hours at 20° to 22° C. in a high-humidity (90-95%) chamber. During this period the spores germinated and the germ tubes penetrated the leaf tissue. The infected plants were then sprayed to runoff with aqueous liquors containing (dry basis) 80% of active ingredient and 20% of emulsifier. After the sprayed-on layer had dried, the plants were set up in the greenhouse at 20° to 22° C. and a relative humidity of 65 to 70%. The extent of rust fungus spread on the leaves was assessed after 8 days.
The results show that active ingredients nos. 49, 429, 56, 14, 15, 16, 17, 582, 578, 573, 592, 571, 704, 705 and 616 from Table I and nos. 17 and 644 from Table II, applied as 0.025 wt % spray liquors, have a better fungicidal action (95%) than prior art comparative compound A (50%).
Leaves of pot-grown rice seedlings of the “Bahia” variety were sprayed to runoff with aqueous emulsions containing (dry basis) 80% of active ingredient and 20% of emulsifier, and inoculated 24 hours later with an aqueous spore suspension of Pyricularia oryzae. The plants were then set up in climatic cabinets at 22° to 24° C. and 95 to 99% relative humidity. The extent of fungus attack was assessed after 6 days.
The results show that active ingredients nos. 429, 583, 593, 592, 571, 706 and 616 from Table I and nos. 14, 15, 16, 17, 582, 592, 571, 769, 782, 672, 644 and 583 from Table II, applied as 0.05 wt % spray liquors, have a very good fungicidal action (100%).
The novel compounds are also suitable for effectively combating pests such as insects, arachnids and nematodes. They may be used as pesticides in crop protection and in the hygiene, stores protection and veterinary sector.
Examples of injurious insects belonging to the Lepidoptera order are Agrotis ypsilon, Agrotis segetum, Alabama argillacea, Anticarsia gemmatalis, Argyresthia conjugella, Autographa gamma, Bupalus piniarius, Cacoecia murinana, Capua reticulana, Cheimatobia brumata, Choristoneura fumiferana, Choristoneura occidentalis, Cirphis unipuncta, Cydia pomonella, Oendrolimus pini, Diaphania nitidalis, Diatraea grandiosella, Earias insulana, Elasmopalpus lignosellus, Eupoecilia ambiguella, Evetria bouliana, Feltia subterranea, Galleria mellonella, Grapholita funebrana, Grapholita molesta, Heliothis armigera, Heliothis virescens, Heliothis zea, Hellula undalis, Hibernia defoliaria, Hyphantria cunea, Hyponomeuta malinellus, Keifferia lycopersicella, Lambdina fiscellaria, Laphygma exigua, Leucoptera coffeella, Leucoptera scitella, Lithocolletis blancardella, Lobesia botrana, Loxostege sticticalis, Lymantria dispar, Lymantria monacha, Lyonetia clerkella, Malacosoma neustria, Mamestra brassicae, Orgyia pseudotsugata, Ostrinia nubilalis, Panolis flamea, Pectinophora gossypiella, Peridroma saucia, Phalera bucephala, Phthorimaea operculella, Phyllocnistis citrella, Pieris brassicae, Plathypena scarbra, Plutella xylostella, rseudoplusia includens, Phyacionia frustrana, Scrobipalpula absoluta, Sitotroga cerelella, Sparganothis pilleriana, Spodoptera frugiperda, Spodoptera littoralis, Spodoptera litura, Thaumatopoea pityocampa, Tortrix viridana, Trichoplusia ni and Zeiraphera canadensis.
Examples from the Coleoptera order are Agrilus sinuatus, Agriotes lineatus, Agriotes obscurus, Amphimallus solstitialis, Anisandrus dispar, Anthonomus grandis, Anthonomus pomorum, Atomaria linearis, Blastophagus piniperda, Blitophaga undata, Bruchus rufimanus, Bruchus pisorum, Sruchus lentis, Byctiscus betulae, Cassida nebulosa, Cerotoma trifurcata, Ceuthorrhynchus assimilis, Ceuthorrynchus napi, Chaetocnema tibialis, Conoderus vespertinus, Crioceris asparagi, Oiabrotica longicornis, Diabrotica 12-punctata, Diabrotica virgifera, Epilachna varivestis, Epitrix hirtipennis, Eutinobothrus brasiliensis, Hylobius abietis, Hypera brunneipennis, Hypera postica, Ips typographus, Lema bilineata, Lema melanopus, Leptinotarsa decemlineata, Limonius californicus, Lissorhoptrus oryzophilus, Melanotus communis, Meligethes aeneus, Melolontha hippocastani, Melolontha melolontha, Onlema oryzae, Ortiorrhynchus sulcatus, Ortiorrhynchus ovatus, Phaedon cochleariae, Phyllotreta chrysocephala, Phyllophaga sp., Phyllopertha horticola, Phyllotreta nemorum, Phyllotreta striolata, Popillia japonica, Sltona lineatus and Sitophilus granaria.
Examples from the Diptera order are Aedes aegypti, Aedes vexans, Anastrepha ludens, Anopheles maculipennis, Ceratitis capitata, Chrysomya bezziana, Chrysomya hominivorax, Chrysomya macellaria, Contarinia sorghicola, Cordylobia anthropophaga, Culex pipiens, Dacus cucurbitae, oacus aleae, Dasineura brassicae, Fannia canicularis, Gasterophilus intestinalis, Glossia morsitans, Haematobia irritans, Haplodiplosis equestris, Hylemyia platura, Hypoderma lineata, Liriomyza sativae, Liriomyza trifolii, Lucilia caprina, Lucilia cuprina, Lucilia sericata, Lycoria pectoralis, Mayetiola destructor, Musca domestica, Muscina stabulans, Oestrus ovis, Oscinella frit, Pegomya hysocyami, Phorbia antiqua, Phorbia brassicae, Phorbia coarctata, Rhagoletis cerasi, Rhagoletis pomonella, Tabanus bovinus, Tipula oleracea and Tipula paludosa.
Examples from the Thysanoptera order are Frankliniella fusca, Frankliniella occidentalis, Frankliniella tritici, Scirtothrips citri, Thrips oryzae, Thrips palmi and Thrips tabaci.
Examples from the Hymenoptera order are Athalia rosae, Atta cephalotes, Atta sexdens, Atta texana, Hoplocampa minuta, Hoplocampa testudinea, Monomorium pharaonis, Solenopsis geminata and Solenopsis invicta.
Examples from the Heteroptera order are Acrosternum hilare, Blissus leucopterus, Cyrtopeltis notatus, Oysdercus cingulatus, Oysdercus intermedius, Eurygaster integriceps, Euchistus impictiventris, Leptoglossus phyllopus, Lygus lineolaris, Lygus pratensis, Nezara viridula, Piesma quadrata, Solubea insularis and Thyanta perditor.
Examples from the nematodes class are root-knot nematodes, e.g., Meloidogyne hapla, Meloidogyne incognita and Meloidogyne javanica, cyst-forming nematodes, e.g., Globodera rostochiensis, Heterodera avenae, Hetrodera glycinae, Heterodera schachtii and Heterodera trifolii, and stem and leaf eelworms, e.g., Belonolaimus longicaudatus, Ditylenchus destructor, Ditylenchus dipsaci, Heliocotylenchus multicinctus, Longidorus elongatus, Radopholus similis, Rotylenchus robustus, Trichodorus primitivus, Tylenchorhynchus claytoni, Tylenchorhynchus dubius, Pratylenchus neglectus, Pratylenchus penetrans, Pratylenchus curvitatus and Pratylenchus goodeyi.
When the active ingredients are used for combating pests, the concentrations in the finished formulations may vary over a wide range. Generally, the concentration is from 0.0001 to 10, and preferably from 0.001 to 0.1%.
The active ingredients may also be successfully used in the ultra-low-volume method (ULV), where it is possible to apply formulations containing more than 95 wt % of active ingredient, or even the active ingredient without any additives.
When the active ingredients are used for combating pests in the open, the application rates are from 0.01 to 10, and preferably from 0.1 to 1.0, kg/ha.
Potted bush beans which had developed the first pair of true leaves and were heavily infested with all stages of the spider mite Tetranychus telarius were sprayed to runoff in a spray cabinet with aqueous formulations of the active ingredients. The plants were placed on a rotating disc and sprayed from all sides with 50 ml of spray liquor. The plants were heavily infested with mites and numerous eggs had been laid on them. The action was assessed after 5 days by means of a binocular microscope. During this period, the plants were kept under normal greenhouse conditions.
Application rate | Mortality | |
Compound no. | in ppm | in % |
from Table I | ||
49 | 100 | 80 |
36 | 100 | 80 |
43 | 1000 | 100 |
429 | 1000 | 100 |
38 | 40 | 100 |
39 | 100 | 100 |
45 | 1000 | 100 |
582 | about 20 | 100 |
579 | 20 | 80 |
583 | 40 | 100 |
573 | 20 | 100 |
593 | 1000 | 80 |
592 | 40 | 100 |
704 | about 20 | 100 |
705 | 40 | 100 |
from Table II | ||
37 | 1000 | 100 |
39 | 1000 | 100 |
45 | 1000 | 100 |
Both the tops and bottoms of Petri dishes 10 cm in diameter were lined with a total of 1 ml of acetonic solutions of the active ingredients. After the solvent had evaporated (about 30 mins.), 10 files and absorbent cotton steeped in water were introduced into each dish and the dishes closed. The flies in supine position were counted after 24 hours.
If a kill rate of 80 to 100% occurs at a concentration of 0.01 mg/dish, the test is continued with falling concentrations.
Compound no. | Application rate | Mortality |
from Table I | in ppm | in % |
49 | 0.1 | 80 |
36 | 1.0 | 80 |
37 | 0.1 | 100 |
582 | 0.1 | 80 |
593 | 0.1 | 60 |
705 | 0.1 | 100 |
706 | 0.1 | 100 |
Young kohlrabi leaves are dipped for 3 seconds into aqueous solutions of the candidate compounds, and then placed on a round filter paper 9 cm in diameter which has been moistened with 0.5 ml of water. The filter paper is then placed in a Petri dish 10 cm in diameter. 10 caterpillars in the 4th larval stage are then placed on each leaf and the Petri dish is closed. Ingestion inhibition is determined in % after 48 hours.
Compound no. | Application rate | Mortality |
from Table I | in ppm | in % |
49 | 200 | 80 |
36 | 200 | 80 |
429 | 1000 | 80 |
16 | 400 | 80 |
582 | 400 | 100 |
593 | 1000 | 80 |
592 | 400 | 80 |
705 | 400 | 80 |
706 | 400 | 80 |
Leaves of potted vines of the “Müller Thurgau” variety were sprayed with aqueous liquors containing (dry basis) 80% of active ingredient and 20% of emulsifier. To assess the duration of action of the active ingredients, the plants were, after the sprayed-on layer had dried, set up in the greenhouse for 8 days. Only then were the leaves infected with a zoospore suspension of Plasmopara viticola. The vines were then placed for 48 hours in a water-vapor-saturated chamber at 24° C. and then for 5 days in a greenhouse at from 20° to 30° C. To accelerate the sporangiophore discharge, the plants were then again set up in the moist chamber for 16 hours. The extent to which the leaves had been attacked was then assessed.
The results show that active ingredients nos. 49, 429, 56, 14, 15, 16, 17, 582, 578, 573, 592, 571, 704, 705, 616, 117, 156, 579, 583, 593 and 706 from Table I, nos. 17, 644, 117, 429, 56, 43, 36, 49, 14, 15, 16, 582, 614 and 672 from Table II, and compound no. 1 from Table VII have, when applied as 0.025 wt % spray liquors a better fungicidal action (95%) than the prior art comparative agent A (50%).
Claims (14)
where
X is N—C1-C4alkoxy,
Y is O or NR5,
R1, R2 and R5 are H or C1-C4-alkyl,
Z1 and Z2 are identical or different and each is H, halogen, methyl, methoxy or cyano,
R3 and R4 are identical or different and each is hydrogen, cyano, straight-chain or branched C1-C10-alkyl, C1-C4-haloalkyl, C3-C6-cycloalkyl, C3-C6-halocycloalkyl, C3-C6-cycloalkyl-C1-C4-alkyl, C1-C4-alkoxy-C1-C4-alkyl, C1-C4-alkylthio-C1-C4-alkyl, arylthio-C1-C4-alkyl, C2-C6-alkenyl, C2-C5-haloalkenyl, C3-C6-cycloalkenyl, C3-C6-halocycloalkenyl, C2-C6-alkynyl, C1-C6-alkoxy, C1-C6-haloalkoxy, C1-C4-alkylthio, benzylthio, C1-C4-alkylcarbonyl, substituted or unsubstituted phenylcarbonyl, substituted or unsubstituted benzylcarbonyl, C1-C4-alkoxycarbonyl, substituted or unsubstituted phenoxycarbonyl, substituted or unsubstituted benzyloxycarbonyl, substituted or unsubstituted aryl, substituted or unsubstituted aryloxy, substituted or unsubstituted arylthio, substituted or unsubstituted aryl-C1-C4-alkyl, substituted or unsubstituted aryl-C2-C4-alkenyl, substituted or unsubstituted aryloxy-C1-C4-alkyl, or substituted or unsubstituted arylthio-C1-C4-alkyl,
N(R6)2, where the radicals R6 are identical or different and each is H, C1-C6-alkyl or substituted or unsubstituted phenyl,
—CO—N(R7)2, where the radicals R7 are identical or different and each is H or C1-C4-alkyl, substituted or unsubstituted meaning, in addition to hydrogen, the radicals halogen, cyano, nitro, C1-C4-alkyl, C1-C4-alkoxy, C1-C4-haloalkyl, C1-C4-haloalkoxy, C1-C10-alkoximino-C1-C2-alkyl, aryl, aryloxy, benzyloxy, or C3-C6-cycloalkyl, or
R3 and R4 together with the carbon atom to which they are attached form cyclopentyl, cyclohexyl, cycloheptyl, adamantyl, camphenyl, tetralyl, idanyl or fluorenyl, each of which may be substituted by the radicals stated above under substituted or unsubstituted, or
R3 and R4 may be halogen;
and “aryl”, alone or as part of another radical, is phenyl, naphthyl, or anthryl.
3. A compound of the formula I as set forth in claim 1 , wherein
X is NOCH3 or NOC2H5,
Y is 0,
R1 is C1-C4-alkyl,
R2 is H or C1-C2-alkyl,
R3 and R4 are identical or different and each is hydrogen, cyano, straight-chain or branched C1-C10-alkyl, C1-C4-haloalkyl, C3-C6-cycloalkyl, C3-C6-halocycloalkyl, C3-C6-cycloalkyl-C1-C4-alkyl, C1-C4-alkoxy-C1-C4-alkyl, C1-C6-alkylthio-C1-C4-alkyl, arylthio-C1-C4-alkyl, C2-C6-alkenyl, C2-C6-alkynyl, C2-C4-haloalkenyl, C1-C6-alkoxy, C1-C6-alkylthio, C1-C4-alkylcarbonyl, C1-C4-alkoxycarbonyl, substituted or unsubstituted aryl, substituted or unsubstituted aryloxy, substituted or unsubstituted arylthio, substituted or unsubstituted aryl-C1-C4-alkyl, or substituted or unsubstituted aryl-C2-C4-alkenyl,
N(R6)2, where R6 is identical or different and each is H, C1-C6-alkyl, C3-C6-cycloalkyl or substituted or unsubstituted phenyl,
CO—N(R7)2, where R7 is identical or different and each is H or C1-C4-alkyl; or
R3 and R4 together with the carbon atom to which they are attached form cyclopentyl, cyclohexyl, cycloheptyl, adamantyl, camphenyl, tetralyl, indanyl, or fluorenyl, each of which may be substituted by the radicals given under substituted or unsubstituted, or R3 or R4 may be halogen; Z1 and Z2 are each hydrogen;
and substituted or unsubstituted and aryl have the meanings given in claim 1 .
6. A compound of the formula I as set forth in claim 1 , wherein R1 is methyl, R2 is H, R3 is CN, R4 is cyclopropyl, X is N—OCH3, Y is O, and Z1 and Z2 are hydrogen.
7. A compound according to claim 1 , wherein Y is NR5.
8. A compound according to claim 7 10, wherein R1 is methyl, Z1, Z2, R2 and R5 are hydrogen, X is NOCH3, R3 is methyl, and R4 is 3,5-dichlorophenyl.
where
X is N—C1-C4-alkoxy,
Y is O,
R1 is C1-C4-alkyl,
R2, Z1 and Z2 are H,
R3 is hydrogen, methyl, ethyl, propyl or cyano,
R4 is hydrogen, cyano, straight-chain or branched C1-C10-alkyl, C1-C4-haloalkyl, C3-C6-cycloalkyl, C3-C6-halocycloalkyl, C3-C6-cycloalkyl-C1-C4-alkyl, C1-C4-alkoxy-C1-C4-alkyl, C1-C4-alkylthio-C1-C4-alkyl, arylthio-C1-C4-alkyl, C2-C6-alkenyl, C2-C5-haloalkenyl, C3-C6-cycloalkenyl, C3-C6-halocycloalkenyl, C2-C6-alkynyl, C1-C6-alkoxy, C1-C6-haloalkoxy, C1-C4-alkylthio, benzylthio, C1-C4-alkylcarbonyl, substituted or unsubstituted phenylcarbonyl, substituted or unsubstituted benzylcarbonyl, C1-C4-alkoxycarbonyl, substituted or unsubstituted phenoxycarbonyl, substituted or unsubstituted benzyloxycarbonyl, aryl substituted by C1-C10-alkoximino-C1-C2-alkyl, substituted or unsubstituted aryloxy, substituted or unsubstituted arylthio, substituted or unsubstituted aryl-C1-C4-alkyl, substituted or unsubstituted aryl-C2-C4-alkenyl, substituted or unsubstituted aryloxy-C1-C4-alkyl, or substituted or unsubstituted arylthio-C1-C4-alkyl, N(R6)2, where the radicals R6 are identical or different and each is H, C1-C6-alkyl or substituted or unsubstituted phenyl,
—CO—N(R7)2, where the radicals R7 are identical or different and each is H or C1-C4-alkyl, substituted or unsubstituted meaning, in addition to hydrogen, the radicals halogen, cyano, nitro, C1-C4-alkyl, C1-C4-alkoxy, C1-C4-haloalkyl, C1-C4-haloalkoxy, C1-C10-alkoximino-C1-C2-alkyl, aryl, aryloxy, benzyloxy, or C3-C6-cycloalkyl, or
R3 and R4 together with the carbon atom to which they are attached form cyclopentyl, cyclohexyl, cycloheptyl, adamantyl, camphenyl, tetralyl, indanyl or fluorenyl, each of which may be substituted by the radicals stated above under substituted or unsubstituted, or
R3 or R4 may be halogen,
and “aryl”, alone or as part of another radical, is phenyl, naphthyl, or anthryl.
where
X is N—C 1 -C 4-alkoxy
Y is NR 5,
R
1
, R
2
and R
5
are
H or C 1 -C 4-alkyl,
Z
1
and Z
2
are
identical or different and each is H, halogen, methyl, methoxy or cyano,
R
3
and R
4
are
identical or different and each is hydrogen, cyano,
straight-chain or branched C 1 -C 10-alkyl, C 1 -C 4-haloalkyl,
C 3 -C 6-cycloalkyl,
C 3 -C 6-halocycloalkyl,
C 3 -C 6-cycloalkyl-C 1 -C 4-alkyl,
C 1 -C 4-alkoxy-C 1 -C 4-alkyl,
C 1 -C 4-alkylthio-C 1 -C 4-alkyl, arylthio-C 1 -C 4-alkyl,
C 2 -C 6-alkenyl, C 2 -C 5-haloalkenyl,
C 3 -C 6-cycloalkenyl, C 3 -C 6-halocycloalkenyl,
C 2 -C 6-alkynyl, C 1 -C 6-alkoxy, C 1 -C 6-haloalkoxy,
C 1 -C 4-alkylthio, benzylthio,
C 1 -C 4-alkylcarbonyl substituted or unsubstituted phenylcarbonyl, substituted or unsubstituted benzylcarbonyl,
C 1 -C 4-alkoxycarbonyl, substituted or unsubstituted phenoxycarbonyl, substituted or unsubstituted benzyloxycarbonyl,
substituted or unsubstituted aryl, substituted or unsubstituted aryloxy, substituted or unsubstituted arylthio, substituted or unsubstituted aryl-C 1 -C 4-alkyl, substituted or unsubstituted aryl-C 2 -C 4-alkenyl, substituted or unsubstituted aryloxy-C 1 -C 4-alkyl, or substituted or unsubstituted arylthio-C 1 -C 4-alkyl, N(R 6)2 , where the radicals R 6 are identical or different and each is H, C 1 -C 6-alkyl or substituted or unsubstituted phenyl,
—CO—N(R 7)2 , where the radicals R 7 are identical or different and each is H or C 1 -C 4-alkyl, substituted or unsubstituted meaning, in addition to hydrogen, the radicals halogen, cyano, nitro, C 1 -C 4-alkyl, C 1 -C 4-alkoxy, C 1 -C 4-haloalkyl, C 1 -C 4-haloalkoxy, C 1 -C 10-alkoximino-C 1 -C 2-alkyl, aryl, aryloxy, benzyloxy, or C 3 -C 6-cycloalkyl, or
R
3
and R
4
together with the carbon atom to which they are attached form cyclopentyl, cyclohexyl, cycloheptyl, adamantyl, camphenyl, tetralyl, indanyl or fluorenyl, each of which may be substituted by the radicals stated above under substituted or unsubstituted or
R
3
or R
4
may be halogen;
and “aryl”, alone or as part of another radical, is phenyl, naphthyl, or anthryl.
11. The O-benzyloxime ether of claim 10 , wherein R 2 is hydrogen.
where
X is N—C
1
-C
4
alkoxy,
R 1 and R 5 are H or C 1 -C 4-alkyl,
Z
1
and Z
2
are identical or different and each is H, halogen, methyl, methoxy or cyano,
R
3
is cyano, and
R 4 is substituted or unsubstituted phenyl or naphthyl, and the substituents on the phenyl or naphthyl are halogen, cyano, nitro, C 1 -C 4-alkyl, C 1 -C 4-alkoxy, C 1 -C 4-haloalkyl, C 1 -C 4-haloalkoxy, C 1 -C 10-alkoximino-C 1 -C 2-alkyl, aryl, aryloxy, benzyloxy, or C 3 -C 6-cycloalkyl.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US08/627,377 USRE37839E1 (en) | 1990-06-27 | 1996-04-05 | O-benzyloxime ethers and crop protection agents containing these compounds |
Applications Claiming Priority (6)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE4020384 | 1990-06-27 | ||
DE4020388 | 1990-06-27 | ||
DE4020388A DE4020388A1 (en) | 1990-06-27 | 1990-06-27 | New N-phthaloyl-O-benzyl oxime ether cpds. - useful as plant fungicides and for control of wood-destroying fungi |
DE4020384A DE4020384A1 (en) | 1990-06-27 | 1990-06-27 | Fungicidal O-benzyl oxime ether derivs. - useful as insecticides and nematocides for protecting plants, materials and in veterinary and hygiene areas |
US07/722,209 US5194662A (en) | 1990-06-27 | 1991-06-27 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/627,377 USRE37839E1 (en) | 1990-06-27 | 1996-04-05 | O-benzyloxime ethers and crop protection agents containing these compounds |
Related Parent Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US07/722,209 Reissue US5194662A (en) | 1990-06-27 | 1991-06-27 | O-benzyloxime ethers and crop protection agents containing these compounds |
Publications (1)
Publication Number | Publication Date |
---|---|
USRE37839E1 true USRE37839E1 (en) | 2002-09-10 |
Family
ID=25894482
Family Applications (7)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US07/722,209 Ceased US5194662A (en) | 1990-06-27 | 1991-06-27 | O-benzyloxime ethers and crop protection agents containing these compounds |
US07/962,340 Expired - Fee Related US5292759A (en) | 1990-06-27 | 1992-10-15 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/165,413 Expired - Fee Related US5387607A (en) | 1990-06-27 | 1993-12-13 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/328,516 Expired - Fee Related US6316459B1 (en) | 1990-06-27 | 1994-10-25 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/490,895 Expired - Fee Related US5563168A (en) | 1990-06-27 | 1995-06-16 | O-Benzyloxime ethers and crop protection agents containing these compounds |
US08/627,377 Expired - Lifetime USRE37839E1 (en) | 1990-06-27 | 1996-04-05 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/630,091 Expired - Fee Related US6326399B1 (en) | 1990-06-27 | 1996-04-09 | O-benzyloxime ethers and crop protection agents containing these compounds |
Family Applications Before (5)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US07/722,209 Ceased US5194662A (en) | 1990-06-27 | 1991-06-27 | O-benzyloxime ethers and crop protection agents containing these compounds |
US07/962,340 Expired - Fee Related US5292759A (en) | 1990-06-27 | 1992-10-15 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/165,413 Expired - Fee Related US5387607A (en) | 1990-06-27 | 1993-12-13 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/328,516 Expired - Fee Related US6316459B1 (en) | 1990-06-27 | 1994-10-25 | O-benzyloxime ethers and crop protection agents containing these compounds |
US08/490,895 Expired - Fee Related US5563168A (en) | 1990-06-27 | 1995-06-16 | O-Benzyloxime ethers and crop protection agents containing these compounds |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US08/630,091 Expired - Fee Related US6326399B1 (en) | 1990-06-27 | 1996-04-09 | O-benzyloxime ethers and crop protection agents containing these compounds |
Country Status (16)
Country | Link |
---|---|
US (7) | US5194662A (en) |
EP (2) | EP0463488B2 (en) |
JP (1) | JP3009505B2 (en) |
KR (1) | KR100200466B1 (en) |
AT (2) | ATE170511T1 (en) |
AU (1) | AU652159B2 (en) |
CA (1) | CA2045725A1 (en) |
CZ (1) | CZ287402B6 (en) |
DE (2) | DE59108900D1 (en) |
DK (2) | DK0669319T3 (en) |
ES (2) | ES2110421T5 (en) |
GR (1) | GR3026148T3 (en) |
HU (1) | HU209642B (en) |
IL (1) | IL98626A (en) |
NZ (1) | NZ238714A (en) |
SK (1) | SK280842B6 (en) |
Families Citing this family (109)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE68928783T2 (en) * | 1988-11-21 | 1998-12-24 | Zeneca Ltd., London | Intermediate compounds for the production of fungicides |
PH11991042549B1 (en) * | 1990-06-05 | 2000-12-04 | ||
DK0669319T3 (en) * | 1990-06-27 | 1999-02-08 | Basf Ag | O-benzyloxymeters and plant protection products containing these compounds |
GB9018408D0 (en) * | 1990-08-22 | 1990-10-03 | Ici Plc | Fungicides |
AU1161992A (en) † | 1991-01-30 | 1992-09-07 | Zeneca Limited | Fungicides |
US6235887B1 (en) | 1991-11-26 | 2001-05-22 | Isis Pharmaceuticals, Inc. | Enhanced triple-helix and double-helix formation directed by oligonucleotides containing modified pyrimidines |
DE4206353A1 (en) * | 1992-02-29 | 1993-09-02 | Basf Ag | CYANOOXIMETHER, METHOD FOR THE PRODUCTION THEREOF, MEANS CONTAINING IT AND THE USE THEREOF |
IL105191A (en) * | 1992-04-04 | 1998-08-16 | Basf Ag | 0-Iminooxymethylbenzoic acids and their preparation |
DE4213149A1 (en) * | 1992-04-22 | 1993-10-28 | Hoechst Ag | Acaricidal, insecticidal and nematicidal substituted (hetero) aryl-alkyl-ketone oxime-O-ether, process for their preparation, compositions containing them and their use as pesticides |
IL105357A (en) * | 1992-04-30 | 1997-07-13 | Basf Ag | Benzyl enol ethers and benzyloxy carbocyclic and heterocyclic derivatives thereof and their use as crop protection agents |
ES2093327T3 (en) * | 1992-07-15 | 1996-12-16 | Basf Ag | SUBSTITUTED OXIMETERS, PROCEDURE FOR THEIR OBTAINING AND USE FOR THE FIGHT AGAINST PESTS AND FUNGI. |
JP3217191B2 (en) * | 1992-07-16 | 2001-10-09 | ビーエーエスエフ アクチェンゲゼルシャフト | Heteroaromatic compounds and plant protective agents containing the same |
DE59304268D1 (en) * | 1992-08-29 | 1996-11-28 | Basf Ag | N-methylamides, processes and intermediates for their manufacture and processes for controlling pests |
IL106786A (en) * | 1992-09-10 | 1997-02-18 | Basf Ag | Substituted pyridine derivatives and fungicidal compositions containing them |
JP2783130B2 (en) * | 1992-10-02 | 1998-08-06 | 三菱化学株式会社 | Methoxyiminoacetic acid derivatives and agricultural and horticultural fungicides containing the same as active ingredients |
GB9221526D0 (en) * | 1992-10-14 | 1992-11-25 | Ici Plc | Fungicides |
TW279845B (en) * | 1992-12-01 | 1996-07-01 | Ciba Geigy Ag | |
GB9226734D0 (en) * | 1992-12-22 | 1993-02-17 | Ici Plc | Fungicides |
GB9226865D0 (en) * | 1992-12-23 | 1993-02-17 | Ici Plc | Fungicides |
ES2108897T3 (en) * | 1993-03-19 | 1998-01-01 | Ube Industries | COMPOUND OF THE TYPE OXIMA ETER, PROCESSES FOR ITS PREPARATION AND FUNGICIDE CONTAINING SUCH COMPOUND. |
DE4310143A1 (en) * | 1993-03-29 | 1994-10-06 | Basf Ag | Imino-substituted phenylacetic acid amides, their preparation and fungicides containing them |
TW299310B (en) | 1993-05-18 | 1997-03-01 | Ciba Geigy Ag | |
IL109785A0 (en) * | 1993-06-03 | 1994-08-26 | Basf Ag | Azine-substituted phenylacetic acid derivatives and fungicidal compositions containing them |
EP0656352A1 (en) * | 1993-12-03 | 1995-06-07 | BASF Aktiengesellschaft | Thioimidates as agents against animal pests and pest fungi |
SK88096A3 (en) * | 1994-01-05 | 1996-12-04 | Ciba Geigy Ag | Pesticidal compounds, preparation method thereof and intermediate products at this method and pesticidal agents containing them |
US6008257A (en) * | 1994-01-28 | 1999-12-28 | Bayer Aktiengesellschaft | Hydroxamic-acid derivatives, method of preparing them and their use as fungicides |
DE4402533A1 (en) | 1994-01-28 | 1995-08-03 | Bayer Ag | Hydroxamic acid derivatives |
CN1143361A (en) * | 1994-02-04 | 1997-02-19 | 巴斯福股份公司 | Phenylthio acetic acid derivatives, process and intermediate products for their production and agents containing them |
ATE236119T1 (en) * | 1994-02-04 | 2003-04-15 | Basf Ag | PHENYLESACETIC ACID DERIVATIVES, PROCESSES AND INTERMEDIATE PRODUCTS FOR THE PRODUCTION THEREOF AND MATERIALS CONTAINING THEM |
NZ278587A (en) * | 1994-02-04 | 1998-08-26 | Basf Ag | Oxime-substituted phenylacetic acid derivatives; biocides |
DE4404373A1 (en) * | 1994-02-11 | 1995-08-17 | Bayer Ag | Substituted oxazacycloalkenes |
HU219195B (en) † | 1994-06-10 | 2001-03-28 | Basf Ag | Method of preparing alpha-methoxyiminocarboxylic acid methylamides |
ES2137411T3 (en) * | 1994-07-06 | 1999-12-16 | Basf Ag | DERIVATIVES OF PIRAZOLILO, ITS OBTAINING AND ITS EMPLOYMENT AS PESTICIDE AGENTS. |
DE4426940A1 (en) * | 1994-07-29 | 1996-02-01 | Bayer Ag | N-alkoxy amidine derivatives |
US5583249A (en) * | 1994-08-19 | 1996-12-10 | Ciba-Geigy Corporation | Pesticides |
PT779884E (en) * | 1994-09-09 | 2000-10-31 | Bayer Ag | IMMEDIATE DERIVATIVES AND THEIR USE AS PESTICIDES |
DE4442560A1 (en) * | 1994-11-30 | 1996-06-05 | Basf Ag | Iminooxybenzylcrotonic acid esters, process for their preparation and their use |
CN1182423A (en) * | 1995-02-24 | 1998-05-20 | 纳幕尔杜邦公司 | Fungicidal cyclic amides |
JPH093031A (en) * | 1995-04-17 | 1997-01-07 | Mitsubishi Chem Corp | Hydroxamic acid derivative and agricultural and horticultural disinfectant containing it |
US5635494A (en) * | 1995-04-21 | 1997-06-03 | Rohm And Haas Company | Dihydropyridazinones and pyridazinones and their use as fungicides and insecticides |
UA54395C2 (en) | 1995-06-16 | 2003-03-17 | Баєр Акціенгезельшафт | Phytobactericidal composition, a method of controlling and preventing plant diseases, a plant propagating material |
DE19523288A1 (en) * | 1995-06-27 | 1997-01-02 | Basf Ag | Iminooxybenzyl compounds, process for their preparation and their use |
US6054476A (en) * | 1995-10-18 | 2000-04-25 | Bayer Aktiengesellschaft | Iminoacetic acid amides and their use as pest control agents |
US5739140A (en) * | 1995-11-03 | 1998-04-14 | Monsanto Company | Selected novel aryl acrylics |
ES2173330T5 (en) * | 1995-11-29 | 2007-03-16 | Bayer Cropscience Ag | PROCEDURE FOR THE PREPARATION OF METOXYMINOPHENYLGLIOXYLIC ACID DERIVATIVES. |
WO1997020808A1 (en) * | 1995-12-07 | 1997-06-12 | Novartis Ag | Process for the preparation of pesticides |
JP2000501401A (en) | 1995-12-07 | 2000-02-08 | ノバルティス アクチェンゲゼルシャフト | Pesticide |
WO1997029093A1 (en) | 1996-02-05 | 1997-08-14 | Basf Aktiengesellschaft | Pyrimidine derivatives, process and intermediate products for their preparation and pesticides or fungicides containing these derivatives |
FR2754254B1 (en) * | 1996-10-09 | 1998-10-30 | Rhone Poulenc Agrochimie | FUNGICIDES WITH HYDROXIMIC AND HYDRAZONIC GROUPS |
AP1119A (en) * | 1996-12-13 | 2002-11-29 | Bayer Ag | A microbicide composition for plant protection. |
DE19710609A1 (en) * | 1997-03-14 | 1998-09-17 | Bayer Ag | Substituted aminosalicylic acid amides |
DE19711168A1 (en) | 1997-03-18 | 1998-09-24 | Basf Ag | Phenylketiminooxybenzyl compounds, process for their preparation and their use |
DE19716237A1 (en) | 1997-04-18 | 1998-10-22 | Basf Ag | Substituted benzyloxyimino compounds |
US6084120A (en) * | 1997-07-09 | 2000-07-04 | Hoffmann-La Roche Inc. | β-Alkoxyacrylates against malaria |
DE19732846A1 (en) | 1997-07-30 | 1999-02-04 | Basf Ag | Bisimino substituted phenyl compounds |
AU1407899A (en) * | 1997-12-01 | 1999-06-16 | E.I. Du Pont De Nemours And Company | Fungicidal cyclic amides |
EP0936213B1 (en) * | 1998-02-10 | 2003-03-26 | Dow AgroSciences LLC | Unsaturated oxime ethers and their use as fungicides and insecticides |
CN1062711C (en) * | 1998-02-10 | 2001-03-07 | 化工部沈阳化工研究院 | Pesticide and fungicide of unsaturated oximido ethers |
FR2777002A1 (en) * | 1998-04-07 | 1999-10-08 | Rhone Poulenc Agrochimie | New hydroximine or hydrazone derivatives, useful as fungicides for protecting plants and seeds |
FR2777003A1 (en) * | 1998-04-07 | 1999-10-01 | Rhone Poulenc Agrochimie | NEW FUNGICIDE COMPOUNDS |
AR029876A1 (en) * | 1998-05-11 | 2003-07-23 | Takeda Pharmaceutical | OXIIMINOALCANOYL ACID COMPOUND, PHARMACEUTICAL COMPOSITION AND AGENT TO CONTROL RETINOID-RELATED RECEPTORS THAT UNDERSTAND AND USE |
BR9910477A (en) | 1998-05-14 | 2001-01-02 | Basf Ag | Derived from bisoxy ether, process for the preparation of a compound, composition against pests of harmful animals or fungi, process for controlling pests of harmful animals or fungi, use of a cospo, and, compound |
US6313344B1 (en) | 1998-05-27 | 2001-11-06 | Bayer Aktiengesellschaft | Organic compounds |
GB9900963D0 (en) * | 1999-01-15 | 1999-03-10 | Novartis Ag | Organic compounds |
US6348627B1 (en) | 1999-01-27 | 2002-02-19 | Dow Agrosciences Llc | Aryl and heteroarylcyclopropyl oxime ethers and their use as fungicides |
US6063956A (en) * | 1999-01-27 | 2000-05-16 | Rohm And Haas Company | Aryl and heteroarylcyclopropyl oxime ethers and their use as fungicides and insecticides |
EP1265837B1 (en) | 1999-12-07 | 2004-06-09 | Basf Aktiengesellschaft | Method for producing o-chloromethyl benzoic acid chlorides |
US6303818B1 (en) * | 2000-08-08 | 2001-10-16 | Dow Agrosciences Llc | Unsaturated oxime ethers and their use as fungicides |
HU226907B1 (en) | 2001-08-20 | 2010-03-01 | Nippon Soda Co | Tetrazoyl oxime derivatives and fungicidal compositions containing thereof |
CN1179942C (en) * | 2002-09-13 | 2004-12-15 | 湖南化工研究院 | Sulfurous unsaturated oximinoethers with bactericidal activity and preparing process thereof |
DE50310332D1 (en) * | 2002-11-12 | 2008-09-25 | Basf Se | PROCESS FOR INCREASING INCREASE IN GLYPHOSATE RESISTANT LEGUMINOSES |
KR100624238B1 (en) | 2004-06-22 | 2006-09-19 | 한국화학연구원 | Pharmaceutical composition for prevention and treating of metabolic bone diseases containing alpha-arylmethoxyacrylate derivatives |
KR20080061408A (en) * | 2005-10-28 | 2008-07-02 | 바스프 에스이 | Method of inducing resistance to harmful fungi |
US7820010B2 (en) | 2005-12-15 | 2010-10-26 | Kimberly-Clark Worldwide, Inc. | Treated tissue products having increased strength |
US7879189B2 (en) | 2005-12-15 | 2011-02-01 | Kimberly-Clark Worldwide, Inc. | Additive compositions for treating various base sheets |
US8444811B2 (en) | 2005-12-15 | 2013-05-21 | Kimberly-Clark Worldwide, Inc. | Process for increasing the basis weight of sheet materials |
EA015354B1 (en) * | 2006-03-14 | 2011-06-30 | Басф Се | Method of inducing tolerance of plants against bacterioses |
EA015449B1 (en) | 2006-03-24 | 2011-08-30 | Басф Се | Method for combating phytopathogenic fungi |
EP2001555A1 (en) * | 2006-03-29 | 2008-12-17 | Basf Se | Use of strobilurins for treating malfunctions of the iron metabolism |
MX2009011456A (en) | 2007-04-23 | 2009-11-05 | Basf Se | Plant produtivity enhancement by combining chemical agents with transgenic modifications. |
WO2009003953A2 (en) * | 2007-06-29 | 2009-01-08 | Basf Se | Strobilurins for increasing the resistance of plants to abiotic stress |
CN101372470B (en) * | 2008-10-16 | 2013-05-15 | 国家农药创制工程技术研究中心 | Oxime ether methoxy acrylate compound having disinsection and sterilization activity |
US20120129696A1 (en) | 2009-07-28 | 2012-05-24 | Basf Se | Method for increasing the level of free amino acids in storage tissues of perennial plants |
CA2772814A1 (en) | 2009-09-25 | 2011-03-31 | Basf Se | Method for reducing pistillate flower abortion in plants |
WO2011125317A1 (en) * | 2010-04-02 | 2011-10-13 | クミアイ化学工業株式会社 | Triazole derivative and pest control agent |
JP6027465B2 (en) * | 2013-03-11 | 2016-11-16 | 東京エレクトロン株式会社 | Substrate processing apparatus and substrate processing method |
CN104725276B (en) * | 2013-12-18 | 2017-05-10 | 浙江省化工研究院有限公司 | Heptafluoroisopropyl-containing carbonyl oxime ether compound, preparation method and applications thereof |
CN109942461B (en) * | 2015-12-25 | 2020-12-01 | 沈阳中化农药化工研发有限公司 | Malononitrile oxime ether compound and its use |
CN106946770B (en) * | 2017-03-17 | 2020-05-05 | 中国农业大学 | High-activity imido phenylacetate compound and preparation method and application thereof |
JP2021176818A (en) * | 2018-07-31 | 2021-11-11 | 住友化学株式会社 | CONTROL METHOD FOR SOYBEAN RUST DISEASE FUNGUS HAVING RESISTANCE TO Qo INHIBITOR |
EP3903584A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iv |
EP3903582A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ii |
CN115460920A (en) | 2020-04-28 | 2022-12-09 | 巴斯夫欧洲公司 | Use of strobilurin-type compounds to control phytopathogenic fungi containing in the mitochondrial cytochrome b protein an amino acid substitution F129L conferring tolerance to Qo inhibitor II |
EP3903581A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors i |
AU2021266044A1 (en) | 2020-04-28 | 2022-11-24 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution F129L in the mitochondrial cytochrome b protein conferring resistance to Qo inhibitors IV |
WO2021219386A1 (en) | 2020-04-28 | 2021-11-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors i |
EP3903583A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iii |
JP2023527959A (en) | 2020-04-28 | 2023-07-03 | ビーエーエスエフ ソシエタス・ヨーロピア | Use of strobilurin-type compounds to combat phytopathogenic fungi containing the amino acid substitution F129L in the mitochondrial cytochrome b protein that confers resistance to the Qo inhibitor III |
AU2021288898A1 (en) | 2020-06-10 | 2023-01-19 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution F129L in the mitochondrial cytochrome b protein conferring resistance to Qo inhibitors V |
EP3945089A1 (en) | 2020-07-31 | 2022-02-02 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors v |
EP4178943A1 (en) * | 2020-07-08 | 2023-05-17 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors vi |
EP3939961A1 (en) | 2020-07-16 | 2022-01-19 | Basf Se | Strobilurin type compounds and their use for combating phytopathogenic fungi |
EP3970494A1 (en) | 2020-09-21 | 2022-03-23 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors viii |
BR112023002312A2 (en) | 2020-08-11 | 2023-03-21 | Basf Se | USE OF COMPOUNDS, METHODS TO COMBAT PHYTOPATHOGENIC FUNGI, COMPOUNDS, AGROCHEMICAL COMPOSITIONS AND USE OF AT LEAST ONE COMPOUND OF FORMULA I |
WO2023072671A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ix |
WO2023072670A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors x |
EP4242199A1 (en) | 2022-03-07 | 2023-09-13 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors xii |
EP4242198A1 (en) | 2022-03-07 | 2023-09-13 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors xiv |
EP4361126A1 (en) | 2022-10-24 | 2024-05-01 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors xv |
Citations (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0253213A1 (en) * | 1986-07-16 | 1988-01-20 | BASF Aktiengesellschaft | Oximethers and fungicides containing them |
EP0370629A1 (en) * | 1988-11-21 | 1990-05-30 | Zeneca Limited | Fungicides |
EP0414153A1 (en) * | 1989-08-22 | 1991-02-27 | Nihon Nohyaku Co., Ltd. | N-(substituted benzyloxy)imine derivatives, process for the production thereof, use thereof, and method of use thereof |
US5221691A (en) * | 1991-01-30 | 1993-06-22 | Imperial Chemical Industries Plc | Fungicides aromatic oxime amides |
US5238956A (en) * | 1990-08-22 | 1993-08-24 | Imperial Chemical Industries Plc | Fungicidal aromatic dioxime |
Family Cites Families (15)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CH120891A (en) * | 1926-07-22 | 1927-06-16 | Charles Heckman Henry | Internal combustion engine. |
CH189190A (en) * | 1936-05-11 | 1937-02-15 | Schmitz Freres & Co S A | Wristwatch box. |
DE3783503T2 (en) * | 1986-04-17 | 1993-05-13 | Ici Plc | PYRIDYL ACRYLIC ACID ESTER DERIVATIVES, METHOD FOR THE PRODUCTION THEREOF AND THEIR USE AS FUNGICIDES. |
GB8609455D0 (en) * | 1986-04-17 | 1986-05-21 | Ici Plc | Fungicides |
DE3615473A1 (en) * | 1986-05-07 | 1987-11-12 | Basf Ag | METHOD FOR PRODUCING O-SUBSTITUTED HYDROXYLAMINES |
GB8617648D0 (en) * | 1986-07-18 | 1986-08-28 | Ici Plc | Fungicides |
GB8629169D0 (en) * | 1986-12-05 | 1987-01-14 | Ici Plc | Chemical compounds |
JP2907540B2 (en) * | 1988-12-29 | 1999-06-21 | ノバルティス アクチエンゲゼルシャフト | Acrylic acid derivative |
US5228899A (en) * | 1989-08-25 | 1993-07-20 | Sumitomo Chemical Company Limited | Hydroxamic acid esters and plant growth regulation therewith |
EP0426460A1 (en) * | 1989-11-02 | 1991-05-08 | Ube Industries, Ltd. | Oxime ether derivative, preparation thereof and germicide containing the same |
PH11991042549B1 (en) * | 1990-06-05 | 2000-12-04 | ||
DK0669319T3 (en) * | 1990-06-27 | 1999-02-08 | Basf Ag | O-benzyloxymeters and plant protection products containing these compounds |
DE4020384A1 (en) * | 1990-06-27 | 1992-01-02 | Basf Ag | Fungicidal O-benzyl oxime ether derivs. - useful as insecticides and nematocides for protecting plants, materials and in veterinary and hygiene areas |
DE4117371A1 (en) * | 1991-05-28 | 1992-12-03 | Basf Ag | ANTIMYCOTIC AGENTS CONTAINING PHENYL ACIDSEED DERIVATIVES |
ES2173330T5 (en) * | 1995-11-29 | 2007-03-16 | Bayer Cropscience Ag | PROCEDURE FOR THE PREPARATION OF METOXYMINOPHENYLGLIOXYLIC ACID DERIVATIVES. |
-
1991
- 1991-06-13 DK DK95106324T patent/DK0669319T3/en active
- 1991-06-13 ES ES91109684T patent/ES2110421T5/en not_active Expired - Lifetime
- 1991-06-13 ES ES95106324T patent/ES2120100T3/en not_active Expired - Lifetime
- 1991-06-13 DE DE59108900T patent/DE59108900D1/en not_active Expired - Fee Related
- 1991-06-13 AT AT95106324T patent/ATE170511T1/en not_active IP Right Cessation
- 1991-06-13 DK DK91109684T patent/DK0463488T4/en active
- 1991-06-13 EP EP91109684A patent/EP0463488B2/en not_active Expired - Lifetime
- 1991-06-13 EP EP95106324A patent/EP0669319B1/en not_active Expired - Lifetime
- 1991-06-13 DE DE59109047T patent/DE59109047D1/en not_active Expired - Fee Related
- 1991-06-13 AT AT91109684T patent/ATE161007T1/en not_active IP Right Cessation
- 1991-06-26 KR KR1019910010704A patent/KR100200466B1/en not_active IP Right Cessation
- 1991-06-26 NZ NZ23871491A patent/NZ238714A/en unknown
- 1991-06-26 HU HU912143A patent/HU209642B/en not_active IP Right Cessation
- 1991-06-26 IL IL9862691A patent/IL98626A/en not_active IP Right Cessation
- 1991-06-26 CA CA002045725A patent/CA2045725A1/en not_active Abandoned
- 1991-06-26 AU AU79296/91A patent/AU652159B2/en not_active Ceased
- 1991-06-27 JP JP3156560A patent/JP3009505B2/en not_active Expired - Fee Related
- 1991-06-27 CZ CS19911966A patent/CZ287402B6/en not_active IP Right Cessation
- 1991-06-27 SK SK1966-91A patent/SK280842B6/en unknown
- 1991-06-27 US US07/722,209 patent/US5194662A/en not_active Ceased
-
1992
- 1992-10-15 US US07/962,340 patent/US5292759A/en not_active Expired - Fee Related
-
1993
- 1993-12-13 US US08/165,413 patent/US5387607A/en not_active Expired - Fee Related
-
1994
- 1994-10-25 US US08/328,516 patent/US6316459B1/en not_active Expired - Fee Related
-
1995
- 1995-06-16 US US08/490,895 patent/US5563168A/en not_active Expired - Fee Related
-
1996
- 1996-04-05 US US08/627,377 patent/USRE37839E1/en not_active Expired - Lifetime
- 1996-04-09 US US08/630,091 patent/US6326399B1/en not_active Expired - Fee Related
-
1998
- 1998-02-12 GR GR980400322T patent/GR3026148T3/en unknown
Patent Citations (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0253213A1 (en) * | 1986-07-16 | 1988-01-20 | BASF Aktiengesellschaft | Oximethers and fungicides containing them |
EP0370629A1 (en) * | 1988-11-21 | 1990-05-30 | Zeneca Limited | Fungicides |
EP0414153A1 (en) * | 1989-08-22 | 1991-02-27 | Nihon Nohyaku Co., Ltd. | N-(substituted benzyloxy)imine derivatives, process for the production thereof, use thereof, and method of use thereof |
US5238956A (en) * | 1990-08-22 | 1993-08-24 | Imperial Chemical Industries Plc | Fungicidal aromatic dioxime |
US5221691A (en) * | 1991-01-30 | 1993-06-22 | Imperial Chemical Industries Plc | Fungicides aromatic oxime amides |
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
USRE37839E1 (en) | O-benzyloxime ethers and crop protection agents containing these compounds | |
US5395854A (en) | Ortho-substituted phenylacetamides | |
US5556884A (en) | Substituted oxime ethers, their preparation and their use for controlling pests and fungi | |
CA2000362C (en) | Methyl .alpha.-arylacrylates substituted by a heterocyclic radical and their use | |
EP0422597B1 (en) | Derivatives of phenylacetic acid and fungicides containing them | |
US5294628A (en) | Methyl α-arylacrylates substituted by a heterocyclic radical and their use | |
CA1309411C (en) | 2-tert-butyl-5-isoxazolylmethylthio-3(2h)-pyridazin-3-one derivatives | |
US5286750A (en) | Phenylacetic acid derivatives and fungicides containing them | |
US5166216A (en) | Methyl α-arylacrylates substituted by a heterocyclic radical and their use | |
DE4020384A1 (en) | Fungicidal O-benzyl oxime ether derivs. - useful as insecticides and nematocides for protecting plants, materials and in veterinary and hygiene areas | |
AU632421B2 (en) | Ortho-substituted benzyl esters of cyclopropanecarboxylic acids |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FPAY | Fee payment |
Year of fee payment: 12 |