US3899525A - 9{86 ,15{86 -Dihydroxy-11{60 -hydroxymethylprost-13(trans)-enoic acid derivatives - Google Patents
9{86 ,15{86 -Dihydroxy-11{60 -hydroxymethylprost-13(trans)-enoic acid derivatives Download PDFInfo
- Publication number
- US3899525A US3899525A US392113A US39211373A US3899525A US 3899525 A US3899525 A US 3899525A US 392113 A US392113 A US 392113A US 39211373 A US39211373 A US 39211373A US 3899525 A US3899525 A US 3899525A
- Authority
- US
- United States
- Prior art keywords
- trans
- compound
- mixture
- solvent
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000002253 acid Substances 0.000 title claims description 59
- 150000001875 compounds Chemical class 0.000 claims abstract description 88
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 38
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 23
- 125000000217 alkyl group Chemical group 0.000 abstract description 21
- 239000003960 organic solvent Substances 0.000 abstract description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 15
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 abstract description 14
- 150000003839 salts Chemical class 0.000 abstract description 10
- 229910052987 metal hydride Inorganic materials 0.000 abstract description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract description 6
- XLKNMWIXNFVJRR-UHFFFAOYSA-N boron potassium Chemical compound [B].[K] XLKNMWIXNFVJRR-UHFFFAOYSA-N 0.000 abstract description 5
- 150000004681 metal hydrides Chemical class 0.000 abstract description 5
- 125000002947 alkylene group Chemical group 0.000 abstract description 3
- 239000002863 oxytocic agent Substances 0.000 abstract description 3
- NNOJWZIBHANBJD-OALUTQOASA-N 7-[(1S,2S)-2-octylcyclopentyl]hept-2-enoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCC=CC(O)=O NNOJWZIBHANBJD-OALUTQOASA-N 0.000 abstract description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 78
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 73
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 67
- 239000000203 mixture Substances 0.000 description 67
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 64
- 239000002904 solvent Substances 0.000 description 61
- 238000006243 chemical reaction Methods 0.000 description 56
- 239000011541 reaction mixture Substances 0.000 description 52
- 239000003921 oil Substances 0.000 description 48
- 235000019198 oils Nutrition 0.000 description 48
- -1 preferably Chemical group 0.000 description 40
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 37
- 239000000047 product Substances 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- 239000011780 sodium chloride Substances 0.000 description 32
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 30
- 229920006395 saturated elastomer Polymers 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- 239000007788 liquid Substances 0.000 description 29
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 239000000284 extract Substances 0.000 description 24
- 238000002360 preparation method Methods 0.000 description 23
- 238000004440 column chromatography Methods 0.000 description 22
- 229940093499 ethyl acetate Drugs 0.000 description 22
- 235000019439 ethyl acetate Nutrition 0.000 description 22
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- 239000000741 silica gel Substances 0.000 description 20
- 229910002027 silica gel Inorganic materials 0.000 description 20
- 238000001816 cooling Methods 0.000 description 17
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- 239000005457 ice water Substances 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 239000012300 argon atmosphere Substances 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 239000012298 atmosphere Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 150000001339 alkali metal compounds Chemical class 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 238000010992 reflux Methods 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- ORKBYCQJWQBPFG-WOMZHKBXSA-N (8r,9s,10r,13s,14s,17r)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one;(8r,9s,13s,14s,17r)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthrene-3,17-diol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.O=C1CC[C@@H]2[C@H]3CC[C@](CC)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 ORKBYCQJWQBPFG-WOMZHKBXSA-N 0.000 description 6
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 5
- QPMJENKZJUFOON-PLNGDYQASA-N ethyl (z)-3-chloro-2-cyano-4,4,4-trifluorobut-2-enoate Chemical compound CCOC(=O)C(\C#N)=C(/Cl)C(F)(F)F QPMJENKZJUFOON-PLNGDYQASA-N 0.000 description 5
- 239000001307 helium Substances 0.000 description 5
- 229910052734 helium Inorganic materials 0.000 description 5
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000005185 salting out Methods 0.000 description 4
- MZZGLPCJQGFUIN-UHFFFAOYSA-N 1-(tributyl-$l^{5}-phosphanylidene)heptan-2-one Chemical compound CCCCCC(=O)C=P(CCCC)(CCCC)CCCC MZZGLPCJQGFUIN-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000012027 Collins reagent Substances 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- JMAYFSUXBFDECX-UHFFFAOYSA-N [Cl].CS(C)=O Chemical compound [Cl].CS(C)=O JMAYFSUXBFDECX-UHFFFAOYSA-N 0.000 description 3
- PQFZWNNSXMOCAL-UHFFFAOYSA-N acetyl acetate;methylsulfinylmethane Chemical compound CS(C)=O.CC(=O)OC(C)=O PQFZWNNSXMOCAL-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- PPTSBERGOGHCHC-UHFFFAOYSA-N boron lithium Chemical compound [Li].[B] PPTSBERGOGHCHC-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- NPRDHMWYZHSAHR-UHFFFAOYSA-N pyridine;trioxochromium Chemical compound O=[Cr](=O)=O.C1=CC=NC=C1.C1=CC=NC=C1 NPRDHMWYZHSAHR-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 150000003180 prostaglandins Chemical class 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- KIEOKOFEPABQKJ-UHFFFAOYSA-N sodium dichromate Chemical compound [Na+].[Na+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KIEOKOFEPABQKJ-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- WQPPAPPXMKRLDU-UHFFFAOYSA-N 3,3-dimethyl-1-(tributyl-$l^{5}-phosphanylidene)heptan-2-one Chemical compound CCCCC(C)(C)C(=O)C=P(CCCC)(CCCC)CCCC WQPPAPPXMKRLDU-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical class CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- JLGWTGKOSOABRI-UHFFFAOYSA-N B.[Zn] Chemical compound B.[Zn] JLGWTGKOSOABRI-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical class NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AKNUHUCEWALCOI-UHFFFAOYSA-N N-ethyldiethanolamine Chemical compound OCCN(CC)CCO AKNUHUCEWALCOI-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical group OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- ICWUKOMBSCUNOJ-UWVGGRQHSA-N [(1R,2R)-2-(ethoxycarbonyloxymethyl)-4-oxocyclopentyl]methyl ethyl carbonate Chemical compound CCOC(=O)OC[C@@H]1CC(=O)C[C@H]1COC(=O)OCC ICWUKOMBSCUNOJ-UWVGGRQHSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- MCXATSDWYOWARH-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1.C1=CC=CC=C1 MCXATSDWYOWARH-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical compound C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910010277 boron hydride Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 210000003679 cervix uteri Anatomy 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- OAOPDYUHWPBJCW-UHFFFAOYSA-N cyanoboron;sodium Chemical compound [Na].[B]C#N OAOPDYUHWPBJCW-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 1
- ZUIMPJPRFBWGFW-UHFFFAOYSA-N cyclopentylmethyl ethyl carbonate Chemical compound CCOC(=O)OCC1CCCC1 ZUIMPJPRFBWGFW-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- NKRNGKIEDAVMHL-UHFFFAOYSA-L dihydroxy(dioxo)chromium;pyridine Chemical compound O[Cr](O)(=O)=O.C1=CC=NC=C1 NKRNGKIEDAVMHL-UHFFFAOYSA-L 0.000 description 1
- GMKJWKXCHOWVDN-UHFFFAOYSA-N dimethyl 4-oxocyclopentane-1,2-dicarboxylate Chemical compound COC(=O)C1CC(=O)CC1C(=O)OC GMKJWKXCHOWVDN-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- HTIBXQHVKAAGOQ-UHFFFAOYSA-N methyl 7-iodoheptanoate Chemical compound COC(=O)CCCCCCI HTIBXQHVKAAGOQ-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- AYOOGWWGECJQPI-NSHDSACASA-N n-[(1s)-1-(5-fluoropyrimidin-2-yl)ethyl]-3-(3-propan-2-yloxy-1h-pyrazol-5-yl)imidazo[4,5-b]pyridin-5-amine Chemical compound N1C(OC(C)C)=CC(N2C3=NC(N[C@@H](C)C=4N=CC(F)=CN=4)=CC=C3N=C2)=N1 AYOOGWWGECJQPI-NSHDSACASA-N 0.000 description 1
- HFMDLUQUEXNBOP-UHFFFAOYSA-N n-[4-amino-1-[[1-[[4-amino-1-oxo-1-[[6,9,18-tris(2-aminoethyl)-15-benzyl-3-(1-hydroxyethyl)-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl] Chemical compound OS(O)(=O)=O.N1C(=O)C(CCN)NC(=O)C(NC(=O)C(CCN)NC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)CCCCC(C)CC)CCNC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(CC(C)C)NC(=O)C1CC1=CC=CC=C1 HFMDLUQUEXNBOP-UHFFFAOYSA-N 0.000 description 1
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- XJINZNWPEQMMBV-UHFFFAOYSA-N n-methylhexan-1-amine Chemical compound CCCCCCNC XJINZNWPEQMMBV-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- JJPVWQWOOQYHCB-UHFFFAOYSA-N triethyl(phenyl)azanium Chemical class CC[N+](CC)(CC)C1=CC=CC=C1 JJPVWQWOOQYHCB-UHFFFAOYSA-N 0.000 description 1
- MDDPTCUZZASZIQ-UHFFFAOYSA-N tris[(2-methylpropan-2-yl)oxy]alumane Chemical compound [Al+3].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-] MDDPTCUZZASZIQ-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/72—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 spiro-condensed with carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Definitions
- ABSTRACT Prostenoic acid derivative having the formula wherein A represents an alkylene group having from 4 to 8 carbon atoms, R represents an alkyl group having from 4 to 10 carbon atoms, R represents hydrogen atom or an alkyl group having from one to 6 carbon atoms and R represents hydrogen atom or an alkoxycarbonyl group having from one to 6 carbon atoms in the alkyl moiety and pharmaceutically acceptable salts thereof.
- the compounds are useful as oxytocic agents and may be prepared by reducing the compound having the formula 3 R OH C wherein A, R, R and R have the meanings given above with a metal hydride complex, for example, sodium boron hydride and potassium boron hydride in the presence or absence of an inert organic solvent.
- a metal hydride complex for example, sodium boron hydride and potassium boron hydride in the presence or absence of an inert organic solvent.
- R may be a straight or branched alkyl group having from 4 to 10 carbon atoms, preferably, n-butyl, isobutyl, n-pentyl, isopentyl, l-methylpentyl, Z-methylpentyl, 1 l -dimethylpentyl, 1,2-dimethylpentyl, n-hexyl, isohexyl, l-methylhexyl, 1,1-dimethylhexyl, 1,2-dimethylhexyl, n-heptyl,
- R represents hydrogen atom or an alkyl group having from 1 to 6 carbon atoms and the alkyl group may be straight or branched, preferably, methyl, ethyl and n-propyl.
- R represents hydrogen atom or an alkoxycarbonyl group having from 1 to 6 carbon atoms, e.g., ethoxycarbonyl, npropoxycarbonyl and n-butoxycarbonyl.
- a preferred group of the prostaglandin derivatives provided by the invention are those of the formula (I) wherein A represents hexamethylene group, i.e., those having the formula wherein R, R and R are the same as above and the pharmaceutically acceptable salts thereof.
- a bond attached to the cyclopentane nucleus which is in the oz-configuration, i.e., extends below the plane of the cyclopentane ring, is represented by a dotted line
- a bond which is in the ,B-configuration, i.e., extends above the plane of the cyclopentane ring is represented by a solid line.
- the wavy line indicates that either steric configuration is possible.
- the pharmaceitucally acceptable salts of the acids of formulae (I) and (I-a) in which R is hydrogen atom include alkali and alkaline earth metal salts, e.g., the sodium, potassium, magnesium and calcium salts, quaternary ammonium salts, e.g., the ammonium, tetramethylammonium, tetraethylammonium, benzyltrimethylammonium and phenyltriethylammonium salts, aliphatic, alicyclic or aromatic amine salts, e.g., the methylamine, ethylamine, dimethylamine, diethylamine, trimethylamine, triethylamine, N-methylhexylamine, cyclopentylamine, dicyclohexylamine, benzylamine, dibenzylamine, a-phenylethylamine and ethylene diamine salts, heterocyclic amine salts, e.g.,
- the compounds of the invention are useful as oxytocic agents; and the invention provides pharmaceuticalcompositions comprising a compound of formula (I), or a pharmaceutically acceptable salts thereof, and a pharmaceutical carrier or diluent.
- the pharmaceutical compositions of the invention are generally formulated for parenteral administration.
- the compounds of formula (I) may be administered by continuous intravenous infusion, dissolved in sterile, pyrogen-free isotonic sodium chloride solution.
- the optimum dosage of the compounds of the invention will vary with the body weight and age of the patient; but the parenteral total daily dosage for full-term pregnant women will generally be from about 0.5 g. to
- the compound having the formula (I) may be prepared by reducing a compound having the formula wherein A, R R and R are the same as above with a metal hydride complex in the presence or absence of an inert organic solvent.
- the reduction maybe preferably carried out by contacting the compound (II), (III) or (IV) with the metal hydride complex in the presence of an inert organic solvent.
- the metal hydride complex include alkali metal boron hydrides, e.g., sodium boron hydride, potassium boron hydride, lithium boron hydride, sodium cyano boron hydride, lithium 9b-boro-perhydrophenalene hydride; alkali metal aluminum hydrides, e.g., aluminum tri-tert.-butoxylithium hydride, aluminum trimethoxylithium hydride; and zinc boron hydride.
- alkali metal boron hydrides e.g., sodium boron hydride, potassium boron hydride, lithium boron hydride, sodium cyano boron hydride, lithium 9b-boro-perhydrophenalene hydride
- alkali metal aluminum hydrides e.g., aluminum tri
- the inert organic solvent include alcohols, e.g., methanol and ethanol; ethers, e.g., diethyl ether, tetrahydrofuran, dioxane, diglyme; and dialkylformamides, e. g., dimethylformamide.
- the reduction is preferably carried out at relatively low temperatures, usually at a temperature from lOC. to room temperature.
- the reaction period will depend mainly upon the reaction temperature and a kind of the reducing agent. It is usually from about 30 minutes to 3 hours.
- the desired product may be recovered from the reaction mixture by conventional means.
- organic acids e.g., formic acid and acetic acid
- the reaction mixture is extracted with an organic solvent.
- the extract is washed with water and dried and the solvent is'distilled off to give the desired product.
- the product thus obtained may be further purified, if necessary, by conventional means, forv example, column chromatography or thin-layer chromatography.
- the compounds of the formula (I) and their salts can exist as four different optical isomers, depending up n the configuration of the hydroxy groups attached to the cyclopentane nucleusand the side-chain.
- the racemic mixtures of these isomers can be resolved by "16 con.- ventional techniques. so as to obtain the desir ucts in he form of optically pure diastereoisomers formulae (I) and (l-a') are used to represent both diastereoisomeric forms. as well as the racemic mixtures. but the pure isomers are included within the scope of the invention, as well as their mixtures.
- the hydroxyand carboxy-protecting group may be removed by conventional means, for example, by treating the compound (II), (III) or (IV) with an acid, e.g., acetic acid, hydrochloric acid or with a base, e.g., sodium hydroxide, sodium carbonate.
- an acid e.g., acetic acid, hydrochloric acid
- a base e.g., sodium hydroxide, sodium carbonate.
- R R R, R R and R are the same as above, R R R, R R and R may be the same or different and each represents an alkyl group having from 1 to 6 carbon atoms.
- Each of theabove steps may be illustrated as follows: i v
- the compound (VI) may be prepared by reacting the compound (V) with ethylene glycol in the presence of a Lewis acid, e.g., boron trifluoride.
- a Lewis acid e.g., boron trifluoride.
- the reaction is preferably carried out in an inert organic solvent such as dichloromethane, chloroform or benzene at a temperature ranging from 0C. to room temperature.
- the compound (VII) may be prepared by reacting the compound (VI) with an alkali metal compound, e.g., sodium methoxide, potassium ethoxide, sodium hydroxide.
- the reaction is preferably carried out in an inert organic solvent such as tetrahydrofuran, dioxane or methanol at a temperature ranging from OC.'to a reflux temperature of the reaction mixture.
- an inert organic solvent such as tetrahydrofuran, dioxane or methanol at a temperature ranging from OC.'to a reflux temperature of the reaction mixture.
- the bond of the group COOR is changed from B-configuration to a-con'figuration.
- the compound (VIII) may be prepared by reducing the compound (VII) with a metal hydride compound such as sodium boron hydride, potassium boron hydride, lithium boron hydride, trimethoxylithium aluminum hydride or aluminum, lithium hydride.
- a metal hydride compound such as sodium boron hydride, potassium boron hydride, lithium boron hydride, trimethoxylithium aluminum hydride or aluminum, lithium hydride.
- the reaction is preferably carried out in an inert organic solvent such as methanol, tetrahydrofuran or ether at a temperature ranging from 0C. to a reflux temperature of the reaction mixture.
- the compound (IX) or (XVI) may be prepared respectively by reacting the compound (VIII) or (XV) with a compound having the formula X COOR or X COOR wherein R and R are the same as above and X and X represent a halogen atom, e.g., chlorine, bromine, iodine in the presence of a base such as sodium carbonate, sodium' bicarbonate, triethylamine, pyridine or N-methylpiperazine.
- a base such as sodium carbonate, sodium' bicarbonate, triethylamine, pyridine or N-methylpiperazine.
- the reaction is preferably carried out below room temperature.
- the compound (X) may be prepared by reacting the compound (IX) with an acid such as formic acid, acetic acid, hydrochloric acid, hydrobromic acid or sufuric acid.
- the reaction is preferably carried out in a solvent such as water, methanol, ether or acetone at a temperature ranging from 0C. to 60C.
- the compound (XI) may be prepared by reacting the compound (X) with an alkali metal compound such as alkali metal alkoxides, e.g., sodium methoxide, potassium ethoxide, potassium tert.-butoxide; alkali metal hydrides, e.g., sodium hydride, potassium hydride; or alkali metal hydroxides, e.g., sodium hydroxide, potassium hydroxide.
- the reaction is preferably carried out in an inert organic solvent such as tetrahydrofuran, ether and benzene at a temperature ranging from -50C. to 80C. in an inert gas atmosphere, for example in argon or helium atmosphere.
- the compound (XII) may be prepared by reacting the compound (XI) with a compound having the formula X A COOR wherein A and R are the same as above and X represents a halogen atom, e.g., bromine, chlorine, in the presence of an alkali metal compound such as alkali metals, e.g., metallic sodium; alkali metal hydroxides, e.g., sodium hydroxide, potassium hydroxide; or alkali metal alkoxides, e.g., sodium methoxide, potassium ethoxide.
- the reaction is preferably carried out in an inert organic solvent, e.g., benzene, ether, tetrahydrofuran, dimethyl sulfoxide, below room temperature in an inert gas atmosphere, for example in argon or helium atmosphere.
- the compound (XIII) may be prepared by reacting the compound (XII) with an alkali metal compound such as sodium hydroxide, potassium hydroxide, so-
- the reaction is preferably carried out in a solvent, e.g., water, methanol, ether, dioxane, a mixture of water and such an organic solvent, at a temperature ranging from room temperature to reflux temperature of the reaction mixture in an inert gas atmosphere, for example, in an argon or helium atmosphere.
- a solvent e.g., water, methanol, ether, dioxane, a mixture of water and such an organic solvent
- the compound (XIV) may be prepared by contacting the compound (XIII) with an oxidizing agent such as chromic acid, chromic anhydride, chromic anhydride-pyridine complex, sodium bichromate dimethyl sulfoxide-chlorine complex, dimethyl sulfoxide-acetic anhydride.
- an oxidizing agent such as chromic acid, chromic anhydride, chromic anhydride-pyridine complex, sodium bichromate dimethyl sulfoxide-chlorine complex, dimethyl sulfoxide-acetic anhydride.
- the reaction is preferably carried out in a solvent such as acetic acid, dichloromethane and chloroform at a temperature ranging from 0C. to room temperature.
- the compound (XV) may be prepared by contacting the compound (XIV) with an acid such as formic acid, acetic acid, hydrochloric acid or sulfric acid, or with an alkali metal compound such as sodium hydroxide, potassium hydroxide or sodium carbonate.
- an acid such as formic acid, acetic acid, hydrochloric acid or sulfric acid
- an alkali metal compound such as sodium hydroxide, potassium hydroxide or sodium carbonate.
- the reaction is preferably carried out in a solvent, e.g., water, methanol, ether at a temperature ranging from room temperature to reflux temperature of the reaction mixture.
- the compound (XVII) may be prepared by reacting the compound (XV) with an alcohol, e.g., diazomethane and diazoethane.
- the compound (II) may be prepared by reacting the compound (XIV), (XV), (XVI) or (XVII) with a Wittig reagent having the formula wherein R is the same as above and R represents an alkyl group having'from l to 6 carbon atoms or phenyl group. At least I mole of the Wittig reagent is used per mole of the compound (XIV), (XV), (XVI) or (XVII) and preferably from 2 to 10 moles of the Wittig agent is used.
- the reaction is generally carried out in an inert organic solvent such as ether, benzene, toluene, hexane, dimethyl sulfoxide, tetrahydrofuran, methylene chloride or chloroform, at a temperature ranging from O C. to a reflux temperature of the reaction mixture, preferably at room temperature or below and in an inert gas atmosphere, for example, in an argon or helium atmosphere.
- the reaction is carried out for a period of Shows to 30 hours depending on the temperature and concentration of the reaction mixture and the specific Wittig reagent used.
- the product obtained in each step of the above process may be recovered from the reaction mixture in a conventional manner, for example, by evaporating the solvent from the reaction mixture or by adding water and extracting with a water-immiscible solvent.
- the crude product can be purified by conventional means such as recrystallization or chromatography.
- the compound (XVII) may be prepared by reacting the compound (XIII) with ethylene glycol in the presence of a Lewis acid, e.g., boron trifluoride.
- a Lewis acid e.g., boron trifluoride.
- the reaction is preferably carried out in an inert organic solvent such as dichloromethane, chloroform or benzene at a temperature ranging from 0C. to room temperature.
- the compound (XIX) may be prepared by contacting the compound (XVIII) with an oxidizing agent such as chromic acid, chromic anhydride, chromic anhydride-pyridine complex, sodium bichromate, dimethyl sulfoxide-chlorine complex, dimethyl sulfoxide-acetic anhydride.
- an oxidizing agent such as chromic acid, chromic anhydride, chromic anhydride-pyridine complex, sodium bichromate, dimethyl sulfoxide-chlorine complex, dimethyl sulfoxide-acetic anhydride.
- the reaction is preferably carried out in a solvent such as acetic acid, dichloromethane, chloro- 60 perature of the reaction mixture.
- the compound (XXI) may be prepared by reacting the compound (XIX) or (XX) with a Wittig reagent having the formula wherein R is the same as above and R represents an alkyl group having from 1 to 6 carbon atoms or phenyl group. At least 1 mole of the Wittig reagent is used per mole of the compound (XIX) or (XX) and preferably from 2 to 10 moles of the Wittig agent is used.
- the reaction is generally carried out in an inert organic solvent such as ether, benzene, toluene, hexane, dimethyl sulfoxide, tetrahydrofuran, methylene chloride or chloroform, at a temperature ranging from 0C.
- reaction mixture preferably at room temperature or below and in an inert gas atmosphere, for example, in an argon or helium atmosphere.
- the reaction is carried out for a period of'5 hours to 3O or dimethylforrnamide, at relatively low temperatures,
- room I group usually at a temperature ranging from -l0C. to room I group may be prepared by reacting the compound hours depending on the temperature andconcentrati'on of the reaction mixture and the specific Wittig reagent used.
- the compound (XXII) may be prepared by reducing The reaction is preferably carried out in an inert organic solvent such'a's methanol, ethanol, ether, dioxane (XXII) with an acid and reacting the product thus obtained with a compound having the formula X COOR
- the compound (XXIII) may be prepared by reacting the compound (XIII) with dihydropyran in the presence of a mineral acid, e.g., hydrochloric acid, hydrobromic acid or an organic acid, e.g., p-toluenesulfonic acid.
- a mineral acid e.g., hydrochloric acid, hydrobromic acid or an organic acid, e.g., p-toluenesulfonic acid.
- the reaction is preferably carried out in an inert organic solvent such as benzene, toluene or chloroform at a temperature ranging from C. to room temperature.
- the compound (XXIV) may be prepared by reducing the compound (XXIII) with a metal hydride compound such as sodium boron hydride, potassium boron hydride, lithium boron hydride, trimethoxylithium aluminum hydride and aluminum lithium hydride.
- a metal hydride compound such as sodium boron hydride, potassium boron hydride, lithium boron hydride, trimethoxylithium aluminum hydride and aluminum lithium hydride.
- the reaction is preferably carried out in an inert organic solvent such as methanol, tetrahydrofuran or ether at a temperature ranging from 0C. to a reflux temperature of the reaction mixture.
- the compound (XXV) may be prepared by contacting the compound (XXIV) with a halide or anhydride of an alkanoic acid or benzoic acid, e.g., acetic anhydride, acetyl chloride, benzoic anhydride, benzoyl chloride.
- a halide or anhydride of an alkanoic acid or benzoic acid e.g., acetic anhydride, acetyl chloride, benzoic anhydride, benzoyl chloride.
- the compound (XXVI) may be prepared by contacting the compound (XXV) with a dilute acid solution, for example, a dilute solution of acetic acid, hydrochloric acid or sulfuric acid.
- a dilute acid solution for example, a dilute solution of acetic acid, hydrochloric acid or sulfuric acid.
- the compound (XXVII) may be prepared by contacting the compound (XXVI) with an oxidizing agent, e.g., chromic acid, dimethyl sulfoxide-chlorine complex, dimethylsulfoxide-acetic anhydride, N- bromoacetamide and aluminum tert.-butoxide.
- an oxidizing agent e.g., chromic acid, dimethyl sulfoxide-chlorine complex, dimethylsulfoxide-acetic anhydride, N- bromoacetamide and aluminum tert.-butoxide.
- the reaction is carried out at a temperature ranging 20C. to room temperature in a solvent, e.g., benzene, acetic acid, dichloromethane and aqueous tert.-butanol.
- the compound (XXVIII) may be prepared by reacting the compound (XXVII) with a Witting reagent having the formula (R P CH CO R wherein R is the same as above and R represents an alkyl group from I to 6 carbon atoms or phenyl group. At least 1 mole of the Wittig reagent is used per mole of the compound (XXVII) and preferably from 2 to 10 moles of the Wittig agent is used.
- the compound (IV) in which R is an alkyl group and R is hydrogen atom may be prepared by contacting the compound (XXVIII) withan acid such as formic acid, acetic acid. hydrochloric acid or sulfuric acid or with an alkali metal compound such as sodium hydroxide, potassium hydroxide or sodium carbonate.
- an acid such as formic acid, acetic acid. hydrochloric acid or sulfuric acid or with an alkali metal compound such as sodium hydroxide, potassium hydroxide or sodium carbonate.
- the compound (IV) in which R and R are hydrogen atom may be prepared by reacting the compound (XXVIII) with an alkali metal compound such as sodium hydroxide, potassium hydroxide or sodium carbonate.
- an alkali metal compound such as sodium hydroxide, potassium hydroxide or sodium carbonate.
- the compound (IV) in which R is hydrogen atom and R is alkoxycarbonyl group may be prepared by reacting the compound (XXVIII) with an alkali metal compound and reacting the product thus obtained with a compound having the formula x cooR wherein X represents a halogen atom, e.g., chlorine, bromine, iodine and R represents an alkyl group having from 1 to 6 carbon atoms in the presence of an alkali metal compound such as sodium carbonate, sodium bicarbonate.
- X represents a halogen atom, e.g., chlorine, bromine, iodine
- R represents an alkyl group having from 1 to 6 carbon atoms in the presence of an alkali metal compound such as sodium carbonate, sodium bicarbonate.
- the product obtained in each step of the above process may be recovered from the reaction mixture in a conventional means, for example, by evaporating the solvent from the reaction mixture or by adding water and extracting with a water immiscible solvent.
- the crude product can be purified by conventional means such as recrystallization or chromatography.
- Preparations l and 2 illustrate the preparation of the compound (II).
- Preparations 3 and 5 illustrate the preparation of the compound (III).
- Preparation 4 illustrates the preparation of the compound (IV).
- Examples 1 and 2 illustrate the preparation of the compound (I) from the compound (II).
- Example 3, 4, 6 and 7 illustrate the preparation of the compound (I) from the compound (III).
- Example 5 illustrates the preparation of the compound (I) from the compound (IV).
- the re action mixture was added dropwise to 1.5 l. of a saturated aqueous sodium bicarbonate containing pieces of ice in order to decompose the excess of the boron trifluoride etherate.
- the mixture was extracted three times with l l. of ether.
- the extract was washedwith a saturated aqueous sodium chloride and a saturated aqueous sodium bicarbonate and dried over anhydrous sodium sulfate.
- the solvent was distilled off from the extract to give 135.7 g. of the desired product as colorless oil.
- the ether was separated from the reaction mixture by decantation.
- the aqueous layer was extracted with ether and further subjected to evaporation under reduced pressure.
- the residue was extracted with absolute ethanol. All of the extract were combined and dried over anhydrous sodium sulfate.
- the solvent was distilled off to give 68.4 g. of the desired product as pale yellow oil.
- the solvent was distilled off from the reaction mixture under reduced pressure to give 2.52 g. of oil.
- the oil was subjected to column chromatography using 20 g. of silica gel and eluted successively with n-hexane-nhexane-benzene (5:1 The eluates were collected and the solvent was distilled to give 1.52 g. of the desired product as oil.
- the solvent was distilled off to give 2.3 g of pale yellow oils.
- the oils were subjected to column chromatography using 12.5 g. of silica gel and eluted some amounts of n-hexane and next successively with n-hexane-benzene 2:l-1 :1 (2: 1-1 :1 were collected and the solvent was distilled to give 1.25 g. of the desired product as oil.
- the eluates with benzeneethyl acetate (3:2) were collected and the solvent was distilled off to give 150 mg. of the mixture of 9-oxo- 1 1 a-hydroxymethyl- 1 SB-hydroxyprost- 1 3(trans)-enoic acid and 9-oxo-1 1a-hydroxymethyl-15a-hydroxyprost- 13(trans)-enoic acid.
- the eluates with benzene-ethyl acetate (1:1) were collected and the solvent was distilled off to give 108 mg. of 9-oxo-1 loz-hydroxymethyl- ISa-hydroxyprost-l3(trans)-enoic acid.
- PREPARATION 4 Preparation of methyl 9 ⁇ -hydroxy-l la-hydroxymethyl-15-oxoprost-l3(trans)- enoate (1V) 1 1-Oxo-2oz-methoxycarbonylhexyl-3 ,8- tetrahydropyranyloxymethyl-4aethoxycarbonyloxymethylcyclopentane (XXlll) To 3.584 g. of 1-oxo-2a-methoxycarbonylhexyl-3B- hydroxymethyl-4a-ethoxycarbonyloxymethylcyclopentane in 50 ml. of dry benzene were added 1.68 g. of dihydropyran and 15 mg.
- the product thus obtained was acetylated with 10 ml. of acetic anhydride in 50 ml. of dry pyridine at room temperature to give 4.82 g. of oil.
- the oil was subjected to column chromatography using 40 g. of silica gel and eluted with n-hexane-benzene (1:8)-benzene to give 4.01 g. of 1-acetoxy-Za-methoxycarbonylhexyl-3B- tetrahydropyranyloxymethyl-4aethoxycarbonyloxymethylcyclopentane.
- hydroxymethyl-4a-ethoxycarbonyloxymethylcyclopentane (XXVI) In a mixture of 40 m1. of acetic acid, 40 ml. of water and 6 ml. of tetrahydrofuran was dissolved 4.00 g. of 1f-acetoxy-2a-methoxycarbonylhexyl-3B- tetrahydropyranyloxymethyl-4w ethoxycarbonyloxymethylcyclopentane and the solution was stirred for 4.5 hours at 45C.
- the reaction mixture was poured into ice water and extracted with ethyl acetate, washed with a saturated aqueous sodium chloride, dried over anhydrous sodium sulfate and the solvent was distilled off to give 3.86 g. of oil.
- the oil was subjected to column chromatography using 30 g. of silica gel and eluted with benzene-ethyl acetate (99:1 )-(90:l0) to give 3.01 g. of the desired product.
- the product was reacted with diazomethane in acetic anhydride to give 810 mg. of oil.
- the oil was subjected to column chromatography using 8.0 g. of silica gel and eluted with benzene ethyl acetate (85:15) to give 351 mg. of methyl 9ahydroxy-l la-hydroxymethyl-l5-oxopr0st- 13(trans)enoate and with benzene ethyl acetate (60:40) to give 307 mg. of methyl 9a-hydroxy-11ahydroxymethyll 5-oxoprostl 3(trans)-enoate.
- the extract was dried over anhydrous sodium sulfate and the solvent was distilled off.
- the residue was subjected to column chromatography using 20 g. of silica gel and eluted with -20% ethyl acetate in benzene to give 1.8 g. ofthe desired product.
- EXAMPLE 1 l 5-Dihydroxy-1 la-hydroxymethylprost- 1 3(trans enoic acid To a solution of 170 mg. of 9,15-diox o-l 1ahydroxymethylprost-l3(trans)-enoic acid in 8 of ethanol was added 70 mg. of sodium boron hydride in 4 ml. of ethanol under ice cooling and the mixture was stirred for 2 hours. After completion of the reaction, the pH of the reaction mixture was adjusted to 3.5-4.0 by addition of acetic acid at 0C.
- Mass spectram M 370 Using the above procedure, but replacing methyl 9a, 1 Sa-dihydroxy- 1 1 a-hydroxymethylprostl 3 (trans- )enoate by methyl 9oz, ISa-dihydroxy- 1 1ahydroxymethylprost-l3(trans)-enoate, there was ob tained 9,8. ISa-dihydroxy-l la-hydroxymethylprostl3(trans)enoic acid.
- EXAMPLE 4 9oz( and ,8), 1 5 ,B-Dihydroxy-l la-hydroxymethylprost- 1 3(trans)- enoic acid 1.
- Methyl 9a(and B) ISB-dihydroxy-l 1ahydroxymethylprost- 1 3( trans)-enoate
- 109 mg. of sodium boron hydride under ice cooling and the mixture was stirred for 1 hour in ice bath.
- the mixture was diluted with a cooled 2% aqueous hydrochloric acid and subjected to salting out by addition of sodium chloride.
- the mixture was extracted three times with ml. of ethyl acetate.
- the organic layer was washed two times with saturated aqueous sodium chloride and dried over anhydrous sodium sulfate.
- the solvent was distilled off to give 1.09 g. of methyl 95, ISB-dihydroxy-l la'hydroxymethylprost-l3(trans)-enoate as oil.
- the oil was subjected to column chromatography using 30 g. of silica gel and 4.10 (2H, multiplet.
- thylprost-l3(trans)-enoic acid To a solution of 350 mg. of 9-oi o-l lahydroxymethyll Sa-hydroxy-l 6,1 6-dimethylprost' l3(trans)-enoic acid in. ml. of methanol was added 100 mg. of sodium boron hydrideunder ice cooling and the mixture was stirred for 30 minutes. After completion of the reaction, the reaction mixture was made acidic by addition of acetic acid. The mixture was extracted with ethyl acetate and the solvent was distilled off. The residuewas subjected to column chromatography using 10 g. of silica gel and eluted with ethyl acetate-benzene 1:1) to give 1 mg.
- EXAMPLE 7 9a( and B),l5 .-D ihydroxy-l l a-hydroxymethyll 6, 1 6-dimethylprostl3(trans)-enoic acid sin-
- a solution of 295 mg. of ,9-oxo-l lahydroxymethybl SB-hydroxy-l 6, 1 6-dimethylprostl3(trans)enoic acid in 10 ml. of methanol was added 1 l5 mg.,of sodium'boron hydride under ice cooling and the mixture was stirred for minutes. After completion of the reaction, the reaction mixture was treated in the same procedure as in Example 3 to give 85 g.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Pyrane Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP47088171A JPS5146113B2 (fr) | 1972-09-01 | 1972-09-01 |
Publications (1)
Publication Number | Publication Date |
---|---|
US3899525A true US3899525A (en) | 1975-08-12 |
Family
ID=13935457
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US392113A Expired - Lifetime US3899525A (en) | 1972-09-01 | 1973-08-27 | 9{86 ,15{86 -Dihydroxy-11{60 -hydroxymethylprost-13(trans)-enoic acid derivatives |
Country Status (8)
Country | Link |
---|---|
US (1) | US3899525A (fr) |
JP (1) | JPS5146113B2 (fr) |
BE (1) | BE804342A (fr) |
CH (1) | CH578495A5 (fr) |
DE (1) | DE2344058A1 (fr) |
FR (1) | FR2197591B1 (fr) |
GB (1) | GB1410853A (fr) |
NL (1) | NL7312143A (fr) |
Cited By (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3991083A (en) * | 1974-01-23 | 1976-11-09 | Merck & Co., Inc. | 2α-(2-Loweralkanoyloxy-2-carboxyvinyl)-3β-hydroxy-5-oxo-1β-c |
US3992412A (en) * | 1974-01-23 | 1976-11-16 | Merck & Co., Inc. | 2α-(2-Carboxy-2-oxoethyl)-3β-hydroxy-5-oxo-1β-cyclopentaneheptanoic acid and process |
US3992411A (en) * | 1974-01-23 | 1976-11-16 | Merck & Co., Inc. | 2α-Formyl-3β-[(methoxalyl)oxy]-5-oxo-1β-cyclopentaneheptanoic acid and process |
US3996263A (en) * | 1975-05-05 | 1976-12-07 | Sankyo Company Limited | 9-Oxo-11α-methyl-15Ε-hyroxyprost-13(trans)-enoic acid derivatives and process for the preparaion thereof |
US3998849A (en) * | 1974-01-23 | 1976-12-21 | Merck & Co., Inc. | 2α-(2-Carboxy-2-formylethyl)-3β-hydroxy-5-oxo-β-cyclopentaneheptanoic acid and process |
US4005106A (en) * | 1974-01-23 | 1977-01-25 | Merck & Co., Inc. | 3β-[(Methoxalyl)oxy]-2α-(3-oxo-1-octenyl)-5-oxo-1β-cyclopentaneheptanoic acid and process |
Families Citing this family (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
SE384853B (sv) * | 1972-04-04 | 1976-05-24 | Haessle Ab | Forfarande for framstellning av nya aminer |
US3931282A (en) * | 1974-02-21 | 1976-01-06 | Syntex (U.S.A.) Inc. | 11α-Hydroxymethyl prostaglandins |
Citations (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3455992A (en) * | 1966-05-10 | 1969-07-15 | American Home Prod | Process for preparing 11-desoxyprostaglandin and homologs thereof |
-
1972
- 1972-09-01 JP JP47088171A patent/JPS5146113B2/ja not_active Expired
-
1973
- 1973-08-24 GB GB4017573A patent/GB1410853A/en not_active Expired
- 1973-08-27 US US392113A patent/US3899525A/en not_active Expired - Lifetime
- 1973-08-28 FR FR7331132A patent/FR2197591B1/fr not_active Expired
- 1973-08-31 DE DE19732344058 patent/DE2344058A1/de active Pending
- 1973-08-31 BE BE135225A patent/BE804342A/fr unknown
- 1973-08-31 CH CH1254173A patent/CH578495A5/xx not_active IP Right Cessation
- 1973-09-03 NL NL7312143A patent/NL7312143A/xx unknown
Patent Citations (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3455992A (en) * | 1966-05-10 | 1969-07-15 | American Home Prod | Process for preparing 11-desoxyprostaglandin and homologs thereof |
Cited By (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3991083A (en) * | 1974-01-23 | 1976-11-09 | Merck & Co., Inc. | 2α-(2-Loweralkanoyloxy-2-carboxyvinyl)-3β-hydroxy-5-oxo-1β-c |
US3992412A (en) * | 1974-01-23 | 1976-11-16 | Merck & Co., Inc. | 2α-(2-Carboxy-2-oxoethyl)-3β-hydroxy-5-oxo-1β-cyclopentaneheptanoic acid and process |
US3992411A (en) * | 1974-01-23 | 1976-11-16 | Merck & Co., Inc. | 2α-Formyl-3β-[(methoxalyl)oxy]-5-oxo-1β-cyclopentaneheptanoic acid and process |
US3998849A (en) * | 1974-01-23 | 1976-12-21 | Merck & Co., Inc. | 2α-(2-Carboxy-2-formylethyl)-3β-hydroxy-5-oxo-β-cyclopentaneheptanoic acid and process |
US4005106A (en) * | 1974-01-23 | 1977-01-25 | Merck & Co., Inc. | 3β-[(Methoxalyl)oxy]-2α-(3-oxo-1-octenyl)-5-oxo-1β-cyclopentaneheptanoic acid and process |
US3996263A (en) * | 1975-05-05 | 1976-12-07 | Sankyo Company Limited | 9-Oxo-11α-methyl-15Ε-hyroxyprost-13(trans)-enoic acid derivatives and process for the preparaion thereof |
Also Published As
Publication number | Publication date |
---|---|
CH578495A5 (fr) | 1976-08-13 |
FR2197591A1 (fr) | 1974-03-29 |
BE804342A (fr) | 1974-02-28 |
NL7312143A (fr) | 1974-03-05 |
DE2344058A1 (de) | 1974-03-07 |
JPS5146113B2 (fr) | 1976-12-07 |
JPS4943947A (fr) | 1974-04-25 |
FR2197591B1 (fr) | 1976-12-24 |
GB1410853A (en) | 1975-10-22 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4322435A (en) | Prostacyclin compounds | |
US4668814A (en) | Interphenylene carbacyclin derivatives | |
US3880883A (en) | 2-(Hydroxyalkyl)-cyclopentane carbaldehydes | |
US4683330A (en) | Interphenylene carbacyclin derivatives | |
US3845042A (en) | 11-substituted-prostaglandin derivatives | |
US3899525A (en) | 9{86 ,15{86 -Dihydroxy-11{60 -hydroxymethylprost-13(trans)-enoic acid derivatives | |
US4151357A (en) | Polyprenyl piperazines | |
US3914282A (en) | Prostaglandin E{HD 1{B , F{HD 1{B , and A{HD 1 {B analogs | |
US3808259A (en) | 15-oxoprostanoic acid | |
US3767695A (en) | Prostaglandin e1, f1, and a1 analogs | |
US3736319A (en) | Novel cyclopentanone-2-carboxylates | |
GB1601994A (en) | Esters of prostan-1-ol derivatives methods for their preparation and compositions containing them | |
US4199519A (en) | Higher polyalkenyl fatty acids and esters | |
US4105854A (en) | Prostanoic acid derivatives | |
US4338332A (en) | Fluoro-prostaglandins | |
US3894009A (en) | Prostaglandin derivatives and process for the preparation thereof | |
CA1212669A (fr) | Composes de benzopyrane | |
US3576880A (en) | 5(2,6,6-trimethyl - 1 - hydroxy-cyclohex-2-enyl) -3 methyl-penta-2,4-dien-1-al derivatives | |
US4130721A (en) | 11-Deoxy PGE2 compounds | |
US4029693A (en) | 2A,2B-Dihomo-11-deoxy-17(substituted phenyl)-18,19,20-trinor-PGE2 compounds and their corresponding esters | |
US3996263A (en) | 9-Oxo-11α-methyl-15Ε-hyroxyprost-13(trans)-enoic acid derivatives and process for the preparaion thereof | |
US4306095A (en) | Prostane derivatives | |
US4074044A (en) | Cyanoprostaglandins | |
US4338316A (en) | 9-Aryloxy prostane derivatives | |
US3847962A (en) | Prostaglandins and process and intermediates therefor |