US3890188A - Label dispensing and applying apparatus - Google Patents
Label dispensing and applying apparatus Download PDFInfo
- Publication number
- US3890188A US3890188A US283212A US28321272A US3890188A US 3890188 A US3890188 A US 3890188A US 283212 A US283212 A US 283212A US 28321272 A US28321272 A US 28321272A US 3890188 A US3890188 A US 3890188A
- Authority
- US
- United States
- Prior art keywords
- label
- print head
- platen
- head assembly
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000853 adhesive Substances 0.000 claims abstract description 5
- 230000000712 assembly Effects 0.000 claims 4
- 238000000429 assembly Methods 0.000 claims 4
- 230000002093 peripheral effect Effects 0.000 claims 2
- 239000011521 glass Substances 0.000 claims 1
- 238000005452 bending Methods 0.000 abstract description 2
- 101100180402 Caenorhabditis elegans jun-1 gene Proteins 0.000 description 1
- ANBQYFIVLNNZCU-CQCLMDPOSA-N alpha-L-Fucp-(1->2)-[alpha-D-GalpNAc-(1->3)]-beta-D-Galp-(1->3)-[alpha-L-Fucp-(1->4)]-beta-D-GlcpNAc-(1->3)-beta-D-Galp Chemical compound O[C@H]1[C@H](O)[C@H](O)[C@H](C)O[C@H]1O[C@H]1[C@H](O[C@H]2[C@@H]([C@@H](O[C@@H]3[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O3)NC(C)=O)[C@@H](O)[C@@H](CO)O2)O[C@H]2[C@H]([C@H](O)[C@H](O)[C@H](C)O2)O)[C@@H](NC(C)=O)[C@H](O[C@H]2[C@H]([C@@H](CO)O[C@@H](O)[C@@H]2O)O)O[C@@H]1CO ANBQYFIVLNNZCU-CQCLMDPOSA-N 0.000 description 1
Images
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65C—LABELLING OR TAGGING MACHINES, APPARATUS, OR PROCESSES
- B65C11/00—Manually-controlled or manually-operable label dispensers, e.g. modified for the application of labels to articles
- B65C11/02—Manually-controlled or manually-operable label dispensers, e.g. modified for the application of labels to articles having printing equipment
- B65C11/0205—Manually-controlled or manually-operable label dispensers, e.g. modified for the application of labels to articles having printing equipment modified for the application of labels to articles
- B65C11/021—Manually-controlled or manually-operable label dispensers, e.g. modified for the application of labels to articles having printing equipment modified for the application of labels to articles label feeding from strips
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65C—LABELLING OR TAGGING MACHINES, APPARATUS, OR PROCESSES
- B65C9/00—Details of labelling machines or apparatus
- B65C9/08—Label feeding
- B65C9/18—Label feeding from strips, e.g. from rolls
- B65C9/1865—Label feeding from strips, e.g. from rolls the labels adhering on a backing strip
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65C—LABELLING OR TAGGING MACHINES, APPARATUS, OR PROCESSES
- B65C2210/00—Details of manually controlled or manually operable label dispensers
- B65C2210/0037—Printing equipment
- B65C2210/004—Printing equipment using printing heads
- B65C2210/0045—Printing equipment using printing heads mechanically actuated, e.g. by a hand lever
Definitions
- the dispensed labels are applied to an article by 3 3330207 1/1967 g f gsg: semi-circular pad arranged adjacent the dispensing :8: 1561384 edge.
- Each of the applicators is operated by a trigger- 3 674 6o9 M972 Schrotz e;51111IIlIiIIIIIIIIIIII 156/384 like member and applicators as a whole have 3,686,055 8/l972 Hermann .r l56/384 appearance Of 3 P 4 i'lfii'fii? 333% it??? $2324 11 62 -l/ PATENTEDJUN 17 ms SHEET F76. lAB.
Landscapes
- Labeling Devices (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/579,139 US4011813A (en) | 1971-08-25 | 1975-05-20 | Label dispensing and applying apparatus |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3985071A GB1408755A (en) | 1971-08-25 | 1971-08-25 | Label applicators |
| GB430572 | 1972-01-29 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US05/579,139 Division US4011813A (en) | 1971-08-25 | 1975-05-20 | Label dispensing and applying apparatus |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3890188A true US3890188A (en) | 1975-06-17 |
Family
ID=26239031
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US283212A Expired - Lifetime US3890188A (en) | 1971-08-25 | 1972-08-23 | Label dispensing and applying apparatus |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3890188A (OSRAM) |
| JP (1) | JPS5839703B2 (OSRAM) |
| AU (1) | AU471818B2 (OSRAM) |
| BE (1) | BE788033A (OSRAM) |
| CA (1) | CA987638A (OSRAM) |
| CH (1) | CH568888A5 (OSRAM) |
| DE (1) | DE2241128A1 (OSRAM) |
| DK (1) | DK144598C (OSRAM) |
| ES (1) | ES406079A1 (OSRAM) |
| FR (1) | FR2151906A5 (OSRAM) |
| GB (1) | GB1408755A (OSRAM) |
| HK (1) | HK57776A (OSRAM) |
| IT (1) | IT962548B (OSRAM) |
| MY (1) | MY7600268A (OSRAM) |
| NL (1) | NL7211539A (OSRAM) |
| SE (2) | SE407196B (OSRAM) |
Cited By (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091728A (en) * | 1975-04-28 | 1978-05-30 | Kabushiki Kaisha Sato Kenkyusho | Portable label printing machine |
| US4191608A (en) * | 1977-12-27 | 1980-03-04 | Monarch Marking System, Inc. | Hand-held labeler |
| US4252060A (en) * | 1979-04-23 | 1981-02-24 | Monarch Marking Systems, Inc. | Label printing apparatus |
| USD275017S (en) | 1982-06-07 | 1984-08-07 | Kabushiki Kaisha Sato | Cassette for a rolled label strip |
| USD280738S (en) | 1982-10-05 | 1985-09-24 | Comet S.A.R.A. Societa Autoadesivi Resin E Affine S.P.A. | Adhesive tape applicator |
| US5395174A (en) * | 1993-04-19 | 1995-03-07 | Esselte Meto International Gmbh | Apparatus for printing labels |
| USD365597S (en) | 1993-04-22 | 1995-12-26 | Esselte Meto International Produktions Gmbh | Hand held labeler |
| US5642666A (en) * | 1995-11-28 | 1997-07-01 | Comtec Information Systems, Inc. | Hand-held label printer |
| EP0896926A1 (en) | 1997-08-11 | 1999-02-17 | Monarch Marking Systems, INC. | Hand-held labeler |
| US5910227A (en) * | 1996-08-22 | 1999-06-08 | Monarch Marking Systems, Inc. | Hand-held labeler |
| US6241407B1 (en) * | 1999-09-16 | 2001-06-05 | Monarch Marking Systems, Inc. | Portable printer |
| US6516719B2 (en) | 1996-08-22 | 2003-02-11 | Monarch Marking Systems, Inc. | Hand-held labeler |
| CN100368264C (zh) * | 2002-12-10 | 2008-02-13 | 摩登思标签制品(北京)有限公司 | 贴标签机 |
| US20080277068A1 (en) * | 2007-05-08 | 2008-11-13 | Giorgio Arena | Labeling machine |
| US20110079358A1 (en) * | 2009-10-06 | 2011-04-07 | Open Data S.R.L. | Labelling machine |
| US9193293B2 (en) | 2013-11-05 | 2015-11-24 | John R. Wilson | Dunnage bag hanger apparatus and method |
| US10315805B1 (en) | 2013-11-05 | 2019-06-11 | John R. Wilson | Dunnage bag and load strap hanger apparatus and method |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2612326C2 (de) * | 1975-03-24 | 1983-05-11 | Kabushiki Kaisha Sato Kenkyusho, Tokyo | Stempelkopf für ein Etikettenbeschriftungsgerät |
| DE2555910C2 (de) * | 1975-12-12 | 1987-01-22 | Hermann O. 2070 Ahrensburg Steinke | Etikettiervorrichtung |
| DE3114674A1 (de) * | 1980-08-08 | 1982-03-18 | Esselte Pendaflex Corp., 11530 Garden City, N.Y. | "handetikettiergeraet" |
| DE3030138C2 (de) * | 1980-08-08 | 1985-03-07 | Esselte Pendaflex Corp., Garden City, N.Y. | Handetikettiergerät |
| JPH02144150U (OSRAM) * | 1989-05-09 | 1990-12-06 |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3265553A (en) * | 1960-04-20 | 1966-08-09 | Meto Ges Oscar Kind K G | Apparatus for printing, dispensing and application of gummed labels |
| US3330207A (en) * | 1965-10-04 | 1967-07-11 | Dynamic Res Corp | Rolling contact label printer and applicator |
| US3440123A (en) * | 1966-01-10 | 1969-04-22 | Monarch Marking Systems Inc | Hand labeler |
| US3551251A (en) * | 1967-06-26 | 1970-12-29 | Sato Kiko Kk | Portable,one-hand-operable labeling machine |
| US3674609A (en) * | 1969-09-04 | 1972-07-04 | Kurt Schrotz | Labeling devices |
| US3686055A (en) * | 1969-02-27 | 1972-08-22 | Hermann Klaus D | Hand held labelling apparatus |
| US3705833A (en) * | 1970-10-02 | 1972-12-12 | Tokio Wada | Labeller |
| US3741847A (en) * | 1970-01-31 | 1973-06-26 | Sato Kenkyusho | Hand labeler |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3343485A (en) * | 1965-02-05 | 1967-09-26 | Nashua Corp | Label printer and dispenser having reciprocable print carriage |
| JPS455402Y1 (OSRAM) * | 1965-11-17 | 1970-03-14 | ||
| US3417689A (en) * | 1967-10-30 | 1968-12-24 | Chester A. Brethen | Label imprinter |
| FR1601777A (OSRAM) * | 1967-12-07 | 1970-09-14 | ||
| DE1933850C3 (de) * | 1969-07-03 | 1974-07-11 | Sato Kiko K.K., Tokio | Handetikettiergerät zum Aufbringen von lösbar auf einem Trägerband angeordneten Selbstklebeetiketten auf Gegenstände |
| FR2012239A1 (OSRAM) * | 1969-07-03 | 1970-03-13 | Sato Kiko Kk |
-
0
- BE BE788033D patent/BE788033A/xx unknown
-
1971
- 1971-08-25 GB GB3985071A patent/GB1408755A/en not_active Expired
-
1972
- 1972-08-22 DE DE2241128A patent/DE2241128A1/de not_active Withdrawn
- 1972-08-23 US US283212A patent/US3890188A/en not_active Expired - Lifetime
- 1972-08-23 IT IT9647/72A patent/IT962548B/it active
- 1972-08-23 SE SE7210948A patent/SE407196B/xx unknown
- 1972-08-23 AU AU45883/72A patent/AU471818B2/en not_active Expired
- 1972-08-24 CH CH1257972A patent/CH568888A5/xx not_active IP Right Cessation
- 1972-08-24 FR FR7230244A patent/FR2151906A5/fr not_active Expired
- 1972-08-24 ES ES406079A patent/ES406079A1/es not_active Expired
- 1972-08-24 NL NL7211539A patent/NL7211539A/xx unknown
- 1972-08-25 CA CA150,239A patent/CA987638A/en not_active Expired
- 1972-08-25 DK DK422072A patent/DK144598C/da not_active IP Right Cessation
- 1972-08-25 JP JP47085209A patent/JPS5839703B2/ja not_active Expired
-
1976
- 1976-02-05 SE SE7601291A patent/SE7601291L/xx unknown
- 1976-09-16 HK HK577/76*UA patent/HK57776A/xx unknown
- 1976-12-31 MY MY1976268A patent/MY7600268A/xx unknown
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3265553A (en) * | 1960-04-20 | 1966-08-09 | Meto Ges Oscar Kind K G | Apparatus for printing, dispensing and application of gummed labels |
| US3330207A (en) * | 1965-10-04 | 1967-07-11 | Dynamic Res Corp | Rolling contact label printer and applicator |
| US3440123A (en) * | 1966-01-10 | 1969-04-22 | Monarch Marking Systems Inc | Hand labeler |
| US3551251A (en) * | 1967-06-26 | 1970-12-29 | Sato Kiko Kk | Portable,one-hand-operable labeling machine |
| US3686055A (en) * | 1969-02-27 | 1972-08-22 | Hermann Klaus D | Hand held labelling apparatus |
| US3674609A (en) * | 1969-09-04 | 1972-07-04 | Kurt Schrotz | Labeling devices |
| US3741847A (en) * | 1970-01-31 | 1973-06-26 | Sato Kenkyusho | Hand labeler |
| US3705833A (en) * | 1970-10-02 | 1972-12-12 | Tokio Wada | Labeller |
Cited By (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091728A (en) * | 1975-04-28 | 1978-05-30 | Kabushiki Kaisha Sato Kenkyusho | Portable label printing machine |
| US4191608A (en) * | 1977-12-27 | 1980-03-04 | Monarch Marking System, Inc. | Hand-held labeler |
| US4252060A (en) * | 1979-04-23 | 1981-02-24 | Monarch Marking Systems, Inc. | Label printing apparatus |
| USD275017S (en) | 1982-06-07 | 1984-08-07 | Kabushiki Kaisha Sato | Cassette for a rolled label strip |
| USD280738S (en) | 1982-10-05 | 1985-09-24 | Comet S.A.R.A. Societa Autoadesivi Resin E Affine S.P.A. | Adhesive tape applicator |
| US5395174A (en) * | 1993-04-19 | 1995-03-07 | Esselte Meto International Gmbh | Apparatus for printing labels |
| USD365597S (en) | 1993-04-22 | 1995-12-26 | Esselte Meto International Produktions Gmbh | Hand held labeler |
| US5642666A (en) * | 1995-11-28 | 1997-07-01 | Comtec Information Systems, Inc. | Hand-held label printer |
| US6516719B2 (en) | 1996-08-22 | 2003-02-11 | Monarch Marking Systems, Inc. | Hand-held labeler |
| US5910227A (en) * | 1996-08-22 | 1999-06-08 | Monarch Marking Systems, Inc. | Hand-held labeler |
| US5934189A (en) * | 1996-08-22 | 1999-08-10 | Monarch Marking Systems, Inc. | Hand-held labeler |
| US5988249A (en) * | 1996-08-22 | 1999-11-23 | Monarch Marking Systems, Inc. | Hand-held labeler |
| US6766842B1 (en) | 1996-08-22 | 2004-07-27 | Paxar Americas, Inc. | Hand-held labeler |
| US6619204B2 (en) | 1996-08-22 | 2003-09-16 | Paxar Americas, Inc. | Hand-held labeler |
| CN1081576C (zh) * | 1996-08-22 | 2002-03-27 | 蒙纳克标记系统公司 | 手握式标签机 |
| EP0896926A1 (en) | 1997-08-11 | 1999-02-17 | Monarch Marking Systems, INC. | Hand-held labeler |
| US7029189B2 (en) | 1999-09-16 | 2006-04-18 | Paxar Americas, Inc. | Portable printer |
| US7387456B2 (en) | 1999-09-16 | 2008-06-17 | Paxar Americas, Inc. | Portable printer |
| US6623191B2 (en) | 1999-09-16 | 2003-09-23 | Paxar Americas, Inc. | Portable printer |
| US8075207B2 (en) | 1999-09-16 | 2011-12-13 | Avery Dennison Corporation | Portable printer |
| US6241407B1 (en) * | 1999-09-16 | 2001-06-05 | Monarch Marking Systems, Inc. | Portable printer |
| US6837634B2 (en) | 1999-09-16 | 2005-01-04 | Paxar Americas, Inc. | Portable printer |
| US20050117957A1 (en) * | 1999-09-16 | 2005-06-02 | Huggins Orville C. | Portable printer |
| US20060039732A1 (en) * | 1999-09-16 | 2006-02-23 | Huggins Orville C | Portable printer |
| US6347897B2 (en) | 1999-09-16 | 2002-02-19 | Monarch Marking Systems, Inc. | Portable printer |
| US6394674B2 (en) | 1999-09-16 | 2002-05-28 | Monarch Marking Systems, Inc. | Portable printer |
| US20040047667A1 (en) * | 1999-09-16 | 2004-03-11 | Huggins Orville C. | Portable printer |
| US20090290925A1 (en) * | 1999-09-16 | 2009-11-26 | Paxar Americas, Inc. | Portable printer |
| CN100368264C (zh) * | 2002-12-10 | 2008-02-13 | 摩登思标签制品(北京)有限公司 | 贴标签机 |
| US20080277068A1 (en) * | 2007-05-08 | 2008-11-13 | Giorgio Arena | Labeling machine |
| US7900674B2 (en) * | 2007-05-08 | 2011-03-08 | Open Data S.R.L. | Labeling machine |
| US20110079358A1 (en) * | 2009-10-06 | 2011-04-07 | Open Data S.R.L. | Labelling machine |
| US8186407B2 (en) * | 2009-10-06 | 2012-05-29 | Open Data S.R.L. | Labelling machine |
| US9193293B2 (en) | 2013-11-05 | 2015-11-24 | John R. Wilson | Dunnage bag hanger apparatus and method |
| US10315805B1 (en) | 2013-11-05 | 2019-06-11 | John R. Wilson | Dunnage bag and load strap hanger apparatus and method |
Also Published As
| Publication number | Publication date |
|---|---|
| CA987638A (en) | 1976-04-20 |
| BE788033A (fr) | 1973-02-26 |
| AU471818B2 (en) | 1976-05-06 |
| IT962548B (it) | 1973-12-31 |
| SE407196B (sv) | 1979-03-19 |
| NL7211539A (OSRAM) | 1973-02-27 |
| DE2241128A1 (de) | 1973-03-01 |
| JPS5839703B2 (ja) | 1983-08-31 |
| SE7601291L (sv) | 1976-02-05 |
| AU4588372A (en) | 1974-02-28 |
| JPS4831100A (OSRAM) | 1973-04-24 |
| DK144598B (da) | 1982-04-13 |
| CH568888A5 (OSRAM) | 1975-11-14 |
| FR2151906A5 (OSRAM) | 1973-04-20 |
| GB1408755A (en) | 1975-10-01 |
| ES406079A1 (es) | 1975-08-16 |
| DK144598C (da) | 1982-09-20 |
| MY7600268A (en) | 1976-12-31 |
| HK57776A (en) | 1976-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3890188A (en) | Label dispensing and applying apparatus | |
| US3656430A (en) | Label printing and dispensing tool | |
| US3817177A (en) | Hand labeler | |
| US3619324A (en) | Miniature labeling apparatus | |
| US4075944A (en) | Self-indexing label marking gun | |
| US3231446A (en) | Device for printing labels | |
| GB1535290A (en) | Label printing and dispensing apparatus | |
| US3064714A (en) | Apparatus for applying indicia to articles | |
| US4041863A (en) | Precision hand label imprinter and dispenser | |
| US3782279A (en) | Positive registration labeling gun | |
| GB1280186A (en) | Label dispensing apparatus | |
| US4087304A (en) | Label printing and applying apparatus | |
| GB1308154A (en) | Hand held labelling apparatus | |
| US4100852A (en) | Label printing apparatus | |
| US3934507A (en) | Merchandise label marking gun | |
| GB1397636A (en) | Labelling device | |
| US3655492A (en) | Label imprinting and applying machine and method | |
| GB1388996A (en) | Hand-held label marking device | |
| US4813355A (en) | Hand-held printing and labeling device | |
| US4010682A (en) | Label printing and applying apparatus | |
| US3408931A (en) | Portable ticket printer | |
| US4125419A (en) | Hand-held labeler and labeling method | |
| US3116686A (en) | Device for printing labels | |
| US4498389A (en) | Labeler with inking mechanism | |
| EP0010095B1 (en) | Improvements in or relating to label applicators |