US3504623A - Hammer arrangement for high-speed printers - Google Patents
Hammer arrangement for high-speed printers Download PDFInfo
- Publication number
- US3504623A US3504623A US718603A US3504623DA US3504623A US 3504623 A US3504623 A US 3504623A US 718603 A US718603 A US 718603A US 3504623D A US3504623D A US 3504623DA US 3504623 A US3504623 A US 3504623A
- Authority
- US
- United States
- Prior art keywords
- actuator
- hammer
- cushion
- arrangement
- electromagnet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000035939 shock Effects 0.000 description 7
- 230000005284 excitation Effects 0.000 description 3
- 230000001133 acceleration Effects 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 244000201986 Cassia tora Species 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 230000003116 impacting effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- NCAIGTHBQTXTLR-UHFFFAOYSA-N phentermine hydrochloride Chemical compound [Cl-].CC(C)([NH3+])CC1=CC=CC=C1 NCAIGTHBQTXTLR-UHFFFAOYSA-N 0.000 description 1
- 239000012858 resilient material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
Images
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41J—TYPEWRITERS; SELECTIVE PRINTING MECHANISMS, i.e. MECHANISMS PRINTING OTHERWISE THAN FROM A FORME; CORRECTION OF TYPOGRAPHICAL ERRORS
- B41J9/00—Hammer-impression mechanisms
- B41J9/26—Means for operating hammers to effect impression
- B41J9/38—Electromagnetic means
Definitions
- hammer 1 is shown having a recessed portion 1a and a mass M1 which is movable in a direction indicated by arrow 5.
- the hammer is resiliently mounted to a mounting member 6 by means of beryllium springs 7 contained within a resilient material 8 in the hammer.
- the hammers recessed portion 1a is adapted to engage the part 2a of an L-shaped actuator 2 having a mass M2, the actuator 2 is pivotably mounted at its elbow by pin 9 on the mounting member 6.
- a resilient cushion 4 is fixed in member 6 and positioned as shown to stop the movement of actuator 2 during its movement in the direction 5.
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Impact Printers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71860368A | 1968-04-03 | 1968-04-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3504623A true US3504623A (en) | 1970-04-07 |
Family
ID=24886723
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US718603A Expired - Lifetime US3504623A (en) | 1968-04-03 | 1968-04-03 | Hammer arrangement for high-speed printers |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3504623A (cg-RX-API-DMAC7.html) |
| BE (1) | BE730966A (cg-RX-API-DMAC7.html) |
| CH (1) | CH495589A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1916794A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1219253A (cg-RX-API-DMAC7.html) |
Cited By (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3585927A (en) * | 1969-12-22 | 1971-06-22 | Ibm | Pivotally mounted high performance print magnet |
| US3635156A (en) * | 1969-10-06 | 1972-01-18 | Ncr Co | Fatigue-resistant attachment for highly stressed members such as print hammers |
| US3643594A (en) * | 1968-06-11 | 1972-02-22 | Sits Soc It Telecom Siemens | Print hammer for high-speed printer |
| US3696739A (en) * | 1970-05-04 | 1972-10-10 | American Regital Corp | Striking apparatus for rotating wheel printer |
| US3726213A (en) * | 1970-12-07 | 1973-04-10 | Singer Co | Print hammer with high repetition rate |
| US3768403A (en) * | 1971-11-08 | 1973-10-30 | Tally Corp | High speed printer with leaflike impact means |
| US3780648A (en) * | 1969-09-02 | 1973-12-25 | Nortec Computer Devices | High speed print hammer with dynamic damper means |
| US3823667A (en) * | 1972-07-03 | 1974-07-16 | Teletype Corp | Force adjustment in impact printers |
| JPS49102015A (cg-RX-API-DMAC7.html) * | 1972-12-27 | 1974-09-26 | ||
| US3893390A (en) * | 1972-05-01 | 1975-07-08 | Honeywell Inf Systems | Printer with rectilinear type-carrying belt |
| US3924725A (en) * | 1974-06-28 | 1975-12-09 | Ibm | Dual array disc printer |
| US3968744A (en) * | 1975-03-03 | 1976-07-13 | Burroughs Corporation | Self-damping unitary print hammer for high speed printers |
| US3977509A (en) * | 1973-10-18 | 1976-08-31 | De Staat Der Nederlanden, Te Dezen Vertegenwoordigd Door De Directeur-Generaal Der Posterijen, Telegrafie En Telefonie | Bar-code writer |
| US3994381A (en) * | 1973-04-26 | 1976-11-30 | The Singer Company | Wire matrix print head |
| DE2629592A1 (de) * | 1976-07-01 | 1978-01-12 | Ibm Deutschland | Druckhammer fuer typendrucker |
| US4242004A (en) * | 1979-03-21 | 1980-12-30 | Extel Corporation | Dot matrix printhead driver |
| EP0023153A1 (en) * | 1979-07-23 | 1981-01-28 | Ncr Canada Ltd - Ncr Canada Ltee | Print hammer mechanism |
| US4557192A (en) * | 1981-05-26 | 1985-12-10 | International Business Machines Corporation | Self restoring pivoting means and print hammer using same |
| US4852481A (en) * | 1988-07-14 | 1989-08-01 | L. James Hubbard | Print hammer mechanism |
| US5042376A (en) * | 1987-09-02 | 1991-08-27 | Bull Hn Information Systems Italia S.P.A. | Aerodynamic damper for an impact printing actuator |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5153919A (en) * | 1974-11-07 | 1976-05-12 | Nippon Electric Co | Shiriarupurintaano injihanmaakiko |
| DE2954495C2 (cg-RX-API-DMAC7.html) * | 1979-02-26 | 1989-04-20 | Aeg Olympia Ag, 2940 Wilhelmshaven, De | |
| DE2907456A1 (de) * | 1979-02-26 | 1980-09-04 | Olympia Werke Ag | Druckhammeranordnung an schreib- o.ae. daten schreibenden bueromaschinen mit einem summentypentraeger |
| JPS5770681A (en) * | 1980-10-21 | 1982-05-01 | Ricoh Co Ltd | Hammering device for printer |
| JPS5845776A (ja) * | 1981-09-11 | 1983-03-17 | 神鋼電機株式会社 | 小型バイブレ−タ |
| IT1235057B (it) * | 1989-06-08 | 1992-06-17 | C Olivetti & C S P A Sede Via | Dispositivo di battuta per macchine stampanti |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2787210A (en) * | 1953-01-22 | 1957-04-02 | Jr Francis H Shepard | Hammer impelling means in high speed printers |
| US2874634A (en) * | 1956-02-14 | 1959-02-24 | Olympia Werke Ag | Printing apparatus |
| US3110250A (en) * | 1961-10-20 | 1963-11-12 | Potter Instrument Co Inc | Printer hammer assembly |
| US3144821A (en) * | 1960-10-06 | 1964-08-18 | Ibm | Printer apparatus having print force control |
| US3145650A (en) * | 1962-12-03 | 1964-08-25 | Burroughs Corp | Recording apparatus |
| US3166010A (en) * | 1962-05-03 | 1965-01-19 | Potter Instrument Co Inc | Return spring bumper for print hammers |
| US3183830A (en) * | 1960-12-27 | 1965-05-18 | Rca Corp | Print registration control means in high speed printers |
| US3188946A (en) * | 1962-12-31 | 1965-06-15 | Ibm | Hammer control mechanism for record marking machine |
| US3200739A (en) * | 1963-03-18 | 1965-08-17 | Potter Instrument Co Inc | Print hammer modules for high speed printers |
| US3266419A (en) * | 1964-08-11 | 1966-08-16 | Navigation Computer Corp | High speed impact print hammer assembly with resilient energy storing means |
-
1968
- 1968-04-03 US US718603A patent/US3504623A/en not_active Expired - Lifetime
-
1969
- 1969-03-26 GB GB05783/69A patent/GB1219253A/en not_active Expired
- 1969-04-01 DE DE19691916794 patent/DE1916794A1/de active Pending
- 1969-04-03 BE BE730966D patent/BE730966A/xx unknown
- 1969-04-03 CH CH515369A patent/CH495589A/de not_active IP Right Cessation
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2787210A (en) * | 1953-01-22 | 1957-04-02 | Jr Francis H Shepard | Hammer impelling means in high speed printers |
| US2874634A (en) * | 1956-02-14 | 1959-02-24 | Olympia Werke Ag | Printing apparatus |
| US3144821A (en) * | 1960-10-06 | 1964-08-18 | Ibm | Printer apparatus having print force control |
| US3183830A (en) * | 1960-12-27 | 1965-05-18 | Rca Corp | Print registration control means in high speed printers |
| US3110250A (en) * | 1961-10-20 | 1963-11-12 | Potter Instrument Co Inc | Printer hammer assembly |
| US3166010A (en) * | 1962-05-03 | 1965-01-19 | Potter Instrument Co Inc | Return spring bumper for print hammers |
| US3145650A (en) * | 1962-12-03 | 1964-08-25 | Burroughs Corp | Recording apparatus |
| US3188946A (en) * | 1962-12-31 | 1965-06-15 | Ibm | Hammer control mechanism for record marking machine |
| US3200739A (en) * | 1963-03-18 | 1965-08-17 | Potter Instrument Co Inc | Print hammer modules for high speed printers |
| US3266419A (en) * | 1964-08-11 | 1966-08-16 | Navigation Computer Corp | High speed impact print hammer assembly with resilient energy storing means |
Cited By (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3643594A (en) * | 1968-06-11 | 1972-02-22 | Sits Soc It Telecom Siemens | Print hammer for high-speed printer |
| US3780648A (en) * | 1969-09-02 | 1973-12-25 | Nortec Computer Devices | High speed print hammer with dynamic damper means |
| US3635156A (en) * | 1969-10-06 | 1972-01-18 | Ncr Co | Fatigue-resistant attachment for highly stressed members such as print hammers |
| US3585927A (en) * | 1969-12-22 | 1971-06-22 | Ibm | Pivotally mounted high performance print magnet |
| US3696739A (en) * | 1970-05-04 | 1972-10-10 | American Regital Corp | Striking apparatus for rotating wheel printer |
| US3726213A (en) * | 1970-12-07 | 1973-04-10 | Singer Co | Print hammer with high repetition rate |
| US3768403A (en) * | 1971-11-08 | 1973-10-30 | Tally Corp | High speed printer with leaflike impact means |
| US3893390A (en) * | 1972-05-01 | 1975-07-08 | Honeywell Inf Systems | Printer with rectilinear type-carrying belt |
| US3823667A (en) * | 1972-07-03 | 1974-07-16 | Teletype Corp | Force adjustment in impact printers |
| JPS49102015A (cg-RX-API-DMAC7.html) * | 1972-12-27 | 1974-09-26 | ||
| US3994381A (en) * | 1973-04-26 | 1976-11-30 | The Singer Company | Wire matrix print head |
| US3977509A (en) * | 1973-10-18 | 1976-08-31 | De Staat Der Nederlanden, Te Dezen Vertegenwoordigd Door De Directeur-Generaal Der Posterijen, Telegrafie En Telefonie | Bar-code writer |
| US3924725A (en) * | 1974-06-28 | 1975-12-09 | Ibm | Dual array disc printer |
| US3968744A (en) * | 1975-03-03 | 1976-07-13 | Burroughs Corporation | Self-damping unitary print hammer for high speed printers |
| DE2629592A1 (de) * | 1976-07-01 | 1978-01-12 | Ibm Deutschland | Druckhammer fuer typendrucker |
| US4141290A (en) * | 1976-07-01 | 1979-02-27 | International Business Machines Corporation | Print hammer for type printers |
| US4242004A (en) * | 1979-03-21 | 1980-12-30 | Extel Corporation | Dot matrix printhead driver |
| EP0023153A1 (en) * | 1979-07-23 | 1981-01-28 | Ncr Canada Ltd - Ncr Canada Ltee | Print hammer mechanism |
| US4557192A (en) * | 1981-05-26 | 1985-12-10 | International Business Machines Corporation | Self restoring pivoting means and print hammer using same |
| US5042376A (en) * | 1987-09-02 | 1991-08-27 | Bull Hn Information Systems Italia S.P.A. | Aerodynamic damper for an impact printing actuator |
| US4852481A (en) * | 1988-07-14 | 1989-08-01 | L. James Hubbard | Print hammer mechanism |
Also Published As
| Publication number | Publication date |
|---|---|
| BE730966A (cg-RX-API-DMAC7.html) | 1969-10-03 |
| GB1219253A (en) | 1971-01-13 |
| CH495589A (de) | 1970-08-31 |
| DE1916794A1 (de) | 1969-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3504623A (en) | Hammer arrangement for high-speed printers | |
| US2625100A (en) | Printing hammer rebound preventing means | |
| US3139820A (en) | Print hammer mechanism | |
| US3670647A (en) | Method of damping rebound of print hammer | |
| US3351007A (en) | Print hammer rapid reset means in high speed printers | |
| US3675172A (en) | Damping apparatus for a linear actuator device | |
| US3741113A (en) | High energy print hammer unit with fast settle out | |
| US3726213A (en) | Print hammer with high repetition rate | |
| US3199650A (en) | Hammer with dampening means for high speed printer | |
| US3805941A (en) | Ballistic print hammer and type-bearing element combination for on-the-fly printer | |
| US3386376A (en) | Damping means to prevent print hammer rebound | |
| US3266419A (en) | High speed impact print hammer assembly with resilient energy storing means | |
| US2353057A (en) | Printing mechanism | |
| US3195453A (en) | Magnetically actuated print hammer | |
| US3568593A (en) | Hammer for impact printing device | |
| US3780648A (en) | High speed print hammer with dynamic damper means | |
| US3426675A (en) | Print hammer module | |
| EP0028539B1 (en) | Print hammer assembly | |
| US3636868A (en) | Energy-dissipative improvement in high-speed print hammer mechanisms | |
| US3585927A (en) | Pivotally mounted high performance print magnet | |
| US3493091A (en) | Print head shift mechanism | |
| US3461996A (en) | Reed operated printer | |
| US2616366A (en) | Printer hammer dampener | |
| US5188466A (en) | Matrix pin print head with rebound control | |
| US3842737A (en) | Printer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: ITT CORPORATION Free format text: CHANGE OF NAME;ASSIGNOR:INTERNATIONAL TELEPHONE AND TELEGRAPH CORPORATION;REEL/FRAME:004389/0606 Effective date: 19831122 |