US2978292A - Manufacture of rayon - Google Patents
Manufacture of rayon Download PDFInfo
- Publication number
- US2978292A US2978292A US747360A US74736058A US2978292A US 2978292 A US2978292 A US 2978292A US 747360 A US747360 A US 747360A US 74736058 A US74736058 A US 74736058A US 2978292 A US2978292 A US 2978292A
- Authority
- US
- United States
- Prior art keywords
- polymer
- epoxyalkane
- viscose
- weight
- threads
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229920000297 Rayon Polymers 0.000 title claims description 23
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000002964 rayon Substances 0.000 title description 5
- 229920000642 polymer Polymers 0.000 claims description 28
- 238000009987 spinning Methods 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 15
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 16
- 150000001412 amines Chemical class 0.000 description 13
- 239000012991 xanthate Substances 0.000 description 6
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 5
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 5
- 229960001763 zinc sulfate Drugs 0.000 description 5
- 229910000368 zinc sulfate Inorganic materials 0.000 description 5
- 229910017464 nitrogen compound Inorganic materials 0.000 description 4
- 150000002830 nitrogen compounds Chemical class 0.000 description 4
- 230000008961 swelling Effects 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- -1 amine compound Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000004593 Epoxy Substances 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- MZAGXDHQGXUDDX-JSRXJHBZSA-N (e,2z)-4-ethyl-2-hydroxyimino-5-nitrohex-3-enamide Chemical compound [O-][N+](=O)C(C)C(/CC)=C/C(=N/O)/C(N)=O MZAGXDHQGXUDDX-JSRXJHBZSA-N 0.000 description 1
- IQDVXXOBJULTFE-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;hydron;sulfate Chemical compound OS([O-])(=O)=O.CCCCCCCCCCCC[N+]1=CC=CC=C1 IQDVXXOBJULTFE-UHFFFAOYSA-M 0.000 description 1
- WMOXOVYJENYVRD-UHFFFAOYSA-N 2-[2-[dodecyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethoxy]ethanol Chemical compound CCCCCCCCCCCCN(CCOCCO)CCOCCOCCO WMOXOVYJENYVRD-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical compound [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 description 1
- 230000001112 coagulating effect Effects 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01F—CHEMICAL FEATURES IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS; APPARATUS SPECIALLY ADAPTED FOR THE MANUFACTURE OF CARBON FILAMENTS
- D01F2/00—Monocomponent artificial filaments or the like of cellulose or cellulose derivatives; Manufacture thereof
- D01F2/06—Monocomponent artificial filaments or the like of cellulose or cellulose derivatives; Manufacture thereof from viscose
- D01F2/08—Composition of the spinning solution or the bath
- D01F2/10—Addition to the spinning solution or spinning bath of substances which exert their effect equally well in either
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL341945X | 1955-03-18 | ||
| NL833865X | 1957-07-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2978292A true US2978292A (en) | 1961-04-04 |
Family
ID=26643667
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US747360A Expired - Lifetime US2978292A (en) | 1955-03-18 | 1958-07-09 | Manufacture of rayon |
| US793967A Expired - Lifetime US3033696A (en) | 1955-03-18 | 1959-02-18 | Manufacture of rayon |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US793967A Expired - Lifetime US3033696A (en) | 1955-03-18 | 1959-02-18 | Manufacture of rayon |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US2978292A (de) |
| BE (1) | BE568594A (de) |
| CH (3) | CH341945A (de) |
| DE (2) | DE1024676B (de) |
| FR (1) | FR1146890A (de) |
| GB (3) | GB786319A (de) |
| NL (3) | NL103242C (de) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3056688A (en) * | 1960-01-21 | 1962-10-02 | Atlas Chem Ind | Spinning of viscose |
| US3113828A (en) * | 1960-03-15 | 1963-12-10 | Chimiotex | Process for the manufacture of regenerated cellulosic material |
| US3364290A (en) * | 1962-10-30 | 1968-01-16 | American Enka Corp | High tenacity rayon yarn production |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2572217A (en) * | 1950-01-23 | 1951-10-23 | American Enka Corp | Manufacture of viscose rayon |
| US2593466A (en) * | 1948-07-16 | 1952-04-22 | Ind Rayon Corp | Viscose spinning solution |
| US2696423A (en) * | 1951-05-29 | 1954-12-07 | Du Pont | Viscose modifiers |
| USRE24486E (en) * | 1958-06-10 | Chsch | ||
| US2852333A (en) * | 1954-05-21 | 1958-09-16 | Du Pont | Viscose spinning process |
| US2852334A (en) * | 1954-11-03 | 1958-09-16 | American Viscose Corp | Method of producing viscose rayon |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB489234A (en) * | 1936-01-21 | 1938-07-21 | Deutsche Hydrierwerke Ag | Improvements in or relating to the manufacture of threads, bands or ribbons having abasis of regenerated cellulose or cellulose derivatives |
| GB541099A (en) * | 1940-05-11 | 1941-11-12 | Courtaulds Ltd | Improvements in and relating to the manufacture and production of artificial threads and the like articles from viscose |
| US2422021A (en) * | 1940-07-29 | 1947-06-10 | Ind Rayon Corp | Manufacture of thread or the like |
| GB557218A (en) * | 1941-05-06 | 1943-11-10 | British Cellophane Ltd | Improvements in or relating to the manufacture of regenerated cellulose filaments or films from viscose |
| US2397338A (en) * | 1943-10-12 | 1946-03-26 | American Viscose Corp | Manufacture of filaments and fibers |
| NL72458C (de) * | 1948-02-09 | |||
| BE523479A (de) * | 1951-05-29 | |||
| BE540587A (de) * | 1954-11-25 | 1900-01-01 | ||
| US2962341A (en) * | 1956-05-14 | 1960-11-29 | Du Pont | Viscose modification |
| BE567063A (de) * | 1957-06-21 |
-
1955
- 1955-03-18 NL NL195721A patent/NL103242C/xx active
-
1956
- 1956-02-16 GB GB4915/56A patent/GB786319A/en not_active Expired
- 1956-02-20 DE DEN11866A patent/DE1024676B/de active Pending
- 1956-02-21 CH CH341945D patent/CH341945A/de unknown
- 1956-03-08 FR FR1146890D patent/FR1146890A/fr not_active Expired
-
1957
- 1957-07-13 NL NL218933A patent/NL112537C/xx active
-
1958
- 1958-03-18 NL NL225993A patent/NL113191C/xx active
- 1958-06-13 BE BE568594A patent/BE568594A/xx unknown
- 1958-06-14 DE DEN15223A patent/DE1100870B/de active Pending
- 1958-06-16 CH CH348505D patent/CH348505A/de unknown
- 1958-07-08 GB GB21909/58A patent/GB833865A/en not_active Expired
- 1958-07-09 US US747360A patent/US2978292A/en not_active Expired - Lifetime
-
1959
- 1959-02-13 CH CH347297D patent/CH347297A/de unknown
- 1959-02-18 US US793967A patent/US3033696A/en not_active Expired - Lifetime
- 1959-02-25 GB GB6598/59A patent/GB857170A/en not_active Expired
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE24486E (en) * | 1958-06-10 | Chsch | ||
| US2593466A (en) * | 1948-07-16 | 1952-04-22 | Ind Rayon Corp | Viscose spinning solution |
| US2572217A (en) * | 1950-01-23 | 1951-10-23 | American Enka Corp | Manufacture of viscose rayon |
| US2696423A (en) * | 1951-05-29 | 1954-12-07 | Du Pont | Viscose modifiers |
| US2852333A (en) * | 1954-05-21 | 1958-09-16 | Du Pont | Viscose spinning process |
| US2852334A (en) * | 1954-11-03 | 1958-09-16 | American Viscose Corp | Method of producing viscose rayon |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3056688A (en) * | 1960-01-21 | 1962-10-02 | Atlas Chem Ind | Spinning of viscose |
| US3113828A (en) * | 1960-03-15 | 1963-12-10 | Chimiotex | Process for the manufacture of regenerated cellulosic material |
| US3364290A (en) * | 1962-10-30 | 1968-01-16 | American Enka Corp | High tenacity rayon yarn production |
Also Published As
| Publication number | Publication date |
|---|---|
| BE568594A (de) | 1958-12-13 |
| CH347297A (de) | 1960-06-30 |
| DE1024676B (de) | 1958-02-20 |
| GB857170A (en) | 1960-12-29 |
| GB833865A (en) | 1960-05-04 |
| NL113191C (de) | 1966-09-15 |
| GB786319A (en) | 1957-11-13 |
| CH348505A (de) | 1960-08-31 |
| US3033696A (en) | 1962-05-08 |
| FR1146890A (fr) | 1957-11-15 |
| CH341945A (de) | 1959-10-31 |
| NL103242C (de) | 1962-12-17 |
| NL112537C (de) | 1966-03-15 |
| DE1100870B (de) | 1961-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2535044A (en) | Spinning of viscose | |
| US2696423A (en) | Viscose modifiers | |
| NO128613B (de) | ||
| US2535045A (en) | Spinning of viscose | |
| US2214442A (en) | Synthetic polymer | |
| US2852334A (en) | Method of producing viscose rayon | |
| US2784107A (en) | Production of artificial filaments, threads and the like | |
| US2978292A (en) | Manufacture of rayon | |
| US3305377A (en) | Manufacture of regenerated cellulose fibres | |
| US2327516A (en) | Manufacture of artificial filaments and fibers from viscose | |
| US3026169A (en) | Manufacture of viscose rayon | |
| US2937070A (en) | Viscose process | |
| US3007766A (en) | Production of viscose rayon | |
| US2910341A (en) | Spinning viscose | |
| US3018158A (en) | Viscose process | |
| US3146116A (en) | Cyanoethylation and xanthation of alkali cellulose | |
| US2594496A (en) | Method of making artificial fibers or threads from viscose | |
| US3381075A (en) | Process for preparation of viscose regenerated cellulose fibers | |
| US3077375A (en) | Spinning of viscose | |
| US3047412A (en) | Viscose composition and method of spinning | |
| US3151194A (en) | Process for the manufacture of shaped bodies from viscose, and the products thus obtained | |
| US2224693A (en) | Formation of threads and the like | |
| US3031320A (en) | Spinning of viscose | |
| US2983572A (en) | Manufacture of viscose rayon | |
| US2849274A (en) | Producing all skin viscose rayon |