US2791868A - Constructional toy - Google Patents
Constructional toy Download PDFInfo
- Publication number
- US2791868A US2791868A US545496A US54549655A US2791868A US 2791868 A US2791868 A US 2791868A US 545496 A US545496 A US 545496A US 54549655 A US54549655 A US 54549655A US 2791868 A US2791868 A US 2791868A
- Authority
- US
- United States
- Prior art keywords
- building
- buttons
- elements
- button
- toy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000463 material Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 4
- 239000011449 brick Substances 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 210000005069 ears Anatomy 0.000 description 3
- 239000002184 metal Substances 0.000 description 2
- LUTSRLYCMSCGCS-BWOMAWGNSA-N [(3s,8r,9s,10r,13s)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate Chemical compound C([C@@H]12)C[C@]3(C)C(=O)CC=C3[C@@H]1CC=C1[C@]2(C)CC[C@H](OC(=O)C)C1 LUTSRLYCMSCGCS-BWOMAWGNSA-N 0.000 description 1
- -1 as for example Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 229920002457 flexible plastic Polymers 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/04—Building blocks, strips, or similar building parts
- A63H33/06—Building blocks, strips, or similar building parts to be assembled without the use of additional elements
- A63H33/062—Building blocks, strips, or similar building parts to be assembled without the use of additional elements with clip or snap mechanisms
Definitions
- This invention relates to improvements in a constructional toy which comprises a plurality of skeleton-like frames composed of flexible material.
- kits for building toy models have been composed of a great number of different building elements from simple building blocks to the most complicated stamped metallic parts.
- Kits containing metallic parts are associated with the disadvantage that the metal parts are so rigid that the number of models which can be built is limited by the limited possibilities of shaping each metal part. Bending of such parts ultimately will cause breakage of the parts which then will be destroyed or rendered useless. Further, models built by means of this type of building kit have to be assembled by using small bolts and nuts which easily may be lost.
- a building element somewhat between ordinary toy building blocks and the above mentioned miniature bricks are small blocks e. g. of plastic which are provided with lugs or projections on one side and corresponding recesses on the other side, so that the blocks may be held in position relative to each other when they are laid as brick, but with such blocks it is impossible to build curved surfaces or structures.
- a feature common to all the known toy building elements is that they are rigid, whereby as mentioned above the number of models that can be built is very limited.
- the object of the present invention is to provide a building element of the kind described, in which all the above mentioned disadvantages are eliminated in that the element may be bent, in that a number of elements may be attached to each other in a great number of ways according to choice, and in that the use of small bolts and nuts or other separate coupling elements is eliminated.
- buttons preferably designed as small pegs or headed pins and with button holes or pegreceiving openings the size of which corresponds to the buttons or pegs.
- buttons and button holes are advantageous to arrange the buttons and button holes symmetrically about the center of the element and preferably at the corners of the element, and to avoid giving the built models a too heavy and compact appearance the building element is made as a grid structure or skeleton-like frame.
- the invention further consists in an improvement in same, obtained by providing the buttons at their free ends with an enlarged portion or head of greater diameter, thereby forming a lateral expansion which is adapted to cooperate with a corresponding contraction approximately in the middle of the button holes, and a good joint is thereby obtained between the different parts.
- the invention thus consists in :a constructional toy as a building element, and the invention is mainly characterized in that the elements of the toy are made of flexible material as plastic or the like, and each of the elements is alternately provided with button holes and buttons, so that a number of elements easily may be buttoned together for building models of all kinds.
- buttons and button holes are arrangedsymmetrical- 1y about the center of the element, and at the corners of the element, and in addition the element is shaped as a rectangle and as a grid or skeleton structure.
- Another main feature of the invention consists in that at least two of the opposing sides or edges of the building element extend along or inside lines through the centers of the buttons and button holes.
- buttons have an enlargement at the free end and in that the button holes have a contraction approximately at the middle.
- Fig. 1 is a perspective view of a building element in accordance with the invention
- Fig. 2 is a diagrammatical view of a sphere constructed from elements in accordance with the invention
- Fig. 3 is a building element of mainly the same shape as the building element in Fig. 1,
- Fig. 4 is a section through a button hole in accordance with the invention.
- Fig. 5 illustrates the design of a button in accordance with the invention and Fig. 6 shows the button of one element buttoned l0- gether with the button hole in a succeeding element.
- the building element consists as shown in Fig. 1 in accordance with the invention of a suitably designed grid or skeleton structure 1 of plastic or other flexible material.
- the grid or skeleton structure may be given any chosen shape, but it will have to be of such shape as to exert a stiffening action on the sides or edges of the element.
- buttons 2 which in the example shown are in the form of headed pins or pegs and are arranged at two diagonally opposing corners, and the two other corners of the element are provided with button holes 3 adapted to co-operate with the buttons 2 in such a manner that they may be forced tightly on to corresponding buttons on the other elements, which are used for building the toy model.
- the size of the element is of no importance for the invention, but a width of /4 inch and a length twice as large has proved itself to be well suited for the purpose.
- Fig. 2 illustrates a spherical model constructed from a number of elements of the kind shown in Fig. 1.
- buttons or button holes 9 One line through the centers is indicated by the dotted line l fl and at the right end of'the element shown'on Fig. 3 buttoningof one part of the succeeding element 11 in the manner made ,possible by the present construction of a building element is diagrammatically indicated.
- the buttons and button holes therefor are provided in lugs -or :ea'rs extending from the corners of the-element.
- V The elements may of course also be buttoned together with all of one side positioned on :one side of the succeeding element.
- the-button holes 12 on Fig. 4 which preferably are positioned at two diagonally opposite corners, are provided with a contraction 13 approximately half way down, and as shown on'Fig. S the buttons, which preferably are positioned at thetwo other opposed corners, are provided with an enlargement or head 14-iat the free end of the button, and this enlargement will, as shown in Fig. 6 by buttoning together two elements, be positioned outside the contraction-13 "of the button hole 12, and the-enlargement 14'will therefore secure the button in the button hole.
- the button hole '12 converges inwardly from the opposite faces of the element 1 to "a halfway point between said faces. This arrangement not only permits of a snapaction engagement between the button and button hole,
- the embodiment shown will only serve to illustrate the invention and is not to be regarded in a limiting sense, as other embodiments will fall within the scope of the invention, such embodiments being, for example, elements provided with buttons or pegs on both sides with the design of the grid structure made up from triangular or square sections or the like. If necessary the building element may have a greater length, but its length should preferably under any condition be a digital multiple of the width of the element.
- an erectional element consisting of a skeleton-like rectangular frame composed of a flexible plastic material, said frame being normally fiat but being capable of fieXurc or curvature, the frame being provided at each of its corners with a projecting ear, diagonally opposite ears having holes extending through them and the-other ears having integrally formed projecting pins, the edgesof "theelement being so disposed relative to lines through the centers of the pins and holes as to be in substantially abutting relation with corresponding edges of an adjacent element having its cars concentrically placed respectively above and below the ears of the first element with connected elements lying in substantially the same plane.
Landscapes
- Toys (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO339547X | 1955-05-02 | ||
| NO110855X | 1955-08-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2791868A true US2791868A (en) | 1957-05-14 |
Family
ID=26649038
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US545496A Expired - Lifetime US2791868A (en) | 1955-05-02 | 1955-11-07 | Constructional toy |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2791868A (enExample) |
| BE (1) | BE546374A (enExample) |
| CH (1) | CH339547A (enExample) |
| DE (1) | DE1046524B (enExample) |
| FR (1) | FR1134228A (enExample) |
| GB (1) | GB797877A (enExample) |
| NL (1) | NL93413C (enExample) |
Cited By (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1083728B (de) * | 1957-09-06 | 1960-06-15 | Max Ernst | Zerlegbares Fahrspielzeug aus Kunststoff |
| US2956806A (en) * | 1957-09-18 | 1960-10-18 | Edwin J Routson | Climbing and supporting structures |
| US2979844A (en) * | 1958-09-05 | 1961-04-18 | Best Plastics Corp | Plastic party favor basket construction |
| US2990679A (en) * | 1958-05-28 | 1961-07-04 | Lenox Jewelry Products Corp | Band of detachable sheet metal links and the link |
| US3046016A (en) * | 1960-02-11 | 1962-07-24 | Leonard S Laws | Ticktacktoe game apparatus |
| US3138236A (en) * | 1962-04-26 | 1964-06-23 | Jesse B Goodgame | Chain for flats of carding machines |
| US3213586A (en) * | 1961-05-24 | 1965-10-26 | Goodchild George Alfred | Joined screen sections |
| US3242610A (en) * | 1963-01-10 | 1966-03-29 | Interlego Ag | Flexible connector for toy construction sets |
| US3363361A (en) * | 1963-06-10 | 1968-01-16 | Mettoy Co Ltd | Constructional toy composed of separable rods and plates |
| US3398425A (en) * | 1966-09-07 | 1968-08-27 | Illinois Tool Works | Hinges |
| US3604145A (en) * | 1968-09-03 | 1971-09-14 | Victor Zimmerman | Several flexible strip having nestable cup elements thereon |
| US3633587A (en) * | 1970-01-22 | 1972-01-11 | Philip J Hunt | Infant{40 s toy |
| US3642144A (en) * | 1969-08-11 | 1972-02-15 | Tri State Displays Inc | Sectional display for samples of sheet material |
| US3768202A (en) * | 1972-01-17 | 1973-10-30 | J Wheelock | Flower holder |
| US3802144A (en) * | 1972-08-16 | 1974-04-09 | J Spica | Through- and under-draining flooring modules |
| US3868798A (en) * | 1973-08-16 | 1975-03-04 | Joseph P Spica | Modules for through- and under-drawing flooring |
| US3889950A (en) * | 1974-06-19 | 1975-06-17 | Peter B Kasravi | Flexible geodesic-type toys |
| US4026065A (en) * | 1975-01-06 | 1977-05-31 | Walter Dick | Polyhedral elements with undercut recesses and cylindrical connectors having collars |
| US4106228A (en) * | 1977-04-19 | 1978-08-15 | Jack Gibrich | Suspensible ornamental display |
| US4170082A (en) * | 1977-02-28 | 1979-10-09 | Calvin Freedman | Modular connectors for cylindrical elements |
| US4581299A (en) * | 1984-01-16 | 1986-04-08 | Jaeger Rolf A | Blank for the manufacture of spherical filling bodies |
| US4813674A (en) * | 1986-11-05 | 1989-03-21 | Boonchai Lorhpipat | Takraw ball |
| US4822313A (en) * | 1987-02-09 | 1989-04-18 | Yasika Douglas P | Toy assembly device |
| US4874341A (en) * | 1988-10-25 | 1989-10-17 | Novation Design Ltd. | Folding polygonal toy construction element |
| US4911672A (en) * | 1986-03-19 | 1990-03-27 | Harry Erickson | Construction apparatus |
| US4947527A (en) * | 1989-03-23 | 1990-08-14 | Matchbox Toys (Usa) Ltd. | Coupling system for modular article |
| US5015117A (en) * | 1987-02-06 | 1991-05-14 | Pawlicki Patrick S | Construction materials with end connectors |
| US5046982A (en) * | 1985-04-15 | 1991-09-10 | Arlington-Hews, Inc. | Construction apparatus |
| US5201737A (en) * | 1991-04-11 | 1993-04-13 | Oswald Leibinger Gmbh | Plate for covering a drill hole in a skull cap and for fixing a cranial bone cover |
| US5236196A (en) * | 1991-12-02 | 1993-08-17 | Karl Blankenburg | Spherical body formed of polygonal members |
| USD350788S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| USD350786S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| US5578036A (en) * | 1993-12-06 | 1996-11-26 | Stone; Kevin T. | Method and apparatus for fixation of bone during surgical procedures |
| US5690631A (en) * | 1996-09-11 | 1997-11-25 | Walter Lorenz Surgical, Inc. | Multi-configurable plating system |
| US5766176A (en) * | 1996-09-11 | 1998-06-16 | Walter Lorenz Surgical, Inc. | Formable mesh |
| WO1998034706A1 (en) * | 1997-02-06 | 1998-08-13 | Mattel, Inc. | Spherical element combination for construction toy set |
| USD402032S (en) | 1996-02-20 | 1998-12-01 | Walter Lorenz Surgical, Inc. | Neuro gap plate for osteosynthesis |
| USD406646S (en) * | 1996-02-20 | 1999-03-09 | Walter Lorenz Surgical, Inc. | Neuro sub-temporal plate for osteosynthesis |
| US5916200A (en) * | 1997-10-01 | 1999-06-29 | Walter Lorenz Surgical, Inc. | Apparatus and method for stabilization of a cranial shunt |
| US6258091B1 (en) | 1996-02-14 | 2001-07-10 | Walter Lorenz Surgical Inc. | Bone fastener and instrument for insertion thereof |
| US6270500B1 (en) | 1996-02-03 | 2001-08-07 | Karl-Dieter Lerch | Device for postoperative fixation back into the cranium of a plug of bone removed therefrom during a surgical operation |
| US6379363B1 (en) | 1999-09-24 | 2002-04-30 | Walter Lorenz Surgical, Inc. | Method and apparatus for reattachment of a cranial flap using a cranial clamp |
| US6685707B2 (en) | 2001-09-25 | 2004-02-03 | Walter Lorenz Surgical, Inc. | Cranial clamp and method for fixating a bone plate |
| WO2005032682A1 (en) * | 2003-10-02 | 2005-04-14 | Davide Gastaldi | Tripod shaped structural element and grid structure obtainable therewith |
| US20070238069A1 (en) * | 2006-04-10 | 2007-10-11 | Scott Lovald | Osteosynthesis plate, method of customizing same, and method for installing same |
| US20080090486A1 (en) * | 2006-10-11 | 2008-04-17 | Tangle, Inc. | Resilient Ball Containing Looped Segments |
| US20090031694A1 (en) * | 2007-06-21 | 2009-02-05 | Antony Roger | Cursor chains |
| US20090106953A1 (en) * | 2007-10-24 | 2009-04-30 | Wittig Wayne | Apparatus and method for fastening by capturing protruding members in corresponding flexible openings |
| US20090156092A1 (en) * | 2007-12-17 | 2009-06-18 | Tangle, Inc. | Segmented ball with lighted elements |
| USD595516S1 (en) | 2008-08-18 | 2009-07-07 | Tangle, Inc. | Chair |
| USD614882S1 (en) | 2009-02-13 | 2010-05-04 | Tangle, Inc. | Chair |
| USD616506S1 (en) * | 2009-01-27 | 2010-05-25 | Lego A/S | Element of a toy construction set |
| USD623247S1 (en) | 2008-02-14 | 2010-09-07 | Tangle, Inc. | Baseball |
| US20110197407A1 (en) * | 2010-02-13 | 2011-08-18 | Mccabe Stephen O | Method for constructing a product and fastener therefore |
| US20110212798A1 (en) * | 2007-12-17 | 2011-09-01 | Tangle, Inc. | Segmented ball with lighted elements |
| US20130045660A1 (en) * | 2010-07-14 | 2013-02-21 | Owe Lyrsell | Ball comprising a discontinuous ball surface layer |
| USD680698S1 (en) * | 2012-08-17 | 2013-04-23 | Worldwise, Inc. | Pet treat ball |
| USD688760S1 (en) * | 2012-09-10 | 2013-08-27 | Got I, Llc | Toy ball |
| USD690785S1 (en) * | 2012-09-10 | 2013-10-01 | David E. Silverglate | Toy ball |
| USD692510S1 (en) | 2007-12-17 | 2013-10-29 | Tangle, Inc. | Ball |
| US20150021213A1 (en) * | 2009-04-21 | 2015-01-22 | Medi-Mag Ltd. | Flexible Segmented Support Structure |
| US20150297955A1 (en) * | 2008-01-01 | 2015-10-22 | Got I, Llc | Mesh toy apparatus |
| US9480931B1 (en) | 2012-11-16 | 2016-11-01 | Mattel, Inc. | Building components |
| USD791889S1 (en) * | 2015-05-22 | 2017-07-11 | Tucker International Llc | Ball with complex gripping surface |
| US20170312647A1 (en) * | 2016-04-28 | 2017-11-02 | Kenn W. Lehman | Flying disc |
| USD812820S1 (en) | 2016-01-19 | 2018-03-13 | Big Heart Pet, Inc. | Treat dispenser |
| USD813318S1 (en) * | 2017-03-30 | 2018-03-20 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD813317S1 (en) | 2017-03-30 | 2018-03-20 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD815216S1 (en) | 2017-03-30 | 2018-04-10 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| US20180154275A1 (en) * | 2016-12-05 | 2018-06-07 | Brian Semling | Flexible interconnectable block and fastener system |
| USD821661S1 (en) * | 2016-01-19 | 2018-06-26 | Big Heart Pet, Inc. | Treat dispenser |
| US10004999B2 (en) * | 2013-11-28 | 2018-06-26 | Luna Loop As | Connectable element for creating chains and spatial structures |
| US20180221717A1 (en) * | 2017-02-03 | 2018-08-09 | John Hinnen, III | Deformable Toy |
| US10478742B2 (en) * | 2018-03-09 | 2019-11-19 | Mattel-Mega Holdings (Us), Llc | Toy construction element |
| US20200038772A1 (en) * | 2016-09-28 | 2020-02-06 | Bodak Blocks Limited | Building block and building block assemblies |
| USD895024S1 (en) | 2018-03-09 | 2020-09-01 | Mattel-Mega Holdings (Us), Llc | Construction set element |
| USD897451S1 (en) | 2017-07-06 | 2020-09-29 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD910248S1 (en) | 2016-11-30 | 2021-02-09 | Gramercy Products, Llc | Pet toy |
| US20220203176A1 (en) * | 2019-05-10 | 2022-06-30 | Molten Corporation | Assembly ball |
| US12145027B1 (en) | 2004-08-05 | 2024-11-19 | Aaron J. Kim | Sports ball, bat, and associated methods |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1164295B (de) * | 1960-02-18 | 1964-02-27 | Marianne Guntermann Geb Sibbe | Spielzeug-Bauteil |
| JPS548142B2 (enExample) * | 1974-05-18 | 1979-04-12 | ||
| US4536162A (en) * | 1983-04-05 | 1985-08-20 | Mattel, Inc. | Child's playset |
| BE898652A (fr) * | 1984-01-11 | 1984-07-11 | Munnix Rene | Module de systeme de construction |
| IE841118L (en) * | 1984-05-04 | 1985-11-04 | All Go Promotions Ltd | Educational toy |
| DE102018101724A1 (de) * | 2018-01-25 | 2019-07-25 | Matthias Meister & Tony Ramenda GbR (vertretungsberechtigter Gesellschafter: Tony Ramenda, 04177 Leipzig) | Konstruktionssystem |
| EP3668622B1 (de) | 2018-01-25 | 2021-06-30 | TicToys GmbH | Konstruktionssystem |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB149916A (en) * | 1919-08-02 | 1921-05-05 | Charles Fregonara | Improvements in or relating to constructional elements particularly intended for usein toys |
| US1779826A (en) * | 1927-04-18 | 1930-10-28 | Thomas I Potter | Structural toy |
| US2061510A (en) * | 1934-11-16 | 1936-11-17 | United Carr Fastener Corp | Construction toy |
| US2242614A (en) * | 1936-03-21 | 1941-05-20 | Miesen Erich | Device for connecting parts of portable buildings |
| US2649803A (en) * | 1952-06-24 | 1953-08-25 | Internat Molded Plastics Inc | Snap-fastener toy blocks |
| FR1072167A (fr) * | 1953-03-04 | 1954-09-09 | Jeu de construction de villes en miniature | |
| US2712200A (en) * | 1952-09-24 | 1955-07-05 | Harry S Dearling | Shape-retaining interlocking toy element |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB160228A (en) * | 1919-12-08 | 1921-03-08 | Frank Arnold Darrah | Improvements in or relating to constructional or educational toys, models and the like |
| US1393996A (en) * | 1920-07-07 | 1921-10-18 | Fregonara Charles | Removable construction |
| US1971574A (en) * | 1933-05-22 | 1934-08-28 | Ontario Mfg Company | Off bearing delivery |
| FR819014A (fr) * | 1936-03-12 | 1937-10-08 | Premo Rubber Company Ltd | Perfectionnements apportés aux blocs, tuiles, briques et éléments analogues utilisés dans les jeux de construction |
| US2119921A (en) * | 1936-03-12 | 1938-06-07 | Premo Rubber Company Ltd | Toy building blocks, tiles, bricks, and the like |
| GB501951A (en) * | 1938-02-21 | 1939-03-08 | Premo Rubber Company Ltd | Improvements in and relating to constructional toy building elements |
| GB641590A (en) * | 1949-04-30 | 1950-08-16 | John Heritage Wright | Humpty dumpty toy |
-
0
- NL NL93413D patent/NL93413C/xx active
- BE BE546374D patent/BE546374A/xx unknown
-
1955
- 1955-10-29 FR FR1134228D patent/FR1134228A/fr not_active Expired
- 1955-10-29 DE DEV9672A patent/DE1046524B/de active Pending
- 1955-11-07 US US545496A patent/US2791868A/en not_active Expired - Lifetime
- 1955-12-14 GB GB35942/55A patent/GB797877A/en not_active Expired
-
1956
- 1956-03-22 CH CH339547D patent/CH339547A/de unknown
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB149916A (en) * | 1919-08-02 | 1921-05-05 | Charles Fregonara | Improvements in or relating to constructional elements particularly intended for usein toys |
| US1779826A (en) * | 1927-04-18 | 1930-10-28 | Thomas I Potter | Structural toy |
| US2061510A (en) * | 1934-11-16 | 1936-11-17 | United Carr Fastener Corp | Construction toy |
| US2242614A (en) * | 1936-03-21 | 1941-05-20 | Miesen Erich | Device for connecting parts of portable buildings |
| US2649803A (en) * | 1952-06-24 | 1953-08-25 | Internat Molded Plastics Inc | Snap-fastener toy blocks |
| US2712200A (en) * | 1952-09-24 | 1955-07-05 | Harry S Dearling | Shape-retaining interlocking toy element |
| FR1072167A (fr) * | 1953-03-04 | 1954-09-09 | Jeu de construction de villes en miniature |
Cited By (108)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1083728B (de) * | 1957-09-06 | 1960-06-15 | Max Ernst | Zerlegbares Fahrspielzeug aus Kunststoff |
| US2956806A (en) * | 1957-09-18 | 1960-10-18 | Edwin J Routson | Climbing and supporting structures |
| US2990679A (en) * | 1958-05-28 | 1961-07-04 | Lenox Jewelry Products Corp | Band of detachable sheet metal links and the link |
| US2979844A (en) * | 1958-09-05 | 1961-04-18 | Best Plastics Corp | Plastic party favor basket construction |
| US3046016A (en) * | 1960-02-11 | 1962-07-24 | Leonard S Laws | Ticktacktoe game apparatus |
| US3213586A (en) * | 1961-05-24 | 1965-10-26 | Goodchild George Alfred | Joined screen sections |
| US3138236A (en) * | 1962-04-26 | 1964-06-23 | Jesse B Goodgame | Chain for flats of carding machines |
| US3242610A (en) * | 1963-01-10 | 1966-03-29 | Interlego Ag | Flexible connector for toy construction sets |
| US3363361A (en) * | 1963-06-10 | 1968-01-16 | Mettoy Co Ltd | Constructional toy composed of separable rods and plates |
| US3398425A (en) * | 1966-09-07 | 1968-08-27 | Illinois Tool Works | Hinges |
| US3604145A (en) * | 1968-09-03 | 1971-09-14 | Victor Zimmerman | Several flexible strip having nestable cup elements thereon |
| US3642144A (en) * | 1969-08-11 | 1972-02-15 | Tri State Displays Inc | Sectional display for samples of sheet material |
| US3633587A (en) * | 1970-01-22 | 1972-01-11 | Philip J Hunt | Infant{40 s toy |
| US3768202A (en) * | 1972-01-17 | 1973-10-30 | J Wheelock | Flower holder |
| US3802144A (en) * | 1972-08-16 | 1974-04-09 | J Spica | Through- and under-draining flooring modules |
| US3868798A (en) * | 1973-08-16 | 1975-03-04 | Joseph P Spica | Modules for through- and under-drawing flooring |
| US3889950A (en) * | 1974-06-19 | 1975-06-17 | Peter B Kasravi | Flexible geodesic-type toys |
| US4026065A (en) * | 1975-01-06 | 1977-05-31 | Walter Dick | Polyhedral elements with undercut recesses and cylindrical connectors having collars |
| US4170082A (en) * | 1977-02-28 | 1979-10-09 | Calvin Freedman | Modular connectors for cylindrical elements |
| US4106228A (en) * | 1977-04-19 | 1978-08-15 | Jack Gibrich | Suspensible ornamental display |
| US4581299A (en) * | 1984-01-16 | 1986-04-08 | Jaeger Rolf A | Blank for the manufacture of spherical filling bodies |
| US5046982A (en) * | 1985-04-15 | 1991-09-10 | Arlington-Hews, Inc. | Construction apparatus |
| US4911672A (en) * | 1986-03-19 | 1990-03-27 | Harry Erickson | Construction apparatus |
| US4813674A (en) * | 1986-11-05 | 1989-03-21 | Boonchai Lorhpipat | Takraw ball |
| USRE34128E (en) * | 1986-11-05 | 1992-11-17 | Takraw ball | |
| US5015117A (en) * | 1987-02-06 | 1991-05-14 | Pawlicki Patrick S | Construction materials with end connectors |
| US4822313A (en) * | 1987-02-09 | 1989-04-18 | Yasika Douglas P | Toy assembly device |
| US4874341A (en) * | 1988-10-25 | 1989-10-17 | Novation Design Ltd. | Folding polygonal toy construction element |
| US4947527A (en) * | 1989-03-23 | 1990-08-14 | Matchbox Toys (Usa) Ltd. | Coupling system for modular article |
| EP0388746A1 (en) * | 1989-03-23 | 1990-09-26 | Michael R. Hennig | Coupling system for modular article |
| USRE37249E1 (en) * | 1991-04-11 | 2001-06-26 | Oswald Leibinger Gmbh | Plate for covering a drill hole in a skull cap and for fixing a cranial bone cover |
| US5201737A (en) * | 1991-04-11 | 1993-04-13 | Oswald Leibinger Gmbh | Plate for covering a drill hole in a skull cap and for fixing a cranial bone cover |
| US5236196A (en) * | 1991-12-02 | 1993-08-17 | Karl Blankenburg | Spherical body formed of polygonal members |
| USD350788S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| USD350786S (en) | 1993-09-22 | 1994-09-20 | Interlego, A.G. | Element for a toy building set |
| US5578036A (en) * | 1993-12-06 | 1996-11-26 | Stone; Kevin T. | Method and apparatus for fixation of bone during surgical procedures |
| US20040172029A1 (en) * | 1996-02-03 | 2004-09-02 | Karl-Dieter Lerch | Device for postoperative fixation back into the cranium of a plug of bone removed therefrom during a surgical operation |
| US6328743B2 (en) | 1996-02-03 | 2001-12-11 | Karl-Dieter Lerch | Device for postoperative fixation back into the cranium of a plug of bone removed therefrom during a surgical operation |
| US6726688B2 (en) | 1996-02-03 | 2004-04-27 | Karl-Dieter Lerch | Device for postoperative fixation back into the cranium of a plug of bone removed therefrom during a surgical operation |
| US6962591B2 (en) | 1996-02-03 | 2005-11-08 | Karl-Dieter Lerch | Device for postoperative fixation back into the cranium of a plug of bone removed therefrom during a surgical operation |
| US6270500B1 (en) | 1996-02-03 | 2001-08-07 | Karl-Dieter Lerch | Device for postoperative fixation back into the cranium of a plug of bone removed therefrom during a surgical operation |
| US6589244B1 (en) | 1996-02-14 | 2003-07-08 | Walter Lorenz Surgical, Inc. | Bone fastener and instrument for insertion thereof |
| US6258091B1 (en) | 1996-02-14 | 2001-07-10 | Walter Lorenz Surgical Inc. | Bone fastener and instrument for insertion thereof |
| USD402032S (en) | 1996-02-20 | 1998-12-01 | Walter Lorenz Surgical, Inc. | Neuro gap plate for osteosynthesis |
| USD406646S (en) * | 1996-02-20 | 1999-03-09 | Walter Lorenz Surgical, Inc. | Neuro sub-temporal plate for osteosynthesis |
| US5690631A (en) * | 1996-09-11 | 1997-11-25 | Walter Lorenz Surgical, Inc. | Multi-configurable plating system |
| US5766176A (en) * | 1996-09-11 | 1998-06-16 | Walter Lorenz Surgical, Inc. | Formable mesh |
| US5823843A (en) * | 1997-02-06 | 1998-10-20 | Pohlman; Joe K. | Spherical element combination for construction toy set |
| WO1998034706A1 (en) * | 1997-02-06 | 1998-08-13 | Mattel, Inc. | Spherical element combination for construction toy set |
| US5916200A (en) * | 1997-10-01 | 1999-06-29 | Walter Lorenz Surgical, Inc. | Apparatus and method for stabilization of a cranial shunt |
| US6379363B1 (en) | 1999-09-24 | 2002-04-30 | Walter Lorenz Surgical, Inc. | Method and apparatus for reattachment of a cranial flap using a cranial clamp |
| US6685707B2 (en) | 2001-09-25 | 2004-02-03 | Walter Lorenz Surgical, Inc. | Cranial clamp and method for fixating a bone plate |
| US20040127908A1 (en) * | 2001-09-25 | 2004-07-01 | Roman Shawn David | Cranial clamp with torque-limiting feature |
| US20070054588A1 (en) * | 2003-10-02 | 2007-03-08 | Davide Gastaldi | Tripod shaped structural element and grid structure obtainable therewith |
| WO2005032682A1 (en) * | 2003-10-02 | 2005-04-14 | Davide Gastaldi | Tripod shaped structural element and grid structure obtainable therewith |
| US12145027B1 (en) | 2004-08-05 | 2024-11-19 | Aaron J. Kim | Sports ball, bat, and associated methods |
| US8246663B2 (en) * | 2006-04-10 | 2012-08-21 | Scott Lovald | Osteosynthesis plate, method of customizing same, and method for installing same |
| US20070238069A1 (en) * | 2006-04-10 | 2007-10-11 | Scott Lovald | Osteosynthesis plate, method of customizing same, and method for installing same |
| US20080090486A1 (en) * | 2006-10-11 | 2008-04-17 | Tangle, Inc. | Resilient Ball Containing Looped Segments |
| US20090031694A1 (en) * | 2007-06-21 | 2009-02-05 | Antony Roger | Cursor chains |
| US7673441B2 (en) * | 2007-06-21 | 2010-03-09 | S2F Flexico | Slider chains |
| US20090106953A1 (en) * | 2007-10-24 | 2009-04-30 | Wittig Wayne | Apparatus and method for fastening by capturing protruding members in corresponding flexible openings |
| US20110212798A1 (en) * | 2007-12-17 | 2011-09-01 | Tangle, Inc. | Segmented ball with lighted elements |
| US7867115B2 (en) | 2007-12-17 | 2011-01-11 | Tangle, Inc. | Segmented ball with lighted elements |
| US20090156092A1 (en) * | 2007-12-17 | 2009-06-18 | Tangle, Inc. | Segmented ball with lighted elements |
| USD692510S1 (en) | 2007-12-17 | 2013-10-29 | Tangle, Inc. | Ball |
| US20150297955A1 (en) * | 2008-01-01 | 2015-10-22 | Got I, Llc | Mesh toy apparatus |
| US9956457B2 (en) * | 2008-01-01 | 2018-05-01 | Got I, Llc | Mesh toy apparatus |
| USD623247S1 (en) | 2008-02-14 | 2010-09-07 | Tangle, Inc. | Baseball |
| USD595516S1 (en) | 2008-08-18 | 2009-07-07 | Tangle, Inc. | Chair |
| USD616506S1 (en) * | 2009-01-27 | 2010-05-25 | Lego A/S | Element of a toy construction set |
| USD618737S1 (en) * | 2009-01-27 | 2010-06-29 | Lego A/S | Toy construction set element |
| USD614882S1 (en) | 2009-02-13 | 2010-05-04 | Tangle, Inc. | Chair |
| US20150021213A1 (en) * | 2009-04-21 | 2015-01-22 | Medi-Mag Ltd. | Flexible Segmented Support Structure |
| US9115508B2 (en) * | 2009-04-21 | 2015-08-25 | Medi-Mag Ltd. | Flexible segmented support structure |
| US20110197407A1 (en) * | 2010-02-13 | 2011-08-18 | Mccabe Stephen O | Method for constructing a product and fastener therefore |
| US8567021B2 (en) * | 2010-02-13 | 2013-10-29 | Stephen O. McCabe | Method for constructing a product and fastener therefore |
| US20130045660A1 (en) * | 2010-07-14 | 2013-02-21 | Owe Lyrsell | Ball comprising a discontinuous ball surface layer |
| USD680698S1 (en) * | 2012-08-17 | 2013-04-23 | Worldwise, Inc. | Pet treat ball |
| USD690785S1 (en) * | 2012-09-10 | 2013-10-01 | David E. Silverglate | Toy ball |
| USD688760S1 (en) * | 2012-09-10 | 2013-08-27 | Got I, Llc | Toy ball |
| US9480931B1 (en) | 2012-11-16 | 2016-11-01 | Mattel, Inc. | Building components |
| US10596480B1 (en) * | 2012-11-16 | 2020-03-24 | Mattel, Inc. | Building components |
| US10004999B2 (en) * | 2013-11-28 | 2018-06-26 | Luna Loop As | Connectable element for creating chains and spatial structures |
| USD791889S1 (en) * | 2015-05-22 | 2017-07-11 | Tucker International Llc | Ball with complex gripping surface |
| USD850016S1 (en) | 2016-01-19 | 2019-05-28 | Big Heart Pet, Inc. | Treat dispenser |
| USD821661S1 (en) * | 2016-01-19 | 2018-06-26 | Big Heart Pet, Inc. | Treat dispenser |
| USD812820S1 (en) | 2016-01-19 | 2018-03-13 | Big Heart Pet, Inc. | Treat dispenser |
| US20170312647A1 (en) * | 2016-04-28 | 2017-11-02 | Kenn W. Lehman | Flying disc |
| US9914069B2 (en) * | 2016-04-28 | 2018-03-13 | Kenn W. Lehman | Flying disc |
| US10857476B2 (en) * | 2016-09-28 | 2020-12-08 | Bodak Blocks Limited | Building block and building block assemblies |
| US20200038772A1 (en) * | 2016-09-28 | 2020-02-06 | Bodak Blocks Limited | Building block and building block assemblies |
| USD910248S1 (en) | 2016-11-30 | 2021-02-09 | Gramercy Products, Llc | Pet toy |
| US20180154275A1 (en) * | 2016-12-05 | 2018-06-07 | Brian Semling | Flexible interconnectable block and fastener system |
| US10086310B2 (en) * | 2016-12-05 | 2018-10-02 | Brian Semling | Flexible interconnectable block and fastener system |
| US10300346B2 (en) * | 2017-02-03 | 2019-05-28 | John Hinnen, III | Deformable toy |
| US20180221717A1 (en) * | 2017-02-03 | 2018-08-09 | John Hinnen, III | Deformable Toy |
| USD815216S1 (en) | 2017-03-30 | 2018-04-10 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD928890S1 (en) | 2017-03-30 | 2021-08-24 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD813318S1 (en) * | 2017-03-30 | 2018-03-20 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD813317S1 (en) | 2017-03-30 | 2018-03-20 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD897451S1 (en) | 2017-07-06 | 2020-09-29 | Chrome Cherry Design Studio (Pty) Ltd | Tape forming a toy building block base |
| USD895024S1 (en) | 2018-03-09 | 2020-09-01 | Mattel-Mega Holdings (Us), Llc | Construction set element |
| US10953340B2 (en) * | 2018-03-09 | 2021-03-23 | Mattel-Mega Holdings (Us), Llc | Toy construction element |
| US20200061484A1 (en) * | 2018-03-09 | 2020-02-27 | Mattel-Mega Holdings (Us), Llc | Toy Construction Element |
| US10478742B2 (en) * | 2018-03-09 | 2019-11-19 | Mattel-Mega Holdings (Us), Llc | Toy construction element |
| US20220203176A1 (en) * | 2019-05-10 | 2022-06-30 | Molten Corporation | Assembly ball |
| US11752395B2 (en) * | 2019-05-10 | 2023-09-12 | Molten Corporation | Assembly ball |
Also Published As
| Publication number | Publication date |
|---|---|
| BE546374A (enExample) | |
| FR1134228A (fr) | 1957-04-09 |
| DE1046524B (de) | 1958-12-11 |
| CH339547A (de) | 1959-06-30 |
| GB797877A (en) | 1958-07-09 |
| NL93413C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2791868A (en) | Constructional toy | |
| US3242610A (en) | Flexible connector for toy construction sets | |
| US2112247A (en) | Constructional toy and elements thereof | |
| US3005282A (en) | Toy building brick | |
| US3803754A (en) | Blocks with non-circular slits and flat connectors having transversely bowed middle portions | |
| US3271895A (en) | Construction toy comprising panels in plate form connectable by elastic bands | |
| US2147237A (en) | Toy building block | |
| US2063895A (en) | Joint for structural toys | |
| US3461602A (en) | Self-supporting roofing elements with connecting means | |
| JPH069635B2 (ja) | 組立おもちゃセットの組立ベ−ス | |
| US4077154A (en) | Toy building block set | |
| US669029A (en) | Toy building-block. | |
| US3103264A (en) | Extruded cross sections for architectural screens | |
| US1166399A (en) | Iron structure. | |
| JPS5836227U (ja) | 金属製平パレツト | |
| JPS5978285U (ja) | コンテナの面構造体 | |
| US1213374A (en) | Structural toy. | |
| JPS5940173Y2 (ja) | 蜂の巣状空洞を有する消波塊用型枠 | |
| DE884084C (de) | Baustein fuer zweischaliges Mauerwerk | |
| US2932155A (en) | Two-layer expansible linkage with laterally engaged links | |
| JPS59131422U (ja) | 鉄筋コンクリ−ト梁の肋筋かご | |
| JPS59197U (ja) | 組み立て玩具 | |
| JPS6019204Y2 (ja) | 外装材の水切構造 | |
| JPS6126888U (ja) | 組立式格子 | |
| JPH0216655Y2 (enExample) |