US2168181A - Photographic treating bath - Google Patents
Photographic treating bath Download PDFInfo
- Publication number
- US2168181A US2168181A US149836A US14983637A US2168181A US 2168181 A US2168181 A US 2168181A US 149836 A US149836 A US 149836A US 14983637 A US14983637 A US 14983637A US 2168181 A US2168181 A US 2168181A
- Authority
- US
- United States
- Prior art keywords
- photographic
- treating
- baths
- water
- bath
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000002253 acid Substances 0.000 description 20
- 150000007513 acids Chemical class 0.000 description 11
- 125000001931 aliphatic group Chemical group 0.000 description 10
- 125000003277 amino group Chemical group 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- 239000000463 material Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000001556 precipitation Methods 0.000 description 6
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- 235000011941 Tilia x europaea Nutrition 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- -1 alkali metal salt Chemical class 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 239000004571 lime Substances 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 4
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical compound CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- 241001479434 Agfa Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- ZSJLUXRWRYLWGG-UHFFFAOYSA-N tetramethyl 2,2-diaminoethane-1,1,1,2-tetracarboxylate Chemical compound COC(=O)C(C(C(=O)OC)(C(=O)OC)C(=O)OC)(N)N ZSJLUXRWRYLWGG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/29—Development processes or agents therefor
- G03C5/305—Additives other than developers
- G03C5/3053—Tensio-active agents or sequestering agents, e.g. water-softening or wetting agents
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S424/00—Drug, bio-affecting and body treating compositions
- Y10S424/06—Chelate
Definitions
- a composition of matter comprising at least one substance suitable for treating a photographic material and a member selected from the class consisting of aliphatic amino-polycarboxylic acids containing at least one amino group, in each amino group present at most one hydrogen atom being directly attached to' the amino nitrogen and water-soluble salts of said aliphatic aminopolycarboxylic acids.
- a photographic treating bath comprising an aqueous solution containing at least one substance suitable for treating a photographic material and a member selected from the class consisting of aliphatic amino-polycarboxylic acids containing at least one amino group, in each amino group present at most one hydrogen atom being directly attached to the amino nitrogen and water-soluble salts of said aliphatic aminopolycarboxylic acids.
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEI0055336 | 1936-06-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2168181A true US2168181A (en) | 1939-08-01 |
Family
ID=7194100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US149836A Expired - Lifetime US2168181A (en) | 1936-06-25 | 1937-06-23 | Photographic treating bath |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US2168181A (pm) |
| BE (1) | BE421930A (pm) |
| FR (1) | FR822688A (pm) |
| GB (1) | GB496252A (pm) |
Cited By (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2419157A (en) * | 1943-07-28 | 1947-04-15 | Ici Ltd | Preparation of ethylenebisiminodiacetic acid and salts thereof |
| US2489363A (en) * | 1947-08-05 | 1949-11-29 | Frederick C Bersworth | Chlorinated derivatives of alkylene polyamines |
| US2500019A (en) * | 1946-10-08 | 1950-03-07 | Frederick C Bersworth | Method of producing polycarboxylic amino acids |
| US2506492A (en) * | 1946-07-27 | 1950-05-02 | Raymond Lab Inc | Stabilized sulfite solutions |
| US2532392A (en) * | 1947-10-04 | 1950-12-05 | Frederick C Bersworth | Addition products of sulfuric acid and polycarboxylic tertiary amino acids |
| US2541470A (en) * | 1947-05-28 | 1951-02-13 | Eastman Kodak Co | Photographic silver halide developing solutions containing calcium precipitation inhibitors |
| US2542385A (en) * | 1946-10-12 | 1951-02-20 | Gen Aniline & Film Corp | Detergent composition |
| US2542831A (en) * | 1945-10-23 | 1951-02-20 | Socony Vacuum Oil Co Inc | Mineral oil composition and improving agent therefor |
| US2564092A (en) * | 1948-05-12 | 1951-08-14 | Frederick C Bersworth | Poly-ethylene poly-amino acid compounds |
| US2583890A (en) * | 1945-05-02 | 1952-01-29 | Uetikon Chem Fab | Quantitative determination of metals |
| US2583891A (en) * | 1946-04-08 | 1952-01-29 | Uetikon Chem Fab | Quantitative determination of metals |
| US2631165A (en) * | 1948-10-01 | 1953-03-10 | Ploetz Ernst | Process of producing alkali metal salts of nitrilotriacetic acid |
| US2656273A (en) * | 1952-02-12 | 1953-10-20 | Eastman Kodak Co | Photographic developers containing diamino-propanol tetracetic acid |
| US2666700A (en) * | 1950-09-06 | 1954-01-19 | Du Pont | Process of preparing a light sensitive silver halide emulsion |
| US2691588A (en) * | 1952-03-14 | 1954-10-12 | Eastman Kodak Co | Photographic developers containing 8-hydroxyquinolines |
| US2834773A (en) * | 1952-09-23 | 1958-05-13 | American Cyanamid Co | Stabilization of copperized azo dyestuffs |
| US3284202A (en) * | 1961-08-11 | 1966-11-08 | Litho Chemical And Supply Co I | Lithographic plate, its preparation and treatment solution therefor |
| US3300306A (en) * | 1957-10-25 | 1967-01-24 | Gevaert Photo Prod Nv | Process for the manufacture of printing plates |
| US3438767A (en) * | 1966-10-28 | 1969-04-15 | Grace W R & Co | Recovery of copper values from copper ore |
| US4330616A (en) * | 1980-07-31 | 1982-05-18 | Konishiroku Photo Industry Co., Ltd. | Method for processing silver halide color photographic material |
| US4615976A (en) * | 1983-08-15 | 1986-10-07 | The University Of Alabama In Birmingham | Synthesis and isolation of octopine and its analogues |
| US5391466A (en) * | 1992-11-25 | 1995-02-21 | Konica Corporation | Chemical compositions and a processing method using the same for processing silver halide photographic light-sensitive material |
| US5434035A (en) * | 1993-12-29 | 1995-07-18 | Eastman Kodak Company | Fixer additives used in combination with iron complex based bleaches to improve desilvering |
| US5508150A (en) * | 1993-12-29 | 1996-04-16 | Eastman Kodak Company | Fixer additives used in combination with iron complex based bleaches to prevent iron retention |
| US5541041A (en) * | 1995-04-17 | 1996-07-30 | Eastman Kodak Company | Stabilized peroxide bleaching solutions containing multiple chelating ligands and their use for processing of photographic elements |
-
0
- BE BE421930D patent/BE421930A/xx unknown
-
1937
- 1937-05-31 GB GB15080/37A patent/GB496252A/en not_active Expired
- 1937-06-04 FR FR822688D patent/FR822688A/fr not_active Expired
- 1937-06-23 US US149836A patent/US2168181A/en not_active Expired - Lifetime
Cited By (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2419157A (en) * | 1943-07-28 | 1947-04-15 | Ici Ltd | Preparation of ethylenebisiminodiacetic acid and salts thereof |
| US2583890A (en) * | 1945-05-02 | 1952-01-29 | Uetikon Chem Fab | Quantitative determination of metals |
| US2542831A (en) * | 1945-10-23 | 1951-02-20 | Socony Vacuum Oil Co Inc | Mineral oil composition and improving agent therefor |
| US2583891A (en) * | 1946-04-08 | 1952-01-29 | Uetikon Chem Fab | Quantitative determination of metals |
| US2506492A (en) * | 1946-07-27 | 1950-05-02 | Raymond Lab Inc | Stabilized sulfite solutions |
| US2500019A (en) * | 1946-10-08 | 1950-03-07 | Frederick C Bersworth | Method of producing polycarboxylic amino acids |
| US2542385A (en) * | 1946-10-12 | 1951-02-20 | Gen Aniline & Film Corp | Detergent composition |
| US2541470A (en) * | 1947-05-28 | 1951-02-13 | Eastman Kodak Co | Photographic silver halide developing solutions containing calcium precipitation inhibitors |
| US2489363A (en) * | 1947-08-05 | 1949-11-29 | Frederick C Bersworth | Chlorinated derivatives of alkylene polyamines |
| US2532392A (en) * | 1947-10-04 | 1950-12-05 | Frederick C Bersworth | Addition products of sulfuric acid and polycarboxylic tertiary amino acids |
| US2564092A (en) * | 1948-05-12 | 1951-08-14 | Frederick C Bersworth | Poly-ethylene poly-amino acid compounds |
| US2631165A (en) * | 1948-10-01 | 1953-03-10 | Ploetz Ernst | Process of producing alkali metal salts of nitrilotriacetic acid |
| US2666700A (en) * | 1950-09-06 | 1954-01-19 | Du Pont | Process of preparing a light sensitive silver halide emulsion |
| US2656273A (en) * | 1952-02-12 | 1953-10-20 | Eastman Kodak Co | Photographic developers containing diamino-propanol tetracetic acid |
| US2691588A (en) * | 1952-03-14 | 1954-10-12 | Eastman Kodak Co | Photographic developers containing 8-hydroxyquinolines |
| US2834773A (en) * | 1952-09-23 | 1958-05-13 | American Cyanamid Co | Stabilization of copperized azo dyestuffs |
| US3300306A (en) * | 1957-10-25 | 1967-01-24 | Gevaert Photo Prod Nv | Process for the manufacture of printing plates |
| US3284202A (en) * | 1961-08-11 | 1966-11-08 | Litho Chemical And Supply Co I | Lithographic plate, its preparation and treatment solution therefor |
| US3438767A (en) * | 1966-10-28 | 1969-04-15 | Grace W R & Co | Recovery of copper values from copper ore |
| US4330616A (en) * | 1980-07-31 | 1982-05-18 | Konishiroku Photo Industry Co., Ltd. | Method for processing silver halide color photographic material |
| US4615976A (en) * | 1983-08-15 | 1986-10-07 | The University Of Alabama In Birmingham | Synthesis and isolation of octopine and its analogues |
| US5391466A (en) * | 1992-11-25 | 1995-02-21 | Konica Corporation | Chemical compositions and a processing method using the same for processing silver halide photographic light-sensitive material |
| US5434035A (en) * | 1993-12-29 | 1995-07-18 | Eastman Kodak Company | Fixer additives used in combination with iron complex based bleaches to improve desilvering |
| US5508150A (en) * | 1993-12-29 | 1996-04-16 | Eastman Kodak Company | Fixer additives used in combination with iron complex based bleaches to prevent iron retention |
| US5541041A (en) * | 1995-04-17 | 1996-07-30 | Eastman Kodak Company | Stabilized peroxide bleaching solutions containing multiple chelating ligands and their use for processing of photographic elements |
Also Published As
| Publication number | Publication date |
|---|---|
| GB496252A (en) | 1938-11-28 |
| BE421930A (pm) | |
| FR822688A (fr) | 1938-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2168181A (en) | Photographic treating bath | |
| US2371740A (en) | Developers containing silver halide solvents | |
| DE69329814T2 (de) | Photographische Verarbeitungszusammensetzung und photographisches Verarbeitungsverfahren | |
| US2172216A (en) | Photographic developer | |
| DE69722894T2 (de) | Aminopolycarbonsäure-Chelierungsmittel, diese enthaltende Schwermetallchelatverbindung, photographischer Zusatzstoff und Verfahren zur photographischen Verarbeitung | |
| US2656273A (en) | Photographic developers containing diamino-propanol tetracetic acid | |
| US2610122A (en) | Silver halide developer containing 2(beta-hydroxyethyl) aminophenol and p-hydroxyphenylamino acetic acid | |
| US2611699A (en) | Regeneration of exhausted silver bleaching solutions | |
| US2477323A (en) | Photographic developers | |
| GB926646A (en) | Improvements in photographic half-tone reproduction | |
| US3162534A (en) | Photographic developer | |
| US2113312A (en) | Fine grain photographic developer | |
| DE69400379T2 (de) | Photographische Zusammensetzung und ein Verarbeitungsverfahren unter Verwendung dieser Zusammensetzung | |
| US3751251A (en) | Method for preparing bleach-fix regenerator concentrate | |
| US5210010A (en) | Silver halide developing solutions | |
| US3161513A (en) | Photographic developer compositions containing an antistain agent | |
| US3318701A (en) | Photographic monobaths containing a dl 6-8 dithio-octanoic acid antisludging agent | |
| GB255925A (en) | Improvements in and relating to the preparation of photographic developers | |
| US2266442A (en) | Color print by multiple color development | |
| US2550617A (en) | Fine grain photographic developer containing morpholine | |
| US2321347A (en) | Photographic fixing bath | |
| US2901350A (en) | Combined developers and fixers | |
| US2178450A (en) | Developing photographic films and plates | |
| US3161514A (en) | Nonstaining photographic developers | |
| US3305364A (en) | Non-silver halide reducing sulfonamide buffers for photographic developing solutions |